AT327896B - Verfahren zur herstellung neuer xanthoncarbonsaureverbindungen - Google Patents
Verfahren zur herstellung neuer xanthoncarbonsaureverbindungenInfo
- Publication number
- AT327896B AT327896B AT860474*7A AT860474A AT327896B AT 327896 B AT327896 B AT 327896B AT 860474 A AT860474 A AT 860474A AT 327896 B AT327896 B AT 327896B
- Authority
- AT
- Austria
- Prior art keywords
- carbonic acid
- acid compounds
- preparing new
- xanthone
- new xanthone
- Prior art date
Links
- ZYHMJCQVHJOHJW-UHFFFAOYSA-N C(O)(O)=O.C1=CC=CC=2OC3=CC=CC=C3C(C12)=O Chemical class C(O)(O)=O.C1=CC=CC=2OC3=CC=CC=C3C(C12)=O ZYHMJCQVHJOHJW-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00217287A US3849565A (en) | 1972-01-12 | 1972-01-12 | Disubstituted xanthone carboxylic acid compounds for inhibiting asthma |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA860474A ATA860474A (de) | 1975-05-15 |
| AT327896B true AT327896B (de) | 1976-02-25 |
Family
ID=22810416
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT860474*7A AT327896B (de) | 1972-01-12 | 1972-07-12 | Verfahren zur herstellung neuer xanthoncarbonsaureverbindungen |
| AT598972A AT327893B (de) | 1971-07-14 | 1972-07-12 | Verfahren zur herstellung neuer xanthoncarbonsaurederivate |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT598972A AT327893B (de) | 1971-07-14 | 1972-07-12 | Verfahren zur herstellung neuer xanthoncarbonsaurederivate |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3849565A (de) |
| AT (2) | AT327896B (de) |
| DE (1) | DE2234254A1 (de) |
| ES (3) | ES433550A1 (de) |
| ZA (1) | ZA724756B (de) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3951618A (en) * | 1974-03-12 | 1976-04-20 | Syntex (U.S.A.) Inc. | Method of use of, and compositions containing, disubstituted xanthone carboxylic acid compounds |
| IL47519A (en) * | 1974-07-09 | 1979-03-12 | Roussel Uclaf | 7-sulphinimidoyl(sulphimidoyl)-xanthone-2-carboxylic acid derivatives, their preparation and pharmaceutical compositions containing them |
| US4078078A (en) * | 1974-07-09 | 1978-03-07 | Roussel Uclaf | Novel xanthone-2-carboxylic acid compounds |
| US4015009A (en) * | 1974-10-02 | 1977-03-29 | Smithkline Corporation | Pharmaceutical compositions comprising substituted 3-cinnamoyl-2H-pyran-2,6(3H)-diones |
| US4032652A (en) * | 1975-04-23 | 1977-06-28 | Smithkline Corporation | Substituted 2h-pyran-2,6(3h)-dione derivatives, pharmaceutical compositions comprising such derivatives and methods of inhibiting the antigen-antibody reaction |
| US4250097A (en) * | 1978-03-08 | 1981-02-10 | Syntex (U.S.A.) Inc. | Compositions for and a method of preventing diabetic complications |
| US4242267A (en) * | 1980-02-04 | 1980-12-30 | Roussel Uclaf | Process for preparing 5-alkyl-7-(S-alkyl-sulfonimidoyl)-xanthone-2-carboxylic acids |
| IT1223302B (it) * | 1987-09-16 | 1990-09-19 | Baldacci Lab Spa | Composti solfonamido derivati inibitori del sistema enzimatico aldoso-reduttasi e composizioni farmaceutiche che li contengono |
-
1972
- 1972-01-12 US US00217287A patent/US3849565A/en not_active Expired - Lifetime
- 1972-07-12 DE DE2234254A patent/DE2234254A1/de active Pending
- 1972-07-12 AT AT860474*7A patent/AT327896B/de not_active IP Right Cessation
- 1972-07-12 ZA ZA724756A patent/ZA724756B/xx unknown
- 1972-07-12 AT AT598972A patent/AT327893B/de not_active IP Right Cessation
-
1975
- 1975-01-03 ES ES433550A patent/ES433550A1/es not_active Expired
- 1975-01-03 ES ES433551A patent/ES433551A1/es not_active Expired
- 1975-01-03 ES ES433549A patent/ES433549A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ATA598972A (de) | 1975-05-15 |
| US3849565A (en) | 1974-11-19 |
| ES433551A1 (es) | 1976-12-01 |
| ES433549A1 (es) | 1976-12-16 |
| ATA860474A (de) | 1975-05-15 |
| ZA724756B (en) | 1974-02-27 |
| DE2234254A1 (de) | 1973-09-13 |
| ES433550A1 (es) | 1976-12-01 |
| AT327893B (de) | 1976-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT329745B (de) | Verfahren zur herstellung von neuen o-substituierten 7beta-amino-cephem-3-01-4-carbonsaureverbindungen | |
| DD108102A5 (de) | Verfahren zur herstellung von pfropfcopolymeren | |
| ATA588973A (de) | Verfahren zur herstellung neuer phenoxypropanolamine | |
| AT331391B (de) | Verfahren zur herstellung neuer amidinopenicillansaureester | |
| AT327896B (de) | Verfahren zur herstellung neuer xanthoncarbonsaureverbindungen | |
| AT327381B (de) | Verfahren zur herstellung von 7beta-amino-3-cephem-4-carbonsaureverbindungen | |
| AT324309B (de) | Verfahren zur herstellung neuer 2-aminoalkanoylaminobenzophenone | |
| AT333305B (de) | Verfahren zur herstellung von phosphonothioureidoverbindungen | |
| AT327898B (de) | Verfahren zur herstellung neuer xanthoncarbonsaureverbindungen | |
| AT326653B (de) | Verfahren zur herstellung neuer 2-amino-4-h-pyrane | |
| AT325044B (de) | Verfahren zur herstellung neuer xanthoncarbonsaurederivaten | |
| AT327881B (de) | Verfahren zur herstellung neuer furanderivate | |
| AT326121B (de) | Verfahren zur herstellung neuer xanthoncarbonsäurederivate | |
| AT313921B (de) | Verfahren zur Herstellung neuer Dichlorvinylthionophosphorsäurediesteramide | |
| AT326120B (de) | Verfahren zur herstellung neuer isoxazolidinderivate | |
| AT325011B (de) | Verfahren zur herstellung von reinen magnesimverbindungen | |
| DD98669A5 (de) | Verfahren zur herstellung neuer pregnansaeure-derivate | |
| AT322542B (de) | Verfahren zur herstellung neuer nitrofuranverbindungen | |
| AT340396B (de) | Verfahren zur herstellung neuer substituierter chloracetanilide | |
| AT326649B (de) | Verfahren zur herstellung neuer 5-pyrazolessigsäurederivate | |
| ATA328274A (de) | Verfahren zur herstellung neuer substituierter chloracetanilide | |
| AT323165B (de) | Verfahren zur herstellung neuer picolinsäurederivate | |
| ATA611475A (de) | Verfahren zur herstellung neuer amidinopenicillansaureester | |
| AT332868B (de) | Verfahren zur herstellung von diphenylcyclopentylamin-verbindungen | |
| AT350746B (de) | Verfahren zur herstellung neuer pregnansaeure- derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |