DE2637114C2 - - Google Patents
Info
- Publication number
- DE2637114C2 DE2637114C2 DE2637114A DE2637114A DE2637114C2 DE 2637114 C2 DE2637114 C2 DE 2637114C2 DE 2637114 A DE2637114 A DE 2637114A DE 2637114 A DE2637114 A DE 2637114A DE 2637114 C2 DE2637114 C2 DE 2637114C2
- Authority
- DE
- Germany
- Prior art keywords
- sulfonic acid
- acid
- ester
- tert
- isocyanato
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 claims description 24
- 150000002148 esters Chemical class 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 12
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical group C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- -1 chlorosulfonyl aryl isocyanates Chemical class 0.000 description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- 239000012948 isocyanate Substances 0.000 description 17
- 150000002513 isocyanates Chemical class 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 13
- 239000011734 sodium Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000007858 starting material Substances 0.000 description 11
- 230000032050 esterification Effects 0.000 description 10
- 238000005886 esterification reaction Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 9
- 229940117389 dichlorobenzene Drugs 0.000 description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 239000002981 blocking agent Substances 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 230000002152 alkylating effect Effects 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 6
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 6
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 6
- WLJVXDMOQOGPHL-UHFFFAOYSA-N benzyl-alpha-carboxylic acid Natural products OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 5
- SUDHEDJJFGYYPL-UHFFFAOYSA-N ethyl n,n-dimethylcarbamate Chemical class CCOC(=O)N(C)C SUDHEDJJFGYYPL-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- PFNWLGLUWUKHNF-UHFFFAOYSA-N methyl 3-isocyanatobenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC(N=C=O)=C1 PFNWLGLUWUKHNF-UHFFFAOYSA-N 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 5
- 229940031826 phenolate Drugs 0.000 description 5
- 239000003279 phenylacetic acid Substances 0.000 description 5
- 229960003424 phenylacetic acid Drugs 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 230000000903 blocking effect Effects 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229920002635 polyurethane Polymers 0.000 description 4
- 239000004814 polyurethane Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 150000003459 sulfonic acid esters Chemical class 0.000 description 4
- 238000005829 trimerization reaction Methods 0.000 description 4
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 3
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 150000004707 phenolate Chemical class 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 2
- XAQCYASNAMYTQA-UHFFFAOYSA-N 2,4-diamino-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1N XAQCYASNAMYTQA-UHFFFAOYSA-N 0.000 description 2
- CZFHJGAIDYWZTB-UHFFFAOYSA-N 2,5-diisocyanatobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC(N=C=O)=CC=C1N=C=O CZFHJGAIDYWZTB-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- WFRBDWRZVBPBDO-UHFFFAOYSA-N 2-methyl-2-pentanol Chemical compound CCCC(C)(C)O WFRBDWRZVBPBDO-UHFFFAOYSA-N 0.000 description 2
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 2
- HNVRRHSXBLFLIG-UHFFFAOYSA-N 3-hydroxy-3-methylbut-1-ene Chemical compound CC(C)(O)C=C HNVRRHSXBLFLIG-UHFFFAOYSA-N 0.000 description 2
- CFSNFFQWAXHVPZ-UHFFFAOYSA-N 3-isocyanatobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(N=C=O)=C1 CFSNFFQWAXHVPZ-UHFFFAOYSA-N 0.000 description 2
- FRDAATYAJDYRNW-UHFFFAOYSA-N 3-methyl-3-pentanol Chemical compound CCC(C)(O)CC FRDAATYAJDYRNW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000007832 Na2SO4 Substances 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000007259 addition reaction Methods 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- UKPOZTCTTIZXDZ-UHFFFAOYSA-N ethyl 5-isocyanato-2-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC(N=C=O)=CC=C1C UKPOZTCTTIZXDZ-UHFFFAOYSA-N 0.000 description 2
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical compound CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 2
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- LOPROKXZHWKSAF-UHFFFAOYSA-N methyl (2,6-diisocyanatophenyl)methanesulfonate Chemical compound COS(=O)(=O)CC1=C(N=C=O)C=CC=C1N=C=O LOPROKXZHWKSAF-UHFFFAOYSA-N 0.000 description 2
- VJDVKPCVHATTRK-UHFFFAOYSA-N methyl 2,5-diisocyanatobenzenesulfonate Chemical compound COS(=O)(=O)C1=CC(N=C=O)=CC=C1N=C=O VJDVKPCVHATTRK-UHFFFAOYSA-N 0.000 description 2
- BUTJPBNSRQBBRV-UHFFFAOYSA-N methyl 4-isocyanatobenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(N=C=O)C=C1 BUTJPBNSRQBBRV-UHFFFAOYSA-N 0.000 description 2
- JFIQJWQUTKUJSD-UHFFFAOYSA-N methyl 5-isocyanato-2-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC(N=C=O)=CC=C1C JFIQJWQUTKUJSD-UHFFFAOYSA-N 0.000 description 2
- RKGZZKIOFHLCAG-UHFFFAOYSA-N methyl 7-isocyanatonaphthalene-1-sulfonate Chemical compound C1=C(N=C=O)C=C2C(S(=O)(=O)OC)=CC=CC2=C1 RKGZZKIOFHLCAG-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical group OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 150000003509 tertiary alcohols Chemical class 0.000 description 2
- 150000003673 urethanes Chemical class 0.000 description 2
- JBQGNCQLVMYWBX-UHFFFAOYSA-N (2,6-diisocyanatophenyl)methanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=C(N=C=O)C=CC=C1N=C=O JBQGNCQLVMYWBX-UHFFFAOYSA-N 0.000 description 1
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VTBOTOBFGSVRMA-UHFFFAOYSA-N 1-Methylcyclohexanol Chemical compound CC1(O)CCCCC1 VTBOTOBFGSVRMA-UHFFFAOYSA-N 0.000 description 1
- BUCJHJXFXUZJHL-UHFFFAOYSA-N 1-ethylcyclohexan-1-ol Chemical compound CCC1(O)CCCCC1 BUCJHJXFXUZJHL-UHFFFAOYSA-N 0.000 description 1
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical class CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical class OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 1
- IPQWXJDRMKGSFI-UHFFFAOYSA-N 3,5-diamino-4-methylbenzenesulfonic acid Chemical compound CC1=C(N)C=C(S(O)(=O)=O)C=C1N IPQWXJDRMKGSFI-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- XKIRHOWVQWCYBT-UHFFFAOYSA-N 3-ethylpentan-3-ol Chemical compound CCC(O)(CC)CC XKIRHOWVQWCYBT-UHFFFAOYSA-N 0.000 description 1
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- PUXGCFRABSKGED-UHFFFAOYSA-N 4-isocyanatobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(N=C=O)C=C1 PUXGCFRABSKGED-UHFFFAOYSA-N 0.000 description 1
- DQNAQOYOSRJXFZ-UHFFFAOYSA-N 5-Amino-1-naphthalenesulfonic acid Chemical compound C1=CC=C2C(N)=CC=CC2=C1S(O)(=O)=O DQNAQOYOSRJXFZ-UHFFFAOYSA-N 0.000 description 1
- NTPCHAXHWPDMEI-UHFFFAOYSA-N 5-amino-2,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C=C1N NTPCHAXHWPDMEI-UHFFFAOYSA-N 0.000 description 1
- ZBZGGZGVFCIXDE-UHFFFAOYSA-N 5-amino-2-(4-aminophenyl)benzenesulfonic acid Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1S(O)(=O)=O ZBZGGZGVFCIXDE-UHFFFAOYSA-N 0.000 description 1
- GDCAHFTTXXUBKZ-UHFFFAOYSA-N 5-amino-2-[(4-amino-2-sulfophenyl)methyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1CC1=CC=C(N)C=C1S(O)(=O)=O GDCAHFTTXXUBKZ-UHFFFAOYSA-N 0.000 description 1
- BRKFTWHPLMMNHF-UHFFFAOYSA-N 5-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C=C1S(O)(=O)=O BRKFTWHPLMMNHF-UHFFFAOYSA-N 0.000 description 1
- GBWNQBBVSVGAAL-UHFFFAOYSA-N 5-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 GBWNQBBVSVGAAL-UHFFFAOYSA-N 0.000 description 1
- GHCFYCCXEKHAHC-UHFFFAOYSA-N 5-aminonaphthalene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1S(O)(=O)=O GHCFYCCXEKHAHC-UHFFFAOYSA-N 0.000 description 1
- OYFFPEICGBWAFA-UHFFFAOYSA-N 5-isocyanato-2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=C(N=C=O)C=C1S(Cl)(=O)=O OYFFPEICGBWAFA-UHFFFAOYSA-N 0.000 description 1
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 1
- WGAPIALKSXVJAO-UHFFFAOYSA-N 7-isocyanatonaphthalene-1-sulfonyl chloride Chemical compound C1=C(N=C=O)C=C2C(S(=O)(=O)Cl)=CC=CC2=C1 WGAPIALKSXVJAO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical class OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 229910005948 SO2Cl Inorganic materials 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000005362 aryl sulfone group Chemical group 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- DFGQBWYOWLOKNS-UHFFFAOYSA-N butyl 2-amino-4-chlorobenzoate Chemical compound CCCCOC(=O)C1=CC=C(Cl)C=C1N DFGQBWYOWLOKNS-UHFFFAOYSA-N 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- RJOCIDSMMUPDGI-UHFFFAOYSA-N ethyl carbamate;2-methylbenzenesulfonyl chloride Chemical compound CCOC(N)=O.CC1=CC=CC=C1S(Cl)(=O)=O RJOCIDSMMUPDGI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000013072 incoming material Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical class OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- NRZRRZAVMCAKEP-UHFFFAOYSA-N naphthionic acid Chemical compound C1=CC=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 NRZRRZAVMCAKEP-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- YOYNLXLKRDWFKJ-UHFFFAOYSA-N phenyl 2,4-diisocyanato-5-methylbenzenesulfonate Chemical compound C1=C(N=C=O)C(C)=CC(S(=O)(=O)OC=2C=CC=CC=2)=C1N=C=O YOYNLXLKRDWFKJ-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- NHXVNEDMKGDNPR-UHFFFAOYSA-N zinc;pentane-2,4-dione Chemical compound [Zn+2].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O NHXVNEDMKGDNPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/26—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids
- C07C303/30—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids by reactions not involving the formation of esterified sulfo groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762637114 DE2637114A1 (de) | 1976-08-18 | 1976-08-18 | Verfahren zur herstellung von isocyanaten |
| IT50643/77A IT1079815B (it) | 1976-08-18 | 1977-08-11 | Procedimento per produrre isocianurati |
| CH1002177A CH639644A5 (de) | 1976-08-18 | 1977-08-16 | Verfahren zur herstellung von isocyanaten. |
| GB34321/77A GB1539146A (en) | 1976-08-18 | 1977-08-16 | Process for the production of isocyanates |
| BE180224A BE857853A (fr) | 1976-08-18 | 1977-08-17 | Procede de preparation d'isocyanates organiques, par reaction de tert-olyurethannes avec du phosgene et produits obtenus |
| JP52098310A JPS6027664B2 (ja) | 1976-08-18 | 1977-08-18 | イソシアネ−ト |
| FR7725315A FR2362123A1 (fr) | 1976-08-18 | 1977-08-18 | Procede de preparation d'isocyanates organiques, par reaction tert-alkyl-urethannes avec du phosgene et produits obtenus |
| US06/015,577 US4259255A (en) | 1976-08-18 | 1979-02-26 | Process for the production of isocyanates |
| US06/203,077 US4325887A (en) | 1976-08-18 | 1980-10-31 | Isocyanatoaryl sulfonic acid esters |
| JP58019840A JPS58150550A (ja) | 1976-08-18 | 1983-02-10 | イソシアネ−トの製法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762637114 DE2637114A1 (de) | 1976-08-18 | 1976-08-18 | Verfahren zur herstellung von isocyanaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2637114A1 DE2637114A1 (de) | 1978-02-23 |
| DE2637114C2 true DE2637114C2 (enExample) | 1987-12-03 |
Family
ID=5985709
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762637114 Granted DE2637114A1 (de) | 1976-08-18 | 1976-08-18 | Verfahren zur herstellung von isocyanaten |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4259255A (enExample) |
| JP (2) | JPS6027664B2 (enExample) |
| BE (1) | BE857853A (enExample) |
| CH (1) | CH639644A5 (enExample) |
| DE (1) | DE2637114A1 (enExample) |
| FR (1) | FR2362123A1 (enExample) |
| GB (1) | GB1539146A (enExample) |
| IT (1) | IT1079815B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2651065A1 (de) * | 1976-11-09 | 1978-05-18 | Bayer Ag | Modifizierte, sulfonsaeureestergruppen aufweisende polyisocyanate |
| DE2855938A1 (de) * | 1978-12-23 | 1980-07-10 | Bayer Ag | Isocyanatoarylsulfochloride, ein verfahren zu ihrer herstellung, sowie ihre verwendung bei der herstellung von polyisocyanat-polyadditionsprodukten |
| DE3130844A1 (de) * | 1981-08-04 | 1983-02-24 | Bayer Ag, 5090 Leverkusen | Neue n,n-disubstituierte sulfonamidgruppen aufweisende aromatische diisocyanate, verfahren zu ihrer herstellung sowie ihre verwendung als aufbaukomponente bei der herstellung von polyurethanen |
| CN101980767A (zh) * | 2008-03-27 | 2011-02-23 | 通用电气公司 | 芳族卤代磺酰基异氰酸酯组合物和由其制备的聚合物 |
| CN116730880B (zh) * | 2023-08-14 | 2023-10-27 | 江苏天合储能有限公司 | 电解液除水添加剂、电解液及锂离子电池 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB485761A (en) * | 1936-11-24 | 1938-05-24 | Henry Alfred Piggott | Manufacture of isocyanates |
| US3404170A (en) * | 1965-09-27 | 1968-10-01 | Upjohn Co | Preparation of isocyanates |
| DE1618441C3 (de) * | 1967-06-21 | 1975-05-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 2-lso-cyanato-2-methyl-propansulfonsäurechlorid |
| CH542824A (de) * | 1968-06-06 | 1973-11-30 | Bayer Ag | Verfahren zur Herstellung von Chlorsulfonyl-vinyl-isocyanaten |
| CA931688A (en) * | 1968-08-02 | 1973-08-07 | C. Carlson Robert | Sulfonated aromatic polyisocyanates and preparation of stable anionic polyurethane or polyurea latices therefrom |
| DE2227111C2 (de) * | 1972-06-03 | 1984-07-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von flüssigen, Sulfonsäure- und/oder Sulfonatgruppen aufweisenden, aromatischen Polyisocyanatgemischen und die danach hergestellten Gemische |
| DE2359615A1 (de) * | 1973-11-30 | 1975-06-05 | Bayer Ag | Harzartige sulfonierte polyisocyanate |
| US3959329A (en) * | 1973-05-24 | 1976-05-25 | Bayer Aktiengesellschaft | Polyisocyanates containing sulphonic acid or sulphonate groups |
| DE2359614A1 (de) * | 1973-11-30 | 1975-06-05 | Bayer Ag | Sulfonsaeure- und/oder sulfonatgruppen aufweisende polyisocyanate |
| DE2359611C3 (de) * | 1973-11-30 | 1981-09-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von durch Harze auf Isocyanatbasis gebundenen Füllstoffen |
-
1976
- 1976-08-18 DE DE19762637114 patent/DE2637114A1/de active Granted
-
1977
- 1977-08-11 IT IT50643/77A patent/IT1079815B/it active
- 1977-08-16 CH CH1002177A patent/CH639644A5/de not_active IP Right Cessation
- 1977-08-16 GB GB34321/77A patent/GB1539146A/en not_active Expired
- 1977-08-17 BE BE180224A patent/BE857853A/xx not_active IP Right Cessation
- 1977-08-18 JP JP52098310A patent/JPS6027664B2/ja not_active Expired
- 1977-08-18 FR FR7725315A patent/FR2362123A1/fr active Granted
-
1979
- 1979-02-26 US US06/015,577 patent/US4259255A/en not_active Expired - Lifetime
-
1983
- 1983-02-10 JP JP58019840A patent/JPS58150550A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IT1079815B (it) | 1985-05-13 |
| FR2362123A1 (fr) | 1978-03-17 |
| JPS58150550A (ja) | 1983-09-07 |
| US4259255A (en) | 1981-03-31 |
| FR2362123B1 (enExample) | 1980-08-29 |
| GB1539146A (en) | 1979-01-24 |
| CH639644A5 (de) | 1983-11-30 |
| JPS6027664B2 (ja) | 1985-06-29 |
| JPS5323904A (en) | 1978-03-06 |
| BE857853A (fr) | 1978-02-17 |
| DE2637114A1 (de) | 1978-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3144672A1 (de) | Verfahren zur herstellung von mischtrimerisaten organischer isocyanate, die nach dem verfahren erhaltenen mischtrimerisate, sowie ihre verwendung zur herstellung von polyurethanen | |
| EP0070436B1 (de) | Stabilisatorhaltige Reaktivkomponenten für PU-Schaumstoffe, neue Stabilisatoren und ein Verfahren zur Herstellung der Stabilisatoren | |
| DE2637114C2 (enExample) | ||
| EP0183115B1 (de) | Gegebenenfalls in 3-Stellung Methyl-substituierte Bis-(4-isocyanatophenoxy)-alkane, ein Verfahren zu ihrer Herstellung und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
| EP0257420B1 (de) | Ausgewählte Diisocyanate, Verfahren zu deren Herstellung und deren Verwendung als Aufbaukomponente bei der Herstellung von Polyurethankunststoffen | |
| EP0270906A1 (de) | Diisocyanate und Diisocyanatgemische, ein Verfahren zu ihrer Herstellung und ihrer Verwendung bei der Herstellung von Polyurethankunststoffen | |
| EP0137309B1 (de) | Mehrcyclische Kohlensäureester und neue Copolymere erhältlich aus diesen mehrcyclischen Kohlensäureestern und monocyclischen Carbonaten | |
| EP0410214B1 (de) | Verfahren zur Herstellung N,N-disubstituierter Mono- und Oligourethane | |
| EP0195928B1 (de) | 4,4'-Diisocyanato-phenylbenzylether, ein Verfahren zu seiner Herstellung und seine Verwendung als Isocyanatkomponente bei der Herstellung von Polyurethankunststoffen | |
| DE2945867A1 (de) | Substituierte polyisocyanate oder polyisocyanatgemische der diphenylmethanreihe, die chlorsulfonylgruppen enthalten, ein verfahren zu ihrer herstellung, sowie ihre verwendung bei der herstellung von polyisocyanat-polyadditions-verbindungen | |
| US4325887A (en) | Isocyanatoaryl sulfonic acid esters | |
| DE1568497C3 (enExample) | ||
| EP0244727B1 (de) | 1,4-Bis-(4-isocyanatophenoxy)- benzole, ein Verfahren zu ihrer Herstellung und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
| DE3527531A1 (de) | Verfahren zur herstellung von urethanmodifizierten polyisocyanat-zubereitungen, die nach diesem verfahren erhaltenen polyisocyanatzubereitungen und ihre verwendung bei der herstellung von kunststoffen auf polyisocyanat-basis | |
| EP0034711A2 (de) | Verfahren zur Herstellung von aromatisch gebundenen Sulfochloridgruppen aufweisenden aromatischen Isocyanaten | |
| DE3442689A1 (de) | Bis-(4-isocyanatophenoxy)-alkane, ein verfahren zu ihrer herstellung und ihre verwendung bei der herstellung von polyurethankunststoffen | |
| DE3908598A1 (de) | Formtrennmittel fuer poly(ester)carbonate | |
| DE3525606A1 (de) | Bis-(4-isocyanato-3-methyl-phenoxy)-alkane, ein verfahren zu ihrer herstellung und ihre verwendung bei der herstellung von polyurethankunststoffen | |
| DE3609813A1 (de) | Verfahren zur herstellung n,n-disubstituierter mono- und oligourethane | |
| EP0131801A1 (de) | Verfahren zur Herstellung substituierter Ethylenharnstoffe sowie neue N-Vinylethylenharnstoffe | |
| AT362387B (de) | Verfahren zur herstellung von neuen unsymmetrischen n,n'-thio-di-carbamaten | |
| DE2605024A1 (de) | Verfahren zur herstellung neuer aliphatischer polycarbonate | |
| DD143609A5 (de) | Verfahren zur herstellung von di-bzw.tri-isatosaeure-derivaten | |
| DE3606255A1 (de) | Isocyanato-benzotriazole und ein verfahren zu ihrer herstellung | |
| DE3042820A1 (de) | Neue, schwefelhaltige isocyanato-isocyanurate, ein verfahren zu ihrer herstellung und ihrer verwendung als aufbaukomponente bei der herstellung von polyurethankunststoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |