DE2549889C2 - 3,4-Dihydrocarbostyril-Derivate, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten - Google Patents
3,4-Dihydrocarbostyril-Derivate, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthaltenInfo
- Publication number
- DE2549889C2 DE2549889C2 DE2549889A DE2549889A DE2549889C2 DE 2549889 C2 DE2549889 C2 DE 2549889C2 DE 2549889 A DE2549889 A DE 2549889A DE 2549889 A DE2549889 A DE 2549889A DE 2549889 C2 DE2549889 C2 DE 2549889C2
- Authority
- DE
- Germany
- Prior art keywords
- hydroxy
- dihydrocarbostyril
- propoxy
- chch
- och
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 11
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical class C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000003814 drug Substances 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 19
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 17
- 101150065749 Churc1 gene Proteins 0.000 claims description 17
- 102100038239 Protein Churchill Human genes 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 13
- 239000013078 crystal Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 238000000921 elemental analysis Methods 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000003973 alkyl amines Chemical class 0.000 description 6
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 230000036772 blood pressure Effects 0.000 description 5
- 230000001077 hypotensive effect Effects 0.000 description 5
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 4
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 239000012295 chemical reaction liquid Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 229940039009 isoproterenol Drugs 0.000 description 4
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 4
- 229960002275 pentobarbital sodium Drugs 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000003042 antagnostic effect Effects 0.000 description 3
- 230000004872 arterial blood pressure Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000001105 femoral artery Anatomy 0.000 description 2
- 210000003191 femoral vein Anatomy 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- KBQJDQNCORENFW-UHFFFAOYSA-N 3,4-dihydro-1h-quinoline-2,5,8-trione Chemical compound O=C1C=CC(=O)C2=C1NC(=O)CC2 KBQJDQNCORENFW-UHFFFAOYSA-N 0.000 description 1
- UHLHIYJDIQPKOU-UHFFFAOYSA-N 5,8-Dihydroxy-3,4-dihydrocarbostyril Chemical compound N1C(=O)CCC2=C1C(O)=CC=C2O UHLHIYJDIQPKOU-UHFFFAOYSA-N 0.000 description 1
- UDKMDIKMJWOSJP-UHFFFAOYSA-N 8-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C=CC=C2O UDKMDIKMJWOSJP-UHFFFAOYSA-N 0.000 description 1
- KQNIURHFAFFXRT-BTJKTKAUSA-N C(\C=C/C(=O)O)(=O)O.C(CC)OC1C(NC2=C(C=CC=C2C1)O)=O Chemical compound C(\C=C/C(=O)O)(=O)O.C(CC)OC1C(NC2=C(C=CC=C2C1)O)=O KQNIURHFAFFXRT-BTJKTKAUSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- ZFGMDIBRIDKWMY-PASTXAENSA-N heparin Chemical compound CC(O)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(O)(=O)=O)O[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](O[C@H]2[C@@H]([C@@H](OS(O)(=O)=O)[C@@H](O[C@@H]3[C@@H](OC(O)[C@H](OS(O)(=O)=O)[C@H]3O)C(O)=O)O[C@@H]2O)CS(O)(=O)=O)[C@H](O)[C@H]1O ZFGMDIBRIDKWMY-PASTXAENSA-N 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 229960001008 heparin sodium Drugs 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49129387A JPS5156462A (en) | 1974-11-08 | 1974-11-08 | 55 * 33 arukiruamino 22 hidorokishi * purohokishi 88 hidorokishi 3*44 jihidorokarubosuchiriruno seizoho |
| JP49129386A JPS5156461A (en) | 1974-11-08 | 1974-11-08 | *33 arukiruamino 22 hidorokishi * purohokishi 3*44 jihidorokarubosuchirirujudotaino seizoho |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2549889A1 DE2549889A1 (de) | 1976-05-20 |
| DE2549889C2 true DE2549889C2 (de) | 1985-06-05 |
Family
ID=26464802
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2549889A Expired DE2549889C2 (de) | 1974-11-08 | 1975-11-06 | 3,4-Dihydrocarbostyril-Derivate, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4072683A (enExample) |
| AR (1) | AR215578A1 (enExample) |
| AT (1) | AT349020B (enExample) |
| CH (2) | CH618430A5 (enExample) |
| DE (1) | DE2549889C2 (enExample) |
| DK (1) | DK144697C (enExample) |
| ES (1) | ES442455A1 (enExample) |
| FI (1) | FI58329C (enExample) |
| FR (2) | FR2290207A1 (enExample) |
| GB (2) | GB1505899A (enExample) |
| NL (1) | NL181107C (enExample) |
| NO (1) | NO145238C (enExample) |
| SE (1) | SE428015B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH619453A5 (enExample) * | 1976-03-17 | 1980-09-30 | Otsuka Pharma Co Ltd | |
| US4210753A (en) * | 1976-03-17 | 1980-07-01 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril compounds |
| JPS609713B2 (ja) * | 1976-10-08 | 1985-03-12 | 大塚製薬株式会社 | カルボスチリル誘導体 |
| US4314943A (en) * | 1977-07-13 | 1982-02-09 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| JPS5535019A (en) * | 1978-09-01 | 1980-03-11 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| US4495352A (en) * | 1979-02-13 | 1985-01-22 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| DE2909035A1 (de) * | 1979-03-08 | 1980-09-18 | Hoechst Ag | 8-oxo-5,6,7,8-tetrahydro-2-chinolon und verfahren zu dessen herstellung |
| US4322425A (en) * | 1980-03-14 | 1982-03-30 | Otsuka Pharmaceutical Co., Ltd. | Compositions for treating glaucoma |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1058822A (en) * | 1963-07-30 | 1967-02-15 | Ici Ltd | 3-amino-2-hydroxypropoxy heterocyclic derivatives |
| NL6400510A (enExample) * | 1964-01-23 | 1965-07-26 | ||
| JPS421182Y1 (enExample) * | 1964-01-24 | 1967-01-24 | ||
| US3910924A (en) * | 1972-04-13 | 1975-10-07 | Otsuka Pharma Co Ltd | 3,4-Dihydrocarbostyril derivatives and a process for preparing the same |
| JPS48103590A (enExample) * | 1972-04-13 | 1973-12-25 | ||
| AR207554A1 (es) * | 1972-12-02 | 1976-10-15 | Otsuka Pharma Co Ltd | Procedimiento para producir derivados de 3-alquil-5-((3,4-dihidro-5-carbostiril)oximetil)-oxazolidinona-(2) |
| JPS5239035B2 (enExample) * | 1972-12-14 | 1977-10-03 |
-
1975
- 1975-11-05 FI FI753097A patent/FI58329C/fi not_active IP Right Cessation
- 1975-11-06 DE DE2549889A patent/DE2549889C2/de not_active Expired
- 1975-11-07 NO NO753739A patent/NO145238C/no unknown
- 1975-11-07 DK DK502575A patent/DK144697C/da not_active IP Right Cessation
- 1975-11-07 NL NLAANVRAGE7513098,A patent/NL181107C/xx not_active IP Right Cessation
- 1975-11-07 SE SE7512498A patent/SE428015B/xx not_active IP Right Cessation
- 1975-11-07 FR FR7534056A patent/FR2290207A1/fr active Granted
- 1975-11-07 AR AR261112A patent/AR215578A1/es active
- 1975-11-07 AT AT850975A patent/AT349020B/de not_active IP Right Cessation
- 1975-11-07 GB GB46233/75A patent/GB1505899A/en not_active Expired
- 1975-11-07 CH CH1445975A patent/CH618430A5/de not_active IP Right Cessation
- 1975-11-07 GB GB36139/77A patent/GB1505900A/en not_active Expired
- 1975-11-07 ES ES442455A patent/ES442455A1/es not_active Expired
- 1975-11-10 US US05/630,631 patent/US4072683A/en not_active Expired - Lifetime
-
1976
- 1976-05-26 FR FR7615953A patent/FR2303801A1/fr active Granted
-
1980
- 1980-07-23 CH CH563880A patent/CH624673A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NO145238B (no) | 1981-11-02 |
| NO145238C (no) | 1982-02-10 |
| GB1505900A (en) | 1978-03-30 |
| AR215578A1 (es) | 1979-10-31 |
| NL181107C (nl) | 1987-06-16 |
| DK502575A (da) | 1976-05-09 |
| US4072683A (en) | 1978-02-07 |
| NL181107B (nl) | 1987-01-16 |
| FR2303801B1 (enExample) | 1978-05-19 |
| NO753739L (enExample) | 1976-05-11 |
| FR2290207B1 (enExample) | 1978-09-22 |
| CH624673A5 (enExample) | 1981-08-14 |
| FI753097A7 (enExample) | 1976-05-09 |
| FI58329B (fi) | 1980-09-30 |
| DK144697B (da) | 1982-05-17 |
| AU8647675A (en) | 1977-05-19 |
| DK144697C (da) | 1982-11-08 |
| ATA850975A (de) | 1978-08-15 |
| GB1505899A (en) | 1978-03-30 |
| NL7513098A (nl) | 1976-05-11 |
| FR2303801A1 (fr) | 1976-10-08 |
| DE2549889A1 (de) | 1976-05-20 |
| SE428015B (sv) | 1983-05-30 |
| AT349020B (de) | 1979-03-12 |
| SE7512498L (sv) | 1976-05-10 |
| ES442455A1 (es) | 1977-07-16 |
| CH618430A5 (enExample) | 1980-07-31 |
| FI58329C (fi) | 1981-01-12 |
| FR2290207A1 (fr) | 1976-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2658544C2 (de) | Carbostyrilderivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2513916C2 (de) | N-(2-Piperidylmethyl)-2,5-bis (2,2,2-trifluoräthoxy)-benzamid | |
| DE2165962C2 (de) | 4-Hydroxy-6-arylpyrimidine | |
| DE2527914A1 (de) | Vincaminverbindungen, verfahren zu deren herstellung sowie diese enthaltende pharmazeutische mittel | |
| DE1593579B1 (de) | Hydroxy-cyclohexylamine,deren physiologisch vertraeglichen Saeureadditionssalze und Verfahren zu ihrer Herstellung | |
| DE2549889C2 (de) | 3,4-Dihydrocarbostyril-Derivate, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten | |
| DE2635961A1 (de) | Therapeutisch wirksame verbindungen und verfahren zu ihrer herstellung | |
| DE2833505A1 (de) | Tetrahydro-isochinolin-derivate, verfahren zu deren herstellung und mittel enthaltend die derivate | |
| DE1470194C3 (de) | 1,3,3-trisubstituierte 4-0mega-(Aminoalkyl) -2-pyrrolidinone und-2-thiopyrrolidinone | |
| DD216926A5 (de) | Verfahren zur herstellung von neuen anhydro-aminopyridinium-hydroxid-derivaten | |
| CH642668A5 (de) | 2,6-diaminonebularine, verfahren zu deren herstellung und sie enthaltende pharmazeutische praeparate. | |
| CH643830A5 (de) | Bis-moranolin-derivate. | |
| DE1802297C3 (de) | Isopropylaminderivate und Verfahren zu ihrer Herstellung | |
| DE2503751C2 (de) | (L)-1-Phenoxy-3-isopropylamino-2-propanol und dessen Salze, Verfahren zur Herstellung und Verwendung | |
| DE2450161C3 (de) | N-ß-(3',4'-Dihydroxyphenäthyl)- glutamin und dessen Alkylester sowie deren pharmakologisch verträgliche Säureadditionssalze, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2062055C3 (de) | Propanolamin-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DD142547A5 (de) | Verfahren zur herstellung von als neuromuskulaere blockierungsmittel verwendbaren verbindungen | |
| DE2508251C2 (de) | Derivate des Indols, Verfahren zu deren Herstellung sowie diese enthaltende Arzneimittel | |
| DE2917997A1 (de) | Substituierte pyrrolidinyl-benzoesaeure- derivate und verfahren zu ihrer herstellung | |
| DE1593579C (enExample) | ||
| DE2048101A1 (de) | Indolin 2 on derivate und deren Herstellung | |
| DE2515548A1 (de) | Quaternaere ammoniumsalze von n-dialkylaminoalkyl-n-(2-indanyl)-anilinen und verfahren zu ihrer herstellung | |
| DE2701417A1 (de) | Pharmazeutische zubereitungen enthaltend sandwicin, isosandwicin oder neue derivate davon, diese neuen derivate und verfahren zu ihrer herstellung | |
| DE1543673C3 (de) | Basisch substituierte Benzofuranderivate und deren pharmazeutisch verträgliche Säureadditionssalze sowie Verfahren zu deren Herstellung und Arzneimittel mit einem Gehalt dieser Verbindungen | |
| CH638490A5 (de) | Anilide mit hustenhemmender wirkung und verfahren zur herstellung derselben. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |