DE2347551C3 - Trisazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung zum Färben von Papier und Leder - Google Patents
Trisazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung zum Färben von Papier und LederInfo
- Publication number
- DE2347551C3 DE2347551C3 DE2347551A DE2347551A DE2347551C3 DE 2347551 C3 DE2347551 C3 DE 2347551C3 DE 2347551 A DE2347551 A DE 2347551A DE 2347551 A DE2347551 A DE 2347551A DE 2347551 C3 DE2347551 C3 DE 2347551C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- dyes
- leather
- dye
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 17
- 239000010985 leather Substances 0.000 title description 22
- 238000004043 dyeing Methods 0.000 title description 17
- 238000000034 method Methods 0.000 title description 9
- 230000008569 process Effects 0.000 title description 5
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000000975 dye Substances 0.000 description 68
- 230000008878 coupling Effects 0.000 description 20
- 238000010168 coupling process Methods 0.000 description 20
- 238000005859 coupling reaction Methods 0.000 description 20
- -1 nitro, cyano, amino Chemical group 0.000 description 20
- 239000000123 paper Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 125000000217 alkyl group Chemical group 0.000 description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 125000000129 anionic group Chemical group 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 150000008049 diazo compounds Chemical class 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 5
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical group NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- 239000000460 chlorine Chemical group 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- 239000001913 cellulose Substances 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000004677 Nylon Substances 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 229920001778 nylon Polymers 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 229920001131 Pulp (paper) Polymers 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 238000004026 adhesive bonding Methods 0.000 description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000011121 hardwood Substances 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000004745 nonwoven fabric Substances 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical class NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- FDXOYIGOUGEQBC-UHFFFAOYSA-N 8-(4-methylanilino)naphthalene-1-sulfonic acid Chemical compound C1=CC(C)=CC=C1NC1=CC=CC2=CC=CC(S(O)(=O)=O)=C12 FDXOYIGOUGEQBC-UHFFFAOYSA-N 0.000 description 1
- FWEOQOXTVHGIFQ-UHFFFAOYSA-N 8-anilinonaphthalene-1-sulfonic acid Chemical compound C=12C(S(=O)(=O)O)=CC=CC2=CC=CC=1NC1=CC=CC=C1 FWEOQOXTVHGIFQ-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 235000019687 Lamb Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000011122 softwood Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B35/00—Disazo and polyazo dyes of the type A<-D->B prepared by diazotising and coupling
- C09B35/38—Trisazo dyes ot the type
- C09B35/44—Trisazo dyes ot the type the component K being a hydroxy amine
- C09B35/46—Trisazo dyes ot the type the component K being a hydroxy amine the component K being an amino naphthol
- C09B35/461—D being derived from diaminobenzene
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Paper (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1402872A CH571049A5 (en) | 1972-09-26 | 1972-09-26 | Azo dyes for leather, textiles, paper - give deep blue, black or green col-ours with high solidity |
| CH1541372 | 1972-10-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2347551A1 DE2347551A1 (de) | 1974-04-11 |
| DE2347551B2 DE2347551B2 (de) | 1978-04-27 |
| DE2347551C3 true DE2347551C3 (de) | 1978-12-21 |
Family
ID=25713493
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2347551A Expired DE2347551C3 (de) | 1972-09-26 | 1973-09-21 | Trisazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung zum Färben von Papier und Leder |
Country Status (11)
| Country | Link |
|---|---|
| JP (3) | JPS4972327A (enExample) |
| AR (1) | AR200025A1 (enExample) |
| CA (1) | CA1018521A (enExample) |
| DD (2) | DD108107A5 (enExample) |
| DE (1) | DE2347551C3 (enExample) |
| ES (1) | ES419015A1 (enExample) |
| FR (1) | FR2200258B1 (enExample) |
| GB (1) | GB1440088A (enExample) |
| IN (1) | IN142301B (enExample) |
| IT (1) | IT1008564B (enExample) |
| NL (1) | NL7313042A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR207654A1 (es) * | 1974-10-04 | 1976-10-22 | Sandoz Ag | Colorantes anionicos trisazoicos y procedimiento para obtenerlos |
| DE2903588A1 (de) * | 1979-01-31 | 1980-08-14 | Basf Ag | Polyazofarbstoffe |
| DE3118201A1 (de) * | 1981-05-08 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | Trisazofarbstoffe |
