DE2259644A1 - Verfahren zur herstellung neuer heterocyclischer verbindungen - Google Patents
Verfahren zur herstellung neuer heterocyclischer verbindungenInfo
- Publication number
- DE2259644A1 DE2259644A1 DE2259644A DE2259644A DE2259644A1 DE 2259644 A1 DE2259644 A1 DE 2259644A1 DE 2259644 A DE2259644 A DE 2259644A DE 2259644 A DE2259644 A DE 2259644A DE 2259644 A1 DE2259644 A1 DE 2259644A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- carbon atoms
- compounds
- alkyl
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 150000002391 heterocyclic compounds Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical compound [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 239000011877 solvent mixture Substances 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- 239000000945 filler Substances 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- -1 alkyl radical Chemical class 0.000 description 4
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 3
- ZAGRKAFMISFKIO-QMTHXVAHSA-N lysergic acid Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-QMTHXVAHSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ZAGRKAFMISFKIO-UHFFFAOYSA-N Isolysergic acid Natural products C1=CC(C2=CC(CN(C2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000001351 alkyl iodides Chemical class 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- WGZBEDCLEXJQGW-IAQYHMDHSA-N (6ar,9r)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CN(C)C3=C1 WGZBEDCLEXJQGW-IAQYHMDHSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- ILSYTMBVJDPAKS-UHFFFAOYSA-N 2,3-dihydroxybutanedioic acid;propan-2-one Chemical compound CC(C)=O.OC(=O)C(O)C(O)C(O)=O ILSYTMBVJDPAKS-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IWTFOFMTUOBLHG-UHFFFAOYSA-N 2-methoxypyridine Chemical compound COC1=CC=CC=N1 IWTFOFMTUOBLHG-UHFFFAOYSA-N 0.000 description 1
- OBOSXEWFRARQPU-UHFFFAOYSA-N 2-n,2-n-dimethylpyridine-2,5-diamine Chemical compound CN(C)C1=CC=C(N)C=N1 OBOSXEWFRARQPU-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940082988 antihypertensives serotonin antagonists Drugs 0.000 description 1
- 239000003420 antiserotonin agent Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 230000035619 diuresis Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- QYRFJLLXPINATB-UHFFFAOYSA-N hydron;2,4,5,6-tetrafluorobenzene-1,3-diamine;dichloride Chemical compound Cl.Cl.NC1=C(F)C(N)=C(F)C(F)=C1F QYRFJLLXPINATB-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QVEWUCPXJWWROG-UHFFFAOYSA-N methanol propan-2-one hydrochloride Chemical compound Cl.CO.CC(C)=O QVEWUCPXJWWROG-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000054 salidiuretic effect Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
- C07D457/06—Lysergic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1805271A CH560716A5 (en) | 1971-12-10 | 1971-12-10 | N-substd lysergic acid amides - s saluretics and serotonin antagonists |
| CH1805171A CH560715A5 (en) | 1971-12-10 | 1971-12-10 | N-substd lysergic acid amides - s saluretics and serotonin antagonists |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2259644A1 true DE2259644A1 (de) | 1973-06-14 |
Family
ID=25720424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2259644A Pending DE2259644A1 (de) | 1971-12-10 | 1972-12-06 | Verfahren zur herstellung neuer heterocyclischer verbindungen |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS4864099A (cg-RX-API-DMAC10.html) |
| AT (1) | AT339509B (cg-RX-API-DMAC10.html) |
| BE (1) | BE792515A (cg-RX-API-DMAC10.html) |
| DD (1) | DD101672A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2259644A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES409461A1 (cg-RX-API-DMAC10.html) |
| FI (1) | FI53819C (cg-RX-API-DMAC10.html) |
| FR (1) | FR2162618B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1410349A (cg-RX-API-DMAC10.html) |
| HU (1) | HU165738B (cg-RX-API-DMAC10.html) |
| IE (1) | IE38233B1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL41035A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7216464A (cg-RX-API-DMAC10.html) |
| NO (1) | NO135421C (cg-RX-API-DMAC10.html) |
| PL (1) | PL84879B1 (cg-RX-API-DMAC10.html) |
| SE (1) | SE398350B (cg-RX-API-DMAC10.html) |
| SU (1) | SU461500A3 (cg-RX-API-DMAC10.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH653333A5 (de) * | 1981-11-04 | 1985-12-31 | Sandoz Ag | N-substituierte ergolin- und 9,10-didehydroergolinderivate, ihre herstellung und sie enthaltende arzneimittel. |
| EP0091652B1 (en) * | 1982-04-13 | 1986-02-26 | FARMITALIA CARLO ERBA S.p.A. | Ergoline derivatives, process for producing the ergoline derivatives and pharmaceutical compositions containing them |
| US4563461A (en) * | 1983-03-10 | 1986-01-07 | Eli Lilly And Company | Selective method for blocking 5HT2 receptors |
| EP3941583B9 (en) | 2020-06-12 | 2023-04-19 | Beckley Psytech Limited | Composition comprising a benzoate salt of 5-methoxy-n,n-dimethyltryptamine |
| EP4126857A1 (en) | 2021-01-15 | 2023-02-08 | Beckley Psytech Limited | Ergoline analogues |
| GB202212116D0 (en) | 2022-08-19 | 2022-10-05 | Beckley Psytech Ltd | Pharmaceutically acceptable salts and Compositions thereof |
| US12264131B2 (en) | 2022-08-19 | 2025-04-01 | Beckley Psytech Limited | Pharmaceutically acceptable salts and compositions thereof |
| US12246005B2 (en) | 2023-06-13 | 2025-03-11 | Beckley Psytech Limited | 5-methoxy-n,n-dimethyltryptamine (5-MeO-DMT) formulations |
-
0
- BE BE792515D patent/BE792515A/xx unknown
-
1972
- 1972-12-01 FI FI3418/72A patent/FI53819C/fi active
- 1972-12-01 NO NO4414/72A patent/NO135421C/no unknown
- 1972-12-01 SE SE7215662A patent/SE398350B/xx unknown
- 1972-12-05 NL NL7216464A patent/NL7216464A/xx not_active Application Discontinuation
- 1972-12-06 DE DE2259644A patent/DE2259644A1/de active Pending
- 1972-12-07 AT AT1040772A patent/AT339509B/de not_active IP Right Cessation
- 1972-12-08 DD DD167453A patent/DD101672A5/xx unknown
- 1972-12-08 SU SU1855586A patent/SU461500A3/ru active
- 1972-12-08 IE IE1719/72A patent/IE38233B1/xx unknown
- 1972-12-08 FR FR7243832A patent/FR2162618B1/fr not_active Expired
- 1972-12-08 JP JP47122650A patent/JPS4864099A/ja active Pending
- 1972-12-08 GB GB5666072A patent/GB1410349A/en not_active Expired
- 1972-12-08 PL PL1972159392A patent/PL84879B1/pl unknown
- 1972-12-08 IL IL41035A patent/IL41035A/xx unknown
- 1972-12-08 HU HUSA2432A patent/HU165738B/hu unknown
- 1972-12-09 ES ES409461A patent/ES409461A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE792515A (fr) | 1973-06-08 |
| FI53819C (fi) | 1978-08-10 |
| FR2162618A1 (cg-RX-API-DMAC10.html) | 1973-07-20 |
| IL41035A (en) | 1975-08-31 |
| GB1410349A (en) | 1975-10-15 |
| FR2162618B1 (cg-RX-API-DMAC10.html) | 1975-10-17 |
| ES409461A1 (es) | 1976-04-01 |
| IE38233B1 (en) | 1978-02-01 |
| NL7216464A (cg-RX-API-DMAC10.html) | 1973-06-13 |
| PL84879B1 (en) | 1976-04-30 |
| IE38233L (en) | 1973-06-10 |
| SE398350B (sv) | 1977-12-19 |
| DD101672A5 (cg-RX-API-DMAC10.html) | 1973-11-12 |
| JPS4864099A (cg-RX-API-DMAC10.html) | 1973-09-05 |
| NO135421C (cg-RX-API-DMAC10.html) | 1977-04-05 |
| HU165738B (cg-RX-API-DMAC10.html) | 1974-10-28 |
| ATA1040772A (de) | 1977-02-15 |
| SU461500A3 (ru) | 1975-02-25 |
| FI53819B (fi) | 1978-05-02 |
| NO135421B (cg-RX-API-DMAC10.html) | 1976-12-27 |
| IL41035A0 (en) | 1973-02-28 |
| AT339509B (de) | 1977-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE602004005960T2 (de) | Heteroaryl-substituierte pyrrolä2, 3- büpyridin-derivate als crf-rezeptor-antagonisten | |
| EP0135762B1 (de) | Steroide | |
| DE69408580T2 (de) | 2-amino-1,2,3,4-tetrahydronaphthalenderivate mit cardiovaskulärer wirkung | |
| DE2259644A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE3145678A1 (de) | Dibenzazepine, verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| DE69302544T2 (de) | 2-amino-1,2,3,4-tetrahydronaphthalen derivate mit wirkung auf das kardiovasculäre system, verfahren zu deren herstellung und deren pharmazeutische zusammensetzungen | |
| DE2530577A1 (de) | Neue organische verbindungen, ihre herstellung und verwendung | |
| DE2802023A1 (de) | Neue ergotderivate, ihre herstellung und verwendung | |
| DE2454619A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE4123587A1 (de) | 2,14-disubstituierte ergoline, deren herstellung und verwendung in arzneimitteln | |
| CH578565A5 (en) | N-(2-amino-5-pyridyl) lysergic acid amides - with saluretic and serotonin antagonist activity | |
| DE2223681A1 (de) | Neue heterocyclische Verbindungen und Verfahren zu ihrer Herstellung | |
| DE2557792A1 (de) | Neue heterocyclische verbindungen, ihre herstellung und ihre verwendung | |
| CH610330A5 (en) | Process for the preparation of novel ergopeptins | |
| DE2525962A1 (de) | Neue heterocyclische verbindungen, ihre herstellung und verwendung | |
| DE60015997T2 (de) | Indoloazepine als vasopressin rezeptor antagonisten | |
| DE2347325A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| CH560716A5 (en) | N-substd lysergic acid amides - s saluretics and serotonin antagonists | |
| DE68920304T2 (de) | 5-substituierte uridinderivate und zwischenprodukte. | |
| CH579080A5 (en) | N-(Lysergyl)-3-aminopyridines prodn - from lysergic acid reactive derivs and (substd)3-aminopyridines, having CNS and circulatory activities | |
| CH560715A5 (en) | N-substd lysergic acid amides - s saluretics and serotonin antagonists | |
| US4035501A (en) | N-lysergyl-amino-pyridines | |
| DE2541426A1 (de) | Neue heterocyclische verbindungen, ihre herstellung und ihre verwendung | |
| CH605936A5 (en) | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs | |
| DE2633782A1 (de) | Neue organische verbindungen, ihre herstellung und verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |