DE2350800A1 - Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittel - Google Patents
Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittelInfo
- Publication number
- DE2350800A1 DE2350800A1 DE19732350800 DE2350800A DE2350800A1 DE 2350800 A1 DE2350800 A1 DE 2350800A1 DE 19732350800 DE19732350800 DE 19732350800 DE 2350800 A DE2350800 A DE 2350800A DE 2350800 A1 DE2350800 A1 DE 2350800A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- oxygen
- lower alkyl
- haloalkyl
- weed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 241000196324 Embryophyta Species 0.000 title claims description 29
- 239000011814 protection agent Substances 0.000 title 1
- 239000004009 herbicide Substances 0.000 claims description 42
- 150000001875 compounds Chemical class 0.000 claims description 26
- 230000002363 herbicidal effect Effects 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 14
- 239000001301 oxygen Substances 0.000 claims description 14
- 125000001188 haloalkyl group Chemical group 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 230000006378 damage Effects 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 5
- 238000009331 sowing Methods 0.000 claims description 5
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 229960001413 acetanilide Drugs 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 3
- 231100000208 phytotoxic Toxicity 0.000 claims description 3
- 230000000885 phytotoxic effect Effects 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- YZHUMGUJCQRKBT-UHFFFAOYSA-M sodium chlorate Chemical compound [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 claims 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 3
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims 2
- 101100014660 Rattus norvegicus Gimap8 gene Proteins 0.000 claims 1
- 241001243925 Sia Species 0.000 claims 1
- 239000003139 biocide Substances 0.000 claims 1
- 239000012459 cleaning agent Substances 0.000 claims 1
- 244000038559 crop plants Species 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 54
- 241000209219 Hordeum Species 0.000 description 45
- 235000007340 Hordeum vulgare Nutrition 0.000 description 44
- 240000008042 Zea mays Species 0.000 description 39
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 39
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 37
- 235000005822 corn Nutrition 0.000 description 37
- 240000007594 Oryza sativa Species 0.000 description 32
- 235000007164 Oryza sativa Nutrition 0.000 description 32
- 235000009566 rice Nutrition 0.000 description 31
- 240000002791 Brassica napus Species 0.000 description 29
- 235000006008 Brassica napus var napus Nutrition 0.000 description 28
- 239000002689 soil Substances 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 241000208818 Helianthus Species 0.000 description 15
- 235000003222 Helianthus annuus Nutrition 0.000 description 15
- 230000000694 effects Effects 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 240000006394 Sorghum bicolor Species 0.000 description 11
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 11
- 239000000654 additive Substances 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 11
- 230000001681 protective effect Effects 0.000 description 11
- 241000251730 Chondrichthyes Species 0.000 description 9
- -1 chlor- Chemical class 0.000 description 9
- 239000003223 protective agent Substances 0.000 description 9
- 244000068988 Glycine max Species 0.000 description 8
- 235000010469 Glycine max Nutrition 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 241000209140 Triticum Species 0.000 description 8
- 235000021307 Triticum Nutrition 0.000 description 8
- 230000000996 additive effect Effects 0.000 description 8
- 239000011550 stock solution Substances 0.000 description 8
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000000729 antidote Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 235000021186 dishes Nutrition 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 3
- 235000021536 Sugar beet Nutrition 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 3
- 244000045561 useful plants Species 0.000 description 3
- COAABSMONFNYQH-TTWCUHKNSA-N (2r,3s,4s,5r,6s)-2-(hydroxymethyl)-6-(oxiran-2-ylmethylsulfanyl)oxane-3,4,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1SCC1OC1 COAABSMONFNYQH-TTWCUHKNSA-N 0.000 description 2
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 2
- SNPQRYOQWLOTFA-UHFFFAOYSA-N 2,2-dimethyl-1,3-thiazolidine Chemical compound CC1(C)NCCS1 SNPQRYOQWLOTFA-UHFFFAOYSA-N 0.000 description 2
- 235000009393 Avena byzantina Nutrition 0.000 description 2
- BCBIXNWEWWQJST-UHFFFAOYSA-N ClICl Chemical compound ClICl BCBIXNWEWWQJST-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229940075522 antidotes Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000004568 cement Substances 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LWRUUUCNUQUOLE-UHFFFAOYSA-N 1-(2,2-dimethyl-1,3-oxazolidin-3-yl)heptan-1-one Chemical compound CCCCCCC(=O)N1CCOC1(C)C LWRUUUCNUQUOLE-UHFFFAOYSA-N 0.000 description 1
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical group OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 1
- XMPCGZCCOXWBKR-UHFFFAOYSA-N 2,2,5-trimethyl-1,3-oxazolidine Chemical compound CC1CNC(C)(C)O1 XMPCGZCCOXWBKR-UHFFFAOYSA-N 0.000 description 1
- MADHRARJBVVSRO-UHFFFAOYSA-N 2,2-dibromo-1-(2,2-dimethyl-1,3-thiazolidin-3-yl)ethanone Chemical compound CC1(C)SCCN1C(=O)C(Br)Br MADHRARJBVVSRO-UHFFFAOYSA-N 0.000 description 1
- LQBBYHUQQRZRLK-UHFFFAOYSA-N 2,2-dibromoacetyl chloride Chemical compound ClC(=O)C(Br)Br LQBBYHUQQRZRLK-UHFFFAOYSA-N 0.000 description 1
- LWIIQWXXUZNQQV-UHFFFAOYSA-N 2,2-dichloro-1-(2,2-dimethyl-1,3-thiazolidin-3-yl)ethanone Chemical compound CC1(C)SCCN1C(=O)C(Cl)Cl LWIIQWXXUZNQQV-UHFFFAOYSA-N 0.000 description 1
- VSHIRTNKIXRXMI-UHFFFAOYSA-N 2,2-dimethyl-1,3-oxazolidine Chemical compound CC1(C)NCCO1 VSHIRTNKIXRXMI-UHFFFAOYSA-N 0.000 description 1
- HWKWYDXHMQQDQJ-UHFFFAOYSA-N 2,3-dibromopropanoyl chloride Chemical compound ClC(=O)C(Br)CBr HWKWYDXHMQQDQJ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- AVJIQBUUPACBPG-UHFFFAOYSA-N 2-ethyl-1,3-oxazolidine Chemical compound CCC1NCCO1 AVJIQBUUPACBPG-UHFFFAOYSA-N 0.000 description 1
- MKQHZRFXQHLZKC-UHFFFAOYSA-N 2-ethyl-n-(methoxymethyl)-n-phenylbutanamide Chemical compound CCC(CC)C(=O)N(COC)C1=CC=CC=C1 MKQHZRFXQHLZKC-UHFFFAOYSA-N 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- OTKXAIYSRRYVDF-UHFFFAOYSA-N 4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound C(C)(C)NC1=NC(=NC=N1)NC1CC1 OTKXAIYSRRYVDF-UHFFFAOYSA-N 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241000407429 Maja Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- YNQSILKYZQZHFJ-UHFFFAOYSA-N R-29148 Chemical compound CC1CN(C(=O)C(Cl)Cl)C(C)(C)O1 YNQSILKYZQZHFJ-UHFFFAOYSA-N 0.000 description 1
- 235000017016 Setaria faberi Nutrition 0.000 description 1
- 241000820191 Setaria magna Species 0.000 description 1
- QHTQREMOGMZHJV-UHFFFAOYSA-N Thiobencarb Chemical compound CCN(CC)C(=O)SCC1=CC=C(Cl)C=C1 QHTQREMOGMZHJV-UHFFFAOYSA-N 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 241000482268 Zea mays subsp. mays Species 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-DVKNGEFBSA-N alpha-D-glucose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-DVKNGEFBSA-N 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- XPHBRTNHVJSEQD-UHFFFAOYSA-N anidoxime Chemical group C=1C=CC=CC=1C(CCN(CC)CC)=NOC(=O)NC1=CC=C(OC)C=C1 XPHBRTNHVJSEQD-UHFFFAOYSA-N 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- UCVODTZQZHMTPN-UHFFFAOYSA-N heptanoyl chloride Chemical compound CCCCCCC(Cl)=O UCVODTZQZHMTPN-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- QCMHWZUFWLOOGI-UHFFFAOYSA-N s-ethyl chloromethanethioate Chemical compound CCSC(Cl)=O QCMHWZUFWLOOGI-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000004557 technical material Substances 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D263/06—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by oxygen atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/04—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pretreatment Of Seeds And Plants (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29756172A | 1972-10-13 | 1972-10-13 | |
| US05/356,547 US3989503A (en) | 1972-10-13 | 1973-05-02 | Herbicidal antidote compositions with substituted oxazolidines and thiazolidines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2350800A1 true DE2350800A1 (de) | 1974-04-25 |
| DE2350800C2 DE2350800C2 (da) | 1992-06-11 |
Family
ID=26970219
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732350800 Granted DE2350800A1 (de) | 1972-10-13 | 1973-10-10 | Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittel |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3989503A (da) |
| JP (1) | JPS5641601B2 (da) |
| CA (1) | CA1007067A (da) |
| CH (1) | CH598750A5 (da) |
| DD (1) | DD108643A5 (da) |
| DE (1) | DE2350800A1 (da) |
| DK (1) | DK146142C (da) |
| GB (2) | GB1457129A (da) |
| NL (1) | NL7314088A (da) |
| PH (2) | PH12709A (da) |
| RO (1) | RO88857A (da) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2905650A1 (de) * | 1978-02-06 | 1980-08-21 | Nitrokemia Ipartelepek | Unkrautvernichtungsmittel |
| EP2298075A1 (en) | 2006-01-13 | 2011-03-23 | Bayer CropScience AG | A herbicide composition for paddy field |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4021229A (en) * | 1972-09-05 | 1977-05-03 | Stauffer Chemical Company | Sulfonamide herbicide antidote compositions and method of use |
| BG22781A3 (bg) * | 1972-10-13 | 1977-04-20 | Stauffer Chemical Co. | Хербицидни състави,съдържащи противоотровно средство |
| US4249931A (en) * | 1979-06-18 | 1981-02-10 | Stauffer Chemical Company | 5-Oxy or thiomethyl substituted oxazolidine herbicide antidotes |
| US4249932A (en) * | 1979-06-18 | 1981-02-10 | Stauffer Chemical Company | 5-Phenoxymethyl substituted oxazolidine herbicide antidotes |
| BR7600775A (pt) * | 1975-02-14 | 1977-05-10 | Stauffer Chemical Co | Processo para a obtencao de(tio)haloacil-(tia)oxazolidinas arisubstituidas e composicoes herbicidas sinergeticas que as contem |
| US4636244A (en) * | 1975-11-03 | 1987-01-13 | Stauffer Chemical Co. | Haloacyl and thiohaloacyl aryl-substituted oxazolidines and thiazolidines - herbicidal antidotes |
| US4400200A (en) * | 1977-10-11 | 1983-08-23 | Stauffer Chemical Company | Haloacyl and thiohaloacyl aryl-substituted oxazolidines and thiazolidines - herbicidal antidotes |
| US4322240A (en) * | 1975-11-03 | 1982-03-30 | Stauffer Chemical Company | Haloacyl and thiohaloacyl aryl-substituted oxazolidines and thiazolidines-herbicidal antidotes |
| US4319031A (en) * | 1976-02-06 | 1982-03-09 | Stauffer Chemical Company | Substituted thiazolidines |
| US4379716A (en) * | 1976-03-26 | 1983-04-12 | Monsanto Company | Compositions and methods for reducing herbicidal injury |
| US4605431A (en) * | 1976-03-26 | 1986-08-12 | Monsanto Company | Compositions and methods for reducing herbicidal injury |
| HU178301B (en) * | 1978-02-06 | 1982-04-28 | Nitrokemia Ipartelepek | Herbicide compositions containing naphthaline-carboxylic acid derivatives as antidotes and carbamide derivatives and antidote compositions containing naphthaline-carboxylic acid derivatives |
| US4437875A (en) | 1980-04-14 | 1984-03-20 | Monsanto Company | 2,4-Disubstituted-5-thiazole-carboxylic acids and derivatives |
| US4602454A (en) * | 1978-05-15 | 1986-07-29 | Monsanto Company | 2,4-disubstituted-5-thiazole-carboxylic acids and derivatives |
| US4437876A (en) | 1980-04-14 | 1984-03-20 | Monsanto Company | 2,4-Disubstituted-5-thiazole-carboxylic acids and derivatives |
| US4602937A (en) * | 1978-05-15 | 1986-07-29 | Monsanto Company | 2,4-Disubstituted-5-thiazole-carboxylic acids and derivatives |
| DE2832974A1 (de) * | 1978-07-27 | 1980-02-14 | Basf Ag | Ein thiolcarbamat enthaltende herbizide mittel |
| GR66644B (da) * | 1978-07-27 | 1981-04-03 | Basf Ag | |
| US4182622A (en) * | 1978-07-28 | 1980-01-08 | Monsanto Company | 3-Phenacylidene phthalide safening agents |
| US4185989A (en) * | 1978-07-28 | 1980-01-29 | Monsanto Company | 3-Phenacyl phthaldide safening agents |
| US4243406A (en) * | 1978-12-26 | 1981-01-06 | Monsanto Company | 5-Aryl-4-isoxazolecarboxylate-safening agents |
| US4251261A (en) * | 1979-04-09 | 1981-02-17 | Monsanto Company | 2-Chloro-4-trifluoromethyl-5-thiazolecarboxylic acids and derivatives |
| US4380465A (en) * | 1979-04-27 | 1983-04-19 | Monsanto Company | 5-Aryl-4-isothiazolecarboxylic acids and derivatives |
| US4965368A (en) * | 1979-06-18 | 1990-10-23 | Ici Americas Inc. | 5-oxy or thiomethyl substituted oxazolidine herbicide antidotes |
| WO1981000406A1 (en) * | 1979-08-03 | 1981-02-19 | Stauffer Chemical Co | Spirooxazolidines and thiazolidines as herbicide antidotes |
| US4294764A (en) * | 1979-12-26 | 1981-10-13 | Ppg Industries, Inc. | N-(Optionally substituted 1,3-dioxolan- or dioxan-2-ylmethyl)-N-alkyl, alkenyl, or alkynyl-2,2-dichloroacetamides |
| US4338120A (en) * | 1980-04-21 | 1982-07-06 | Stauffer Chemical Company | Halo-substituted thionoacyl ketone herbicidal antidotes |
| US4350517A (en) * | 1980-04-25 | 1982-09-21 | Stauffer Chemical Company | Hydroxyacetyl oxaxolidine herbicidal antidotes |
| HU187284B (en) * | 1980-12-11 | 1985-12-28 | Mta Koezponti Kemiai Kutato In | Herbicide compositions containing antitoxines of aldehyde- and ketone-derivatives |
| US4586948A (en) * | 1981-04-22 | 1986-05-06 | Monsanto Company | 2,4-disubstituted-5-thiazole-carboxylic acids and derivatives |
