AT327893B - Verfahren zur herstellung neuer xanthoncarbonsaurederivate - Google Patents
Verfahren zur herstellung neuer xanthoncarbonsaurederivateInfo
- Publication number
- AT327893B AT327893B AT598972A AT598972A AT327893B AT 327893 B AT327893 B AT 327893B AT 598972 A AT598972 A AT 598972A AT 598972 A AT598972 A AT 598972A AT 327893 B AT327893 B AT 327893B
- Authority
- AT
- Austria
- Prior art keywords
- xanthon
- acid derivatives
- carbonic acid
- preparing new
- preparing
- Prior art date
Links
- ZYHMJCQVHJOHJW-UHFFFAOYSA-N C(O)(O)=O.C1=CC=CC=2OC3=CC=CC=C3C(C12)=O Chemical class C(O)(O)=O.C1=CC=CC=2OC3=CC=CC=C3C(C12)=O ZYHMJCQVHJOHJW-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT622774A AT327895B (de) | 1972-01-12 | 1972-07-12 | Verfahren zur herstellung von neuen xanthoncarbonsaurederivaten und deren estern, amiden und salzen |
| AT765874A AT329054B (de) | 1971-07-14 | 1972-07-12 | Verfahren zur herstellung neuer xanthoncarbonsaurederivate und deren estern, amiden und salzen |
| AT453574A AT326654B (de) | 1972-01-12 | 1972-07-12 | Verfahren zur herstellung von neuen xanthoncarbonsäurederivaten und deren estern, amiden und salzen |
| AT765974A AT326655B (de) | 1971-07-14 | 1972-07-12 | Verfahren zur herstellung der neuen 5- oder 7-formylxanthon-2-carbonsäure und deren estern amiden und salzen |
| AT765774A AT329053B (de) | 1971-07-14 | 1974-09-24 | Verfahren zur herstellung neuer xanthoncarbonsaurederivate und deren estern, amiden und salzen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00217287A US3849565A (en) | 1972-01-12 | 1972-01-12 | Disubstituted xanthone carboxylic acid compounds for inhibiting asthma |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA598972A ATA598972A (de) | 1975-05-15 |
| AT327893B true AT327893B (de) | 1976-02-25 |
Family
ID=22810416
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT598972A AT327893B (de) | 1971-07-14 | 1972-07-12 | Verfahren zur herstellung neuer xanthoncarbonsaurederivate |
| AT860474*7A AT327896B (de) | 1972-01-12 | 1972-07-12 | Verfahren zur herstellung neuer xanthoncarbonsaureverbindungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT860474*7A AT327896B (de) | 1972-01-12 | 1972-07-12 | Verfahren zur herstellung neuer xanthoncarbonsaureverbindungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3849565A (de) |
| AT (2) | AT327893B (de) |
| DE (1) | DE2234254A1 (de) |
| ES (3) | ES433551A1 (de) |
| ZA (1) | ZA724756B (de) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3951618A (en) * | 1974-03-12 | 1976-04-20 | Syntex (U.S.A.) Inc. | Method of use of, and compositions containing, disubstituted xanthone carboxylic acid compounds |
| IL47519A (en) * | 1974-07-09 | 1979-03-12 | Roussel Uclaf | 7-sulphinimidoyl(sulphimidoyl)-xanthone-2-carboxylic acid derivatives, their preparation and pharmaceutical compositions containing them |
| US4078078A (en) * | 1974-07-09 | 1978-03-07 | Roussel Uclaf | Novel xanthone-2-carboxylic acid compounds |
| US4015009A (en) * | 1974-10-02 | 1977-03-29 | Smithkline Corporation | Pharmaceutical compositions comprising substituted 3-cinnamoyl-2H-pyran-2,6(3H)-diones |
| US4032652A (en) * | 1975-04-23 | 1977-06-28 | Smithkline Corporation | Substituted 2h-pyran-2,6(3h)-dione derivatives, pharmaceutical compositions comprising such derivatives and methods of inhibiting the antigen-antibody reaction |
