DE2247418A1 - Neue azofarbstoffe und verfahren zu ihrer herstellung - Google Patents
Neue azofarbstoffe und verfahren zu ihrer herstellungInfo
- Publication number
- DE2247418A1 DE2247418A1 DE19722247418 DE2247418A DE2247418A1 DE 2247418 A1 DE2247418 A1 DE 2247418A1 DE 19722247418 DE19722247418 DE 19722247418 DE 2247418 A DE2247418 A DE 2247418A DE 2247418 A1 DE2247418 A1 DE 2247418A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- sodium
- acid
- methyl
- dye according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 32
- 239000002253 acid Substances 0.000 claims description 30
- 238000004043 dyeing Methods 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 150000002431 hydrogen Chemical class 0.000 claims description 19
- 239000011734 sodium Substances 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000000835 fiber Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- 239000000975 dye Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 238000003756 stirring Methods 0.000 description 12
- 239000000463 material Substances 0.000 description 11
- 229920001778 nylon Polymers 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 239000004677 Nylon Substances 0.000 description 9
- 238000005859 coupling reaction Methods 0.000 description 9
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 8
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 8
- -1 kthoxy Chemical group 0.000 description 8
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 7
- 239000000987 azo dye Substances 0.000 description 7
- 238000010168 coupling process Methods 0.000 description 7
- 238000006193 diazotization reaction Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 229960001413 acetanilide Drugs 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 description 6
- 239000011707 mineral Substances 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 235000010288 sodium nitrite Nutrition 0.000 description 5
- 210000002268 wool Anatomy 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical class [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- XJQRCFRVWZHIPN-UHFFFAOYSA-N 3-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1Cl XJQRCFRVWZHIPN-UHFFFAOYSA-N 0.000 description 2
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- WJJBXBDFQFYLCE-UHFFFAOYSA-N 2-(diethylamino)-N-phenylbutanamide Chemical compound C(C)N(CC)C(C(=O)NC1=CC=CC=C1)CC WJJBXBDFQFYLCE-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- LEQAQBFYCMENLP-UHFFFAOYSA-N 2-methoxy-n-phenylacetamide Chemical compound COCC(=O)NC1=CC=CC=C1 LEQAQBFYCMENLP-UHFFFAOYSA-N 0.000 description 1
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 1
- NZDXSXLYLMHYJA-UHFFFAOYSA-M 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C NZDXSXLYLMHYJA-UHFFFAOYSA-M 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000440398 Butia Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 125000005998 bromoethyl group Chemical group 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- BJSFZEPCOUSXMN-UHFFFAOYSA-N n-[3-(2-chloroethylamino)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(NCCCl)=C1 BJSFZEPCOUSXMN-UHFFFAOYSA-N 0.000 description 1
- OMFRCMQOCKKUOR-UHFFFAOYSA-N n-[3-(diethylamino)phenyl]benzamide Chemical compound CCN(CC)C1=CC=CC(NC(=O)C=2C=CC=CC=2)=C1 OMFRCMQOCKKUOR-UHFFFAOYSA-N 0.000 description 1
- FWQIENRDARREMJ-UHFFFAOYSA-N n-[3-(methylamino)phenyl]acetamide Chemical compound CNC1=CC=CC(NC(C)=O)=C1 FWQIENRDARREMJ-UHFFFAOYSA-N 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 239000010979 ruby Substances 0.000 description 1
- 229910001750 ruby Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/04—Disazo dyes from a coupling component "C" containing a directive amino group
- C09B31/043—Amino-benzenes
- C09B31/047—Amino-benzenes containing acid groups, e.g. —CO2H, —SO3H, —PO3H2, —OSO3H, —OPO2H2; Salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00185342A US3847895A (en) | 1971-09-30 | 1971-09-30 | Substituted sulfophenyl-azo-naphthylazo-anilide compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2247418A1 true DE2247418A1 (de) | 1973-04-05 |
Family
ID=22680594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722247418 Pending DE2247418A1 (de) | 1971-09-30 | 1972-09-27 | Neue azofarbstoffe und verfahren zu ihrer herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3847895A (enExample) |
| JP (1) | JPS4843419A (enExample) |
| CA (1) | CA962668A (enExample) |
| CH (1) | CH561758A5 (enExample) |
| DE (1) | DE2247418A1 (enExample) |
| FR (1) | FR2154588B1 (enExample) |
| GB (1) | GB1374048A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2443485A1 (de) * | 1974-09-11 | 1976-03-25 | Bayer Ag | Disazofarbstoffe |
| DE2557410A1 (de) * | 1975-12-19 | 1977-06-30 | Bayer Ag | Disazofarbstoffe |
| DE2708779A1 (de) * | 1977-03-01 | 1978-09-07 | Bayer Ag | Disazofarbstoffe |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1555480A (en) * | 1975-10-08 | 1979-11-14 | Ici Ltd | Disazo dyes |
| US4466920A (en) * | 1977-03-14 | 1984-08-21 | Sandoz Ltd. | Disazo compounds having a further unsubstituted or substituted sulfophenyl diazo component radical and a 4-alkoxy- or arylsulfonyloxy benzene coupling component radical having an acylamina substituent |
| JPS57150612A (en) * | 1981-03-13 | 1982-09-17 | Tanabe Seiyaku Co Ltd | Immediately releasing micro-capsule and its preparation |
| JPS5858146A (ja) * | 1981-10-05 | 1983-04-06 | Tanabe Seiyaku Co Ltd | 速放性マイクロカプセル |
| JPS5858145A (ja) * | 1981-10-05 | 1983-04-06 | Tanabe Seiyaku Co Ltd | 速放性マイクロカプセル |
| FR2651127B1 (fr) * | 1989-08-30 | 1994-06-03 | Chevance Leon | Nouvelle utilisation de substances comme anticomplements et medicaments renfermant une telle substance. |
| FR2651128A1 (fr) * | 1989-08-30 | 1991-03-01 | Chevance Leon | Nouvelle utilisation des anticomplements pour le traitement des parodontoses. |
| KR102594487B1 (ko) * | 2015-03-16 | 2023-10-25 | 아르크로마 아이피 게엠베하 | 트리스아조 산 염료 |
| ES2969949T3 (es) * | 2019-01-17 | 2024-05-23 | Archroma Ip Gmbh | Nuevos tintes ácidos bisazo |
-
1971
- 1971-09-30 US US00185342A patent/US3847895A/en not_active Expired - Lifetime
-
1972
- 1972-08-30 CA CA150,595A patent/CA962668A/en not_active Expired
- 1972-09-08 GB GB4181072A patent/GB1374048A/en not_active Expired
- 1972-09-25 CH CH1397572A patent/CH561758A5/xx not_active IP Right Cessation
- 1972-09-26 FR FR7233985A patent/FR2154588B1/fr not_active Expired
- 1972-09-27 DE DE19722247418 patent/DE2247418A1/de active Pending
- 1972-09-27 JP JP47096961A patent/JPS4843419A/ja active Pending
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2443485A1 (de) * | 1974-09-11 | 1976-03-25 | Bayer Ag | Disazofarbstoffe |
| DE2557410A1 (de) * | 1975-12-19 | 1977-06-30 | Bayer Ag | Disazofarbstoffe |
| DE2708779A1 (de) * | 1977-03-01 | 1978-09-07 | Bayer Ag | Disazofarbstoffe |
Also Published As
| Publication number | Publication date |
|---|---|
| CH561758A5 (enExample) | 1975-05-15 |
| FR2154588B1 (enExample) | 1976-01-30 |
| US3847895A (en) | 1974-11-12 |
| CA962668A (en) | 1975-02-11 |
| GB1374048A (en) | 1974-11-13 |
| FR2154588A1 (enExample) | 1973-05-11 |
| JPS4843419A (enExample) | 1973-06-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2340569C2 (de) | Azofarbstoffe | |
| DE2247418A1 (de) | Neue azofarbstoffe und verfahren zu ihrer herstellung | |
| DE1930261C3 (de) | Disazofarbstoffe und ihre Verwendung zum Färben stickstoffhaltiger Fasermaterialien | |
| DE1923680B2 (de) | Disazofarbstoffe und ihre verwendung zum faerben und bedrucken von natuerlichen und synthetischen fasermaterialien | |
| DE1644340C3 (de) | Monoazofarbstoffe und ein Verfahren zu ihrer Herstellung. Ausscheidung aus: 1225323 | |
| DE2154942B2 (de) | Faserreaktive Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von nativen oder regenerierten Cellulosefasern, natürlichen oder synthetischen Polyamidfasern oder von Polyurethanfasern | |
| DE1107356B (de) | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen | |
| DE2453209C2 (de) | Disazofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2163389B2 (de) | Wasserlösliche Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Fasermaterial | |
| DE2161698C3 (de) | Wasserlösliche, faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamidfasern, Polyurethanfasern, nativen oder regenerierten Cellulosefasern | |
| DE2716503A1 (de) | Azofarbstoff-zwischenprodukt | |
| DE1644074B2 (de) | Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen | |
| AT220742B (de) | Verfahren zur Herstellung von neuen Azofarbstoffen | |
| DE914300C (de) | Verfahren zur Herstellung von kupferbaren Polyazofarbstoffen | |
| AT162592B (de) | Verfahren zur Herstellung von neuen Disazofarbstoffen | |
| DE955884C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE2305616C3 (de) | Trisazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1544347C (de) | Monoazostilbenverbindungen sowie deren Herstellung und Verwendung | |
| AT227852B (de) | Verfahren zur Herstellung neuer wasserunlöslicher Monoazofarbstoffe | |
| DE2811189A1 (de) | Wasserloesliche saure azofarbstoffe | |
| DE2514856A1 (de) | Neue wasserloesliche disazofarbstoffe und verfahren zu ihrer herstellung | |
| CH302404A (de) | Verfahren zur Herstellung eines Trisazofarbstoffes. | |
| EP0891395A1 (de) | Trisazofarbstoffe | |
| DE3905810A1 (de) | Azofarbstoffe, verfahren zu deren herstellung und deren verwendung | |
| CH341586A (de) | Verfahren zur Herstellung walkechter Monoazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |