DE2647317A1 - Verfahren zur herstellung von alpha,omega-diaminen - Google Patents
Verfahren zur herstellung von alpha,omega-diaminenInfo
- Publication number
- DE2647317A1 DE2647317A1 DE19762647317 DE2647317A DE2647317A1 DE 2647317 A1 DE2647317 A1 DE 2647317A1 DE 19762647317 DE19762647317 DE 19762647317 DE 2647317 A DE2647317 A DE 2647317A DE 2647317 A1 DE2647317 A1 DE 2647317A1
- Authority
- DE
- Germany
- Prior art keywords
- ammonia
- temperature
- saturated
- hydrogenation
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 31
- 150000004985 diamines Chemical class 0.000 title description 18
- 238000004519 manufacturing process Methods 0.000 title description 17
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 30
- 229910021529 ammonia Inorganic materials 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 229920006395 saturated elastomer Polymers 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 14
- 238000005984 hydrogenation reaction Methods 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 9
- 238000006268 reductive amination reaction Methods 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- 230000009467 reduction Effects 0.000 claims description 5
- 238000006722 reduction reaction Methods 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 229910052707 ruthenium Inorganic materials 0.000 claims description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 230000036571 hydration Effects 0.000 claims 2
- 238000006703 hydration reaction Methods 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 235000019441 ethanol Nutrition 0.000 description 18
- 238000009835 boiling Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 4
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- -1 ethylene - Chemical class 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- SZCGBFUWBCDIEA-UHFFFAOYSA-N dodecanedial Chemical compound O=CCCCCCCCCCCC=O SZCGBFUWBCDIEA-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 238000006385 ozonation reaction Methods 0.000 description 2
- WURFKUQACINBSI-UHFFFAOYSA-M ozonide Chemical compound [O]O[O-] WURFKUQACINBSI-UHFFFAOYSA-M 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical compound CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- UJPKMTDFFUTLGM-UHFFFAOYSA-N 1-aminoethanol Chemical compound CC(N)O UJPKMTDFFUTLGM-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical group NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 240000000233 Melia azedarach Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- DDTBPAQBQHZRDW-UHFFFAOYSA-N cyclododecane Chemical compound C1CCCCCCCCCCC1 DDTBPAQBQHZRDW-UHFFFAOYSA-N 0.000 description 1
- HYPABJGVBDSCIT-UPHRSURJSA-N cyclododecene Chemical compound C1CCCCC\C=C/CCCC1 HYPABJGVBDSCIT-UPHRSURJSA-N 0.000 description 1
- MYUWZTRYQGERCY-UHFFFAOYSA-N deca-2,6-diene Chemical compound CCCC=CCCC=CC MYUWZTRYQGERCY-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- OUGLNWBGUSNCLT-UHFFFAOYSA-N dodeca-4,8-diene-1,12-diamine Chemical compound NCCCC=CCCC=CCCCN OUGLNWBGUSNCLT-UHFFFAOYSA-N 0.000 description 1
- CIGZZLYQLQLUQO-UHFFFAOYSA-N dodeca-4,8-dienedial Chemical compound O=CCCC=CCCC=CCCC=O CIGZZLYQLQLUQO-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- OADYBSJSJUFUBR-UHFFFAOYSA-N octanedial Chemical compound O=CCCCCCCC=O OADYBSJSJUFUBR-UHFFFAOYSA-N 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 230000010181 polygamy Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2843475A IT1048464B (it) | 1975-10-20 | 1975-10-20 | Procedimento per la preparazione di alfa omega diammine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2647317A1 true DE2647317A1 (de) | 1977-05-05 |
Family
ID=11223595
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762647317 Withdrawn DE2647317A1 (de) | 1975-10-20 | 1976-10-20 | Verfahren zur herstellung von alpha,omega-diaminen |
Country Status (4)
| Country | Link |
|---|---|
| DE (1) | DE2647317A1 (enExample) |
| FR (1) | FR2328692A1 (enExample) |
| GB (1) | GB1520969A (enExample) |
| IT (1) | IT1048464B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005856A3 (en) * | 1978-06-03 | 1980-01-09 | Ruhrchemie Aktiengesellschaft | Process for the preparation of diamines |
| EP0400426A3 (de) * | 1989-05-30 | 1991-06-12 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von alpha-, omega-Diaminen |
| DE102008044655A1 (de) | 2008-08-27 | 2010-03-04 | Bayer Materialscience Ag | Verfahren zur reduktiven Aminierung von Di- und Mehrfachaldehyden |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4483888A (en) * | 1981-09-01 | 1984-11-20 | Phillips Petroleum Company | Carbon dioxide treatment of epoxy resin compositions |
| ATE25853T1 (de) * | 1982-06-28 | 1987-03-15 | Swan Thomas & Co Ltd | Haertung von epoxidharzen. |
| FR2656864A1 (fr) * | 1990-01-11 | 1991-07-12 | Shell Int Research | Procede pour la preparation d'une diamine aliphatique ou cycloaliphatique, en particulier pour la preparation du diaminooctane. |
| AT399149B (de) * | 1993-06-07 | 1995-03-27 | Chemie Linz Gmbh | Verfahren zur herstellung primärer amine aus aldehyden |
| SG70081A1 (en) * | 1997-05-14 | 2000-01-25 | Kuraray Co | Process for producing diamines |
Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2219879A (en) * | 1938-12-14 | 1940-10-29 | Commercial Solvents Corp | Production of alkylamines |
| US2518659A (en) * | 1945-06-09 | 1950-08-15 | Eastman Kodak Co | Preparation of n-butylamine |
| GB663294A (en) * | 1948-04-05 | 1951-12-19 | Bataafsche Petroleum | Process for the preparation of diamines |
| DE832887C (de) * | 1947-07-07 | 1952-03-03 | Bataafsche Petroleum | Verfahren zur Herstellung von Polyaminen |
| DE836211C (de) * | 1949-03-09 | 1952-04-10 | Siemens Ag | Daempfungsglied fuer Freileitungen |
| US2636051A (en) * | 1948-04-05 | 1953-04-21 | Shell Dev | Preparation of diamine |
| DE875357C (de) * | 1944-08-15 | 1953-04-30 | Degussa | Verfahren zur Herstellung von Polyaminen |
| US2809995A (en) * | 1951-12-31 | 1957-10-15 | Ruhrchemie Ag | Production of amines |
| US3346640A (en) * | 1963-07-24 | 1967-10-10 | Lonza Ag | Preparation of monoalkylamines and dialkylamines |
| GB1204626A (en) * | 1967-03-08 | 1970-09-09 | Melle Bezons | Process for the preparation of primary amines |
| DE2048750C2 (de) * | 1970-10-03 | 1983-12-22 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur Herstellung von primären Aminen |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1069267A (fr) * | 1951-12-31 | 1954-07-06 | Ruhrchemie Ag | Procédé de préparation d'amines |
| US3707563A (en) * | 1970-09-14 | 1972-12-26 | Du Pont | Process for preparing n-alkylated aliphatic diamines |
-
1975
- 1975-10-20 IT IT2843475A patent/IT1048464B/it active
-
1976
- 1976-10-19 GB GB4333676A patent/GB1520969A/en not_active Expired
- 1976-10-20 DE DE19762647317 patent/DE2647317A1/de not_active Withdrawn
- 1976-10-20 FR FR7631586A patent/FR2328692A1/fr active Granted
Patent Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2219879A (en) * | 1938-12-14 | 1940-10-29 | Commercial Solvents Corp | Production of alkylamines |
| DE875357C (de) * | 1944-08-15 | 1953-04-30 | Degussa | Verfahren zur Herstellung von Polyaminen |
| US2518659A (en) * | 1945-06-09 | 1950-08-15 | Eastman Kodak Co | Preparation of n-butylamine |