| US4668238A (en) * | 1984-10-18 | 1987-05-26 | Sandoz Ltd. | The dyeing of leather with mixtures of trisazo and tetrakisazo compounds having 1-amino-8-hydroxynaphthalene-mono- or di-sulfonic acid biscoupling component radicals |
| CH671023A5 (enExample) * | 1987-02-10 | 1989-07-31 | Ciba Geigy Ag |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE582399C (de) * | 1931-06-19 | 1933-08-14 | Chem Fab Vorm Sandoz | Verfahren zur Herstellung von Trisazofarbstoffen |
| FR835111A (fr) * | 1937-03-13 | 1938-12-13 | Prod Chim Fab De | Colorants polyazoïques et procédé de préparation de ces colorants |
| DE868034C (de) * | 1950-07-05 | 1953-04-02 | Ici Ltd | Verfahren zur Herstellung von neuen Trisazofarbstoffen |
| DE917991C (de) * | 1952-09-03 | 1954-09-16 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von neuen Trisazofarbstoffen |
| CH332137A (de) * | 1954-05-05 | 1958-08-31 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von neuen Polyazofarbstoffen |
-
1973
- 1973-09-20 GB GB4411673A patent/GB1440088A/en not_active Expired
- 1973-09-21 DE DE2347551A patent/DE2347551C3/de not_active Expired
- 1973-09-21 NL NL7313042A patent/NL7313042A/xx unknown
- 1973-09-24 DD DD173635A patent/DD108107A5/xx unknown
- 1973-09-24 ES ES419015A patent/ES419015A1/es not_active Expired
- 1973-09-24 DD DD178124*A patent/DD111089A5/xx unknown
- 1973-09-24 AR AR250219A patent/AR200025A1/es active
- 1973-09-25 IT IT52722/73A patent/IT1008564B/it active
- 1973-09-25 FR FR7334348A patent/FR2200258B1/fr not_active Expired
- 1973-09-25 CA CA181,853A patent/CA1018521A/en not_active Expired
- 1973-09-25 JP JP48107860A patent/JPS4972327A/ja active Pending
-
1974
- 1974-09-18 IN IN2077/CAL/1974A patent/IN142301B/en unknown
-
1976
- 1976-03-09 JP JP51024717A patent/JPS51132217A/ja active Pending
- 1976-03-09 JP JP51024716A patent/JPS51136801A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DD111089A5 (enExample) | 1975-01-20 |
| IT1008564B (it) | 1976-11-30 |
| AR200025A1 (es) | 1974-10-15 |
| FR2200258B1 (enExample) | 1977-05-27 |
| IN142301B (enExample) | 1977-06-25 |
| GB1440088A (en) | 1976-06-23 |
| ES419015A1 (es) | 1976-07-01 |
| JPS51132217A (en) | 1976-11-17 |
| FR2200258A1 (enExample) | 1974-04-19 |
| DE2347551A1 (de) | 1974-04-11 |
| JPS51136801A (en) | 1976-11-26 |
| JPS4972327A (enExample) | 1974-07-12 |
| NL7313042A (enExample) | 1974-03-28 |
| AU6063873A (en) | 1975-03-27 |
| CA1018521A (en) | 1977-10-04 |
| DD108107A5 (enExample) | 1974-09-05 |
| DE2347551B2 (de) | 1978-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE751343C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE3236238A1 (de) | Metallkomplexe sulfogruppenhaltiger disazoverbindungen, verfahren zur herstellung und verwendung | |
| DE2525418C3 (de) | Trisazoverbindungen, deren Herstellung und Verwendung | |
| DE2347551C3 (de) | Trisazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung zum Färben von Papier und Leder | |
| EP0016975B1 (de) | Polyazofarbstoffe sowie ihre Verwendung zum Färben von amino- und hydroxygruppenhaltigen Fasermaterialien und Leder | |
| DE943662C (de) | Verfahren zur Herstellung von Tris- und Polyazofarbstoffen | |
| DE2355279A1 (de) | Auf der faser diazotierbare direktfarbstoffe | |
| DE1769398C3 (de) | Wasserlösliche Phthalocyanin-Azofarbstoffe sowie Verfahren zu deren Herstellung und deren Verwendung | |
| DE2832756A1 (de) | 1 zu 2-chromkomplexe von disazofarbstoffen, deren herstellung und verwendung | |
| DE1292277B (de) | Verfahren zur Herstellung von Polyazofarbstoffen | |
| DE2408907C3 (de) | Wasserlösliche Tetrakisazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben von Leder | |
| CH623346A5 (enExample) | ||
| CH671023A5 (enExample) | ||
| DE852879C (de) | Verfahren zur Herstellung von Polyazofarbstoffen | |
| DE2541007A1 (de) | Wasserloesliche trisazofarbstoffe, ihre herstellung und verwendung | |
| DE2542410C2 (de) | Organische Verbindungen, deren Herstellung und Verwendung | |
| DE2431873A1 (de) | Azoverbindungen | |
| DE2033602A1 (de) | Polyazofarbstoffe, ihre Herstellung und Verwendung | |
| DE729230C (de) | Verfahren zum Drucken von tierischen Fasern oder Cellulosefasern oder Fasergemischen daraus mit Chrombeizenfarbstoffen | |
| DE724832C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE1247511B (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE180147C (enExample) | ||
| CH571049A5 (en) | Azo dyes for leather, textiles, paper - give deep blue, black or green col-ours with high solidity | |
| DE2159380C3 (de) | Polyazofarbstoffe und Verfahren zu deren Herstellung und Verwendung | |
| DE636355C (de) | Verfahren zur Herstellung von Azofarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2542410 Format of ref document f/p: P |