DE2251348A1 - Osmoseverfahren und dafuer geeignete membran - Google Patents
Osmoseverfahren und dafuer geeignete membranInfo
- Publication number
- DE2251348A1 DE2251348A1 DE2251348A DE2251348A DE2251348A1 DE 2251348 A1 DE2251348 A1 DE 2251348A1 DE 2251348 A DE2251348 A DE 2251348A DE 2251348 A DE2251348 A DE 2251348A DE 2251348 A1 DE2251348 A1 DE 2251348A1
- Authority
- DE
- Germany
- Prior art keywords
- groups
- membrane
- crosslinking agent
- flow
- crosslinking
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000012528 membrane Substances 0.000 title claims description 77
- 238000000034 method Methods 0.000 title claims description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 239000004760 aramid Substances 0.000 claims description 16
- 229920003235 aromatic polyamide Polymers 0.000 claims description 16
- 239000003431 cross linking reagent Substances 0.000 claims description 16
- 230000002441 reversible effect Effects 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 14
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical group O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 11
- 230000005855 radiation Effects 0.000 claims description 11
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 9
- 150000004985 diamines Chemical group 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 6
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 claims description 5
- 150000001299 aldehydes Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical group O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 claims description 4
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 2
- 238000010612 desalination reaction Methods 0.000 claims description 2
- 229940015043 glyoxal Drugs 0.000 claims description 2
- 229920002866 paraformaldehyde Polymers 0.000 claims description 2
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical group C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 claims 1
- 125000001142 dicarboxylic acid group Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000004952 Polyamide Substances 0.000 description 28
- 229920002647 polyamide Polymers 0.000 description 28
- 238000004132 cross linking Methods 0.000 description 27
- 239000000243 solution Substances 0.000 description 27
- 229920000642 polymer Polymers 0.000 description 18
- -1 dicarboxylic acid chlorides Chemical class 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000005266 casting Methods 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 7
- 238000006116 polymerization reaction Methods 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000005345 coagulation Methods 0.000 description 6
- 230000015271 coagulation Effects 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- SXGMVGOVILIERA-UHFFFAOYSA-N (2R,3S)-2,3-diaminobutanoic acid Natural products CC(N)C(N)C(O)=O SXGMVGOVILIERA-UHFFFAOYSA-N 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 238000007334 copolymerization reaction Methods 0.000 description 4
- 239000008367 deionised water Substances 0.000 description 4
- 229910021641 deionized water Inorganic materials 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- UENRXLSRMCSUSN-UHFFFAOYSA-N 3,5-diaminobenzoic acid Chemical compound NC1=CC(N)=CC(C(O)=O)=C1 UENRXLSRMCSUSN-UHFFFAOYSA-N 0.000 description 3
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 230000004907 flux Effects 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000013557 residual solvent Substances 0.000 description 3
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 3
- UPYXKEAOXBAIFT-UHFFFAOYSA-N 3,4-dimethylazete-2-carboxamide Chemical compound CC1=C(C)C(C(N)=O)=N1 UPYXKEAOXBAIFT-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 238000010640 amide synthesis reaction Methods 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000001112 coagulating effect Effects 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- MTZUIIAIAKMWLI-UHFFFAOYSA-N 1,2-diisocyanatobenzene Chemical compound O=C=NC1=CC=CC=C1N=C=O MTZUIIAIAKMWLI-UHFFFAOYSA-N 0.000 description 1
- XQUPVDVFXZDTLT-UHFFFAOYSA-N 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C(C=C1)=CC=C1CC1=CC=C(N2C(C=CC2=O)=O)C=C1 XQUPVDVFXZDTLT-UHFFFAOYSA-N 0.000 description 1
- VLDPXPPHXDGHEW-UHFFFAOYSA-N 1-chloro-2-dichlorophosphoryloxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(Cl)=O VLDPXPPHXDGHEW-UHFFFAOYSA-N 0.000 description 1
- JIABEENURMZTTI-UHFFFAOYSA-N 1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene Chemical compound O=C=NC1=CC=CC=C1CC1=CC=CC=C1N=C=O JIABEENURMZTTI-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2,2'-azo-bis-isobutyronitrile Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- YDYSEBSNAKCEQU-UHFFFAOYSA-N 2,3-diamino-n-phenylbenzamide Chemical compound NC1=CC=CC(C(=O)NC=2C=CC=CC=2)=C1N YDYSEBSNAKCEQU-UHFFFAOYSA-N 0.000 description 1
- UDKYPBUWOIPGDY-UHFFFAOYSA-N 3-amino-n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=CC(N)=C1 UDKYPBUWOIPGDY-UHFFFAOYSA-N 0.000 description 1
- WPBZMCGPFHZRHJ-UHFFFAOYSA-N 4-aminobenzohydrazide Chemical compound NNC(=O)C1=CC=C(N)C=C1 WPBZMCGPFHZRHJ-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- OXIKYYJDTWKERT-UHFFFAOYSA-N [4-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCC(CN)CC1 OXIKYYJDTWKERT-UHFFFAOYSA-N 0.000 description 1
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- JMLPVHXESHXUSV-UHFFFAOYSA-N dodecane-1,1-diamine Chemical compound CCCCCCCCCCCC(N)N JMLPVHXESHXUSV-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000012527 feed solution Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002531 isophthalic acids Chemical class 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- IHYNKGRWCDKNEG-UHFFFAOYSA-N n-(4-bromophenyl)-2,6-dihydroxybenzamide Chemical compound OC1=CC=CC(O)=C1C(=O)NC1=CC=C(Br)C=C1 IHYNKGRWCDKNEG-UHFFFAOYSA-N 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- FEZFGASTIQVZSC-UHFFFAOYSA-N nonanoyl nonaneperoxoate Chemical compound CCCCCCCCC(=O)OOC(=O)CCCCCCCC FEZFGASTIQVZSC-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920005597 polymer membrane Polymers 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- KQBSGRWMSNFIPG-UHFFFAOYSA-N trioxane Chemical compound C1COOOC1 KQBSGRWMSNFIPG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D71/00—Semi-permeable membranes for separation processes or apparatus characterised by the material; Manufacturing processes specially adapted therefor
- B01D71/06—Organic material
- B01D71/56—Polyamides, e.g. polyester-amides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/60—Polyamides or polyester-amides
- C08G18/603—Polyamides
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US191818A US3904519A (en) | 1971-10-19 | 1971-10-19 | Reverse osmosis process using crosslinked aromatic polyamide membranes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2251348A1 true DE2251348A1 (de) | 1973-04-26 |
Family
ID=22707053
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2251348A Withdrawn DE2251348A1 (de) | 1971-10-19 | 1972-10-19 | Osmoseverfahren und dafuer geeignete membran |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3904519A (OSRAM) |
| AU (1) | AU473950B2 (OSRAM) |
| CA (1) | CA966067A (OSRAM) |
| DE (1) | DE2251348A1 (OSRAM) |
| FR (1) | FR2156839B1 (OSRAM) |
| GB (1) | GB1390418A (OSRAM) |
| IL (1) | IL40449A (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2638065A1 (de) * | 1975-08-25 | 1977-03-03 | Sumitomo Chemical Co | Verfahren zur herstellung von semipermeablen membranen |
| FR2527469A1 (fr) * | 1982-05-29 | 1983-12-02 | Seitz Filter Werke | Filtre a membrane pour la microfiltration et procede pour sa fabrication |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5543367B2 (OSRAM) * | 1975-01-08 | 1980-11-06 | ||
| DE2554932A1 (de) * | 1975-12-06 | 1977-06-08 | Bayer Ag | Semipermeable membranen aus copolyamiden |
| NZ184767A (en) * | 1976-08-05 | 1980-03-05 | Tecneco Spa | Assymetric membranes from fluorinated polymeric materials |
| US4087388A (en) * | 1976-10-21 | 1978-05-02 | E. I. Du Pont De Nemours And Company | Process of preparing a permselective membrane |
| US4259183A (en) * | 1978-11-07 | 1981-03-31 | Midwest Research Institute | Reverse osmosis membrane |
| US4277344A (en) * | 1979-02-22 | 1981-07-07 | Filmtec Corporation | Interfacially synthesized reverse osmosis membrane |
| DE2940447C2 (de) * | 1979-10-05 | 1982-03-18 | Forschungsinstitut Berghof GmbH, 7400 Tübingen | Integralasymmetrische Ultrafiltrationsmembran |
| JPS5824304A (ja) * | 1981-08-07 | 1983-02-14 | Toray Ind Inc | 高性能半透性複合膜 |
| JPS58152498A (ja) * | 1982-03-06 | 1983-09-10 | Terumo Corp | 低分子ペプチド混合物の製造方法 |
| DE3483554D1 (de) * | 1983-02-02 | 1990-12-13 | Memtec Ltd | Vernetzte poroese membranen. |
| AU571194B2 (en) * | 1983-02-02 | 1988-04-14 | Memtec Limited | Cross linked porous membranes |
| US4606943A (en) * | 1983-03-18 | 1986-08-19 | Culligan International Company | Method for preparation of semipermeable composite membrane |
| WO1985001735A1 (en) * | 1983-10-18 | 1985-04-25 | Memtec Limited | Substituted aliphatic polyamide porous membranes |
| US4659475A (en) * | 1984-03-19 | 1987-04-21 | Midwest Research Institute | Composite reverse osmosis membrane comprising crosslinked poly(amine-epihalohydrin adduct) |
| US4772394A (en) * | 1984-12-26 | 1988-09-20 | Uop Inc. | Chlorine-resistant semipermeable membranes |
| US4661254A (en) * | 1985-05-23 | 1987-04-28 | Uop Inc. | Chlorine-resistant semipermeable membranes |
| US4919808A (en) * | 1985-10-21 | 1990-04-24 | Allied-Signal Inc. | Semipermeable membrane compositions |
| US4814082A (en) * | 1986-10-20 | 1989-03-21 | Memtec North America Corporation | Ultrafiltration thin film membranes |
| US5069945A (en) * | 1986-10-20 | 1991-12-03 | Memtec America Corporation | Ultrapous thin-film membranes |
| US4830885A (en) * | 1987-06-08 | 1989-05-16 | Allied-Signal Inc. | Chlorine-resistant semipermeable membranes |
| US4769148A (en) * | 1987-11-18 | 1988-09-06 | The Dow Chemical Company | Novel polyamide reverse osmosis membranes |
| US4859384A (en) * | 1987-11-18 | 1989-08-22 | Filmtec Corp. | Novel polyamide reverse osmosis membranes |
| US4792404A (en) * | 1988-03-28 | 1988-12-20 | Allied-Signal Inc. | Desalination of saline water |
| US5254261A (en) * | 1991-08-12 | 1993-10-19 | Hydranautics | Interfacially synthesized reverse osmosis membranes and processes for preparing the same |
| US5271843A (en) * | 1991-09-09 | 1993-12-21 | Allied-Signal Inc. | Chlorine-tolerant, thin-film composite membrane |
| US5246587A (en) * | 1991-12-23 | 1993-09-21 | Hydranautics | Interfacially synthesized reverse osmosis membranes and processes for preparing the same |
| KR0118208B1 (ko) * | 1992-07-20 | 1997-09-30 | 하기주 | 방향족 폴리아미드 및 그의 제조방법 |
| KR0183370B1 (ko) * | 1995-07-07 | 1999-04-15 | 김은영 | 방향족 폴리에스테르 또는 방향족 폴리에스테르와 폴리아미드 공중합체의 활성층을 갖는 역삼투용 복합막 |
| US5922203A (en) * | 1997-10-07 | 1999-07-13 | Hydranautics | Amine monomers and their use in preparing interfacially synthesized membranes for reverse osmosis and nanofiltration |
| US6368507B1 (en) | 1998-10-14 | 2002-04-09 | Saekan Industries Incorporation | Composite polyamide reverse osmosis membrane and method of producing the same |
| US6245234B1 (en) * | 1999-06-03 | 2001-06-12 | Saehan Industries Incorporation | Composite polyamide reverse osmosis membrane and method of producing the same |
| US6464873B1 (en) | 1999-06-15 | 2002-10-15 | Hydranautics | Interfacially polymerized, bipiperidine-polyamide membranes for reverse osmosis and/or nanofiltration and process for making the same |
| KR100614176B1 (ko) * | 1999-09-28 | 2006-08-21 | 도레이 가부시끼가이샤 | 복합 반투막의 제조 방법 |
| US6881209B2 (en) * | 2000-05-25 | 2005-04-19 | Cook Incorporated | Medical device including unitary, continuous portion of varying durometer |
| WO2004091471A2 (en) * | 2003-04-04 | 2004-10-28 | Berger, Constance, F. | Apparatus for heating bottles and method of manufacturing same |
| US8268937B2 (en) * | 2006-09-09 | 2012-09-18 | Teijin Aramid B.V. | Crosslinkable aramid copolymers |
| MX2009008435A (es) * | 2007-02-14 | 2009-11-02 | Dxv Water Technologies Llc | Membrana expuesta a profundidad para extraccion de agua. |
| US7910012B2 (en) * | 2007-07-16 | 2011-03-22 | General Electric Company | Composition, membrane, and associated method |
| US8177978B2 (en) * | 2008-04-15 | 2012-05-15 | Nanoh20, Inc. | Reverse osmosis membranes |
| EP2448657B1 (en) | 2009-06-29 | 2018-12-26 | NanoH2O Inc. | Improved hybrid tfc ro membranes with nitrogen additives |
| US8685252B2 (en) * | 2010-02-04 | 2014-04-01 | Dxv Water Technologies, Llc | Water treatment systems and methods |
| EP2637773B1 (en) | 2010-11-10 | 2019-10-30 | NanoH2O Inc. | Improved hybrid tfc ro membranes with non-metallic additives |
| KR101962155B1 (ko) * | 2010-12-28 | 2019-07-17 | 도레이 카부시키가이샤 | 복합 반투막 |
| CN102512982B (zh) * | 2012-01-11 | 2013-11-13 | 浙江理工大学 | 一种抗菌耐氧化复合反渗透膜 |
| US9795928B2 (en) | 2014-06-24 | 2017-10-24 | Nano And Advanced Materials Institute Limited | Stepwise interfacial polymerization technique with different reagent solution designs to prepare hollow fiber nanofiltration membrane composites |
| US10513446B2 (en) | 2014-10-10 | 2019-12-24 | EcoDesal, LLC | Depth exposed membrane for water extraction |
| US9861940B2 (en) | 2015-08-31 | 2018-01-09 | Lg Baboh2O, Inc. | Additives for salt rejection enhancement of a membrane |
| US9737859B2 (en) | 2016-01-11 | 2017-08-22 | Lg Nanoh2O, Inc. | Process for improved water flux through a TFC membrane |
| US10155203B2 (en) | 2016-03-03 | 2018-12-18 | Lg Nanoh2O, Inc. | Methods of enhancing water flux of a TFC membrane using oxidizing and reducing agents |
| WO2018049013A1 (en) * | 2016-09-07 | 2018-03-15 | Oasys Water, Inc. | Membranes with alternative selective layers |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3140256A (en) * | 1957-09-30 | 1964-07-07 | Standard Oil Co | Separation process |
| US3276996A (en) * | 1963-07-15 | 1966-10-04 | Lazare Leon | Separating water from saline solutions |
| US3423491A (en) * | 1964-09-02 | 1969-01-21 | Dow Chemical Co | Permselective hollow fibers and method of making |
| US3497451A (en) * | 1967-10-11 | 1970-02-24 | Du Pont | Permeation separation with type-8 nylon membranes |
| US3524546A (en) * | 1967-10-11 | 1970-08-18 | Du Pont | Permeation separation with acidgrafted nylon membranes |
| US3531525A (en) * | 1968-03-18 | 1970-09-29 | Lubrizol Corp | Preparation of n-3-hydroxyalkyl acrylamides by hydrolysis of vinyl oxazines |
| US3567632A (en) * | 1968-09-04 | 1971-03-02 | Du Pont | Permselective,aromatic,nitrogen-containing polymeric membranes |
| US3554379A (en) * | 1969-06-10 | 1971-01-12 | Du Pont | Desalination apparatus and process of manufacture using improved, nitrogenous membranes |
| FR2080241A5 (OSRAM) * | 1970-02-27 | 1971-11-12 | Consiglio Nazionale Ricerche |
-
1971
- 1971-10-19 US US191818A patent/US3904519A/en not_active Expired - Lifetime
-
1972
- 1972-09-18 GB GB4313172A patent/GB1390418A/en not_active Expired
- 1972-09-18 CA CA151,944A patent/CA966067A/en not_active Expired
- 1972-09-28 IL IL40449A patent/IL40449A/en unknown
- 1972-10-10 AU AU47569/72A patent/AU473950B2/en not_active Expired
- 1972-10-19 DE DE2251348A patent/DE2251348A1/de not_active Withdrawn
- 1972-10-19 FR FR7237121A patent/FR2156839B1/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2638065A1 (de) * | 1975-08-25 | 1977-03-03 | Sumitomo Chemical Co | Verfahren zur herstellung von semipermeablen membranen |
| FR2527469A1 (fr) * | 1982-05-29 | 1983-12-02 | Seitz Filter Werke | Filtre a membrane pour la microfiltration et procede pour sa fabrication |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2156839A1 (OSRAM) | 1973-06-01 |
| CA966067A (en) | 1975-04-15 |
| FR2156839B1 (OSRAM) | 1979-04-13 |
| IL40449A (en) | 1976-01-30 |
| GB1390418A (en) | 1975-04-09 |
| IL40449A0 (en) | 1972-11-28 |
| AU4756972A (en) | 1974-04-26 |
| US3904519A (en) | 1975-09-09 |
| AU473950B2 (en) | 1974-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2251348A1 (de) | Osmoseverfahren und dafuer geeignete membran | |
| DE2920772C2 (de) | Semipermeable zusammengesetzte Membran und Verfahren zu deren Herstellung | |
| DE2849978C3 (de) | Selektivdurchlässige Membran und Verfahren zu deren Herstellung | |
| DE69211731T2 (de) | Verfahren zur Herstellung einer teildurchlässigen Verbundmembran | |
| DE2602493A1 (de) | Verfahren zur entfernung von harnstoff aus waessrigen loesungen | |
| DE2642407A1 (de) | Zusammengesetzte halbdurchlaessige membranen und verfahren zu ihrer herstellung | |
| DE3018540A1 (de) | Verfahren zur herstellung von selektiv durchlaessigen membranen | |
| DE69620720T2 (de) | Halbdurchlässige, zusammengesetzte Membran, Verfahren zur Herstellung einer derartigen Membran, und ihre Verwendung | |
| EP0043481B1 (de) | Semipermeable Membranen | |
| EP0364892B1 (de) | Vollaromatische Polyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE69007340T2 (de) | Behandlung von Umkehrosmosemembranen. | |
| DE2418996A1 (de) | Asymmetrische, semipermeable membranen aus polybenz-1,3-oxazindionen-2,4 | |
| EP0364893B1 (de) | Vollaromatische Polyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE3935472A1 (de) | Vollaromatische polyamide, verfahren zu ihrer herstellung und daraus geformte gebilde | |
| DE2554932A1 (de) | Semipermeable membranen aus copolyamiden | |
| EP0364891B1 (de) | Vollaromatische Polyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE3038012C2 (de) | Selektiv durchlässige Membran auf Basis eines Polychinazolon-Polymers | |
| DE929151C (de) | Verfahren zur Herstellung hochpolymerer linearer Polyamide | |
| DE2352332A1 (de) | Verfahren zur modifizierung von formkoerpern aus polyaminosaeuren | |
| DE69000710T2 (de) | Verfahren zur herstellung von chlorbestaendigen halbdurchlaessigen polyestermembranen. | |
| DE3707851C2 (de) | Permselektive Membran | |
| DE2544118C2 (de) | Zusammengesetzte Membran aus einem Träger und einem darauf aufgebrachten dünnen semipermeablen Häutchen | |
| DE69010727T2 (de) | Verbundmembranen aus P-Xylylendiamid oder -diimid zur Umkehrosmose. | |
| DE1965479B2 (de) | Verfahren zur herstellung von copolyamiden und ihre verwendung fuer flach- und/oder schlauchfolien | |
| DE2950236C2 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8136 | Disposal/non-payment of the fee for publication/grant |