DE2303631C3 - Verfahren zur Herstellung eines verbesserten segmentierten thermoplastischen Mischpolyester-Elastomeren - Google Patents
Verfahren zur Herstellung eines verbesserten segmentierten thermoplastischen Mischpolyester-ElastomerenInfo
- Publication number
- DE2303631C3 DE2303631C3 DE2303631A DE2303631A DE2303631C3 DE 2303631 C3 DE2303631 C3 DE 2303631C3 DE 2303631 A DE2303631 A DE 2303631A DE 2303631 A DE2303631 A DE 2303631A DE 2303631 C3 DE2303631 C3 DE 2303631C3
- Authority
- DE
- Germany
- Prior art keywords
- ester
- mixed
- mixed polyester
- polyepoxide
- polyester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001169 thermoplastic Polymers 0.000 title claims description 7
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 7
- 229920001971 elastomer Polymers 0.000 title claims description 6
- 239000000806 elastomer Substances 0.000 title claims description 5
- 238000000034 method Methods 0.000 title description 13
- 229920000728 polyester Polymers 0.000 claims description 66
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 32
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 16
- 238000004519 manufacturing process Methods 0.000 claims description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 4
- 150000002009 diols Chemical class 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims 3
- 229920000647 polyepoxide Polymers 0.000 description 37
- 229920000642 polymer Polymers 0.000 description 29
- 239000003054 catalyst Substances 0.000 description 27
- 150000002148 esters Chemical group 0.000 description 25
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 14
- 239000000155 melt Substances 0.000 description 12
- 239000004593 Epoxy Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 8
- 239000004721 Polyphenylene oxide Substances 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 229920000570 polyether Polymers 0.000 description 7
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 6
- 238000001746 injection moulding Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000006068 polycondensation reaction Methods 0.000 description 6
- 230000015556 catabolic process Effects 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229920001451 polypropylene glycol Polymers 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229920001634 Copolyester Polymers 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical class [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 2
- 239000001639 calcium acetate Substances 0.000 description 2
- 229960005147 calcium acetate Drugs 0.000 description 2
- 235000011092 calcium acetate Nutrition 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- -1 dicarboxylic acid ester Chemical class 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011654 magnesium acetate Substances 0.000 description 2
- 235000011285 magnesium acetate Nutrition 0.000 description 2
- 229940069446 magnesium acetate Drugs 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical class C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- IUIRWOGXLQFRHG-UHFFFAOYSA-N 2-aminoethanol;trifluoroborane Chemical compound NCCO.FB(F)F IUIRWOGXLQFRHG-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- OXEZLYIDQPBCBB-UHFFFAOYSA-N 4-(3-piperidin-4-ylpropyl)piperidine Chemical compound C1CNCCC1CCCC1CCNCC1 OXEZLYIDQPBCBB-UHFFFAOYSA-N 0.000 description 1
- VSAWBBYYMBQKIK-UHFFFAOYSA-N 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-2,6-ditert-butylphenol Chemical compound CC1=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C1CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 VSAWBBYYMBQKIK-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000003679 aging effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 238000009750 centrifugal casting Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- JQZRVMZHTADUSY-UHFFFAOYSA-L di(octanoyloxy)tin Chemical compound [Sn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O JQZRVMZHTADUSY-UHFFFAOYSA-L 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 239000012971 dimethylpiperazine Substances 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- GIWKOZXJDKMGQC-UHFFFAOYSA-L lead(2+);naphthalene-2-carboxylate Chemical compound [Pb+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 GIWKOZXJDKMGQC-UHFFFAOYSA-L 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- DBIWHDFLQHGOCS-UHFFFAOYSA-N piperidine;trifluoroborane Chemical compound FB(F)F.C1CCNCC1 DBIWHDFLQHGOCS-UHFFFAOYSA-N 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 238000012667 polymer degradation Methods 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- WSFQLUVWDKCYSW-UHFFFAOYSA-M sodium;2-hydroxy-3-morpholin-4-ylpropane-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC(O)CN1CCOCC1 WSFQLUVWDKCYSW-UHFFFAOYSA-M 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004634 thermosetting polymer Substances 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L63/00—Compositions of epoxy resins; Compositions of derivatives of epoxy resins
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/42—Polycarboxylic acids; Anhydrides, halides or low molecular weight esters thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/66—Polyesters containing oxygen in the form of ether groups
- C08G63/668—Polyesters containing oxygen in the form of ether groups derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/672—Dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
- C08L67/025—Polyesters derived from dicarboxylic acids and dihydroxy compounds containing polyether sequences
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Epoxy Resins (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23004572A | 1972-02-28 | 1972-02-28 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2303631A1 DE2303631A1 (de) | 1973-09-20 |
| DE2303631B2 DE2303631B2 (de) | 1978-09-28 |
| DE2303631C3 true DE2303631C3 (de) | 1985-04-25 |
Family
ID=22863738
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2303631A Expired DE2303631C3 (de) | 1972-02-28 | 1973-01-25 | Verfahren zur Herstellung eines verbesserten segmentierten thermoplastischen Mischpolyester-Elastomeren |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3723568A (enExample) |
| JP (1) | JPS5543016B2 (enExample) |
| AR (1) | AR209413A1 (enExample) |
| BE (1) | BE794029A (enExample) |
| BR (1) | BR7301291D0 (enExample) |
| CA (1) | CA1010187A (enExample) |
| DE (1) | DE2303631C3 (enExample) |
| ES (1) | ES410715A1 (enExample) |
| FR (1) | FR2174000B1 (enExample) |
| GB (1) | GB1402966A (enExample) |
| IT (1) | IT983402B (enExample) |
| NL (1) | NL157625B (enExample) |
| SE (1) | SE406924B (enExample) |
| ZA (1) | ZA73189B (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3847029A (en) * | 1972-12-11 | 1974-11-12 | Dayco Corp | Endless power transmission belt and method of making same |
| US4020122A (en) * | 1973-01-05 | 1977-04-26 | General Electric Company | Process for the preparation of polyester compositions having increased melt elasticity |
| US3968015A (en) * | 1973-10-11 | 1976-07-06 | Raychem Corporation | Poly(tetramethyleneterephthalate) crosslinked by irradiation |
| US4113594A (en) * | 1973-10-11 | 1978-09-12 | Raychem Corporation | Poly(tetramethyleneterephthalate) crosslinked by irradiation |
| JPS5855167B2 (ja) * | 1974-01-29 | 1983-12-08 | 帝人株式会社 | 芳香族ポリエステル成型品の製造法 |
| JPS5928579B2 (ja) * | 1974-02-05 | 1984-07-13 | 帝人株式会社 | ポリエステルの製造方法 |
| GB1506910A (en) * | 1974-07-12 | 1978-04-12 | Mitsubishi Petrochemical Co | Curable resin compositions |
| NL7508324A (nl) * | 1974-07-12 | 1976-01-14 | Mitsubishi Petrochemical Co | Hardbare harsmaterialen. |
| JPS558023B2 (enExample) * | 1975-02-27 | 1980-03-01 | ||
| US4093675A (en) * | 1975-06-26 | 1978-06-06 | Unitech Chemical Inc. | High peel strength adhesives |
| US4101601A (en) * | 1975-12-24 | 1978-07-18 | Celanese Corporation | Epoxy-catalyst additive system to produce higher I.V. polybutylene terephthalate from low I.V. polymer |
| US4055606A (en) * | 1976-06-21 | 1977-10-25 | Allied Chemical Corporation | Novel copolyester-polyepoxide compositions |
| US4076226A (en) * | 1976-09-02 | 1978-02-28 | E. I. Du Pont De Nemours And Company | Energy absorbing mechanism |
| US4129607A (en) * | 1977-05-31 | 1978-12-12 | Unitech Chemical Inc. | Hot melt adhesive having both high peel and tensile shear strength |
| DE2834032A1 (de) * | 1978-08-03 | 1980-02-28 | Basf Ag | Stabilisierte polyalkylenterephthalat- formmassen |
| US4342678A (en) * | 1979-07-17 | 1982-08-03 | Ciba-Geigy Corporation | Glass-reinforced polyester moulding compounds |
| WO1981000718A1 (en) * | 1979-09-14 | 1981-03-19 | Minnesota Mining & Mfg | Heat activatable adhesive with improved temperature resistance |
| US4430479A (en) | 1979-09-14 | 1984-02-07 | Minnesota Mining And Manufacturing Company | Heat activatable adhesive with improved temperature resistance |
| US4415469A (en) * | 1981-11-02 | 1983-11-15 | Stauffer Chemical Company | Phase stable compositions containing a paraffinic polyol and an isocyanate reactive prepolymer |
| JPS5891758A (ja) * | 1981-11-27 | 1983-05-31 | Toray Ind Inc | ポリエ−テルエステルブロツク共重合体組成物 |
| US4533679A (en) * | 1982-06-28 | 1985-08-06 | Mobay Chemical Corporation | Reinforced polyester composition having an improved strength |
| US4642321A (en) * | 1985-07-19 | 1987-02-10 | Kollmorgen Technologies Corporation | Heat activatable adhesive for wire scribed circuits |
| US4785060A (en) * | 1986-08-28 | 1988-11-15 | Colgate-Palmolive Company | Soil release promoting pet-poet copolymer, method of producing same and use thereof in detergent composition having soil release promoting property |
| US4739019A (en) * | 1986-12-08 | 1988-04-19 | Ppg Industries, Inc. | Curable epoxy based compositions having reduced shrinkage during cure |
| ES2020299B3 (es) * | 1986-12-19 | 1991-08-01 | Ciba-Geigy Ag | Resinas epoxidicas con contenido de poliester sobre base de polialquilenglicol. |
| US4962138A (en) * | 1988-05-27 | 1990-10-09 | W. R. Grace & Co.-Conn. | Reactive hot melt structural adhesive |
| EP0381625B1 (de) * | 1989-02-02 | 1996-07-31 | Ciba-Geigy Ag | Zähe Epoxidharze |
| US4999128A (en) * | 1989-06-01 | 1991-03-12 | Colgate-Palmolive Co. | Soil release polymers having improved performance, stability and economy |
| US4999388A (en) * | 1989-09-14 | 1991-03-12 | General Electric Company | Branched polyester resin composition having enhanced melt viscosity |
| KR960002955B1 (ko) * | 1992-06-30 | 1996-03-02 | 제일합섬 주식회사 | 폴리에테르-에스테르 탄성중합체의 제조방법 |
| KR950008565A (ko) * | 1993-09-10 | 1995-04-19 | 박홍기 | 폴리에테르에스테르 탄성중합체의 제조방법 |
| CA2188538A1 (en) * | 1995-02-23 | 1996-08-29 | Kanegafuchi Kagaku Kogyo Kabushiki Kaisha | Polyethylene terephthalate resin composition |
| US6027818A (en) * | 1998-07-20 | 2000-02-22 | E. I. Du Pont De Nemours And Company | Thermoplastic copolyester compositions modified with epoxide compounds |
| US6294610B1 (en) | 1999-11-29 | 2001-09-25 | Rohm And Haas Company | Coating powders for heat-sensitive substrates |
| US20030216500A1 (en) * | 2002-04-29 | 2003-11-20 | Mckenna James Michael | Hydrolysis resistant polyester elastomer compositions and related articles and methods |
| US7008983B2 (en) * | 2002-04-29 | 2006-03-07 | E. I. Du Pont De Nemours And Company | Hydrolysis resistant polyester compositions and related articles and methods |
| DE60336078D1 (en) * | 2002-12-30 | 2011-03-31 | Samyang Corp | Thermoplastisches elastomerharz |
| US8114515B2 (en) * | 2007-02-05 | 2012-02-14 | Sabic Innovative Plastics Ip B.V. | Crosslinked polyester compositions, method of manufacture, and uses thereof |
| JP5549902B2 (ja) * | 2008-07-17 | 2014-07-16 | 東レ・デュポン株式会社 | ポリエーテルエステルブロック共重合体組成物 |
| DE102018110180A1 (de) | 2018-04-27 | 2019-10-31 | Schill + Seilacher "Struktol" Gmbh | Kettenverlängerte Polyester und Polyester-Blockcopolymere, präpolymerisierte Derivate davon sowie deren Verwendung |
| WO2021021273A1 (en) | 2019-07-29 | 2021-02-04 | Bridgestone Americas Tire Operations, Llc | Temperature stable polymeric blends for use in non-pneumatic tires |
| JP7361197B2 (ja) | 2019-07-29 | 2023-10-13 | ブリヂストン アメリカズ タイヤ オペレーションズ、 エルエルシー | 非空気圧タイヤで使用するための温度安定性ポリマーブレンド |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE564172A (enExample) * | 1957-01-22 | |||
| US2890197A (en) * | 1957-04-04 | 1959-06-09 | Union Carbide Corp | Composition comprising a diepoxide, a polycarboxylic acid and a polyhydric compound |
| US2890196A (en) * | 1957-04-04 | 1959-06-09 | Union Carbide Corp | Curable composition comprising a diepoxide, a polycarboxylic anhydride and a polyhydric compound |
| GB872254A (en) * | 1958-02-04 | 1961-07-05 | Connollys Blackley Ltd | Polyester resin and electric conductors insulated therewith |
| DE1251950B (de) * | 1963-08-29 | 1967-10-12 | Farbwerke Hoechst Aktiengesellschfat vormals Meister Lucius S- Brüning, Frankfurt/M | Verfahren zur Herstellung von linearen Polyestern |
| US3297782A (en) * | 1964-03-03 | 1967-01-10 | Avisun Corp | Coating composition of polyoxyalkylene ether of a 2-alkylidene diphenol esterified with fumaric or maleic acid, and a polyglycidyl ether of a dihydric phenol |
| US3397254A (en) * | 1964-09-21 | 1968-08-13 | Union Carbide Corp | Carboxy terminated polyesters prepared from tribasic acid anhydrides and hydroxy terminated polyesters |
| US3378497A (en) * | 1965-02-08 | 1968-04-16 | Union Carbide Corp | Stabilized polyols |
| DE1769097A1 (de) * | 1968-04-03 | 1971-10-21 | Hoechst Ag | Thermoplastische Polyester enthaltende Formmassen |
| BE753040A (fr) * | 1969-07-18 | 1970-12-16 | Du Pont | Elastomeres de copolyesters thermoplastiques segmentes |
| US3670045A (en) * | 1970-12-30 | 1972-06-13 | Union Carbide Corp | Aba block polymers of polylactones and polyethers |
-
0
- BE BE794029D patent/BE794029A/xx not_active IP Right Cessation
-
1972
- 1972-02-28 US US00230045A patent/US3723568A/en not_active Expired - Lifetime
-
1973
- 1973-01-08 SE SE7300195A patent/SE406924B/sv unknown
- 1973-01-09 CA CA160,808A patent/CA1010187A/en not_active Expired
- 1973-01-10 ZA ZA730189A patent/ZA73189B/xx unknown
- 1973-01-15 IT IT19230/73A patent/IT983402B/it active
- 1973-01-17 ES ES410715A patent/ES410715A1/es not_active Expired
- 1973-01-22 AR AR246225A patent/AR209413A1/es active
- 1973-01-24 JP JP961273A patent/JPS5543016B2/ja not_active Expired
- 1973-01-25 DE DE2303631A patent/DE2303631C3/de not_active Expired
- 1973-02-01 NL NL7301478.A patent/NL157625B/xx not_active IP Right Cessation
- 1973-02-07 FR FR7304294A patent/FR2174000B1/fr not_active Expired
- 1973-02-21 BR BR731291A patent/BR7301291D0/pt unknown
- 1973-02-26 GB GB935773A patent/GB1402966A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE406924B (sv) | 1979-03-05 |
| ES410715A1 (es) | 1976-01-01 |
| BR7301291D0 (pt) | 1974-05-16 |
| FR2174000A1 (enExample) | 1973-10-12 |
| AU5083073A (en) | 1974-07-11 |
| DE2303631B2 (de) | 1978-09-28 |
| NL157625B (nl) | 1978-08-15 |
| ZA73189B (en) | 1973-09-26 |
| JPS5543016B2 (enExample) | 1980-11-04 |
| JPS48100495A (enExample) | 1973-12-18 |
| FR2174000B1 (enExample) | 1976-09-10 |
| US3723568A (en) | 1973-03-27 |
| GB1402966A (en) | 1975-08-13 |
| CA1010187A (en) | 1977-05-10 |
| AR209413A1 (es) | 1977-04-29 |
| IT983402B (it) | 1974-10-31 |
| DE2303631A1 (de) | 1973-09-20 |
| BE794029A (fr) | 1973-05-02 |
| NL7301478A (enExample) | 1973-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2303631C3 (de) | Verfahren zur Herstellung eines verbesserten segmentierten thermoplastischen Mischpolyester-Elastomeren | |
| DE69323632T2 (de) | Thermoplastische biologisch abbaubare harze und verfahren zu deren herstellung | |
| DE3011561C2 (de) | Copolyätherester, abgeleitet aus Terephthalsäure oder ihrem esterbildenden Äquivalent | |
| DE2313903C3 (de) | Verfahren zur Herstellung von segmentierten thermoplastischen Copolyesterelastomeren | |
| CH456142A (de) | Verformbare Masse aus Polycarbonat und Polyalkylen-terephthalat | |
| DE2265320B2 (de) | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren | |
| DE2265294B2 (de) | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren | |
| DE2400098A1 (de) | Thermoplastische massen | |
| DE2400097A1 (de) | Verfahren zur steigerung der schmelzelastizitaet von hochmolekularen linearen polyesterharzen | |
| DE1720877B2 (de) | Spritzgussmassen und verfahren zur herstellung von spritzgussmassen | |
| DE69424510T2 (de) | Fluormodifizierte Polyester mit verbesserter Verarbeitbarkeit | |
| DE2725709A1 (de) | Thermoplastische blockmischpolymere und deren herstellung | |
| EP0023248A1 (de) | Formmasse aus einem hochmolekularen linearen Polyester | |
| DE1495021A1 (de) | Haertbares,biegsames Polyesterharz | |
| DE69414202T2 (de) | Halogenfreie flammhemmende Thermoplast-Zusammensetzung | |
| DE4129980A1 (de) | Thermoplastische formmassen auf der basis von thermoplastischen polyester-elastomeren und oxazolinen | |
| DE2904184A1 (de) | Formmasse und die daraus hergestellten spritzguss-formkoerper | |
| EP0618248A2 (de) | Carbonsäureester- und Kohlensäureestergruppen enthaltendes Polymer und Verfahren zu seiner Herstellung | |
| DE2311849A1 (de) | Herstellung von mischpolyesterelastomerem | |
| DE2065701A1 (de) | Haertbare harzzusammensetzungen | |
| DE2210119B2 (de) | Thermoplastische elastomere Formmassen | |
| DE1420278A1 (de) | Thermoplastische Polyesteramide und Verfahren zu ihrer Herstellung | |
| DE2551324C2 (enExample) | ||
| DE4311748A1 (de) | Polyesterzusammensetzung | |
| DE2352584A1 (de) | Thermoplastische mischpolyaetheresterformmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8281 | Inventor (new situation) |
Free format text: HOESCHELE, GUENTHER KURT, WILMINGTON, DEL., US |
|
| C3 | Grant after two publication steps (3rd publication) |