DE2436261B2 - Elektrochemische gasdetektoren - Google Patents
Elektrochemische gasdetektorenInfo
- Publication number
- DE2436261B2 DE2436261B2 DE19742436261 DE2436261A DE2436261B2 DE 2436261 B2 DE2436261 B2 DE 2436261B2 DE 19742436261 DE19742436261 DE 19742436261 DE 2436261 A DE2436261 A DE 2436261A DE 2436261 B2 DE2436261 B2 DE 2436261B2
- Authority
- DE
- Germany
- Prior art keywords
- electrolyte
- gas detector
- electrochemical gas
- measuring
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000007789 gas Substances 0.000 claims description 69
- 239000002904 solvent Substances 0.000 claims description 41
- 239000003792 electrolyte Substances 0.000 claims description 34
- 239000011245 gel electrolyte Substances 0.000 claims description 33
- 229920000642 polymer Polymers 0.000 claims description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 24
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 16
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 claims description 16
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 14
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 14
- 150000002500 ions Chemical class 0.000 claims description 13
- 239000002000 Electrolyte additive Substances 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000007787 solid Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 229910052709 silver Inorganic materials 0.000 claims description 9
- 239000004332 silver Substances 0.000 claims description 9
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 8
- LZCLXQDLBQLTDK-UHFFFAOYSA-N ethyl 2-hydroxypropanoate Chemical compound CCOC(=O)C(C)O LZCLXQDLBQLTDK-UHFFFAOYSA-N 0.000 claims description 8
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 claims description 8
- 229920002521 macromolecule Polymers 0.000 claims description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 6
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910000037 hydrogen sulfide Inorganic materials 0.000 claims description 5
- RUTXIHLAWFEWGM-UHFFFAOYSA-H iron(3+) sulfate Chemical compound [Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUTXIHLAWFEWGM-UHFFFAOYSA-H 0.000 claims description 5
- 229910000360 iron(III) sulfate Inorganic materials 0.000 claims description 5
- -1 y-bulyrolactone Chemical compound 0.000 claims description 5
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 claims description 5
- ZZXUZKXVROWEIF-UHFFFAOYSA-N 1,2-butylene carbonate Chemical compound CCC1COC(=O)O1 ZZXUZKXVROWEIF-UHFFFAOYSA-N 0.000 claims description 4
- GDKSTFXHMBGCPG-UHFFFAOYSA-N 4,4-dimethyl-1,3-dioxane Chemical compound CC1(C)CCOCO1 GDKSTFXHMBGCPG-UHFFFAOYSA-N 0.000 claims description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 4
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 4
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 claims description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 claims description 4
- 239000004800 polyvinyl chloride Substances 0.000 claims description 4
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 4
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 claims description 4
- 239000004299 sodium benzoate Substances 0.000 claims description 4
- 235000010234 sodium benzoate Nutrition 0.000 claims description 4
- 239000005711 Benzoic acid Substances 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- YYLLIJHXUHJATK-UHFFFAOYSA-N Cyclohexyl acetate Chemical compound CC(=O)OC1CCCCC1 YYLLIJHXUHJATK-UHFFFAOYSA-N 0.000 claims description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 3