| US4483706A (en) * | 1981-11-04 | 1984-11-20 | Stauffer Chemical Company | Haloacyl and thiohaloacyl aryl-substituted oxazolidines and thiazolidines herbicidal antidotes |
| US4938796A (en) * | 1987-07-06 | 1990-07-03 | Ici Americas Inc. | Herbicidal compositions of acylated 1,3-dicarbonyl herbicides and antidotes therefor |
| US5256630A (en) * | 1987-08-13 | 1993-10-26 | Monsanto Company | Safening mixtures of sulfonylurea and acetanilide herbicides |
| US4824468A (en) * | 1987-10-13 | 1989-04-25 | Ici Americas Inc. | Herbicidal oxazolidines and methods of use |
| US5484760A (en) * | 1990-12-31 | 1996-01-16 | Monsanto Company | Herbicide antidotes as safeners for reducing phytotoxicity resulting from synergistic interaction between herbicides and other pesticides |
| JPH0621818U (ja) * | 1992-02-20 | 1994-03-22 | 天龍製鋸株式会社 | 回転鋸型切断機 |
| DE10337497A1 (de) | 2003-08-14 | 2005-03-10 | Bayer Cropscience Ag | 4-Biphenylsubstituierte-Pyrazolidin-3,5-dion-Derivate |
| DE10351647A1 (de) * | 2003-11-05 | 2005-06-09 | Bayer Cropscience Ag | 2-Halogen-6-alkyl-phenyl substituierte Tetramsäure-Derivate |
| DE102005008033A1 (de) * | 2005-02-22 | 2006-08-24 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| US7749224B2 (en) * | 2005-12-08 | 2010-07-06 | Ebi, Llc | Foot plate fixation |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2218097A1 (de) * | 1971-04-16 | 1972-11-02 | Stauffer Chemical Co., New York, N. Y. (V.StA.) | Herbizides Mittel und seine Verwendung |
| DE2350547C2 (de) * | 1972-10-13 | 1986-10-23 | Stauffer Chemical Co., Westport, Conn. | N-Dichloracetyl-2,2,5-trimethyl-oxazolidin |
| DE2266035C2 (da) * | 1971-12-09 | 1987-10-29 | Stauffer Chemical Co.,, New York, N.Y., Us |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3131509A (en) * | 1961-05-08 | 1964-05-05 | Spencer Chem Co | Compositions and methods for reducing herbicidal injury |
| US3719466A (en) * | 1970-04-16 | 1973-03-06 | Gulf Research Development Co | Protection of wheat and grain sorghum from herbicidal injury |
-
1973
- 1973-05-02 US US05/356,547 patent/US3989503A/en not_active Expired - Lifetime
- 1973-10-03 GB GB4616173A patent/GB1457129A/en not_active Expired
- 1973-10-03 GB GB1221076A patent/GB1457130A/en not_active Expired
- 1973-10-04 CA CA182,645A patent/CA1007067A/en not_active Expired
- 1973-10-05 PH PH15093A patent/PH12709A/en unknown
- 1973-10-08 RO RO7376275A patent/RO88857A/ro unknown
- 1973-10-10 DK DK549173A patent/DK146142C/da not_active IP Right Cessation
- 1973-10-10 DE DE19732350800 patent/DE2350800A1/de active Granted
- 1973-10-11 JP JP11333673A patent/JPS5641601B2/ja not_active Expired
- 1973-10-12 CH CH1453373A patent/CH598750A5/xx not_active IP Right Cessation
- 1973-10-12 DD DD174027A patent/DD108643A5/xx unknown
- 1973-10-12 NL NL7314088A patent/NL7314088A/xx not_active Application Discontinuation
-
1978
- 1978-03-07 PH PH20853A patent/PH13514A/en unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2218097A1 (de) * | 1971-04-16 | 1972-11-02 | Stauffer Chemical Co., New York, N. Y. (V.StA.) | Herbizides Mittel und seine Verwendung |
| DE2266035C2 (da) * | 1971-12-09 | 1987-10-29 | Stauffer Chemical Co.,, New York, N.Y., Us | |
| DE2350547C2 (de) * | 1972-10-13 | 1986-10-23 | Stauffer Chemical Co., Westport, Conn. | N-Dichloracetyl-2,2,5-trimethyl-oxazolidin |
Non-Patent Citations (1)
| Title |
|---|
| Can. J. Plant. Sci. 52, 707-714 * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2905650A1 (de) * | 1978-02-06 | 1980-08-21 | Nitrokemia Ipartelepek | Unkrautvernichtungsmittel |
| EP2298075A1 (en) | 2006-01-13 | 2011-03-23 | Bayer CropScience AG | A herbicide composition for paddy field |
Also Published As
| Publication number | Publication date |
|---|---|
| PH12709A (en) | 1979-07-20 |
| US3989503A (en) | 1976-11-02 |
| GB1457130A (en) | 1976-12-01 |
| NL7314088A (da) | 1974-04-16 |
| DK146142C (da) | 1983-12-05 |
| RO88857A (ro) | 1986-03-31 |
| CH598750A5 (da) | 1978-05-12 |
| DK146142B (da) | 1983-07-11 |
| JPS5641601B2 (da) | 1981-09-29 |
| DD108643A5 (da) | 1974-10-05 |
| PH13514A (en) | 1980-06-03 |
| CA1007067A (en) | 1977-03-22 |
| GB1457129A (en) | 1976-12-01 |
| JPS4993543A (da) | 1974-09-05 |
| DE2350800C2 (da) | 1992-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2350800A1 (de) | Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittel | |
| EP0012158B1 (de) | Oximderivate und ihre Anwendung zum Schutz von Pflanzenkulturen | |
| DE2350547A1 (de) | Neue substituierte oxazolidine und thiazolidine | |
| DE2212268B2 (de) | N-Halogenacetylanilinoessigsäureester, Verfahren zu deren Herstellung und diese enthaltende herbicide Massen | |
| EP0010588B1 (de) | Schwefelhaltige Oxim-Verbindungen und ihre Verwendung zum Schutz von Kulturpflanzen | |
| EP0063101A1 (de) | Nitroaryl-alkylsulfon-derivate als Gametozide | |
| EP0026872B1 (de) | Pflanzenwachstumsregulierende Mittel enthaltend substituierte Alkylammoniumsalze und deren Verwendung | |
| DD146536A5 (de) | Verfahren zum schutz von pflanzenkulturen | |
| DE2421195C2 (de) | Thiazolidinverbindungen sowie dieselben enthaltendes Herbizid-Antidot | |
| EP0133155A2 (de) | Mittel und Verfahren zur Steigerung des Ernteertrages | |
| CH619599A5 (en) | Method of protecting crops. | |
| EP0252875B1 (de) | Mikrobizide Mittel | |
| DE2441741C2 (de) | Saatschützende herbizide Zubereitung und ihre Verwendung | |
| DE2519085C3 (de) | Substituierte Benzolmethanolverbindungen und diese enthaltende herbizide Mittel | |
| DE4011781A1 (de) | Herbizides mittel | |
| DD202490A5 (de) | Herbizide zusammensetzung | |
| DE1936218C3 (de) | Bekämpfung von Nematoden | |
| CH635083A5 (de) | 1-alkylcarbonyl-3-(3,5-dihalogenphenyl)-imidazolidin-2,4-dione mit verzweigter alkylgruppe im alkylcarbonylrest. | |
| EP0106949A2 (de) | 3,7-Dichlor-8-chinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE1301175B (de) | Totalherbizid mit insektizider Wirkung | |
| EP0210445A1 (de) | Mittel zur Regulierung des Pflanzenwachstums | |
| DE2361189A1 (de) | Oximino-thiolphosphorsaeureester, verfahren zu deren herstellung und deren verwendung als pestizide | |
| DE3034063A1 (de) | N(pfeil hoch)4(pfeil hoch)-phenoxyalkanoylsulfanilamide, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1668081A1 (de) | Verfahren zur Herstellung von neuen Mucononitrilen und diese enthaltende pesticide Zusammensetzungen sowie neue Muconitrile | |
| DE2356892A1 (de) | Alpha-pyron-derivate, ihre herstellung und ihre verwendung als selektivherbicide, pflanzenwachstumsregulatoren und fungicide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8176 | Proceedings suspended because of application no: |
Ref document number: 2266035 Country of ref document: DE Format of ref document f/p: P |
|
| 8178 | Suspension cancelled | ||
| D2 | Grant after examination |