| US4250097A (en) * | 1978-03-08 | 1981-02-10 | Syntex (U.S.A.) Inc. | Compositions for and a method of preventing diabetic complications |
| US4242267A (en) * | 1980-02-04 | 1980-12-30 | Roussel Uclaf | Process for preparing 5-alkyl-7-(S-alkyl-sulfonimidoyl)-xanthone-2-carboxylic acids |
| IT1223302B (it) * | 1987-09-16 | 1990-09-19 | Baldacci Lab Spa | Composti solfonamido derivati inibitori del sistema enzimatico aldoso-reduttasi e composizioni farmaceutiche che li contengono |
-
1972
- 1972-01-12 US US00217287A patent/US3849565A/en not_active Expired - Lifetime
- 1972-07-12 DE DE2234254A patent/DE2234254A1/de active Pending
- 1972-07-12 AT AT598972A patent/AT327893B/de not_active IP Right Cessation
- 1972-07-12 ZA ZA724756A patent/ZA724756B/xx unknown
- 1972-07-12 AT AT860474*7A patent/AT327896B/de not_active IP Right Cessation
-
1975
- 1975-01-03 ES ES433551A patent/ES433551A1/es not_active Expired
- 1975-01-03 ES ES433549A patent/ES433549A1/es not_active Expired
- 1975-01-03 ES ES433550A patent/ES433550A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES433551A1 (es) | 1976-12-01 |
| ES433549A1 (es) | 1976-12-16 |
| US3849565A (en) | 1974-11-19 |
| DE2234254A1 (de) | 1973-09-13 |
| ES433550A1 (es) | 1976-12-01 |
| ATA860474A (de) | 1975-05-15 |
| ZA724756B (en) | 1974-02-27 |
| ATA598972A (de) | 1975-05-15 |
| AT327896B (de) | 1976-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT331970B (de) | Verfahren zur herstellung neuer alpha- aminobenzylpenicillinderivate | |
| AT333987B (de) | Verfahren zur herstellung neuer insulinderivate | |
| ATA588973A (de) | Verfahren zur herstellung neuer phenoxypropanolamine | |
| AT327893B (de) | Verfahren zur herstellung neuer xanthoncarbonsaurederivate | |
| AT324310B (de) | Verfahren zur herstellung neuer 2-aminoalkanoylaminobenzophenone | |
| AT329570B (de) | Verfahren zur herstellung neuer chinazolinonderivate | |
| AT325784B (de) | Verfahren zur herstellung neuer acylierter n(6)-aralkyl-adenosin-derivate | |
| AT327414B (de) | Verfahren zur herstellung neuer bis-piperazino-androstan-derivate | |
| AT331255B (de) | Verfahren zur herstellung neuer hexahydrotriazinonderivate | |
| AT326653B (de) | Verfahren zur herstellung neuer 2-amino-4-h-pyrane | |
| AT327881B (de) | Verfahren zur herstellung neuer furanderivate | |
| ATA470873A (de) | Verfahren zur herstellung neuer anhydro- furanosederivate | |
| ATA599372A (de) | Verfahren zur herstellung neuer xanthoncarbonsaeurederivate | |
| AT313921B (de) | Verfahren zur Herstellung neuer Dichlorvinylthionophosphorsäurediesteramide | |
| AT327897B (de) | Verfahren zur herstellung neuer xanthoncarbonsaureverbindungen | |
| AT326120B (de) | Verfahren zur herstellung neuer isoxazolidinderivate | |
| AT325039B (de) | Verfahren zur herstellung neuer kanthoncarbon säureverbindungen | |
| DD98669A5 (de) | Verfahren zur herstellung neuer pregnansaeure-derivate | |
| AT326649B (de) | Verfahren zur herstellung neuer 5-pyrazolessigsäurederivate | |
| AT335462B (de) | Verfahren zur herstellung neuer 1-nitrosoharnstoffderivate | |
| AT323730B (de) | Verfahren zur herstellung neuer indolderivate | |
| ATA2575A (de) | Verfahren zur herstellung neuer anhydro- furanosederivate | |
| ATA1016673A (de) | Verfahren zur herstellung neuer sydnon-derivate | |
| ATA1030473A (de) | Verfahren zur herstellung neuer everninomicinderivate | |
| AT323165B (de) | Verfahren zur herstellung neuer picolinsäurederivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |