DE2631166C2 - Verfahren zur Herstellung von Oxazinfarbstoffen - Google Patents
Verfahren zur Herstellung von OxazinfarbstoffenInfo
- Publication number
- DE2631166C2 DE2631166C2 DE2631166A DE2631166A DE2631166C2 DE 2631166 C2 DE2631166 C2 DE 2631166C2 DE 2631166 A DE2631166 A DE 2631166A DE 2631166 A DE2631166 A DE 2631166A DE 2631166 C2 DE2631166 C2 DE 2631166C2
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- alkyl
- alkenyl
- alkoxy
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 5
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 title description 4
- 239000001257 hydrogen Substances 0.000 claims description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims description 39
- 150000002431 hydrogen Chemical class 0.000 claims description 27
- -1 aromatic radical Chemical class 0.000 claims description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 150000001450 anions Chemical class 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- CWLKGDAVCFYWJK-UHFFFAOYSA-N m-Aminophenol Natural products NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical class [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 238000005580 one pot reaction Methods 0.000 claims description 5
- 229940018563 3-aminophenol Drugs 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 claims description 2
- 230000009935 nitrosation Effects 0.000 claims description 2
- 238000007034 nitrosation reaction Methods 0.000 claims description 2
- 150000002989 phenols Chemical class 0.000 claims 2
- 150000002118 epoxides Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- 150000002832 nitroso derivatives Chemical class 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 239000000460 chlorine Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000003396 thiol group Chemical class [H]S* 0.000 description 2
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical group O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- WAVOOWVINKGEHS-UHFFFAOYSA-N 3-(diethylamino)phenol Chemical compound CCN(CC)C1=CC=CC(O)=C1 WAVOOWVINKGEHS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical group CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical group [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000006231 alkoxy propyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000004988 m-phenylenediamines Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- SBOJXQVPLKSXOG-UHFFFAOYSA-N o-amino-hydroxylamine Chemical class NON SBOJXQVPLKSXOG-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- PVEFEIWVJKUCLJ-UHFFFAOYSA-N sulfuric acid;toluene Chemical group OS(O)(=O)=O.CC1=CC=CC=C1 PVEFEIWVJKUCLJ-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B19/00—Oxazine dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Coloring (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762660747 DE2660747C2 (de) | 1976-07-10 | 1976-07-10 | Aminophenolether und deren Herstellung |
| DE2631166A DE2631166C2 (de) | 1976-07-10 | 1976-07-10 | Verfahren zur Herstellung von Oxazinfarbstoffen |
| MX169411A MX147241A (es) | 1976-07-10 | 1977-06-10 | Procedimiento para la obtencion de colorantes oxazinicos basisicos |
| GB27880/77A GB1570109A (en) | 1976-07-10 | 1977-07-04 | Process for the preparation of oxazine dyestuffs |
| CH828177A CH630944A5 (de) | 1976-07-10 | 1977-07-05 | Verfahren zur herstellung basischer oxazinfarbstoffe. |
| US05/813,316 US4125717A (en) | 1976-07-10 | 1977-07-06 | Process for the preparation of oxazine dyestuffs |
| BE179181A BE856615A (fr) | 1976-07-10 | 1977-07-08 | Procede de production de colorants oxazeniques |
| JP52081108A JPS6026154B2 (ja) | 1976-07-10 | 1977-07-08 | 塩基性オキサジン染料の製造法 |
| ES460561A ES460561A1 (es) | 1976-07-10 | 1977-07-08 | Procedimiento para la obtencion de colorantes oxazinicos ba-sicos. |
| FR7721137A FR2357603A1 (fr) | 1976-07-10 | 1977-07-08 | Procede de production de colorants oxazeniques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2631166A DE2631166C2 (de) | 1976-07-10 | 1976-07-10 | Verfahren zur Herstellung von Oxazinfarbstoffen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2631166A1 DE2631166A1 (de) | 1978-01-19 |
| DE2631166C2 true DE2631166C2 (de) | 1983-05-26 |
Family
ID=5982713
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2631166A Expired DE2631166C2 (de) | 1976-07-10 | 1976-07-10 | Verfahren zur Herstellung von Oxazinfarbstoffen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4125717A (enExample) |
| JP (1) | JPS6026154B2 (enExample) |
| BE (1) | BE856615A (enExample) |
| CH (1) | CH630944A5 (enExample) |
| DE (1) | DE2631166C2 (enExample) |
| ES (1) | ES460561A1 (enExample) |
| FR (1) | FR2357603A1 (enExample) |
| GB (1) | GB1570109A (enExample) |
| MX (1) | MX147241A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005451A3 (de) * | 1978-04-21 | 1979-12-12 | Ciba-Geigy Ag | Verfahren zur Herstellung von kationischen Oxazinverbindungen, die Oxazinverbindungen sowie deren Verwendung zum Färben und Bedrucken von Textilmaterialien |
| CH638548A5 (de) * | 1978-07-21 | 1983-09-30 | Ciba Geigy Ag | Kationische oxazinfarbstoffe. |
| DE3033439A1 (de) * | 1980-09-05 | 1982-04-22 | Basf Ag, 6700 Ludwigshafen | Basische farbstoffe der oxazinreihe |
| JPS6313550Y2 (enExample) * | 1980-09-26 | 1988-04-18 | ||
| US5409507A (en) * | 1993-10-28 | 1995-04-25 | Chevron Chemical Company | Fuel compositions containing poly(oxyalkylene) aromatic ethers |
| US5631371A (en) * | 1995-11-22 | 1997-05-20 | Bayer Corporation | Method for the preparation of substituted 3-(phenylimino)-3H-phenothiazines and phenoxazines |
| RU2524660C2 (ru) | 2007-12-10 | 2014-07-27 | БАЙЕР ХЕЛТКЭА ЭлЭлСи | Способ получения медиатора 3-фенилимино-3н-фенотиазина или 3-фенилимино-3н-феноксазина |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE300253C (enExample) * | ||||
| FR799142A (fr) | 1935-03-05 | 1936-06-06 | Cie Nat Matieres Colorantes | Procédé de fabrication de colorants pour esters de cellulose, et produits en résultant |
| DE1569603C3 (de) * | 1966-08-04 | 1974-03-14 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Verfahren zur Herstellung von Oxazinfarbstoffen |
| FR2036034A5 (en) * | 1969-03-03 | 1970-12-24 | Hoechst Ag | Basic oxazine dyestuffs |
| DE1569604A1 (de) * | 1966-09-02 | 1970-08-13 | Hoechst Ag | Verfahren zur Herstellung von basischen Oxazinfarbstoffen |
| FR2036035A5 (en) * | 1969-03-03 | 1970-12-24 | Hoechst Ag | Basic oxazinic dyestuffs prepn |
| DE2030028B2 (de) * | 1970-06-18 | 1975-02-20 | Farbwerke Hoechst Ag Vormals Meister Lucius & Bruening, 6000 Frankfurt | Basische Oxazinfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| NL153588B (nl) * | 1970-12-31 | 1977-06-15 | Hoechst Ag | Werkwijze voor het bereiden van basische oxazinekleurstoffen. |
| NL7200948A (enExample) * | 1971-02-03 | 1972-08-07 | ||
| BE795072A (fr) * | 1972-02-11 | 1973-08-07 | Basf Ag | Procede de preparation de colorants oxaziniques |
| DE2353987C3 (de) * | 1973-10-27 | 1978-08-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur Isolierung leichtlöslicher basischer Oxazin- und Phenazinfarbstoffe |
| DE2458347A1 (de) * | 1974-12-10 | 1976-06-16 | Hoechst Ag | Verfahren zur herstellung von basischen oxazinfarbstoffen |
-
1976
- 1976-07-10 DE DE2631166A patent/DE2631166C2/de not_active Expired
-
1977
- 1977-06-10 MX MX169411A patent/MX147241A/es unknown
- 1977-07-04 GB GB27880/77A patent/GB1570109A/en not_active Expired
- 1977-07-05 CH CH828177A patent/CH630944A5/de not_active IP Right Cessation
- 1977-07-06 US US05/813,316 patent/US4125717A/en not_active Expired - Lifetime
- 1977-07-08 ES ES460561A patent/ES460561A1/es not_active Expired
- 1977-07-08 BE BE179181A patent/BE856615A/xx not_active IP Right Cessation
- 1977-07-08 JP JP52081108A patent/JPS6026154B2/ja not_active Expired
- 1977-07-08 FR FR7721137A patent/FR2357603A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS538627A (en) | 1978-01-26 |
| MX147241A (es) | 1982-10-28 |
| BE856615A (fr) | 1978-01-09 |
| ES460561A1 (es) | 1978-06-16 |
| US4125717A (en) | 1978-11-14 |
| GB1570109A (en) | 1980-06-25 |
| DE2631166A1 (de) | 1978-01-19 |
| JPS6026154B2 (ja) | 1985-06-21 |
| FR2357603B1 (enExample) | 1981-02-13 |
| FR2357603A1 (fr) | 1978-02-03 |
| CH630944A5 (de) | 1982-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1207531B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE2631166C2 (de) | Verfahren zur Herstellung von Oxazinfarbstoffen | |
| DE2353987C3 (de) | Verfahren zur Isolierung leichtlöslicher basischer Oxazin- und Phenazinfarbstoffe | |
| DE2518587C2 (de) | Verfahren zur Herstellung basischer Oxazinfarbstoffe | |
| DE2741386C3 (de) | Verfahren zur Isomerisierung von cis,cis- und cis, trans-Isomeren des Di-(p-aminocyclohexyl)-methans und dabei als Zwischenprodukte gebildete Bis-benzaldimine | |
| DE1569603C3 (de) | Verfahren zur Herstellung von Oxazinfarbstoffen | |
| DE2514759B2 (de) | Verfahren zur Herstellung von 233-TrimethyIindolenin | |
| DE2458347A1 (de) | Verfahren zur herstellung von basischen oxazinfarbstoffen | |
| DE1643384A1 (de) | Algizide Mittel | |
| DE1263743B (de) | Verfahren zur Herstellung von substituierten Acetamiden | |
| DE1912941B2 (de) | 1 -PhenyM-amino-e-methoxypridaziniumsalze | |
| DE2614886C2 (de) | Verfahren zur Herstellung von kationischen Naphtholactam-Farbstoffen | |
| DE2318106C3 (de) | Verfahren zur Herstellung von Dichlorbenzoesäuren | |
| DE2660747C2 (de) | Aminophenolether und deren Herstellung | |
| DE2061760B2 (de) | Konzentrierte wäßrige Lösungen metallfreier anionischer Farbstoffe | |
| DE69917163T2 (de) | Verfahren zur herstellung von l-valinbenzylester-p-toluolsufonaten | |
| DE2104682C3 (de) | Verfahren zur Herstellung von o-Sulfamidobenzoesäuren | |
| DE2413189C2 (de) | Verfahren zur Herstellung von Benzohydrochinonen | |
| DE855121C (de) | Verfahren zur Herstellung von Azomethinen und Komplexsalzen derselben | |
| DE2906132A1 (de) | Verfahren zur herstellung kationischer anthrachinon-farbstoffe | |
| DE2034081C3 (de) | Verfahren zur Herstellung von 23A 6-Tetrahydroimidazo [2,1 -b] thiazolen | |
| DE3115548A1 (de) | Verfahren zur herstellung von 1-alkylaminoanthrachinonen | |
| DE1670580C3 (de) | Verfahren zur Herstellung von sekundären Aminen, die einen Arylalkyl- beziehungsweise Xanthinoalkylrest enthalten | |
| CH627769A5 (de) | Verfahren zur herstellung von symmetrischen 4-halogen-4',4''-diarylamino-triphenylmethanverbindungen. | |
| DE1906851A1 (de) | Verfahren zur Herstellung von Sulfatobetainen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2660747 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2660747 |
|
| 8181 | Inventor (new situation) |
Free format text: PSAAR, HUBERTUS, DR., 5090 LEVERKUSEN, DE |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 2660747 Format of ref document f/p: P |
|
| 8339 | Ceased/non-payment of the annual fee |