| DE832887C (de) * | 1947-07-07 | 1952-03-03 | Bataafsche Petroleum | Verfahren zur Herstellung von Polyaminen |
| GB663294A (en) * | 1948-04-05 | 1951-12-19 | Bataafsche Petroleum | Process for the preparation of diamines |
| US2636051A (en) * | 1948-04-05 | 1953-04-21 | Shell Dev | Preparation of diamine |
| DE836211C (de) * | 1949-03-09 | 1952-04-10 | Siemens Ag | Daempfungsglied fuer Freileitungen |
| US2809995A (en) * | 1951-12-31 | 1957-10-15 | Ruhrchemie Ag | Production of amines |
| US3346640A (en) * | 1963-07-24 | 1967-10-10 | Lonza Ag | Preparation of monoalkylamines and dialkylamines |
| GB1204626A (en) * | 1967-03-08 | 1970-09-09 | Melle Bezons | Process for the preparation of primary amines |
| DE2048750C2 (de) * | 1970-10-03 | 1983-12-22 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur Herstellung von primären Aminen |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005856A3 (en) * | 1978-06-03 | 1980-01-09 | Ruhrchemie Aktiengesellschaft | Process for the preparation of diamines |
| EP0400426A3 (de) * | 1989-05-30 | 1991-06-12 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von alpha-, omega-Diaminen |
| DE102008044655A1 (de) | 2008-08-27 | 2010-03-04 | Bayer Materialscience Ag | Verfahren zur reduktiven Aminierung von Di- und Mehrfachaldehyden |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2328692B1 (enExample) | 1980-09-05 |
| FR2328692A1 (fr) | 1977-05-20 |
| GB1520969A (en) | 1978-08-09 |
| IT1048464B (it) | 1980-11-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2647317A1 (de) | Verfahren zur herstellung von alpha,omega-diaminen | |
| DE2505902C2 (de) | Verfahren zur Herstellung von 2,5- Dimethyl-3-(2H)-furanon | |
| DE2502893C2 (de) | Cycloaliphatische Amine | |
| DE2926641C2 (de) | Molybdän enthaltender Raney-Nickel-Katalysator und seine Verwendung zur katalytischen Hydrierung von Butindiol | |
| DE954416C (de) | Verfahren zur Herstellung von Aminonitrilen und Diaminen | |
| DE2551055A1 (de) | Verfahren zur herstellung von 1,3- oder 1,4-bis-(aminomethyl)-cyclohexan | |
| DE2945614C2 (enExample) | ||
| DE1668571C3 (de) | Verfahren zur Herstellung von 2-Methyl-polycycloalkylmethylaminen | |
| DE1953583A1 (de) | Verfahren zur Herstellung von Tetrahydrofuran | |
| DE2345160C2 (de) | Verfahren zur Herstellung von 1,4- Diacetoxybutan | |
| DE2831118A1 (de) | Verfahren zur herstellung von p-hydroxyphenylglycin und seiner n-alkyl- und n,n-dialkylderivate | |
| DE2459547C2 (de) | Verfahren zur Herstellung von Hexamethylenimin | |
| DE2151553A1 (de) | Verfahren zur Herstellung von Adipinsaeurenitril | |
| DE2609209C2 (de) | Verfahren zur Herstellung von 2-Pyrrolidon | |
| DE69805415T2 (de) | Verfahren zur isomerisierung von tilidin | |
| DE3010673A1 (de) | Verfahren zur herstellung von omega-aminosaeuren | |
| DE3886862T2 (de) | Verfahren zur Herstellung von Dioktamäthylentriamin. | |
| DE2200939C3 (de) | Verfahren zur Herstellung von Hl'-Aminoäthyl)adamantanhydrochlorid | |
| DE1493752A1 (de) | Verfahren zur Herstellung von reinem wasserfreiem 2-Amino-propionitril | |
| DE2651371A1 (de) | Quaternaere ammoniumsalze | |
| CH366554A (de) | Verfahren zur Herstellung von @-Amino-caprylsäure und ihren Estern | |
| DE961622C (de) | Verfahren zur Herstellung von cis-Cyclohexan-1, 2-dicarbonsaeureanhydrid | |
| EP0984014A2 (de) | Verfahren zur Herstellung von Guanin | |
| DE2160674C3 (de) | Verfahren zur Herstellung von 4(5)-Aminoimidazol-5(4)-carboxamid aus 4(5)-Aminoimidazol-5(4)-carbonitril | |
| CH388981A (de) | Verfahren zur Herstellung von w-Aminodecansäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |