DE2527160A1 - Zahnreinigungsmittel - Google Patents
ZahnreinigungsmittelInfo
- Publication number
- DE2527160A1 DE2527160A1 DE19752527160 DE2527160A DE2527160A1 DE 2527160 A1 DE2527160 A1 DE 2527160A1 DE 19752527160 DE19752527160 DE 19752527160 DE 2527160 A DE2527160 A DE 2527160A DE 2527160 A1 DE2527160 A1 DE 2527160A1
- Authority
- DE
- Germany
- Prior art keywords
- percent
- thickener
- weight
- sodium
- cellulose
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004140 cleaning Methods 0.000 title 1
- 239000002562 thickening agent Substances 0.000 claims description 19
- 239000000551 dentifrice Substances 0.000 claims description 13
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 12
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 claims description 12
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 12
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 10
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 10
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims description 10
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims description 10
- 239000012459 cleaning agent Substances 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 2
- 239000001913 cellulose Substances 0.000 claims description 2
- 239000000606 toothpaste Substances 0.000 description 7
- 229940034610 toothpaste Drugs 0.000 description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000015424 sodium Nutrition 0.000 description 3
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical compound OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000001461 cytolytic effect Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 229960004711 sodium monofluorophosphate Drugs 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- 150000005168 4-hydroxybenzoic acids Chemical class 0.000 description 1
- 108010059892 Cellulase Proteins 0.000 description 1
- DUSWSURQSVBDKY-UHFFFAOYSA-N ClF.[Sn+2] Chemical compound ClF.[Sn+2] DUSWSURQSVBDKY-UHFFFAOYSA-N 0.000 description 1
- UDIPTWFVPPPURJ-UHFFFAOYSA-M Cyclamate Chemical compound [Na+].[O-]S(=O)(=O)NC1CCCCC1 UDIPTWFVPPPURJ-UHFFFAOYSA-M 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- 240000006497 Dianthus caryophyllus Species 0.000 description 1
- 235000009355 Dianthus caryophyllus Nutrition 0.000 description 1
- 244000004281 Eucalyptus maculata Species 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 240000001238 Gaultheria procumbens Species 0.000 description 1
- 235000007297 Gaultheria procumbens Nutrition 0.000 description 1
- 244000178870 Lavandula angustifolia Species 0.000 description 1
- 235000010663 Lavandula angustifolia Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- SPAGIJMPHSUYSE-UHFFFAOYSA-N Magnesium peroxide Chemical compound [Mg+2].[O-][O-] SPAGIJMPHSUYSE-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000007265 Myrrhis odorata Nutrition 0.000 description 1
- DAOANAATJZWTSJ-UHFFFAOYSA-N N-Decanoylmorpholine Chemical compound CCCCCCCCCC(=O)N1CCOCC1 DAOANAATJZWTSJ-UHFFFAOYSA-N 0.000 description 1
- 240000004760 Pimpinella anisum Species 0.000 description 1
- 235000012550 Pimpinella anisum Nutrition 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 235000004789 Rosa xanthina Nutrition 0.000 description 1
- 241000109329 Rosa xanthina Species 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- QDHCSLPBAUIAHY-UHFFFAOYSA-L [Sn](F)F.[K] Chemical compound [Sn](F)F.[K] QDHCSLPBAUIAHY-UHFFFAOYSA-L 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- JUNWLZAGQLJVLR-UHFFFAOYSA-J calcium diphosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])(=O)OP([O-])([O-])=O JUNWLZAGQLJVLR-UHFFFAOYSA-J 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229940043256 calcium pyrophosphate Drugs 0.000 description 1
- 229920003064 carboxyethyl cellulose Polymers 0.000 description 1
- 229940106157 cellulase Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000000625 cyclamic acid and its Na and Ca salt Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 235000019821 dicalcium diphosphate Nutrition 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- UMGSFZGNYYDQSL-UHFFFAOYSA-H disodium;tin(4+);hexafluoride Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[Na+].[Na+].[Sn+4] UMGSFZGNYYDQSL-UHFFFAOYSA-H 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000007515 enzymatic degradation Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 229960004068 hexachlorophene Drugs 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000001102 lavandula vera Substances 0.000 description 1
- 235000018219 lavender Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 229960004995 magnesium peroxide Drugs 0.000 description 1
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 1
- 239000004137 magnesium phosphate Substances 0.000 description 1
- 229960002261 magnesium phosphate Drugs 0.000 description 1
- 229910000157 magnesium phosphate Inorganic materials 0.000 description 1
- 235000010994 magnesium phosphates Nutrition 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- 239000001683 mentha spicata herb oil Substances 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical class CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- -1 polyalcohols Chemical compound 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- WBHHMMIMDMUBKC-QJWNTBNXSA-M ricinoleate Chemical compound CCCCCC[C@@H](O)C\C=C/CCCCCCCC([O-])=O WBHHMMIMDMUBKC-QJWNTBNXSA-M 0.000 description 1
- 229940066675 ricinoleate Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 108700004121 sarkosyl Proteins 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229960001462 sodium cyclamate Drugs 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- KSAVQLQVUXSOCR-UHFFFAOYSA-M sodium lauroyl sarcosinate Chemical compound [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O KSAVQLQVUXSOCR-UHFFFAOYSA-M 0.000 description 1
- AQMNWCRSESPIJM-UHFFFAOYSA-M sodium metaphosphate Chemical compound [Na+].[O-]P(=O)=O AQMNWCRSESPIJM-UHFFFAOYSA-M 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 235000019721 spearmint oil Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 229940098465 tincture Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/72—Cosmetics or similar toiletry preparations characterised by the composition containing organic macromolecular compounds
- A61K8/73—Polysaccharides
- A61K8/731—Cellulose; Quaternized cellulose derivatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2800/00—Properties of cosmetic compositions or active ingredients thereof or formulation aids used therein and process related aspects
- A61K2800/40—Chemical, physico-chemical or functional or structural properties of particular ingredients
- A61K2800/59—Mixtures
- A61K2800/594—Mixtures of polymers
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2688674 | 1974-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2527160A1 true DE2527160A1 (de) | 1976-01-08 |
Family
ID=10250754
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752527160 Withdrawn DE2527160A1 (de) | 1974-06-18 | 1975-06-18 | Zahnreinigungsmittel |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4022881A (en:Method) |
| JP (1) | JPS5119142A (en:Method) |
| BE (1) | BE830375A (en:Method) |
| CA (1) | CA1028958A (en:Method) |
| DE (1) | DE2527160A1 (en:Method) |
| DK (1) | DK137036B (en:Method) |
| FR (1) | FR2275192A1 (en:Method) |
| IT (1) | IT1040636B (en:Method) |
| NL (1) | NL7507057A (en:Method) |
| SE (1) | SE413981B (en:Method) |
| ZA (1) | ZA753832B (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9586438B2 (en) | 2013-07-08 | 2017-03-07 | Bbs Gmbh | Cover for a wheel rim and wheel having such a cover |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4426373A (en) | 1982-09-14 | 1984-01-17 | Colgate-Palmolive Co. | Smooth dental cream |
| IN163274B (en:Method) * | 1982-09-14 | 1988-09-03 | Colgate Palmolive Co | |
| US4444747A (en) * | 1983-03-28 | 1984-04-24 | Colgate-Palmolive Company | Extrudable dental cream |
| US4425323A (en) | 1983-03-28 | 1984-01-10 | Colgate-Palmolive Company | Smooth dental cream |
| US4418057A (en) * | 1983-02-09 | 1983-11-29 | Scherer Laboratories, Inc. | Method of forming stable dental gel of stannous fluoride |
| AT388666B (de) * | 1983-03-28 | 1989-08-10 | Colgate Palmolive Co | Zahncreme |
| US4482536A (en) * | 1983-03-28 | 1984-11-13 | Colgate-Palmolive Company | Extrudable dental cream |
| AT388098B (de) * | 1983-03-28 | 1989-04-25 | Colgate Palmolive Co | Zahncreme |
| JPS6136213A (ja) * | 1984-07-27 | 1986-02-20 | Rooto Seiyaku Kk | 口腔用組成物 |
| JPS6185482A (ja) * | 1984-10-02 | 1986-05-01 | Daicel Chem Ind Ltd | 彫塑材用糊剤 |
| US5256402A (en) * | 1991-09-13 | 1993-10-26 | Colgate-Palmolive Company | Abrasive tooth whitening dentifrice of improved stability |
| US5192529A (en) * | 1992-06-02 | 1993-03-09 | Chesebrough-Pond's Usa Co., Division Of Conopco, Inc. | Low stringing toothpaste |
| US5496541C1 (en) * | 1993-01-19 | 2001-06-26 | Squigle Inc | Tasteful toothpaste and other dental products |
| US5601803A (en) * | 1995-05-26 | 1997-02-11 | Masters; James G. | Silica abrasive dentifrice of reduced stringless and improved flavor |
| US5871715A (en) * | 1997-02-28 | 1999-02-16 | Gillette Canada Inc. | Stannous fluoride gel with improved stand-up |
| DE602004008072T3 (de) * | 2003-06-23 | 2011-05-12 | Colgate-Palmolive Co. | Stabile zahnreinigungszusammensetzungen |
| US8287843B2 (en) * | 2003-06-23 | 2012-10-16 | Colgate-Palmolive Company | Antiplaque oral care compositions |
| GB2408933A (en) * | 2003-12-12 | 2005-06-15 | Reckitt Benckiser Healthcare | Antimicrobial composition |
| EP3178913A1 (en) * | 2015-12-10 | 2017-06-14 | The Procter and Gamble Company | Liquid laundry detergent composition |
| CN106697984A (zh) * | 2016-12-30 | 2017-05-24 | 冯幸国 | 分料装置 |
| CN106586592A (zh) * | 2016-12-30 | 2017-04-26 | 冯幸国 | 用于分料的装置 |
| CN106586511A (zh) * | 2016-12-30 | 2017-04-26 | 冯幸国 | 连续分料机构 |
| US10517804B2 (en) * | 2017-11-30 | 2019-12-31 | Colgate-Palmolive Company | Whitening compositions and methods for increasing stability of the same |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2618632A (en) * | 1949-04-05 | 1952-11-18 | Hercules Powder Co Ltd | Mixed cellulose ether and preparation thereof |
| BE544763A (en:Method) * | 1955-02-09 | |||
| US3014808A (en) * | 1958-02-21 | 1961-12-26 | Mo Och Domsjoe Ab | Cellulose derivative compositions |
| US3151027A (en) * | 1961-06-07 | 1964-09-29 | Procter & Gamble | Abrasive for dentifrice composition |
| US3251824A (en) * | 1961-08-22 | 1966-05-17 | Fmc Corp | Method of preparing stable aqueous dispersion-forming cellulosic aggregates |
| NL121193C (en:Method) * | 1962-01-26 | |||
| US3266996A (en) * | 1963-06-27 | 1966-08-16 | Indiana University Foundation | Oral compositions for caries prophylaxis containing stannous fluorozirconate |
| US3538230A (en) * | 1966-12-05 | 1970-11-03 | Lever Brothers Ltd | Oral compositions containing silica xerogels as cleaning and polishing agents |
| US3510553A (en) * | 1967-10-27 | 1970-05-05 | Kendall & Co | Dentifrices containing fluosilicates and silica |
| US3448100A (en) * | 1968-04-18 | 1969-06-03 | Dow Chemical Co | Manufacture of carboxymethyl hydroalkyl mixed cellulose ethers |
| US3804946A (en) * | 1972-01-03 | 1974-04-16 | Colgate Palmolive Co | Dentifrices containing crystalline silica |
| US3903252A (en) * | 1972-06-08 | 1975-09-02 | Lorvic Corp | Dental disclosing compositions and the method of making and using the same |
-
1975
- 1975-06-10 US US05/585,699 patent/US4022881A/en not_active Expired - Lifetime
- 1975-06-11 FR FR7518229A patent/FR2275192A1/fr not_active Withdrawn
- 1975-06-13 SE SE7506836A patent/SE413981B/xx unknown
- 1975-06-13 NL NL7507057A patent/NL7507057A/xx not_active Application Discontinuation
- 1975-06-16 CA CA229,402A patent/CA1028958A/en not_active Expired
- 1975-06-16 IT IT50067/75A patent/IT1040636B/it active
- 1975-06-16 ZA ZA00753832A patent/ZA753832B/xx unknown
- 1975-06-17 JP JP50074216A patent/JPS5119142A/ja active Pending
- 1975-06-17 DK DK272175AA patent/DK137036B/da unknown
- 1975-06-18 BE BE157449A patent/BE830375A/xx unknown
- 1975-06-18 DE DE19752527160 patent/DE2527160A1/de not_active Withdrawn
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9586438B2 (en) | 2013-07-08 | 2017-03-07 | Bbs Gmbh | Cover for a wheel rim and wheel having such a cover |
Also Published As
| Publication number | Publication date |
|---|---|
| BE830375A (fr) | 1975-12-18 |
| FR2275192A1 (fr) | 1976-01-16 |
| SE7506836L (sv) | 1975-12-19 |
| DK272175A (en:Method) | 1975-12-19 |
| JPS5119142A (en:Method) | 1976-02-16 |
| SE413981B (sv) | 1980-07-07 |
| DK137036C (en:Method) | 1978-06-19 |
| AU8204675A (en) | 1976-12-16 |
| DK137036B (da) | 1978-01-09 |
| CA1028958A (en) | 1978-04-04 |
| US4022881A (en) | 1977-05-10 |
| ZA753832B (en) | 1976-05-26 |
| NL7507057A (nl) | 1975-12-22 |
| IT1040636B (it) | 1979-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2527160A1 (de) | Zahnreinigungsmittel | |
| DE2352008C2 (de) | Zahnpasta | |
| EP0038867B1 (de) | Zahnpasta | |
| DE1617430C3 (de) | Schäumende lagerstabile Zahnpaste | |
| DE69201113T2 (de) | Aromastoffe enthaltende, orale Peroxid-Bicarbonat Zusammensetzung. | |
| EP0063222B1 (de) | Zahnpflegemittel | |
| DE2918134A1 (de) | Zahnpflegemittel | |
| DE2807006A1 (de) | Zahnpflegemittel | |
| CH649000A5 (de) | Zahnpflegemittel. | |
| DE69535286T2 (de) | Orale Formulierung zum verbesserten Bleichen von Zähnen | |
| DE2508412B2 (de) | Lagerbeständiges festes Bleichmittel | |
| EP0002690B1 (de) | Zahnpasta und Verwendung eines synthetischen Alkalialuminiumsilikats als antikorrosiver Zusatz darin | |
| DE2918133C2 (de) | Opake extrudierbare Zahnpasta | |
| DE2512293A1 (de) | Zahnreinigungsmittel | |
| DE1492027B2 (de) | Natriummonofluorphosphat enthaltende zahnpaste | |
| DE19522750A1 (de) | Flüssige Zahnreinigungsmittel | |
| CH649705A5 (de) | Zahnpflegemittel. | |
| CH653887A5 (de) | Aromahaltiges mundpflegemittel. | |
| DE2220662A1 (de) | Zahnpasten | |
| DE2918132C2 (en:Method) | ||
| DE425598C (de) | Verfahren zur Herstellung von lagerbestaendigen Alkalipercarbonaten | |
| DE659120C (de) | Mittel zur Herstellung von Dauerwellen | |
| DE2240352A1 (de) | Aromamischung fuer zahnpasten und mundwaesser | |
| DE2011003A1 (de) | Zahnpflegemittel | |
| DE1492033A1 (de) | Zahnpflegemittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |