DE2636130C3 - Mindestens einen 2,2,6,6-Tetramethylpiperidylrest enthaltende 133-Triazinylverbindungen, Verfahren zu ihrer Herstellung und Mittel zur Stabilisierung von Polymerisaten - Google Patents
Mindestens einen 2,2,6,6-Tetramethylpiperidylrest enthaltende 133-Triazinylverbindungen, Verfahren zu ihrer Herstellung und Mittel zur Stabilisierung von PolymerisatenInfo
- Publication number
- DE2636130C3 DE2636130C3 DE2636130A DE2636130A DE2636130C3 DE 2636130 C3 DE2636130 C3 DE 2636130C3 DE 2636130 A DE2636130 A DE 2636130A DE 2636130 A DE2636130 A DE 2636130A DE 2636130 C3 DE2636130 C3 DE 2636130C3
- Authority
- DE
- Germany
- Prior art keywords
- radical
- carbon atoms
- general formula
- formula
- bis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 title claims description 22
- 238000002360 preparation method Methods 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 7
- 230000000087 stabilizing effect Effects 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 44
- 239000000203 mixture Substances 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 150000007529 inorganic bases Chemical class 0.000 claims description 3
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229920000768 polyamine Polymers 0.000 claims description 2
- 150000003918 triazines Chemical class 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 125000006839 xylylene group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 63
- -1 aromatic salicylates Chemical class 0.000 description 43
- 239000000835 fiber Substances 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 239000000155 melt Substances 0.000 description 18
- 239000003381 stabilizer Substances 0.000 description 16
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 15
- 239000008096 xylene Substances 0.000 description 15
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 13
- 239000002904 solvent Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 238000001914 filtration Methods 0.000 description 8
- QUAMTGJKVDWJEQ-UHFFFAOYSA-N octabenzone Chemical compound OC1=CC(OCCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 QUAMTGJKVDWJEQ-UHFFFAOYSA-N 0.000 description 8
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 6
- 229920001059 synthetic polymer Polymers 0.000 description 6
- 239000004743 Polypropylene Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 229920001155 polypropylene Polymers 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 239000004611 light stabiliser Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000012262 resinous product Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000006309 butyl amino group Chemical group 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexamethylene diamine Natural products NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 3
- 150000002484 inorganic compounds Chemical class 0.000 description 3
- 229910010272 inorganic material Inorganic materials 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 150000000182 1,3,5-triazines Chemical class 0.000 description 2
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 239000006096 absorbing agent Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 150000008366 benzophenones Chemical class 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229920001903 high density polyethylene Polymers 0.000 description 2
- 239000004700 high-density polyethylene Substances 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000002004 n-butylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- ZQBAKBUEJOMQEX-UHFFFAOYSA-N phenyl salicylate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=CC=C1 ZQBAKBUEJOMQEX-UHFFFAOYSA-N 0.000 description 2
- 150000003053 piperidines Chemical class 0.000 description 2
