AT339509B - Verfahren zur herstellung neuer lysergsaurederivate - Google Patents
Verfahren zur herstellung neuer lysergsaurederivateInfo
- Publication number
- AT339509B AT339509B AT1040772A AT1040772A AT339509B AT 339509 B AT339509 B AT 339509B AT 1040772 A AT1040772 A AT 1040772A AT 1040772 A AT1040772 A AT 1040772A AT 339509 B AT339509 B AT 339509B
- Authority
- AT
- Austria
- Prior art keywords
- acid derivatives
- lysergic acid
- preparing new
- preparing
- new
- Prior art date
Links
- ZAGRKAFMISFKIO-QMTHXVAHSA-N lysergic acid Chemical class C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-QMTHXVAHSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
- C07D457/06—Lysergic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1805271A CH560716A5 (en) | 1971-12-10 | 1971-12-10 | N-substd lysergic acid amides - s saluretics and serotonin antagonists |
| CH1805171A CH560715A5 (en) | 1971-12-10 | 1971-12-10 | N-substd lysergic acid amides - s saluretics and serotonin antagonists |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA1040772A ATA1040772A (de) | 1977-02-15 |
| AT339509B true AT339509B (de) | 1977-10-25 |
Family
ID=25720424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1040772A AT339509B (de) | 1971-12-10 | 1972-12-07 | Verfahren zur herstellung neuer lysergsaurederivate |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS4864099A (de) |
| AT (1) | AT339509B (de) |
| BE (1) | BE792515A (de) |
| DD (1) | DD101672A5 (de) |
| DE (1) | DE2259644A1 (de) |
| ES (1) | ES409461A1 (de) |
| FI (1) | FI53819C (de) |
| FR (1) | FR2162618B1 (de) |
| GB (1) | GB1410349A (de) |
| HU (1) | HU165738B (de) |
| IE (1) | IE38233B1 (de) |
| IL (1) | IL41035A (de) |
| NL (1) | NL7216464A (de) |
| NO (1) | NO135421C (de) |
| PL (1) | PL84879B1 (de) |
| SE (1) | SE398350B (de) |
| SU (1) | SU461500A3 (de) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH653333A5 (de) * | 1981-11-04 | 1985-12-31 | Sandoz Ag | N-substituierte ergolin- und 9,10-didehydroergolinderivate, ihre herstellung und sie enthaltende arzneimittel. |
| EP0091652B1 (de) * | 1982-04-13 | 1986-02-26 | FARMITALIA CARLO ERBA S.p.A. | Ergolinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen |
| US4563461A (en) * | 1983-03-10 | 1986-01-07 | Eli Lilly And Company | Selective method for blocking 5HT2 receptors |
| WO2021250434A1 (en) | 2020-06-12 | 2021-12-16 | Beckley Psytech Limited | Composition comprising a benzoate salt of 5-methoxy-n,n-dimethyltryptamine |
| EP4126857A1 (de) | 2021-01-15 | 2023-02-08 | Beckley Psytech Limited | Ergolinanaloga |
| GB202212116D0 (en) | 2022-08-19 | 2022-10-05 | Beckley Psytech Ltd | Pharmaceutically acceptable salts and Compositions thereof |
| US12264131B2 (en) | 2022-08-19 | 2025-04-01 | Beckley Psytech Limited | Pharmaceutically acceptable salts and compositions thereof |
| US12246005B2 (en) | 2023-06-13 | 2025-03-11 | Beckley Psytech Limited | 5-methoxy-n,n-dimethyltryptamine (5-MeO-DMT) formulations |
-
0
- BE BE792515D patent/BE792515A/xx unknown
-
1972
- 1972-12-01 SE SE7215662A patent/SE398350B/xx unknown
- 1972-12-01 NO NO4414/72A patent/NO135421C/no unknown
- 1972-12-01 FI FI3418/72A patent/FI53819C/fi active
- 1972-12-05 NL NL7216464A patent/NL7216464A/xx not_active Application Discontinuation
- 1972-12-06 DE DE2259644A patent/DE2259644A1/de active Pending
- 1972-12-07 AT AT1040772A patent/AT339509B/de not_active IP Right Cessation
- 1972-12-08 SU SU1855586A patent/SU461500A3/ru active
- 1972-12-08 FR FR7243832A patent/FR2162618B1/fr not_active Expired
- 1972-12-08 GB GB5666072A patent/GB1410349A/en not_active Expired
- 1972-12-08 HU HUSA2432A patent/HU165738B/hu unknown
- 1972-12-08 IE IE1719/72A patent/IE38233B1/xx unknown
- 1972-12-08 PL PL1972159392A patent/PL84879B1/pl unknown
- 1972-12-08 JP JP47122650A patent/JPS4864099A/ja active Pending
- 1972-12-08 IL IL41035A patent/IL41035A/xx unknown
- 1972-12-08 DD DD167453A patent/DD101672A5/xx unknown
- 1972-12-09 ES ES409461A patent/ES409461A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4864099A (de) | 1973-09-05 |
| PL84879B1 (en) | 1976-04-30 |
| DE2259644A1 (de) | 1973-06-14 |
| IE38233L (en) | 1973-06-10 |
| FI53819B (fi) | 1978-05-02 |
| NO135421C (de) | 1977-04-05 |
| DD101672A5 (de) | 1973-11-12 |
| ES409461A1 (es) | 1976-04-01 |
| NO135421B (de) | 1976-12-27 |
| HU165738B (de) | 1974-10-28 |
| BE792515A (fr) | 1973-06-08 |
| IL41035A0 (en) | 1973-02-28 |
| FI53819C (fi) | 1978-08-10 |
| ATA1040772A (de) | 1977-02-15 |
| SE398350B (sv) | 1977-12-19 |
| FR2162618A1 (de) | 1973-07-20 |
| IE38233B1 (en) | 1978-02-01 |
| SU461500A3 (ru) | 1975-02-25 |
| FR2162618B1 (de) | 1975-10-17 |
| GB1410349A (en) | 1975-10-15 |
| NL7216464A (de) | 1973-06-13 |
| IL41035A (en) | 1975-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT321457B (de) | Verfahren zur Herstellung neuer 7-Aminocephalosporansäurederivate | |
| AT326674B (de) | Verfahren zur herstellung neuer naphthyridinderivaten | |
| DD110652A5 (de) | Verfahren zur herstellung neuer 1-aryloxy-2-hydroxy-3-alkinylaminopropane | |
| AT321906B (de) | Verfahren zur herstellung neuer imidazolderivate | |
| AT319249B (de) | Verfahren zur Herstellung neuer Chinolinderivate | |
| AT339509B (de) | Verfahren zur herstellung neuer lysergsaurederivate | |
| DD95565A5 (de) | Verfahren zur herstellung neuer pregnansaeurederivate | |
| AT315164B (de) | Verfahren zur Herstellung neuer 2-Nitroimidazolderivate | |
| AT330804B (de) | Verfahren zur herstellung neuer oligopeptidderivate | |
| AT327893B (de) | Verfahren zur herstellung neuer xanthoncarbonsaurederivate | |
| CH556835A (de) | Verfahren zur herstellung neuer spiroindanpyrrolidinderivate. | |
| ATA221172A (de) | Verfahren zur herstellung neuer 2-hydroxybenzophenonderivate | |
| AT320873B (de) | Verfahren zur Herstellung neuer Östradiolderivate | |
| ATA599372A (de) | Verfahren zur herstellung neuer xanthoncarbonsaeurederivate | |
| DD98669A5 (de) | Verfahren zur herstellung neuer pregnansaeure-derivate | |
| CH533633A (de) | Verfahren zur Herstellung neuer Phenanthrotriazolylderivate | |
| AT326672B (de) | Verfahren zur herstellung neuer triazinderivate | |
| AT326120B (de) | Verfahren zur herstellung neuer isoxazolidinderivate | |
| CH518273A (de) | Verfahren zur Herstellung neuer Acovenosid-A-Derivate | |
| AT323165B (de) | Verfahren zur herstellung neuer picolinsäurederivate | |
| CH528539A (de) | Verfahren zur Herstellung neuer 6-Isocyanatopenicillansäurederivate | |
| AT347606B (de) | Verfahren zur herstellung neuer ergolenderivate | |
| AT328094B (de) | Verfahren zur herstellung neuer ergolenderivate | |
| AT326649B (de) | Verfahren zur herstellung neuer 5-pyrazolessigsäurederivate | |
| CH546240A (de) | Verfahren zur herstellung neuer indenopyridinderivate. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |