DE2448761A1 - Anordnung zur vermeidung der formierung von korpuskularem material in coronaentladungsvorrichtungen - Google Patents
Anordnung zur vermeidung der formierung von korpuskularem material in coronaentladungsvorrichtungenInfo
- Publication number
- DE2448761A1 DE2448761A1 DE19742448761 DE2448761A DE2448761A1 DE 2448761 A1 DE2448761 A1 DE 2448761A1 DE 19742448761 DE19742448761 DE 19742448761 DE 2448761 A DE2448761 A DE 2448761A DE 2448761 A1 DE2448761 A1 DE 2448761A1
- Authority
- DE
- Germany
- Prior art keywords
- corona discharge
- discharge device
- filter
- air
- chemically active
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000463 material Substances 0.000 title claims description 25
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 41
- 229910021529 ammonia Inorganic materials 0.000 claims description 20
- 239000011149 active material Substances 0.000 claims description 19
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 12
- 239000000428 dust Substances 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 8
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims description 7
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000741 silica gel Substances 0.000 claims description 4
- 229910002027 silica gel Inorganic materials 0.000 claims description 4
- 238000007600 charging Methods 0.000 claims description 3
- 239000013078 crystal Substances 0.000 claims description 2
- 239000003570 air Substances 0.000 description 45
- 239000002245 particle Substances 0.000 description 8
- 239000012876 carrier material Substances 0.000 description 7
- 238000004140 cleaning Methods 0.000 description 5
- 230000008021 deposition Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000011148 porous material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000011236 particulate material Substances 0.000 description 3
- 206010011906 Death Diseases 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Inorganic materials [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000012824 chemical production Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000007786 electrostatic charging Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000013618 particulate matter Substances 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G15/00—Apparatus for electrographic processes using a charge pattern
- G03G15/02—Apparatus for electrographic processes using a charge pattern for laying down a uniform charge, e.g. for sensitising; Corona discharge devices
- G03G15/0258—Apparatus for electrographic processes using a charge pattern for laying down a uniform charge, e.g. for sensitising; Corona discharge devices provided with means for the maintenance of the charging apparatus, e.g. cleaning devices, ozone removing devices G03G15/0225, G03G15/0291 takes precedence
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G15/00—Apparatus for electrographic processes using a charge pattern
- G03G15/02—Apparatus for electrographic processes using a charge pattern for laying down a uniform charge, e.g. for sensitising; Corona discharge devices
- G03G15/0291—Apparatus for electrographic processes using a charge pattern for laying down a uniform charge, e.g. for sensitising; Corona discharge devices corona discharge devices, e.g. wires, pointed electrodes, means for cleaning the corona discharge device
Landscapes
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Plasma & Fusion (AREA)
- General Physics & Mathematics (AREA)
- Treating Waste Gases (AREA)
- Control Or Security For Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US411987A US3862420A (en) | 1973-11-01 | 1973-11-01 | System to prevent the formation of particulate material in corona units |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2448761A1 true DE2448761A1 (de) | 1975-05-07 |
Family
ID=23631093
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742448761 Withdrawn DE2448761A1 (de) | 1973-11-01 | 1974-10-12 | Anordnung zur vermeidung der formierung von korpuskularem material in coronaentladungsvorrichtungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3862420A (enExample) |
| JP (1) | JPS5828581B2 (enExample) |
| CA (1) | CA1049089A (enExample) |
| DE (1) | DE2448761A1 (enExample) |
| FR (1) | FR2250216B1 (enExample) |
| GB (1) | GB1444669A (enExample) |
| IT (1) | IT1027571B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3314255A1 (de) * | 1982-04-20 | 1983-10-20 | Ricoh Co., Ltd., Tokyo | Koronaladeeinrichtung |
| EP0185507A3 (en) * | 1984-12-12 | 1986-12-10 | Xerox Corporation | Corona generating device |
| EP0216450A1 (en) * | 1985-07-01 | 1987-04-01 | Xerox Corporation | Corona generating device |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4117778A (en) * | 1974-10-30 | 1978-10-03 | Oki Electric Industry Co., Ltd. | High speed printer with arc preventing fluorocarbon gas |
| US4040731A (en) * | 1975-04-04 | 1977-08-09 | Olympus Optical Co., Ltd. | Electrophotographic apparatus having a screen-type photoconductive drum |
| JPS6034112B2 (ja) * | 1975-11-11 | 1985-08-07 | 株式会社東芝 | 電子写真感光体の清掃方法 |
| JPS5928430Y2 (ja) * | 1977-06-20 | 1984-08-16 | コニカ株式会社 | コロナ放電器 |
| US4143118A (en) * | 1977-08-08 | 1979-03-06 | Xerox Corporation | Apparatus and method for ozone reduction in electrostatographic reproduction equipment |
| US4250431A (en) * | 1979-12-26 | 1981-02-10 | Joseph Sugarman | Particulate collector apparatus and method for ion generators |
| US4388274A (en) * | 1980-06-02 | 1983-06-14 | Xerox Corporation | Ozone collection and filtration system |
| US4466813A (en) * | 1982-06-11 | 1984-08-21 | International Business Machines Corporation | Plasticizer removal process and system |
| JPS6183431U (enExample) * | 1984-11-02 | 1986-06-02 | ||
| US4585320A (en) * | 1984-12-12 | 1986-04-29 | Xerox Corporation | Corona generating device |
| US4585323A (en) * | 1984-12-12 | 1986-04-29 | Xerox Corporation | Corona generating device |
| US4734721A (en) * | 1985-10-04 | 1988-03-29 | Markem Corporation | Electrostatic printer utilizing dehumidified air |
| US4680040A (en) * | 1986-01-17 | 1987-07-14 | Xerox Corporation | Multipurpose filtering material |
| US4679924A (en) * | 1986-06-26 | 1987-07-14 | Wamsley Allen W | Corona discharge photography |
| US4809026A (en) * | 1986-07-29 | 1989-02-28 | Markem Corporation | Electrostatic printing utilizing a heated air flow |
| US4772901A (en) * | 1986-07-29 | 1988-09-20 | Markem Corporation | Electrostatic printing utilizing dehumidified air |
| US4809027A (en) * | 1986-07-29 | 1989-02-28 | Markem Corporation | Offset electrostatic printing utilizing a heated air flow |
| US4841146A (en) * | 1987-08-03 | 1989-06-20 | Xerox Corporation | Self-cleaning scorotron with focused ion beam |
| US5118942A (en) * | 1990-02-05 | 1992-06-02 | Hamade Thomas A | Electrostatic charging apparatus and method |
| US5012094A (en) * | 1990-02-05 | 1991-04-30 | Hamade Thomas A | Electrostatic charging apparatus and method |
| US5077468A (en) * | 1990-02-05 | 1991-12-31 | Hamade Thomas A | Electrostatic charging apparatus and method |
| JP2536564Y2 (ja) * | 1990-02-13 | 1997-05-21 | 株式会社リコー | 画像形成装置 |
| US5087943A (en) * | 1990-12-10 | 1992-02-11 | Eastman Kodak Company | Ozone removal system |
| US5128720A (en) * | 1991-01-18 | 1992-07-07 | Eastman Kodak Company | Device for collecting contamination products and ozone from a corona charger |
| US5264989A (en) * | 1991-06-14 | 1993-11-23 | Bauer William S | Apparatus for treating the surface of formed plastic articles using corona discharge |
| DE4314942A1 (de) * | 1993-05-06 | 1994-11-10 | Ahlbrandt Andreas | Abscheider für insbesondere Ozon aus Gas |
| US5607647A (en) * | 1993-12-02 | 1997-03-04 | Extraction Systems, Inc. | Air filtering within clean environments |
| DE19852705A1 (de) * | 1998-11-16 | 2000-05-25 | Atmos Medizintechnik Gmbh & Co | Absaugvorrichtung, welche luftgetragene oder luftgelöste Abfallprodukte einer chirurgische Behandlung mit einem stromgetriebenen Chirurgieinstrument insbesondere mit einem Laser-Skalpell absaugt, mit einer Filtereinheit |
| US6070026A (en) * | 1999-05-10 | 2000-05-30 | Xerox Corporation | Charging device with separate pressure and vacuum air flows |
| US6907888B2 (en) * | 2000-11-27 | 2005-06-21 | Matsushita Electric Works, Ltd. | Ion generator and hairbrush using the same |
| JP4384513B2 (ja) * | 2004-01-22 | 2009-12-16 | 株式会社リコー | 画像形成装置 |
| DE102005026674A1 (de) * | 2005-05-31 | 2006-12-07 | M + W Zander Facility Engineering Gmbh | Verfahren zum Abscheiden von gasförmigen Bestandteilen in gasförmigen Medien sowie Filter zur Durchführung des Verfahrens |
| JP5919813B2 (ja) * | 2011-12-27 | 2016-05-18 | 富士ゼロックス株式会社 | 送風管、送風装置及び画像形成装置 |
| JP2014126816A (ja) * | 2012-12-27 | 2014-07-07 | Brother Ind Ltd | 帯電器 |
| US10278617B1 (en) * | 2013-03-15 | 2019-05-07 | Invoy Holdings, Llc | Method and apparatus for sensing ammonia in breath |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3324291A (en) * | 1964-07-06 | 1967-06-06 | Xerox Corp | Corona generating device with means to cause air flow therethrough to maintain the parts free of dust accumulation |
| FR2121127A5 (enExample) * | 1970-12-30 | 1972-08-18 | Kalle Ag | |
| US3736424A (en) * | 1971-12-03 | 1973-05-29 | Ibm | Corona discharge device |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3306011A (en) * | 1964-05-28 | 1967-02-28 | Dvorkin Harry | Air filter for inflatable tires |
| JPS4211199Y1 (enExample) * | 1965-03-31 | 1967-06-21 | ||
| US3471695A (en) * | 1967-05-22 | 1969-10-07 | Xerox Corp | Corona charging apparatus with means to urge a flow of aeriform fluid across the corona wires |
-
1973
- 1973-11-01 US US411987A patent/US3862420A/en not_active Expired - Lifetime
-
1974
- 1974-09-11 FR FR7431441A patent/FR2250216B1/fr not_active Expired
- 1974-09-19 IT IT27467/74A patent/IT1027571B/it active
- 1974-10-04 JP JP49113981A patent/JPS5828581B2/ja not_active Expired
- 1974-10-11 GB GB4411774A patent/GB1444669A/en not_active Expired
- 1974-10-12 DE DE19742448761 patent/DE2448761A1/de not_active Withdrawn
- 1974-10-25 CA CA74212264A patent/CA1049089A/en not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3324291A (en) * | 1964-07-06 | 1967-06-06 | Xerox Corp | Corona generating device with means to cause air flow therethrough to maintain the parts free of dust accumulation |
| FR2121127A5 (enExample) * | 1970-12-30 | 1972-08-18 | Kalle Ag | |
| US3736424A (en) * | 1971-12-03 | 1973-05-29 | Ibm | Corona discharge device |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3314255A1 (de) * | 1982-04-20 | 1983-10-20 | Ricoh Co., Ltd., Tokyo | Koronaladeeinrichtung |
| EP0185507A3 (en) * | 1984-12-12 | 1986-12-10 | Xerox Corporation | Corona generating device |
| EP0216450A1 (en) * | 1985-07-01 | 1987-04-01 | Xerox Corporation | Corona generating device |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1444669A (en) | 1976-08-04 |
| IT1027571B (it) | 1978-12-20 |
| JPS5828581B2 (ja) | 1983-06-16 |
| FR2250216B1 (enExample) | 1976-10-22 |
| US3862420A (en) | 1975-01-21 |
| JPS5075441A (enExample) | 1975-06-20 |
| FR2250216A1 (enExample) | 1975-05-30 |
| CA1049089A (en) | 1979-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2448761A1 (de) | Anordnung zur vermeidung der formierung von korpuskularem material in coronaentladungsvorrichtungen | |
| DE1522582C3 (de) | Elektrophotographische Vorrichtung und Verfahren zur bildmäßigen Aufladung eines Aufzeichnungsmaterials unter Verwendung dieser Vorrichtung | |
| DE3314255C2 (enExample) | ||
| DE69333075T2 (de) | Vorrichtung und verfahren zur herstellung von gasförmigen ionen unter verwendung von röntgenstrahlen und deren anwendung in verschiedenen geräten und strukturen | |
| DE2027336C3 (de) | Vorrichtung zum Entfernen von auf einer Fläche durch elektrische Ladung gebundenen elektroskopischen TeUchen | |
| DE2653789C3 (de) | Elektrophotografisches Kopiergerät | |
| DE2201701A1 (de) | Spruehentladungsvorrichtung fuer die Elektrophotographie | |
| DE1046372B (de) | Verfahren und Vorrichtung zur elektrischen Feststellung von Aerosolen in Gasen | |
| DE2062961C3 (de) | Vorrichtung zur Steuerung des Entwicklungsvermögens eines Entwicklerstoffes | |
| DE2033152A1 (de) | Vorrichtung zur EntWickelung eines latenten elektrostatischen Bildes | |
| DE2644521C3 (de) | Vorrichtung zur Reinigung einer beweglichen, photoleitfähigen Oberfläche | |
| DE2339458B2 (de) | Elektrophotographische Kopiereinrichtung mit einer mehrschichtigen Aufzeichnungseinheit | |
| DE2757513C2 (de) | Vorrichtung zum katalytischen Abbau von Ozon bei einem elektrografischen Vervielfältigungsgerät | |
| DE1912278B2 (de) | Verfahren und Vorrichtung zum gleichförmigen Aufladen einer Fläche mittete einer Koronaentladung | |
| DE69005571T2 (de) | Beschichtungsmaterial zur Ozonbeseitigung und Bildverarbeitungsgerät hiermit. | |
| DE1522645B2 (enExample) | ||
| DE2908603A1 (de) | Elektrophotographisches verfahren | |
| DE2948972A1 (de) | Koronaentladungseinrichtung | |
| DE2611755A1 (de) | Magnetbuersten-entwicklungsvorrichtung | |
| DE2145112C3 (de) | Elektrophotographisches Aufzeichnungsmaterial sowie elektrophotographisches Verfahren und Kopiergerät | |
| DE2658510A1 (de) | Luftreinigungsgeraet | |
| DE2250062C3 (de) | Elektrofotografisches Kopierverfahren und Kopiergerät | |
| DE2625395C2 (de) | Verfahren zur Verbesserung des elektrischen Kontaktes zwischen isolierendem Bildträger und leitfähiger Unterlage bei elektrographischen Aufzeichnungsverfahren | |
| AT205266B (de) | Vorrichtung zur Feststellung von Aerosolen in Gasen | |
| DE1900151C3 (de) | Vorrichtung zur Regelung der Tonerkonzentration in elektrophotographischen Entwicklervorrichtungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: BRUEGEL, G., DIPL.-ING., PAT.-ANW., 7030 BOEBLINGE |
|
| 8136 | Disposal/non-payment of the fee for publication/grant |