DE2451904A1 - Zubereitung zum stabilisieren von peressigsaeure - Google Patents
Zubereitung zum stabilisieren von peressigsaeureInfo
- Publication number
- DE2451904A1 DE2451904A1 DE19742451904 DE2451904A DE2451904A1 DE 2451904 A1 DE2451904 A1 DE 2451904A1 DE 19742451904 DE19742451904 DE 19742451904 DE 2451904 A DE2451904 A DE 2451904A DE 2451904 A1 DE2451904 A1 DE 2451904A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- sodium hexametaphosphate
- weight
- pyridinedicarboxylic
- peracetic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 title claims description 86
- 238000002360 preparation method Methods 0.000 title claims description 20
- 230000000087 stabilizing effect Effects 0.000 title claims description 13
- 235000019982 sodium hexametaphosphate Nutrition 0.000 claims description 25
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims description 25
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 claims description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 21
- GJAWHXHKYYXBSV-UHFFFAOYSA-N pyridinedicarboxylic acid Natural products OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 claims description 21
- LVPMIMZXDYBCDF-UHFFFAOYSA-N isocinchomeronic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)N=C1 LVPMIMZXDYBCDF-UHFFFAOYSA-N 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 16
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- 150000003863 ammonium salts Chemical class 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 7
- MPFLRYZEEAQMLQ-UHFFFAOYSA-N dinicotinic acid Chemical compound OC(=O)C1=CN=CC(C(O)=O)=C1 MPFLRYZEEAQMLQ-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- MUYSADWCWFFZKR-UHFFFAOYSA-N cinchomeronic acid Chemical compound OC(=O)C1=CC=NC=C1C(O)=O MUYSADWCWFFZKR-UHFFFAOYSA-N 0.000 claims description 3
- 238000000034 method Methods 0.000 claims 3
- 150000001875 compounds Chemical class 0.000 claims 1
- NRUIRIGWLXIEGS-UHFFFAOYSA-N diazanium pyridine-2-carboxylate Chemical compound N1=C(C=CC=C1)C(=O)[O-].N1=C(C=CC=C1)C(=O)[O-].[NH4+].[NH4+] NRUIRIGWLXIEGS-UHFFFAOYSA-N 0.000 claims 1
- FJPKLZSBCADXQZ-UHFFFAOYSA-L dipotassium pyridine-2-carboxylate Chemical compound N1=C(C=CC=C1)C(=O)[O-].N1=C(C=CC=C1)C(=O)[O-].[K+].[K+] FJPKLZSBCADXQZ-UHFFFAOYSA-L 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 22
- 239000003381 stabilizer Substances 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 9
- 235000019832 sodium triphosphate Nutrition 0.000 description 6
- -1 Dinicotinic acid Sodium Chemical compound 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- OVGWRBSAYYTZGE-UHFFFAOYSA-N pyridine-2-carboxylic acid;sodium Chemical compound [Na].OC(=O)C1=CC=CC=N1.OC(=O)C1=CC=CC=N1 OVGWRBSAYYTZGE-UHFFFAOYSA-N 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229940079864 sodium stannate Drugs 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- OOKDYUQHMDBHMB-UHFFFAOYSA-N 3,6-dichloro-2-methoxybenzoic acid;2-(2,4-dichlorophenoxy)acetic acid;n-methylmethanamine Chemical compound CNC.CNC.COC1=C(Cl)C=CC(Cl)=C1C(O)=O.OC(=O)COC1=CC=C(Cl)C=C1Cl OOKDYUQHMDBHMB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- TVQLLNFANZSCGY-UHFFFAOYSA-N disodium;dioxido(oxo)tin Chemical compound [Na+].[Na+].[O-][Sn]([O-])=O TVQLLNFANZSCGY-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- 101001055222 Homo sapiens Interleukin-8 Proteins 0.000 description 1
- 102100026236 Interleukin-8 Human genes 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- FMMSEFNIWDFLKK-UHFFFAOYSA-N [O].OO Chemical compound [O].OO FMMSEFNIWDFLKK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- SAMDIDMZDCSOCM-UHFFFAOYSA-N pyridine-2,5-dicarboxylic acid;sodium Chemical compound [Na].OC(=O)C1=CC=C(C(O)=O)N=C1 SAMDIDMZDCSOCM-UHFFFAOYSA-N 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
- C07C407/006—Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12369273A JPS5238009B2 (https=) | 1973-11-02 | 1973-11-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2451904A1 true DE2451904A1 (de) | 1975-05-07 |
Family
ID=14866950
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742451904 Withdrawn DE2451904A1 (de) | 1973-11-02 | 1974-10-31 | Zubereitung zum stabilisieren von peressigsaeure |
Country Status (4)
| Country | Link |
|---|---|
| JP (1) | JPS5238009B2 (https=) |
| DE (1) | DE2451904A1 (https=) |
| FR (1) | FR2249878A1 (https=) |
| SU (1) | SU583748A3 (https=) |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1991007375A1 (en) * | 1989-11-10 | 1991-05-30 | Eka Nobel Ab | Peracetic acid composition |
| DE4210425A1 (de) * | 1992-03-30 | 1993-10-07 | Degussa | Stabilisierte Percarbonsäurelösungen und Verfahren zu deren Herstellung |
| WO1994015465A1 (en) * | 1993-01-09 | 1994-07-21 | Solvay Interox Limited | Compositions and uses thereof |
| DE4317420C1 (de) * | 1993-05-26 | 1994-11-03 | Degussa | Stabilisierte Percarbonsäurelösungen und Verfahren zu deren Herstellung |
| US5624634A (en) * | 1991-10-17 | 1997-04-29 | Solvay Interox Limited | Peracid compositions for medical disinfection |
| BE1020013A3 (nl) * | 2011-07-11 | 2013-03-05 | Christeyns Nv | Productie van meer stabiele perzuren. |
| US11180385B2 (en) | 2012-10-05 | 2021-11-23 | Ecolab USA, Inc. | Stable percarboxylic acid compositions and uses thereof |
| US12058999B2 (en) | 2018-08-22 | 2024-08-13 | Ecolab Usa Inc. | Hydrogen peroxide and peracid stabilization with molecules based on a pyridine carboxylic acid |
| US12096768B2 (en) | 2019-08-07 | 2024-09-24 | Ecolab Usa Inc. | Polymeric and solid-supported chelators for stabilization of peracid-containing compositions |
| US12465048B2 (en) | 2013-03-05 | 2025-11-11 | Ecolab Usa Inc. | Defoamer useful in a peracid composition with anionic surfactants |
| US12558713B2 (en) | 2019-05-31 | 2026-02-24 | Ecolab Usa Inc. | Peracid compositions with conductivity monitoring capability |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS52145121U (https=) * | 1976-04-27 | 1977-11-02 | ||
| JPS5321916U (https=) * | 1976-08-05 | 1978-02-24 | ||
| JPS5328117U (https=) * | 1976-08-18 | 1978-03-10 | ||
| JPS5362812U (https=) * | 1976-10-30 | 1978-05-27 |
-
1973
- 1973-11-02 JP JP12369273A patent/JPS5238009B2/ja not_active Expired
-
1974
- 1974-10-31 DE DE19742451904 patent/DE2451904A1/de not_active Withdrawn
- 1974-11-01 SU SU7402074823A patent/SU583748A3/ru active
- 1974-11-04 FR FR7436620A patent/FR2249878A1/fr active Granted
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1991007375A1 (en) * | 1989-11-10 | 1991-05-30 | Eka Nobel Ab | Peracetic acid composition |
| US5624634A (en) * | 1991-10-17 | 1997-04-29 | Solvay Interox Limited | Peracid compositions for medical disinfection |
| DE4210425A1 (de) * | 1992-03-30 | 1993-10-07 | Degussa | Stabilisierte Percarbonsäurelösungen und Verfahren zu deren Herstellung |
| WO1994015465A1 (en) * | 1993-01-09 | 1994-07-21 | Solvay Interox Limited | Compositions and uses thereof |
| CN1076164C (zh) * | 1993-01-09 | 2001-12-19 | 索尔维因特罗斯有限公司 | 组合物及其用途 |
| DE4317420C1 (de) * | 1993-05-26 | 1994-11-03 | Degussa | Stabilisierte Percarbonsäurelösungen und Verfahren zu deren Herstellung |
| EP0626371A1 (de) * | 1993-05-26 | 1994-11-30 | Degussa Aktiengesellschaft | Stabilisierte Percarbonsäurelösungen und Verfahren zu deren Herstellung |
| BE1020013A3 (nl) * | 2011-07-11 | 2013-03-05 | Christeyns Nv | Productie van meer stabiele perzuren. |
| US11180385B2 (en) | 2012-10-05 | 2021-11-23 | Ecolab USA, Inc. | Stable percarboxylic acid compositions and uses thereof |
| US11939241B2 (en) | 2012-10-05 | 2024-03-26 | Ecolab Usa Inc. | Stable percarboxylic acid compositions and uses thereof |
| US12465048B2 (en) | 2013-03-05 | 2025-11-11 | Ecolab Usa Inc. | Defoamer useful in a peracid composition with anionic surfactants |
| US12058999B2 (en) | 2018-08-22 | 2024-08-13 | Ecolab Usa Inc. | Hydrogen peroxide and peracid stabilization with molecules based on a pyridine carboxylic acid |
| US12558713B2 (en) | 2019-05-31 | 2026-02-24 | Ecolab Usa Inc. | Peracid compositions with conductivity monitoring capability |
| US12096768B2 (en) | 2019-08-07 | 2024-09-24 | Ecolab Usa Inc. | Polymeric and solid-supported chelators for stabilization of peracid-containing compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2249878A1 (en) | 1975-05-30 |
| FR2249878B1 (https=) | 1979-02-23 |
| JPS5071615A (https=) | 1975-06-13 |
| SU583748A3 (ru) | 1977-12-05 |
| JPS5238009B2 (https=) | 1977-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2451904A1 (de) | Zubereitung zum stabilisieren von peressigsaeure | |
| DE2441725A1 (de) | Stabilisiertes wasserstoffperoxid | |
| EP0626371B1 (de) | Stabilisierte Percarbonsäurelösungen und Verfahren zu deren Herstellung | |
| DE2609039B2 (de) | Verfahren zum Herstellen von beständigem Natriumpercarbonat | |
| DE2038320C3 (de) | Nichtwäßrige Wasserstoffperpxid-Lösungen | |
| EP2598436B1 (de) | Verwendung von hydroxypyridonen oder deren salzen zur stabilisierung von wasserstoffperoxid oder wasserstoffperoxid freisetzenden substanzen | |
| DE1280239B (de) | Stabilisieren von Loesungen der Peressigsaeure in einem organischen Loesungsmittel | |
| DE1174755B (de) | Verfahren zum Stabilisieren von nieder-molekularen gesaettigten Perfettsaeuren | |
| DE1170927B (de) | Verfahren zum Stabilisieren von Peressigsaeureloesungen | |
| CH646257A5 (de) | Karl-fischer-reagenz. | |
| DE2009960A1 (de) | Formalverbindungen; Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1770579A1 (de) | Verfahren zur Herstellung von Rifamycin | |
| DE945147C (de) | Verfahren zur Herstellung von Pyridin-2, 3-dicarbonsaeure | |
| DE1060849B (de) | Stabilisierung von Perborat | |
| DE828104C (de) | Verfahren zur Herstellung N,N -substituierter Piperazine | |
| DE2100784A1 (de) | Verfahren zur gleichzeitigen Herstel lung von Wasserstoffperoxyd und ahphati sehen oder alicychschen Peroxyden | |
| DE2043571A1 (de) | Stabilisierung von Harnstoff peroxid | |
| DE1795350C3 (de) | Pyrimldlnylthiophosphorsäureester, Verfahren zu ihrer Herstellung und diese enthaltende Mittel | |
| EP0120219A1 (de) | Mittel mit bakterizider und fungizider Wirkung | |
| DE956639C (de) | Fungicides Gemisch | |
| AT246697B (de) | Verfahren zur Stabilisierung von 3-90 gew.-%igen wässerigen Wasserstoffperoxydlösungen | |
| DE1545755B1 (de) | Sulfinyl- oder Sulfonylpyridine sowie Verfahren zu ihrer Herstellung | |
| DE936040C (de) | Verfahren zur Herstellung von neuen Estern der Penicillin-Reihe | |
| DE1567519C (de) | Stabilisierung von Wasserstoffperoxyd | |
| AT232792B (de) | Fungizide Mischung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |