DE2525092A1 - Neue copolyester sowie verfahren zu ihrer herstellung - Google Patents
Neue copolyester sowie verfahren zu ihrer herstellungInfo
- Publication number
- DE2525092A1 DE2525092A1 DE19752525092 DE2525092A DE2525092A1 DE 2525092 A1 DE2525092 A1 DE 2525092A1 DE 19752525092 DE19752525092 DE 19752525092 DE 2525092 A DE2525092 A DE 2525092A DE 2525092 A1 DE2525092 A1 DE 2525092A1
- Authority
- DE
- Germany
- Prior art keywords
- radicals
- residues
- aromatic
- radical
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 37
- 238000004519 manufacturing process Methods 0.000 title claims description 16
- 229920001634 Copolyester Polymers 0.000 claims description 106
- 229920000728 polyester Polymers 0.000 claims description 67
- 239000002253 acid Substances 0.000 claims description 25
- 229910052760 oxygen Inorganic materials 0.000 claims description 24
- 239000001301 oxygen Substances 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 150000002009 diols Chemical class 0.000 claims description 7
- 229920000642 polymer Polymers 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- 238000010411 cooking Methods 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 35
- -1 aromatic diol Chemical class 0.000 description 33
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 22
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 14
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 10
- 125000001424 substituent group Chemical group 0.000 description 10
- 229920000139 polyethylene terephthalate Polymers 0.000 description 9
- 239000005020 polyethylene terephthalate Substances 0.000 description 9
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 5
- 125000002837 carbocyclic group Chemical group 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000000465 moulding Methods 0.000 description 5
- 238000006068 polycondensation reaction Methods 0.000 description 4
- AKOGNYJNGMLDOA-UHFFFAOYSA-N (4-acetyloxyphenyl) acetate Chemical compound CC(=O)OC1=CC=C(OC(C)=O)C=C1 AKOGNYJNGMLDOA-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000002667 nucleating agent Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 229920001059 synthetic polymer Polymers 0.000 description 3
- VJIDDJAKLVOBSE-UHFFFAOYSA-N 2-ethylbenzene-1,4-diol Chemical compound CCC1=CC(O)=CC=C1O VJIDDJAKLVOBSE-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 125000001142 dicarboxylic acid group Chemical group 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000012744 reinforcing agent Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- GVGLGOZIDCSQPN-UHFFFAOYSA-N (9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-7-yl) acetate Chemical group C12C=CC(OC(C)=O)C3OC4=C5C32CCN(C)C1CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-UHFFFAOYSA-N 0.000 description 1
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 1
- WWCSTJWKTAXUGJ-UHFFFAOYSA-N 1943-97-1 Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C(C2C3CCC2)CC3C1 WWCSTJWKTAXUGJ-UHFFFAOYSA-N 0.000 description 1
- FQXGHZNSUOHCLO-UHFFFAOYSA-N 2,2,4,4-tetramethyl-1,3-cyclobutanediol Chemical compound CC1(C)C(O)C(C)(C)C1O FQXGHZNSUOHCLO-UHFFFAOYSA-N 0.000 description 1
- QGPNCAAQXZRRMR-UHFFFAOYSA-N 2,3,5-trifluorobenzene-1,4-diol Chemical compound OC1=CC(F)=C(O)C(F)=C1F QGPNCAAQXZRRMR-UHFFFAOYSA-N 0.000 description 1
- NAQNEMNLLODUCG-UHFFFAOYSA-N 2,3-dichloroterephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(Cl)=C1Cl NAQNEMNLLODUCG-UHFFFAOYSA-N 0.000 description 1
- RJWLXGOSIRVRAR-UHFFFAOYSA-N 2,4-dimethylbenzene-1,3-diol Chemical compound CC1=CC=C(O)C(C)=C1O RJWLXGOSIRVRAR-UHFFFAOYSA-N 0.000 description 1
- BLDLRWQLBOJPEB-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfanylphenol Chemical compound OC1=CC=CC=C1SC1=CC=CC=C1O BLDLRWQLBOJPEB-UHFFFAOYSA-N 0.000 description 1
- WRFLIILFPBSTQD-UHFFFAOYSA-N 2-(2-methylpropyl)pentane-1,3-diol Chemical compound CCC(O)C(CO)CC(C)C WRFLIILFPBSTQD-UHFFFAOYSA-N 0.000 description 1
- RYHGQTREHREIBC-UHFFFAOYSA-N 3,4-dimethylbenzene-1,2-diol Chemical compound CC1=CC=C(O)C(O)=C1C RYHGQTREHREIBC-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000234435 Lilium Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LUSFFPXRDZKBMF-UHFFFAOYSA-N [3-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCCC(CO)C1 LUSFFPXRDZKBMF-UHFFFAOYSA-N 0.000 description 1
- LZKPUVULVAMJGR-UHFFFAOYSA-N acetic acid;benzene-1,4-diol Chemical compound CC(O)=O.OC1=CC=C(O)C=C1 LZKPUVULVAMJGR-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229920006125 amorphous polymer Polymers 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- IGRDVZMWAPRNBE-UHFFFAOYSA-N butane-1,3-diol butane-1,4-diol propane-1,3-diol Chemical compound OCCCO.CC(O)CCO.OCCCCO IGRDVZMWAPRNBE-UHFFFAOYSA-N 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- PMMYEEVYMWASQN-IMJSIDKUSA-N cis-4-Hydroxy-L-proline Chemical compound O[C@@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-IMJSIDKUSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004403 ethyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229940043351 ethyl-p-hydroxybenzoate Drugs 0.000 description 1
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- SXCBDZAEHILGLM-UHFFFAOYSA-N heptane-1,7-diol Chemical compound OCCCCCCCO SXCBDZAEHILGLM-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- HBMCQTHGYMTCOF-UHFFFAOYSA-N hydroquinone monoacetate Natural products CC(=O)OC1=CC=C(O)C=C1 HBMCQTHGYMTCOF-UHFFFAOYSA-N 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/60—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from the reaction of a mixture of hydroxy carboxylic acids, polycarboxylic acids and polyhydroxy compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/31504—Composite [nonstructural laminate]
- Y10T428/31786—Of polyester [e.g., alkyd, etc.]
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US47738174 US3890256A (en) | 1974-06-07 | 1974-06-07 | Copolyester prepared by contacting acyloxy benzoic acid with a polyester of ethylene glycol and dicarboxylic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2525092A1 true DE2525092A1 (de) | 1975-12-18 |
Family
ID=23895693
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752525092 Withdrawn DE2525092A1 (de) | 1974-06-07 | 1975-06-05 | Neue copolyester sowie verfahren zu ihrer herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3890256A (OSRAM) |
| JP (1) | JPS5913531B2 (OSRAM) |
| CA (1) | CA1039443A (OSRAM) |
| DE (1) | DE2525092A1 (OSRAM) |
| FR (1) | FR2273837A1 (OSRAM) |
| GB (1) | GB1507350A (OSRAM) |
| IT (1) | IT1038768B (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0321691A3 (en) * | 1987-11-17 | 1989-07-19 | Idemitsu Petrochemical Co. Ltd. | Process for producing aromatic polyester |
| US4892912A (en) * | 1988-11-08 | 1990-01-09 | Idemitsu Petrochemical Co., Ltd. | Process for producing aromatic polyester |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083829A (en) * | 1976-05-13 | 1978-04-11 | Celanese Corporation | Melt processable thermotropic wholly aromatic polyester |
| US4067852A (en) * | 1976-05-13 | 1978-01-10 | Celanese Corporation | Melt processable thermotropic wholly aromatic polyester containing polybenzoyl units |
| DE2722120A1 (de) * | 1976-05-17 | 1977-12-01 | Eastman Kodak Co | Copolyester sowie verfahren zu ihrer herstellung |
| JPS5441977A (en) * | 1977-09-09 | 1979-04-03 | Hitachi Chemical Co Ltd | Method of making golf ball |
| US4184996A (en) * | 1977-09-12 | 1980-01-22 | Celanese Corporation | Melt processable thermotropic wholly aromatic polyester |
| US4130545A (en) * | 1977-09-12 | 1978-12-19 | Celanese Corporation | Melt processable thermotropic wholly aromatic polyester comprising both para-oxybenzoyl and meta-oxybenzoyl moieties |
| JPS5582150A (en) * | 1978-12-19 | 1980-06-20 | Toray Ind Inc | Polyester composition |
| US4337190A (en) * | 1980-07-15 | 1982-06-29 | Celanese Corporation | Polyester of 6-hydroxy-2-naphthoic acid and meta-hydroxy benzoic acid capable of readily undergoing melt processing |
| US4331782A (en) * | 1981-03-05 | 1982-05-25 | Ashland Oil, Inc. | Hydroxybenzoic acid-epoxy adduct capping agents for polyester resins |
| US4565850A (en) * | 1981-08-03 | 1986-01-21 | Allied Corporation | Thermoplastic composition containing nematic oligomer |
| JPS5887125A (ja) * | 1981-11-18 | 1983-05-24 | Asahi Chem Ind Co Ltd | 液晶性ポリエステルの重合法 |
| JPS5893731A (ja) * | 1981-12-01 | 1983-06-03 | Toray Ind Inc | 発泡樹脂成形品 |
| US4390681A (en) * | 1982-03-04 | 1983-06-28 | Monsanto Company | Liquid crystal copolyesters |
| JPS59124925A (ja) * | 1983-01-05 | 1984-07-19 | Mitsubishi Chem Ind Ltd | 全芳香族ポリエステル |
| US6045906A (en) | 1984-03-15 | 2000-04-04 | Cytec Technology Corp. | Continuous, linearly intermixed fiber tows and composite molded article thereform |
| US4611025A (en) * | 1985-04-04 | 1986-09-09 | Akkapeddi Murali K | Process for the production of thermoplastic compositions containing thermotropic oligomers and compositions produced by such process |
| JPS61192789U (OSRAM) * | 1985-05-24 | 1986-12-01 | ||
| JPH0653383B2 (ja) * | 1986-08-18 | 1994-07-20 | ユニチカ株式会社 | 高弾性ポリエステルフイルム |
| JP2537534B2 (ja) * | 1987-03-31 | 1996-09-25 | ユニチカ株式会社 | サ―モトロピック液晶性ポリエステルの製造方法 |
| JPH02196819A (ja) * | 1989-01-25 | 1990-08-03 | Nippon Oil Co Ltd | 全芳香族ポリエステル |
| JPH0774285B2 (ja) * | 1991-06-07 | 1995-08-09 | 東レ株式会社 | 発泡樹脂成形品 |
| US5298593A (en) * | 1991-06-25 | 1994-03-29 | Mitsubishi Petrochemical Company, Ltd. | Method of producing thermotropic liquid crystalline polyester |
| US5236960A (en) * | 1992-06-22 | 1993-08-17 | Basf Corporation | Water-blown polyurethane integral skin foam |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2025971A1 (de) * | 1969-05-28 | 1970-12-03 | The Carborundum Company, Niagara Palls, N.Y. (V.St.A.) | p-Oxybenzyol-Mischpolyester und Verfahren zur Herstellung desselben |
| DE2348697A1 (de) * | 1972-09-28 | 1974-04-11 | Eastman Kodak Co | Verfahren zur herstellung eines copolyesters |
| DE2423990A1 (de) * | 1973-05-18 | 1974-12-05 | Unitika Ltd | Aromatische copolymer-massen |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3345331A (en) * | 1963-11-18 | 1967-10-03 | Du Pont | Poly [ethylene terephthalate/4-(3-oxypropoxy) benzoate] |
| US3288755A (en) * | 1964-02-19 | 1966-11-29 | Inventa Ag | Process for the manufacture of copolyetheresters |
| US3662052A (en) * | 1969-05-28 | 1972-05-09 | Carborundum Co | Impact molding of oxybenzoyl polyesters |
| US3759870A (en) * | 1970-08-24 | 1973-09-18 | Carborundum Co | Polyester based on hydroxybenzoic acids |
| US3790528A (en) * | 1971-12-27 | 1974-02-05 | Nippon Soda Co | Process for preparation of oxybenzoyl polymer |
| BE794938A (fr) * | 1972-02-02 | 1973-08-02 | Eastman Kodak Co | Nouveau procede de preparation de copolyesters et applications |
| US3804805A (en) * | 1972-12-01 | 1974-04-16 | Eastman Kodak Co | Copolyester prepared from polyethylene terephthalate and an acyloxy benzoic acid |
-
1974
- 1974-06-07 US US47738174 patent/US3890256A/en not_active Expired - Lifetime
-
1975
- 1975-05-09 CA CA226,587A patent/CA1039443A/en not_active Expired
- 1975-06-05 DE DE19752525092 patent/DE2525092A1/de not_active Withdrawn
- 1975-06-06 GB GB2444475A patent/GB1507350A/en not_active Expired
- 1975-06-06 FR FR7517682A patent/FR2273837A1/fr active Granted
- 1975-06-06 JP JP50068459A patent/JPS5913531B2/ja not_active Expired
- 1975-06-06 IT IT2411675A patent/IT1038768B/it active
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2025971A1 (de) * | 1969-05-28 | 1970-12-03 | The Carborundum Company, Niagara Palls, N.Y. (V.St.A.) | p-Oxybenzyol-Mischpolyester und Verfahren zur Herstellung desselben |
| DE2348697A1 (de) * | 1972-09-28 | 1974-04-11 | Eastman Kodak Co | Verfahren zur herstellung eines copolyesters |
| DE2423990A1 (de) * | 1973-05-18 | 1974-12-05 | Unitika Ltd | Aromatische copolymer-massen |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0321691A3 (en) * | 1987-11-17 | 1989-07-19 | Idemitsu Petrochemical Co. Ltd. | Process for producing aromatic polyester |
| US4892912A (en) * | 1988-11-08 | 1990-01-09 | Idemitsu Petrochemical Co., Ltd. | Process for producing aromatic polyester |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1507350A (en) | 1978-04-12 |
| FR2273837A1 (fr) | 1976-01-02 |
| FR2273837B1 (OSRAM) | 1979-01-05 |
| IT1038768B (it) | 1979-11-30 |
| CA1039443A (en) | 1978-09-26 |
| JPS5913531B2 (ja) | 1984-03-30 |
| US3890256A (en) | 1975-06-17 |
| JPS518395A (OSRAM) | 1976-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2525092A1 (de) | Neue copolyester sowie verfahren zu ihrer herstellung | |
| DE68929259T2 (de) | Aromatische Polyester, aromatische Polyesteramide und Verfahren zu deren Herstellung | |
| DE69127676T2 (de) | Ein Verfahren zur Herstellung gesättigter Polyester | |
| DE2503000A1 (de) | Polymerisation des poly(1,4-butylen- terephthalats) im festen aggregatzustand | |
| CH456142A (de) | Verformbare Masse aus Polycarbonat und Polyalkylen-terephthalat | |
| DE2834537A1 (de) | Copolyester auf terephthalsaeurebasis | |
| DE2348697A1 (de) | Verfahren zur herstellung eines copolyesters | |
| DE2342415A1 (de) | Neue, lineare homo- und copolyester auf basis von tere- und/oder isophthalsaeure | |
| DE69125501T2 (de) | Polyester aus Terephtalsäure, 2,6-Naphthalendicarbonsäure und Hydrochinon | |
| DE3713080A1 (de) | Polyester-zusammensetzung und verfahren zu ihrer herstellung | |
| EP0226078A1 (de) | Vollaromatische mesomorphe Polyester, deren Herstellung sowie Verwendung | |
| EP0032163B1 (de) | Verfahren zum Regenerieren und Aufarbeiten von inaktivem linearen Poly(alkylenterephthalat) | |
| DE1292398B (de) | Verfahren zur Herstellung von hochpolymeren Polyestern | |
| DE60214734T2 (de) | Amorphe copolyester | |
| DE2453270A1 (de) | Polymerisation des poly(1,4-butylenterephthalats) im festen aggregatzustand | |
| DE2348698C2 (OSRAM) | ||
| DE2533675A1 (de) | Lineare copolyester auf basis von terephthal- und/oder isophthalsaeure | |
| DE2904184A1 (de) | Formmasse und die daraus hergestellten spritzguss-formkoerper | |
| DE2722120A1 (de) | Copolyester sowie verfahren zu ihrer herstellung | |
| DE1720652A1 (de) | Verfahren zur Herstellung linearer Polyester | |
| DE2519672A1 (de) | Imid-modifizierte polyester und diese polyester enthaltende drahtlacke | |
| DE3622137A1 (de) | Vollaromatische mesomorphe polyester, deren herstellung sowie verwendung | |
| DE69023043T2 (de) | Vollaromatischer Copolyester. | |
| DE2751653A1 (de) | Polyphenyl-1,4-phenylenterephthalate und daraus hergestellte fasern | |
| DE1271397B (de) | Verfahren zur Herstellung von spinnfaehigem Poly-(aethylenglykolterephthalat) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C08G 63/60 |
|
| 8128 | New person/name/address of the agent |
Representative=s name: BRANDES, J., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8 |
|
| 8130 | Withdrawal |