- 239000002861 polymer material Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- KJYSXRBJOSZLEL-UHFFFAOYSA-N (2,4-ditert-butylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OC(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 KJYSXRBJOSZLEL-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- ARVUDIQYNJVQIW-UHFFFAOYSA-N (4-dodecoxy-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC(OCCCCCCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 ARVUDIQYNJVQIW-UHFFFAOYSA-N 0.000 description 1
- ZBBLRPRYYSJUCZ-GRHBHMESSA-L (z)-but-2-enedioate;dibutyltin(2+) Chemical compound [O-]C(=O)\C=C/C([O-])=O.CCCC[Sn+2]CCCC ZBBLRPRYYSJUCZ-GRHBHMESSA-L 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 1
- 125000004955 1,4-cyclohexylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:1])C([H])([H])C([H])([H])C1([H])[*:2] 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- UPYPTOCXMIWHSG-UHFFFAOYSA-N 1-dodecylsulfanyldodecane Chemical compound CCCCCCCCCCCCSCCCCCCCCCCCC UPYPTOCXMIWHSG-UHFFFAOYSA-N 0.000 description 1
- IHWDIGHWDQPQMQ-UHFFFAOYSA-N 1-octadecylsulfanyloctadecane Chemical compound CCCCCCCCCCCCCCCCCCSCCCCCCCCCCCCCCCCCC IHWDIGHWDQPQMQ-UHFFFAOYSA-N 0.000 description 1
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- OCSIKZYSDOXRPA-UHFFFAOYSA-N 2,2-bis(hydroxymethyl)-3-octadecylhenicosane-1,3-diol dihydroxyphosphanyl dihydrogen phosphite Chemical compound OP(O)OP(O)O.C(CCCCCCCCCCCCCCCCC)C(O)(C(CO)(CO)CO)CCCCCCCCCCCCCCCCCC OCSIKZYSDOXRPA-UHFFFAOYSA-N 0.000 description 1
- QIJIUJYANDSEKG-UHFFFAOYSA-N 2,4,4-trimethylpentan-2-amine Chemical compound CC(C)(C)CC(C)(C)N QIJIUJYANDSEKG-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- JHKXUWMQZIBWOF-UHFFFAOYSA-N 2-chloro-4,6-bis(2,6-dimethylphenoxy)-1,3,5-triazine Chemical compound CC1=CC=CC(C)=C1OC1=NC(Cl)=NC(OC=2C(=CC=CC=2C)C)=N1 JHKXUWMQZIBWOF-UHFFFAOYSA-N 0.000 description 1
- IJVRPNIWWODHHA-UHFFFAOYSA-N 2-cyanoprop-2-enoic acid Chemical class OC(=O)C(=C)C#N IJVRPNIWWODHHA-UHFFFAOYSA-N 0.000 description 1
- RLXPEQVECSTYJT-UHFFFAOYSA-N 2-n,4-n,6-n-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine Chemical compound C1C(C)(C)NC(C)(C)CC1NC1=NC(NC2CC(C)(C)NC(C)(C)C2)=NC(NC2CC(C)(C)NC(C)(C)C2)=N1 RLXPEQVECSTYJT-UHFFFAOYSA-N 0.000 description 1
- HXIQYSLFEXIOAV-UHFFFAOYSA-N 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenol Chemical compound CC1=CC(O)=C(C(C)(C)C)C=C1SC1=CC(C(C)(C)C)=C(O)C=C1C HXIQYSLFEXIOAV-UHFFFAOYSA-N 0.000 description 1
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical compound OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- WUCDQLRTWMSFBP-UHFFFAOYSA-N 4-piperidin-1-yltriazine Chemical class C1CCCCN1C1=CC=NN=N1 WUCDQLRTWMSFBP-UHFFFAOYSA-N 0.000 description 1
- DBOSBRHMHBENLP-UHFFFAOYSA-N 4-tert-Butylphenyl Salicylate Chemical compound C1=CC(C(C)(C)C)=CC=C1OC(=O)C1=CC=CC=C1O DBOSBRHMHBENLP-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Didodecyl thiobispropanoate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 1
- 229920000299 Nylon 12 Polymers 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 101150030755 Ocln gene Proteins 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 229910000086 alane Inorganic materials 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- XITRBUPOXXBIJN-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 XITRBUPOXXBIJN-UHFFFAOYSA-N 0.000 description 1
- PZGVVCOOWYSSGB-UHFFFAOYSA-L but-2-enedioate;dioctyltin(2+) Chemical compound CCCCCCCC[Sn]1(CCCCCCCC)OC(=O)C=CC(=O)O1 PZGVVCOOWYSSGB-UHFFFAOYSA-L 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IETFBKOGVBSBJQ-UHFFFAOYSA-N n-butylpiperidin-4-amine Chemical compound CCCCNC1CCNCC1 IETFBKOGVBSBJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- JMWUYEFBFUCSAK-UHFFFAOYSA-L nickel(2+);octadecanoate Chemical class [Ni+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O JMWUYEFBFUCSAK-UHFFFAOYSA-L 0.000 description 1
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- NRNFFDZCBYOZJY-UHFFFAOYSA-N p-quinodimethane Chemical group C=C1C=CC(=C)C=C1 NRNFFDZCBYOZJY-UHFFFAOYSA-N 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960000969 phenyl salicylate Drugs 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- JZNDMMGBXUYFNQ-UHFFFAOYSA-N tris(dodecylsulfanyl)phosphane Chemical compound CCCCCCCCCCCCSP(SCCCCCCCCCCCC)SCCCCCCCCCCCC JZNDMMGBXUYFNQ-UHFFFAOYSA-N 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- GPYYEEJOMCKTPR-UHFFFAOYSA-L zinc;dodecanoate Chemical class [Zn+2].CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O GPYYEEJOMCKTPR-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/50—Two nitrogen atoms with a halogen atom attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
- C08K5/34926—Triazines also containing heterocyclic groups other than triazine groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/37—Thiols
- C08K5/378—Thiols containing heterocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT52769/75A IT1060458B (it) | 1975-12-18 | 1975-12-18 | Composti piperidil triazinici adatti per la stabilizzazione di polimeri sintetici e procedimento per la loro preparazione |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2636130A1 DE2636130A1 (de) | 1977-06-30 |
| DE2636130B2 DE2636130B2 (de) | 1979-07-19 |
| DE2636130C3 true DE2636130C3 (de) | 1980-10-02 |
Family
ID=11277521
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2636130A Expired DE2636130C3 (de) | 1975-12-18 | 1976-08-11 | Mindestens einen 2,2,6,6-Tetramethylpiperidylrest enthaltende 133-Triazinylverbindungen, Verfahren zu ihrer Herstellung und Mittel zur Stabilisierung von Polymerisaten |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US4108829A (Direct) |
| JP (1) | JPS5273886A (Direct) |
| AT (1) | AT351269B (Direct) |
| AU (1) | AU504440B2 (Direct) |
| BE (1) | BE847034A (Direct) |
| CA (1) | CA1088058A (Direct) |
| CH (1) | CH632523A5 (Direct) |
| DE (1) | DE2636130C3 (Direct) |
| DK (1) | DK167017B1 (Direct) |
| ES (1) | ES454370A1 (Direct) |
| FR (1) | FR2335509A1 (Direct) |
| GB (1) | GB1511773A (Direct) |
| HK (1) | HK23979A (Direct) |
| IE (1) | IE43247B1 (Direct) |
| IT (1) | IT1060458B (Direct) |
| LU (1) | LU75880A1 (Direct) |
| NL (1) | NL166940C (Direct) |
| ZA (1) | ZA767425B (Direct) |
Families Citing this family (104)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1123083B (it) * | 1976-11-26 | 1986-04-30 | Chimosa Chimica Organica Spa | Derivati piperidinici della 1,3,5 triazina quali stabilizzanti per polimeri sintetici che li comprendono e procedimento per la loro preparazione |
| JPS5373241A (en) * | 1976-12-10 | 1978-06-29 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin compositions |
| EP0002754B1 (de) * | 1977-12-30 | 1983-05-18 | Ciba-Geigy Ag | Neue Polyalkylpiperidinderivate von s-Triazinen, ihre Verwendung zum Stabilisieren von Kunststoffen und die so stabilisierten Kunststoffe |
| DE2961381D1 (en) * | 1978-02-08 | 1982-01-28 | Ciba Geigy Ag | Polyalkylpiperidine derivatives of s-triazines, their use as stabilizers for polymers and polymers thus stabilized |
| JPS554331A (en) * | 1978-06-24 | 1980-01-12 | Sankyo Co Ltd | Piperidine-spiro-hydantoin derivative |
| US4315859A (en) * | 1979-01-15 | 1982-02-16 | Ciba-Geigy Corporation | 1,3,5-Triazines containing at least one piperidine radical |
| DE2961017D1 (en) * | 1979-01-29 | 1981-12-24 | Ciba Geigy Ag | Piperidyl-triazine derivatives, process for their production, their use as stabilizers for polymers and the polymers stabilized therewith |
| US4288593A (en) * | 1979-02-06 | 1981-09-08 | Ciba-Geigy Corporation | Polyalkylpiperidine derivatives of s-triazines |
| US4315848A (en) * | 1979-05-10 | 1982-02-16 | Ciba-Geigy Corporation | 2-[2-Hydroxy-3,5-di-(α,α-dimethylbenzyl)-phenyl]-2H-benzotriazole and stabilized compositions |
| JPS564639A (en) * | 1979-06-23 | 1981-01-19 | Sankyo Co Ltd | Stabilizer for high-molecular material |
| DE2933078A1 (de) * | 1979-08-16 | 1981-03-26 | Hoechst Ag, 65929 Frankfurt | Neue triazinderivate, ihre herstellung und ihre verwendung als stabilisatoren fuer synthetische polymere |
| DE2944729A1 (de) * | 1979-11-06 | 1981-05-14 | Hoechst Ag, 6000 Frankfurt | Neue triazinstabilisatoren |
| DE3022896A1 (de) * | 1980-06-19 | 1981-12-24 | Hoechst Ag, 6000 Frankfurt | Polytriazinylamine, verfahren zu ihrer herstellung und ihre verwendung als stabilisatoren fuer synthetische polymere |
| DE3027223A1 (de) * | 1980-07-18 | 1982-02-11 | Hoechst Ag, 6000 Frankfurt | Triazinylaminotriazine, ihre herstellung und verwendung |
| IT1151035B (it) * | 1980-07-31 | 1986-12-17 | Chimosa Chimica Organica Spa | Piperidil-derivati di copolimeri triazinici,processi per la loro preparazione e composizioni stabilizzate che li comprendono |
| DE3111209A1 (de) * | 1981-03-21 | 1982-09-30 | Hoechst Ag, 6000 Frankfurt | Hochmolekulare piperidingruppenhaltige ester und urethane, verfahren zu ihrer herstellung, ihre verwendung als stabilisatoren fuer polymere sowie diese verbindungen enthaltende polymere |
| DE3113455A1 (de) * | 1981-04-03 | 1982-10-21 | Hoechst Ag, 6000 Frankfurt | Poly-bis-triazinylimide, ihre herstellung, ihre verwendung als lichtschutzmittel fuer polymere sowie die mit ihnen stabilisierten polymeren |
| US4461861A (en) * | 1981-07-20 | 1984-07-24 | American Cyanamid Company | Polymer compositions stabilized with triazinyl-piperidine compounds |
| US4356287A (en) * | 1981-07-20 | 1982-10-26 | American Cyanamid Company | Novel polymeric light stabilizers for polymers |
| US4400505A (en) * | 1981-07-20 | 1983-08-23 | American Cyanamid Company | Triazinyl-piperidines as light stabilizers for polymers |
| US4348493A (en) * | 1981-07-20 | 1982-09-07 | American Cyanamid Company | Novel light stabilizers for polymers |
| IT1195277B (it) * | 1981-10-02 | 1988-10-12 | Chimosa Chimica Organica Spa | Piperidil derivati di composti triazinici macrociclici,aventi attivita' stabilizzante per i polimeri e processi per la loro preparazione |
| EP0080431B1 (de) * | 1981-10-16 | 1986-09-24 | Ciba-Geigy Ag | Synergistisches Gemisch von niedermolekularen und hochmolekularen Polyalkylpiperidinen |
| US4547538A (en) * | 1982-02-19 | 1985-10-15 | The B. F. Goodrich Company | Alkylated polyalkylenepolyamines, substituted oxo-piperazinyl-triazines and UV light stabilized compositions |
| US4480092A (en) * | 1982-02-19 | 1984-10-30 | The B. F. Goodrich Company | Alkylated polyalkylenepolyamines, substituted oxo-piperazinyl-triazines |
| JPS58194931A (ja) * | 1982-05-07 | 1983-11-14 | Adeka Argus Chem Co Ltd | 合成樹脂組成物 |
| DE3379050D1 (en) * | 1982-08-11 | 1989-03-02 | Ciba Geigy Ag | Process for the chemical bond between a stabilising compound and a polymer |
| EP0109937B1 (de) * | 1982-11-18 | 1988-01-20 | Ciba-Geigy Ag | Farbphotographisches Aufzeichnungsmaterial |
| US4469828A (en) * | 1982-11-22 | 1984-09-04 | Adeka Argus Chemical Co., Ltd. | Alkylthiopropionyl hydrazino triazines and synthetic resin compositions |
| JPS59122487A (ja) * | 1982-12-28 | 1984-07-14 | Sankyo Co Ltd | ピペリジル−トリアジン−トリアミン誘導体及び高分子材料用安定剤 |
| IT1193659B (it) * | 1983-02-04 | 1988-07-21 | Chimosa Chimica Organica Spa | Composti piperidinil-triazinici utili come stabilizzanti per polimeri sintetici |
| IT1169843B (it) * | 1983-09-23 | 1987-06-03 | Chimosa Chimica Organica Spa | Composti polimerici contenenti radicali piperidinici, processo per la loro preparazione e loro impiego quali stabilizzanti per polimeri sintetici |
| US4696959A (en) * | 1983-09-26 | 1987-09-29 | Ppg Industries, Inc. | Modified piperidines as ultraviolet light stabilizers |
| US4691015A (en) * | 1984-07-23 | 1987-09-01 | Ciba-Geigy Corporation | Hydroxylamines derived from hindered amines |
| US4668721A (en) * | 1984-07-23 | 1987-05-26 | Ciba-Geigy Corporation | Polyolefin compositions stabilized against degradation using hydroxylamine derivatives |
| JPS6181441A (ja) * | 1984-09-28 | 1986-04-25 | Adeka Argus Chem Co Ltd | 高分子材料組成物 |
| US4965301A (en) * | 1984-12-03 | 1990-10-23 | Phillips Petroleum Company | Stabilization of polyolefins |
| US4675353A (en) * | 1985-01-29 | 1987-06-23 | The Bfgoodrich Company | Hindered 2-keto-1,4-diazacycloalkane oligomers containing triazine rings and compositions stabilized thereby |
| JPS6218444A (ja) * | 1985-07-16 | 1987-01-27 | Adeka Argus Chem Co Ltd | 安定化された高分子材料組成物 |
| JPS6218443A (ja) * | 1985-07-17 | 1987-01-27 | Adeka Argus Chem Co Ltd | 安定化高分子材料組成物 |
| JPS6248745A (ja) * | 1985-08-28 | 1987-03-03 | Mitsubishi Petrochem Co Ltd | ポリオレフイン組成物 |
| JPS6250342A (ja) * | 1985-08-30 | 1987-03-05 | Adeka Argus Chem Co Ltd | 安定化された高分子材料組成物 |
| IT1204389B (it) * | 1986-06-16 | 1989-03-01 | Ciba Geigy Spa | Derivati triazinici di piperidinilammidine atti all'impiego come stabilizzanti per polimeri sintetici |
| IT1197853B (it) * | 1986-08-07 | 1988-12-21 | Ciba Geigy Spa | Composti politriazinici contenenti gruppi piperidinilammidinici e loro impiego come stabilizzanti per polimeri |
| IT1197466B (it) * | 1986-08-25 | 1988-11-30 | Ciba Geigy Spa | Metodo per la stabilizzazione di polimeri oleofinici mediante composti triazinici |
| IT1205023B (it) * | 1987-05-22 | 1989-03-10 | Ciba Geigy Spa | Composti piperidin-triazinici utilizzabili come stabilizzanti di poliolefine |
| IT1222049B (it) * | 1987-07-16 | 1990-08-31 | Ciba Geygi Spa | Composti piperidin triazinici utilizzabili come stabilizzanti per polimeri sintetici |
| ES2058309T3 (es) * | 1987-10-30 | 1994-11-01 | Sankyo Co | Derivados de piperidiltriazina y su utilizacion como agentes estabilizadores para polimeros. |
| IT1223405B (it) * | 1987-12-04 | 1990-09-19 | Ciba Geigy Spa | Procedimento per la metilazione di composti triazinici contenenti gruppi 2,2,6,6 tetrametilpiperidinici |
| AU621082B2 (en) * | 1988-02-08 | 1992-03-05 | Ciba-Geigy Ag | Tetramethylpiperidino-s-triazines |
| IT1217742B (it) * | 1988-05-31 | 1990-03-30 | Ciba Geigy Spa | Poliammine parzialmente sostituite con piperidin triazine |
| IT1219701B (it) * | 1988-05-31 | 1990-05-24 | Ciba Geigy Spa | Poliammine parzialmente sostituite con 4,6 bis (n,n bis(2,2,6,6 tetrametil 4 piperdil) ammino) 1,3,5-triazin-2-il |
| US5244948A (en) * | 1988-06-30 | 1993-09-14 | Ciba-Geigy Corporation | Process for the stabilization of polyolefins |
| IT1227334B (it) * | 1988-08-04 | 1991-04-08 | Ciba Geigy Spa | Composti piperidin triazinici atti all'impiego come stabilizzanti per materiali organici. |
| IT1226857B (it) * | 1988-09-23 | 1991-02-19 | Ciba Geigy Spa | Composti piperidin triazinici atti all'impiego come stabilizzanti per materiali organici. |
| US4981964A (en) * | 1988-12-15 | 1991-01-01 | Ici Americas Inc. | Oligomeric polyesters and polyamides containing dipiperidyl triazine groups |
| IT1227953B (it) * | 1988-12-23 | 1991-05-14 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| DE69008406T2 (de) * | 1989-03-21 | 1994-08-25 | Ciba Geigy Ag | N-Hydroxycarbyloxy-Derivate von s-Triazinen mit gehinderter Aminogruppe. |
| EP0389428A3 (en) * | 1989-03-21 | 1991-10-09 | Ciba-Geigy Ag | N,n-bis(l-hydroxycarbyloxy-2,2,6,6-tetramethyl-piperidin-4-yl) amino triazines and stabilized compositions |
| US5118736A (en) * | 1989-03-21 | 1992-06-02 | Ciba-Geigy Corporation | N,N-bis(1-hydrocarbyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino triazines and stabilized compositions |
| US5194466A (en) * | 1989-04-27 | 1993-03-16 | Ciba-Geigy Corporation | Piperidine-triazine compounds for use as stabilizers for organic materials |
| IT1230091B (it) * | 1989-04-27 | 1991-10-05 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici. |
| IT1230086B (it) * | 1989-05-25 | 1991-10-05 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici. |
| DE3927623A1 (de) * | 1989-08-22 | 1991-02-28 | Hoechst Ag | N,n'-bis-1,3,5-triazin-6-yl-piperazine und verfahren zu ihrer herstellung |
| US5223560A (en) * | 1989-08-28 | 1993-06-29 | Ministero Dell'universita' E Della Ricerca Scientifica E Tecnologica | Self-extinguishing polymeric compositions |
| IT1237129B (it) * | 1989-11-10 | 1993-05-18 | Valerio Borzatta | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici. |
| IT1237541B (it) * | 1989-12-28 | 1993-06-08 | Ciba Geigy | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| IT1240690B (it) * | 1990-04-30 | 1993-12-17 | Ciba Geigy Ag | Composti piperdin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| IT1248698B (it) * | 1990-06-06 | 1995-01-26 | Ciba Geigy Spa | Composti piepridin-triazinici contenenti gruppi silossanici,atti all'impiego come stabilizzanti per materiali organici |
| IT1246170B (it) * | 1990-07-24 | 1994-11-16 | Ciba Geigy Spa | Composizione stabilizzante per polipropilene comprendente composti triazinici contenenti gruppi piperidinici e composti metallici |
| IT1243374B (it) * | 1990-07-27 | 1994-06-10 | Ciba Geigy Spa | Composti piperidin-triazinici contenenti gruppi tetraidrofuranici o tetraidropiranici atti all'impiego come stabilizzanti per materiali organici |
| IT1251467B (it) * | 1991-07-12 | 1995-05-15 | Ciba Geigy Spa | Nuovi composti tetrametilpiperidinici atti all'impiego come stabilizzanti per materiali organici. |
| IT1252227B (it) * | 1991-12-17 | 1995-06-05 | Ciba Geigy Spa | Composti tetrametilpiperidinici atti all'impiego come stabilizzanti per materiali organici |
| IT1256636B (it) * | 1992-12-10 | 1995-12-12 | Ciba Geigy Spa | Processo per la preparazione di 2,2,6,6-tetrametil-4- piperidilossi-1,3,5-triazine contenenti due o piu' anelli triazinici |
| IT1263993B (it) * | 1993-04-05 | 1996-09-06 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| GB2279649B (en) * | 1993-07-08 | 1997-07-16 | Ciba Geigy Ag | Phenolic s-triazines |
| IT1264945B1 (it) * | 1993-07-16 | 1996-10-17 | Ciba Geigy Spa | Composti piperidinici atti all'impiego come stabilizzanti per materiali organici |
| IT1271711B (it) * | 1994-11-09 | 1997-06-04 | Ciba Geigy Spa | Derivati della 2,2,6,6-tetrametilpiperidina utili come stabilizzanti alla luce, al calore e all'ossidazione per materiali organici |
| TW358820B (en) | 1995-04-11 | 1999-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| US5603885A (en) * | 1995-07-06 | 1997-02-18 | E. I. Du Pont De Nemours And Company | Process for the preparation of nonwoven fibrous sheets |
| IT1275584B1 (it) * | 1995-07-21 | 1997-08-06 | 3V Sigma Spa | Composizioni per la stabilizzazione di polimeri sintetici |
| TW390897B (en) * | 1995-07-21 | 2000-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| US6046304A (en) | 1995-12-04 | 2000-04-04 | Ciba Specialty Chemicals Corporation | Block oligomers containing 2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials |
| ES2128978B1 (es) * | 1996-04-01 | 2000-03-01 | Ciba Sc Holding Ag | Derivados de politriazina que contienen grupos de polialquilpiperidiniloxilo o polialquilpiperidinilamino. |
| EP0835873A1 (en) * | 1996-10-14 | 1998-04-15 | Ciba Speciality Chemicals Holding Inc. | Mixtures of trisubstituted and tetrasubstituted polyalkylpiperidinylaminotriazine tetraamine compounds |
| DE69719004T2 (de) | 1996-12-24 | 2003-07-24 | Ciba Speciality Chemicals Holding Inc., Basel | Triazinverbindungen die 2,2,6,6-Tetramethyl-4-piperidingruppen enthalten als Stabilisatoren für organische Materialen |
| KR100786241B1 (ko) * | 2000-05-31 | 2007-12-17 | 시바 스폐셜티 케미칼스 홀딩 인코포레이티드 | 안정화제 혼합물 |
| ITMI20012085A1 (it) | 2000-10-17 | 2003-04-09 | Ciba Sc Holding Ag | Polpropilene metallocene stabilizzato |
| US20030225191A1 (en) | 2002-04-12 | 2003-12-04 | Francois Gugumus | Stabilizer mixtures |
| US20030236325A1 (en) * | 2002-05-30 | 2003-12-25 | Michela Bonora | Agricultural articles |
| EP1507824B1 (en) * | 2002-05-30 | 2008-03-12 | Ciba SC Holding AG | Stabilized articles |
| BRPI0416843A8 (pt) * | 2003-11-24 | 2019-01-02 | Prometic Biosciences Inc | dímeros de triazina, composição compreendendo os mesmos, seus usos e processos de remoção e purificação de anticorpos |
| EP2511274A3 (en) | 2005-01-21 | 2013-01-02 | Basf Se | Polyamine derivative |
| US20100074083A1 (en) | 2006-10-17 | 2010-03-25 | Mitsui Chemicals, Inc. | Resin composition and molded product obtained by molding the resin composition |
| ITMI20080747A1 (it) | 2008-04-24 | 2009-10-25 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| KR20120104164A (ko) | 2009-08-18 | 2012-09-20 | 바스프 에스이 | Uv-안정화된 광전 모듈 |
| IT1399477B1 (it) | 2010-03-15 | 2013-04-19 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| ITMI20110802A1 (it) | 2011-05-10 | 2012-11-11 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| SG11201601045WA (en) * | 2013-10-17 | 2016-05-30 | Basf Se | Triazine, piperidine and pyrrolidine based hindered amine light stabilizers |
| SA116370295B1 (ar) | 2015-02-20 | 2016-12-06 | باسف اس اى | رقائق، وأشرطة وفتائل أحادية من البولي أوليفين مثبتة للضوء |
| BR112018001603B1 (pt) | 2015-07-27 | 2022-10-11 | Basf Se | Mistura de aditivo, composição, película multicamada, uso de uma mistura de aditivo, e, método para estabilizar uma película de polímero |
| IT201700073726A1 (it) | 2017-06-30 | 2018-12-30 | 3V Sigma Spa | Ammine impedite polimeriche |
| IT201700078234A1 (it) | 2017-07-11 | 2019-01-11 | 3V Sigma Spa | Ammine impedite |
| IL286101B2 (en) * | 2019-03-08 | 2025-10-01 | Basf Se | Spatially disordered amine stabilizer mixtures |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3156690A (en) * | 1960-04-12 | 1964-11-10 | Geigy Chem Corp | 6 (nu-acyl-alkylhydroxyanilino)-2, 4-bis-(alkylthio)-1, 3, 5-triazines |
| BE651967A (Direct) * | 1963-01-11 | |||
| US3883523A (en) * | 1970-05-15 | 1975-05-13 | Ici Ltd | Triazine derivatives of triphenodioxazines |
| US3850918A (en) * | 1970-06-17 | 1974-11-26 | Ciba Geigy Corp | 2-amino-4,6-disalicyloyl-hydrazino-s-triazines |
| BE754242A (fr) * | 1970-07-15 | 1971-02-01 | Geigy Ag J R | Diamino-s-triazines et dinitro-s-triazines |
| US3928344A (en) * | 1971-12-27 | 1975-12-23 | Degussa | Phenylenediamine-s-triazines |
| US3988292A (en) * | 1972-02-24 | 1976-10-26 | Teijin Limited | Gas-fade inhibitor and anti-gas-fade polymer composition |
| GB1393551A (en) | 1972-04-21 | 1975-05-07 | Ciba Geigy Ag | Piperidine derivatives |
| US4042562A (en) * | 1972-11-15 | 1977-08-16 | Sandoz Ltd. | Nitrogen-containing aromatic heterocyclic compounds as anti-oxidants |
| JPS5082082A (Direct) * | 1973-11-14 | 1975-07-03 | ||
| CH582231A5 (Direct) * | 1973-12-10 | 1976-11-30 | Sandoz Ag |
-
1975
- 1975-12-18 IT IT52769/75A patent/IT1060458B/it active
-
1976
- 1976-06-21 DK DK277676A patent/DK167017B1/da not_active IP Right Cessation
- 1976-06-23 US US05/699,163 patent/US4108829A/en not_active Expired - Lifetime
- 1976-06-23 IE IE1369/76A patent/IE43247B1/en unknown
- 1976-06-24 CA CA255,635A patent/CA1088058A/en not_active Expired
- 1976-06-29 GB GB27110/76A patent/GB1511773A/en not_active Expired
- 1976-07-22 JP JP51086680A patent/JPS5273886A/ja active Granted
- 1976-08-11 DE DE2636130A patent/DE2636130C3/de not_active Expired
- 1976-08-27 FR FR7626014A patent/FR2335509A1/fr active Granted
- 1976-09-27 LU LU75880A patent/LU75880A1/xx unknown
- 1976-09-27 NL NL7610695.A patent/NL166940C/xx not_active IP Right Cessation
- 1976-10-07 BE BE171311A patent/BE847034A/xx not_active IP Right Cessation
- 1976-12-03 AU AU20229/76A patent/AU504440B2/en not_active Expired
- 1976-12-13 CH CH1565876A patent/CH632523A5/de not_active IP Right Cessation
- 1976-12-14 ZA ZA767425A patent/ZA767425B/xx unknown
- 1976-12-16 AT AT931176A patent/AT351269B/de not_active IP Right Cessation
- 1976-12-17 ES ES454370A patent/ES454370A1/es not_active Expired
-
1978
- 1978-04-28 US US05/901,242 patent/US4263434A/en not_active Expired - Lifetime
-
1979
- 1979-04-04 HK HK239/79A patent/HK23979A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1060458B (it) | 1982-08-20 |
| NL7610695A (nl) | 1977-06-21 |
| ZA767425B (en) | 1977-12-28 |
| ATA931176A (de) | 1978-12-15 |
| LU75880A1 (Direct) | 1977-05-06 |
| US4263434A (en) | 1981-04-21 |
| CH632523A5 (de) | 1982-10-15 |
| NL166940C (nl) | 1981-10-15 |
| IE43247B1 (en) | 1981-01-14 |
| AT351269B (de) | 1979-07-10 |
| ES454370A1 (es) | 1978-10-01 |
| DK167017B1 (da) | 1993-08-16 |
| JPS5738589B2 (Direct) | 1982-08-16 |
| FR2335509B1 (Direct) | 1978-06-30 |
| HK23979A (en) | 1979-04-12 |
| GB1511773A (en) | 1978-05-24 |
| DE2636130B2 (de) | 1979-07-19 |
| US4108829A (en) | 1978-08-22 |
| CA1088058A (en) | 1980-10-21 |
| NL166940B (nl) | 1981-05-15 |
| DE2636130A1 (de) | 1977-06-30 |
| BE847034A (fr) | 1977-01-31 |
| DK277676A (da) | 1977-06-19 |
| JPS5273886A (en) | 1977-06-21 |
| IE43247L (en) | 1977-06-18 |
| FR2335509A1 (fr) | 1977-07-15 |
| AU2022976A (en) | 1978-06-08 |
| AU504440B2 (en) | 1979-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2636130C3 (de) | Mindestens einen 2,2,6,6-Tetramethylpiperidylrest enthaltende 133-Triazinylverbindungen, Verfahren zu ihrer Herstellung und Mittel zur Stabilisierung von Polymerisaten | |
| DE2636144C3 (de) | Polytriazinverbindungen | |
| DE2760429C2 (Direct) | ||
| DE2319816C2 (de) | Piperidin-Derivate, Verfahren zu deren Herstellung und deren Verwendung | |
| DE69921806T3 (de) | Methoden und zusammensetzungen zum schutz von polymeren vor uv-licht | |
| EP0045721B1 (de) | Piperidylderivate von Triazincopolymeren, Verfahren zu deren Herstellung und solche Derivate enthaltende stabilisierte Zusammensetzung | |
| DE2040975C3 (de) | Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere | |
| EP0014683B1 (de) | Neue Polyalkylpiperidinderivate von s-Triazinen, deren Verwendung als Stabilisatoren für Polymere und mit diesen Verbindungen stabilisierte Polymerzusammensetzungen | |
| DE2621870A1 (de) | Neue derivate von 4-aminopiperidin | |
| EP0101411B1 (de) | Verfahren zur chemischen Bindung von Stabilisatoren an Polymere | |
| EP0002005B1 (de) | Verfahren zur Endgruppenblockierung polymerer Polyalkylpiperidinderivate, die so erhaltenen endgruppenblockierten Produkte und ihre Verwendung als Lichtschutzmittel für Kunststoffe | |
| EP0002754A1 (de) | Neue Polyalkylpiperidinderivate von s-Triazinen, ihre Verwendung zum Stabilisieren von Kunststoffen und die so stabilisierten Kunststoffe | |
| DE2636143C2 (de) | Polyharnstoffgemische, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3304266C2 (Direct) | ||
| EP0001840A2 (de) | Stabilisatorgemische, Verfahren zum Stabilisieren von Kunststoffen gegen Licht mit diesen Gemischen und so stabilisierte Kunststoffe | |
| DE3236070A1 (de) | Piperidylderivate makrocyclischer triazinverbindungen mit stabilisierender wirkung auf polymere sowie verfahren zu deren herstellung | |
| EP0031304A1 (de) | Piperidinderivate als Stabilisatoren für synthetische Polymere | |
| EP0053775A2 (de) | Poly-bis-triazinylamine, Verfahren zu ihrer Herstellung, ihre Verwendung zum Stabilisieren von synthetischen Polymeren und die so stabilisierten Polymeren | |
| DE3027223A1 (de) | Triazinylaminotriazine, ihre herstellung und verwendung | |
| DE2752740A1 (de) | Stabilisatorverbindungen, verfahren zu deren herstellung und diese enthaltende mittel | |
| DE2621841A1 (de) | Lichtschutzmittel fuer polymere | |
| DE68920845T2 (de) | Verbindungen auf Triazinbasis, als Lichtstabilisatoren für Kunststoffe. | |
| EP0061659B1 (de) | Piperidingruppenhaltige Ester, Verfahren zu ihrer Herstellung, ihre Verwendung als Stabilisatoren für Polymere sowie diese Verbindungen enthaltende Polymere | |
| DE69608039T2 (de) | Zusammensetzungen für die Stabilisation synthetischer Polymere | |
| DE2651511A1 (de) | Synthetische polymeren-stabilisatoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: CIBA-GEIGY S.P.A., ORIGGIO, IT |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: KINZEBACH, W., DIPL.-CHEM. DR.PHIL. RIEDL, P., DIPL.-CHEM.DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8327 | Change in the person/name/address of the patent owner |
Owner name: CIBA-GEIGY AG, BASEL, CH |
|
| 8339 | Ceased/non-payment of the annual fee |