- 230000009471 action Effects 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- GZFRSYFOWVTEHV-UHFFFAOYSA-N dimethylazanium;phosphate Chemical compound C[NH2+]C.C[NH2+]C.C[NH2+]C.[O-]P([O-])([O-])=O GZFRSYFOWVTEHV-UHFFFAOYSA-N 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- IMXBRVLCKXGWSS-UHFFFAOYSA-N methyl 2-cyclohexylacetate Chemical compound COC(=O)CC1CCCCC1 IMXBRVLCKXGWSS-UHFFFAOYSA-N 0.000 claims description 3
- 239000005486 organic electrolyte Substances 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- YPNVIBVEFVRZPJ-UHFFFAOYSA-L silver sulfate Chemical compound [Ag+].[Ag+].[O-]S([O-])(=O)=O YPNVIBVEFVRZPJ-UHFFFAOYSA-L 0.000 claims description 3
- 229910000367 silver sulfate Inorganic materials 0.000 claims description 3
- 229910052726 zirconium Inorganic materials 0.000 claims description 3
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 claims description 2
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 claims description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 claims description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052737 gold Inorganic materials 0.000 claims description 2
- 239000010931 gold Substances 0.000 claims description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims description 2
- 125000002270 phosphoric acid ester group Chemical group 0.000 claims description 2
- 229920001059 synthetic polymer Polymers 0.000 claims description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 claims 2
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 claims 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000000499 gel Substances 0.000 description 25
- 239000000084 colloidal system Substances 0.000 description 14
- 238000005259 measurement Methods 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 9
- 238000009792 diffusion process Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 238000010276 construction Methods 0.000 description 5
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 230000008859 change Effects 0.000 description 4
- 238000010494 dissociation reaction Methods 0.000 description 4
- 230000005593 dissociations Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 230000028161 membrane depolarization Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 238000013461 design Methods 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 230000010287 polarization Effects 0.000 description 3
- 239000007784 solid electrolyte Substances 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- UFMZWBIQTDUYBN-UHFFFAOYSA-N cobalt dinitrate Chemical compound [Co+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O UFMZWBIQTDUYBN-UHFFFAOYSA-N 0.000 description 2
- 230000001427 coherent effect Effects 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- RLJMLMKIBZAXJO-UHFFFAOYSA-N lead(II) nitrate Inorganic materials [O-][N+](=O)O[Pb]O[N+]([O-])=O RLJMLMKIBZAXJO-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 238000007614 solvation Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101710188106 SEC14-like protein 2 Proteins 0.000 description 1
- JGNPSJMNGPUQIW-UHFFFAOYSA-N [C].CC=C Chemical compound [C].CC=C JGNPSJMNGPUQIW-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 238000002848 electrochemical method Methods 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 229940116333 ethyl lactate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 230000037427 ion transport Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 238000004454 trace mineral analysis Methods 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N27/00—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means
- G01N27/26—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means by investigating electrochemical variables; by using electrolysis or electrophoresis
- G01N27/403—Cells and electrode assemblies
- G01N27/404—Cells with anode, cathode and cell electrolyte on the same side of a permeable membrane which separates them from the sample fluid, e.g. Clark-type oxygen sensors
- G01N27/4045—Cells with anode, cathode and cell electrolyte on the same side of a permeable membrane which separates them from the sample fluid, e.g. Clark-type oxygen sensors for gases other than oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Physics & Mathematics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Molecular Biology (AREA)
- Analytical Chemistry (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- General Physics & Mathematics (AREA)
- Immunology (AREA)
- Pathology (AREA)
- Measuring Oxygen Concentration In Cells (AREA)
- Investigating Or Analyzing Materials By The Use Of Fluid Adsorption Or Reactions (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742436261 DE2436261B2 (de) | 1974-07-27 | 1974-07-27 | Elektrochemische gasdetektoren |
| GB30598/75A GB1509582A (en) | 1974-07-27 | 1975-07-22 | Electrochemical gas detectors |
| BE158557A BE831673A (fr) | 1974-07-27 | 1975-07-24 | Analyseur electrochimique de gaz |
| US05/598,601 US4049503A (en) | 1974-07-27 | 1975-07-24 | Electrochemical gas detection |
| SE7508441A SE424471B (sv) | 1974-07-27 | 1975-07-24 | Elektrokemisk gasdetektor |
| LU73068A LU73068A1 (esLanguage) | 1974-07-27 | 1975-07-25 | |
| NLAANVRAGE7508920,A NL179091C (nl) | 1974-07-27 | 1975-07-25 | Elektrochemische gasdetector. |
| DK340275A DK340275A (da) | 1974-07-27 | 1975-07-25 | Elektrokemiske gasdetektorer |
| JP9034075A JPS555052B2 (esLanguage) | 1974-07-27 | 1975-07-25 | |
| CA232,221A CA1071304A (en) | 1974-07-27 | 1975-07-25 | Electrochemical gas detectors |
| FR7523368A FR2280078A1 (fr) | 1974-07-27 | 1975-07-25 | Analyseur electrochimique de gaz |
| IT25804/75A IT1040137B (it) | 1974-07-27 | 1975-07-25 | Rivelatori di gas elettrochimici |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742436261 DE2436261B2 (de) | 1974-07-27 | 1974-07-27 | Elektrochemische gasdetektoren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2436261A1 DE2436261A1 (de) | 1976-02-12 |
| DE2436261B2 true DE2436261B2 (de) | 1976-11-25 |
Family
ID=5921708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742436261 Granted DE2436261B2 (de) | 1974-07-27 | 1974-07-27 | Elektrochemische gasdetektoren |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4049503A (esLanguage) |
| JP (1) | JPS555052B2 (esLanguage) |
| BE (1) | BE831673A (esLanguage) |
| CA (1) | CA1071304A (esLanguage) |
| DE (1) | DE2436261B2 (esLanguage) |
| DK (1) | DK340275A (esLanguage) |
| FR (1) | FR2280078A1 (esLanguage) |
| GB (1) | GB1509582A (esLanguage) |
| IT (1) | IT1040137B (esLanguage) |
| LU (1) | LU73068A1 (esLanguage) |
| NL (1) | NL179091C (esLanguage) |
| SE (1) | SE424471B (esLanguage) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2808165A1 (de) * | 1977-02-28 | 1978-08-31 | Gen Electric | Spannungsstabilisiert betriebener festpolymerelektrolyt-gasmessfuehler mit drei elektroden und mit hoechst temperaturunabhaengigen grundstromeigenschaften bei null-luft betrieb |
| DE2808339A1 (de) * | 1977-02-28 | 1978-09-07 | Ici Ltd | Elektrochemische vorrichtung zum aufspueren und/oder ueberwachen einer komponente in einem fluid |
| DE2951650A1 (de) * | 1978-12-26 | 1980-07-03 | Catalyst Research Corp | Elektrochemische zelle zum nachweis von chlorgas |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2621676C3 (de) * | 1976-05-15 | 1979-01-11 | Bayer Ag, 5090 Leverkusen | Elektrochemischer Gasdetektor zum Nachweis von Gasspuren |
| DE2627487A1 (de) * | 1976-06-18 | 1977-12-29 | Bayer Ag | Elektrochemischer nachweis von phosgen in gasgemischen |
| DE2657570C3 (de) * | 1976-12-18 | 1980-11-20 | Bayer Ag, 5090 Leverkusen | Elektrochemische Zelle zum Nachweis von Schwefelwasserstoff in einem Gasgemisch |
| DE2715285C2 (de) * | 1977-04-05 | 1983-08-25 | Vjačeslav Michajlovič Puškino Moskovskaja oblast' Krylov | Elektrochemische Zelle zum Bestimmen von Wasserstoff und wasserstoffhaltigen Reduktionsmitteln |
| DE2832328C2 (de) * | 1977-07-27 | 1986-08-07 | Coal Industry (Patents) Ltd., London | Gassensor mit elektrochemischer Zelle |
| DE2733781A1 (de) | 1977-07-27 | 1979-02-15 | Hartmann & Braun Ag | Elektrochemische messzellen |
| US4123700A (en) * | 1977-11-14 | 1978-10-31 | General Electric Company | Potentiostated, self-humidifying, solid polymer electrolyte carbon monoxide dosimeter |
| US4169779A (en) * | 1978-12-26 | 1979-10-02 | Catalyst Research Corporation | Electrochemical cell for the detection of hydrogen sulfide |
| US4326200A (en) * | 1979-05-18 | 1982-04-20 | Neotronics Limited | Gas detecting and measuring apparatus |
| JPS5670928U (esLanguage) * | 1979-11-06 | 1981-06-11 | ||
| JPS56112641A (en) * | 1980-02-12 | 1981-09-05 | Mitsubishi Chem Ind Ltd | Electrolytic solution for coulometric titration by karl fischer method |
| DE3033796A1 (de) * | 1980-09-09 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Elektrochemischer sensor zum nachweis reduzierender gase, insbesondere von kohlenmonoxid, hydrazin und wasserstoff in luft |
| US4473456A (en) * | 1981-04-08 | 1984-09-25 | National Research Development Corporation | Conductimetric gas sensor |
| JPS57187647A (en) * | 1981-05-15 | 1982-11-18 | Hitachi Ltd | Combustion detector |
| DE3129680A1 (de) * | 1981-07-28 | 1983-02-17 | Bayer Ag, 5090 Leverkusen | Messeinrichtung zur analytischen bestimmung eines gaspartialdruckes |
| DE3277134D1 (en) * | 1982-06-07 | 1987-10-08 | Dow Chemical Co | Analyzer for chemical oxidizing or reducing agents |
| US4460448A (en) * | 1982-09-30 | 1984-07-17 | The Dow Chemical Company | Calibration unit for gases |
| JPS59107980A (ja) * | 1982-12-07 | 1984-06-22 | イビデン株式会社 | 薄板状セラミツクス焼結体の製造方法 |
| US4469562A (en) * | 1982-12-29 | 1984-09-04 | Chang Kuo Wei | Carbon dioxide sensor |
| CH661128A5 (de) * | 1983-09-07 | 1987-06-30 | Proton Ag | Messsonde zu potentiometrischer messung von ionenkonzentrationen, verfahren zu deren herstellung und ihre verwendung. |
| US4525266A (en) * | 1983-10-13 | 1985-06-25 | Allied Corporation | Electrochemical gas sensor |
| US4522690A (en) * | 1983-12-01 | 1985-06-11 | Honeywell Inc. | Electrochemical sensing of carbon monoxide |
| US4595486A (en) * | 1985-02-01 | 1986-06-17 | Allied Corporation | Electrochemical gas sensor |
| DE3609402A1 (de) * | 1986-03-20 | 1987-09-24 | Bayer Diagnostic & Electronic | Verfahren zur herstellung elektrochemischer gassensoren |
| JP2511880B2 (ja) * | 1986-06-03 | 1996-07-03 | 松下電器産業株式会社 | 冷媒加熱器 |
| DE3715260C3 (de) * | 1987-05-08 | 1994-07-07 | Licentia Gmbh | Vorrichtung zum Nachweisen und zur quantitativen Bestimmung von Stickstoffdioxid in einem Gasgemisch |
| WO1988008975A2 (en) * | 1987-05-15 | 1988-11-17 | National Research Development Corporation | Electrochemical sensor with solid phase electrolyte |
| US4812221A (en) * | 1987-07-15 | 1989-03-14 | Sri International | Fast response time microsensors for gaseous and vaporous species |
| JPH0170011U (esLanguage) * | 1987-10-28 | 1989-05-10 | ||
| GB8927377D0 (en) * | 1989-12-04 | 1990-01-31 | Univ Edinburgh | Improvements in and relating to amperometric assays |
| DE4128494A1 (de) * | 1991-08-28 | 1993-03-04 | Bayer Ag | Elektrochemischer sensor |
| GB9218376D0 (en) * | 1992-08-28 | 1992-10-14 | Cranfield Inst Of Tech | Media for biocatalytic electrochemical reactions in the gaseous phase |
| DE19708038C2 (de) * | 1997-02-28 | 2000-03-09 | Draegerwerk Ag | Elektrochemische Meßzelle zum Nachweis von Phosgen |
| US6248224B1 (en) * | 1999-05-12 | 2001-06-19 | Mst Analytics Inc. | Toxic sensor and method of manufacture |
| AU2003251278A1 (en) * | 2002-09-16 | 2004-04-30 | Aerocrine Ab | Sensor holder |
| GB2404738B (en) * | 2003-08-04 | 2005-09-28 | Schlumberger Holdings | System and method for sensing using diamond based microelectrodes |
| US7678253B2 (en) * | 2003-08-11 | 2010-03-16 | Mehrooz Zamanzadeh | Atmospheric corrosion sensor |
| US7407998B2 (en) * | 2004-09-28 | 2008-08-05 | Arkema France | Stabilized UV transparent acrylic composition |
| US20060074161A1 (en) * | 2004-09-28 | 2006-04-06 | Shi-Jun Yang | Stabilized UV transparent acrylic composition |
| AU2008222632A1 (en) * | 2007-03-08 | 2008-09-12 | Fsp Instruments, Inc. | Gas analyzer |
| US20120276648A1 (en) * | 2011-04-29 | 2012-11-01 | Schlumberger Technology Corporation | Electrostatically stabilized metal sulfide nanoparticles for colorimetric measurement of hydrogen sulfide |
| JP6622955B2 (ja) * | 2014-10-09 | 2019-12-18 | 株式会社パイロットコーポレーション | ガスセンサ用ゲル状組成物 |
| JP2016148589A (ja) * | 2015-02-12 | 2016-08-18 | セイコーエプソン株式会社 | センサー用ゲルおよびセンサー |
| EP3735583A4 (en) | 2018-01-22 | 2021-10-27 | Insyte Systems, Inc. | LOW IMPEDANCE SENSOR FOR LOW DENSITY MATERIALS |
| EP4403185A4 (en) | 2021-09-15 | 2025-10-08 | Univ Of The Ryukyus | PHARMACEUTICAL COMPOSITION INTENDED FOR USE IN THE TREATMENT OF EITHER THE DECLINE OF COGNITIVE FUNCTIONS OR OVERWEIGHT OR OBESITY |
| US20240398775A1 (en) | 2021-09-15 | 2024-12-05 | University Of The Ryukyus | Pharmaceutical composition for use in treating cognitive decline or for use in treating overweight or obesity |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3160577A (en) * | 1961-03-24 | 1964-12-08 | Bendix Corp | Sensing unit |
| US3272725A (en) * | 1963-05-08 | 1966-09-13 | Pan American Petroleum Corp | Method of electrolytically testing oxygen concentration |
| US3258415A (en) * | 1964-05-11 | 1966-06-28 | Union Carbide Corp | Oxygen analyzer and oxygen-depolarized cell therefor |
| US3857760A (en) * | 1968-07-08 | 1974-12-31 | Bayer Ag | Process of measuring the concentration of a dissociatable component in a gas and apparatus therefor |
| US3912614A (en) * | 1972-01-10 | 1975-10-14 | Int Biophysics Corp | Sensor |
| US3785948A (en) * | 1972-02-14 | 1974-01-15 | Dudley Wright H | Electrochemical oxygen detector |
-
1974
- 1974-07-27 DE DE19742436261 patent/DE2436261B2/de active Granted
-
1975
- 1975-07-22 GB GB30598/75A patent/GB1509582A/en not_active Expired
- 1975-07-24 SE SE7508441A patent/SE424471B/xx not_active IP Right Cessation
- 1975-07-24 US US05/598,601 patent/US4049503A/en not_active Expired - Lifetime
- 1975-07-24 BE BE158557A patent/BE831673A/xx not_active IP Right Cessation
- 1975-07-25 NL NLAANVRAGE7508920,A patent/NL179091C/xx not_active IP Right Cessation
- 1975-07-25 LU LU73068A patent/LU73068A1/xx unknown
- 1975-07-25 CA CA232,221A patent/CA1071304A/en not_active Expired
- 1975-07-25 JP JP9034075A patent/JPS555052B2/ja not_active Expired
- 1975-07-25 DK DK340275A patent/DK340275A/da unknown
- 1975-07-25 FR FR7523368A patent/FR2280078A1/fr active Granted
- 1975-07-25 IT IT25804/75A patent/IT1040137B/it active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2808165A1 (de) * | 1977-02-28 | 1978-08-31 | Gen Electric | Spannungsstabilisiert betriebener festpolymerelektrolyt-gasmessfuehler mit drei elektroden und mit hoechst temperaturunabhaengigen grundstromeigenschaften bei null-luft betrieb |
| DE2808339A1 (de) * | 1977-02-28 | 1978-09-07 | Ici Ltd | Elektrochemische vorrichtung zum aufspueren und/oder ueberwachen einer komponente in einem fluid |
| DE2951650A1 (de) * | 1978-12-26 | 1980-07-03 | Catalyst Research Corp | Elektrochemische zelle zum nachweis von chlorgas |
Also Published As
| Publication number | Publication date |
|---|---|
| DK340275A (da) | 1976-01-28 |
| DE2436261A1 (de) | 1976-02-12 |
| GB1509582A (en) | 1978-05-04 |
| NL7508920A (nl) | 1976-01-29 |
| FR2280078A1 (fr) | 1976-02-20 |
| JPS5137287A (esLanguage) | 1976-03-29 |
| LU73068A1 (esLanguage) | 1976-07-01 |
| SE7508441L (sv) | 1976-01-28 |
| NL179091C (nl) | 1986-07-01 |
| JPS555052B2 (esLanguage) | 1980-02-04 |
| BE831673A (fr) | 1976-01-26 |
| FR2280078B1 (esLanguage) | 1981-08-07 |
| US4049503A (en) | 1977-09-20 |
| SE424471B (sv) | 1982-07-19 |
| CA1071304A (en) | 1980-02-05 |
| IT1040137B (it) | 1979-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2436261B2 (de) | Elektrochemische gasdetektoren | |
| DE3841622C2 (esLanguage) | ||
| DE3405431C2 (esLanguage) | ||
| DE69624885T2 (de) | Fühler für Kohlenstoffmonoxyd und toxische Gase mit Feuchtigkeitskompensation mit Hilfe von protonenleitenden Membranen und dessen Herstellungsverfahren | |
| DE69429892T2 (de) | Festkörper-Ionen-Sensor | |
| DE2951650C2 (de) | Elektrochemische Zelle zum Nachweis von Chlorgas | |
| EP0069285A1 (de) | Verfahren und Vorrichtung zur quantitativen Bestimmung von Kationen oder Anionen durch Ionenchromatographie | |
| WO2022236354A1 (de) | Verfahren zur herstellung eines sensors sowie sensor | |
| DE19780491B4 (de) | CO-Gassensor und Verfahren zur Messung der Konzentration von CO-Gas | |
| CH679526A5 (esLanguage) | ||
| DE102013007872A1 (de) | Elektrochemischer Gassensor, Verfahren zu dessen Herstellung und dessen Verwendung | |
| CH635200A5 (de) | Verfahren zur einstellung des ph-wertes eines probenstromes in einem potentiometrischen system zur messung niedriger ionenaktivitaeten. | |
| DE2215378C3 (de) | Ionenselektive Meßelektrode | |
| EP1377818B1 (de) | Verfahren und vorrichtung zur erfassung der konzentration einer sauerstoffhaltigen verbindung in einem messgas | |
| EP1480038B1 (de) | Potentiometrische, ionenselektive Elektrode | |
| DE2926172A1 (de) | Verfahren zur messung von aktivitaeten mit festen ionenleitern | |
| DE1598896B1 (de) | Elektrochemische elektrodenanordnung | |
| DE3841623C2 (esLanguage) | ||
| DE1598196A1 (de) | Elektrochemische Apparatur | |
| DE60122930T2 (de) | Verfahren zur messung der konzentration von verunreinigungen in stickstoff, wasserstoff und sauerstoff mittels eines ionenmobilitäts-spektrometers | |
| DE102013014994A1 (de) | Elektrochemischer Gassensor, flüssiger Elektrolyt und Verwendung eines flüssigen Elektrolyten in einem elektrochemischen Gassensor | |
| EP1936365A2 (de) | Set mit ionenselektiven Festkontakt-Elektroden | |
| DE19727051A1 (de) | Elektrolytische Lösung für die coulometrische Tetration nach Karl Fischer und Verfahren zur Bestimmung des Wassergehalts unter Verwendung der elektrolytischen Lösung | |
| EP2128606A1 (de) | Referenz-Pufferlösung für die Schnell-Kalibrierung von pH-Messeinrichtungen | |
| EP0533682A1 (de) | Verfahren und vorrichtung zum nachweisen von messubstanzen in einer umgebungssubstanz, insbesondere zum nachweisen gasförmiger kampfstoffe in umgebungsluft. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |