DE2247418A1 - Neue azofarbstoffe und verfahren zu ihrer herstellung - Google Patents
Neue azofarbstoffe und verfahren zu ihrer herstellungInfo
- Publication number
- DE2247418A1 DE2247418A1 DE19722247418 DE2247418A DE2247418A1 DE 2247418 A1 DE2247418 A1 DE 2247418A1 DE 19722247418 DE19722247418 DE 19722247418 DE 2247418 A DE2247418 A DE 2247418A DE 2247418 A1 DE2247418 A1 DE 2247418A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- sodium
- acid
- methyl
- dye according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 32
- 239000002253 acid Substances 0.000 claims description 30
- 238000004043 dyeing Methods 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 150000002431 hydrogen Chemical class 0.000 claims description 19
- 239000011734 sodium Substances 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000000835 fiber Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- 239000000975 dye Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 238000003756 stirring Methods 0.000 description 12
- 239000000463 material Substances 0.000 description 11
- 229920001778 nylon Polymers 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 239000004677 Nylon Substances 0.000 description 9
- 238000005859 coupling reaction Methods 0.000 description 9
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 8
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 8
- -1 kthoxy Chemical group 0.000 description 8
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 7
- 239000000987 azo dye Substances 0.000 description 7
- 238000010168 coupling process Methods 0.000 description 7
- 238000006193 diazotization reaction Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 229960001413 acetanilide Drugs 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 description 6
- 239000011707 mineral Substances 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 235000010288 sodium nitrite Nutrition 0.000 description 5
- 210000002268 wool Anatomy 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical class [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- XJQRCFRVWZHIPN-UHFFFAOYSA-N 3-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1Cl XJQRCFRVWZHIPN-UHFFFAOYSA-N 0.000 description 2
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- WJJBXBDFQFYLCE-UHFFFAOYSA-N 2-(diethylamino)-N-phenylbutanamide Chemical compound C(C)N(CC)C(C(=O)NC1=CC=CC=C1)CC WJJBXBDFQFYLCE-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- LEQAQBFYCMENLP-UHFFFAOYSA-N 2-methoxy-n-phenylacetamide Chemical compound COCC(=O)NC1=CC=CC=C1 LEQAQBFYCMENLP-UHFFFAOYSA-N 0.000 description 1
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 1
- NZDXSXLYLMHYJA-UHFFFAOYSA-M 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C NZDXSXLYLMHYJA-UHFFFAOYSA-M 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000440398 Butia Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 125000005998 bromoethyl group Chemical group 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- BJSFZEPCOUSXMN-UHFFFAOYSA-N n-[3-(2-chloroethylamino)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(NCCCl)=C1 BJSFZEPCOUSXMN-UHFFFAOYSA-N 0.000 description 1
- OMFRCMQOCKKUOR-UHFFFAOYSA-N n-[3-(diethylamino)phenyl]benzamide Chemical compound CCN(CC)C1=CC=CC(NC(=O)C=2C=CC=CC=2)=C1 OMFRCMQOCKKUOR-UHFFFAOYSA-N 0.000 description 1
- FWQIENRDARREMJ-UHFFFAOYSA-N n-[3-(methylamino)phenyl]acetamide Chemical compound CNC1=CC=CC(NC(C)=O)=C1 FWQIENRDARREMJ-UHFFFAOYSA-N 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 239000010979 ruby Substances 0.000 description 1
- 229910001750 ruby Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/04—Disazo dyes from a coupling component "C" containing a directive amino group
- C09B31/043—Amino-benzenes
- C09B31/047—Amino-benzenes containing acid groups, e.g. —CO2H, —SO3H, —PO3H2, —OSO3H, —OPO2H2; Salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00185342A US3847895A (en) | 1971-09-30 | 1971-09-30 | Substituted sulfophenyl-azo-naphthylazo-anilide compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2247418A1 true DE2247418A1 (de) | 1973-04-05 |
Family
ID=22680594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722247418 Pending DE2247418A1 (de) | 1971-09-30 | 1972-09-27 | Neue azofarbstoffe und verfahren zu ihrer herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3847895A (OSRAM) |
| JP (1) | JPS4843419A (OSRAM) |
| CA (1) | CA962668A (OSRAM) |
| CH (1) | CH561758A5 (OSRAM) |
| DE (1) | DE2247418A1 (OSRAM) |
| FR (1) | FR2154588B1 (OSRAM) |
| GB (1) | GB1374048A (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2443485A1 (de) * | 1974-09-11 | 1976-03-25 | Bayer Ag | Disazofarbstoffe |
| DE2557410A1 (de) * | 1975-12-19 | 1977-06-30 | Bayer Ag | Disazofarbstoffe |
| DE2708779A1 (de) * | 1977-03-01 | 1978-09-07 | Bayer Ag | Disazofarbstoffe |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1555480A (en) * | 1975-10-08 | 1979-11-14 | Ici Ltd | Disazo dyes |
| US4466920A (en) * | 1977-03-14 | 1984-08-21 | Sandoz Ltd. | Disazo compounds having a further unsubstituted or substituted sulfophenyl diazo component radical and a 4-alkoxy- or arylsulfonyloxy benzene coupling component radical having an acylamina substituent |
| JPS57150612A (en) * | 1981-03-13 | 1982-09-17 | Tanabe Seiyaku Co Ltd | Immediately releasing micro-capsule and its preparation |
| JPS5858145A (ja) * | 1981-10-05 | 1983-04-06 | Tanabe Seiyaku Co Ltd | 速放性マイクロカプセル |
| JPS5858146A (ja) * | 1981-10-05 | 1983-04-06 | Tanabe Seiyaku Co Ltd | 速放性マイクロカプセル |
| FR2651128A1 (fr) * | 1989-08-30 | 1991-03-01 | Chevance Leon | Nouvelle utilisation des anticomplements pour le traitement des parodontoses. |
| FR2651127B1 (fr) * | 1989-08-30 | 1994-06-03 | Chevance Leon | Nouvelle utilisation de substances comme anticomplements et medicaments renfermant une telle substance. |
| TWI667293B (zh) * | 2015-03-16 | 2019-08-01 | 瑞士商亞齊羅馬Ip公司 | 三偶氮酸性染料及其製造方法與用途、以及將其用於染色或印刷基板的製程和使用其所得到之具有顏色的基板、以及其染色組成 |
| EP3683276B1 (en) * | 2019-01-17 | 2023-11-15 | Archroma IP GmbH | New bisazo acid dyes |
-
1971
- 1971-09-30 US US00185342A patent/US3847895A/en not_active Expired - Lifetime
-
1972
- 1972-08-30 CA CA150,595A patent/CA962668A/en not_active Expired
- 1972-09-08 GB GB4181072A patent/GB1374048A/en not_active Expired
- 1972-09-25 CH CH1397572A patent/CH561758A5/xx not_active IP Right Cessation
- 1972-09-26 FR FR7233985A patent/FR2154588B1/fr not_active Expired
- 1972-09-27 DE DE19722247418 patent/DE2247418A1/de active Pending
- 1972-09-27 JP JP47096961A patent/JPS4843419A/ja active Pending
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2443485A1 (de) * | 1974-09-11 | 1976-03-25 | Bayer Ag | Disazofarbstoffe |
| DE2557410A1 (de) * | 1975-12-19 | 1977-06-30 | Bayer Ag | Disazofarbstoffe |
| DE2708779A1 (de) * | 1977-03-01 | 1978-09-07 | Bayer Ag | Disazofarbstoffe |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4843419A (OSRAM) | 1973-06-23 |
| CA962668A (en) | 1975-02-11 |
| FR2154588A1 (OSRAM) | 1973-05-11 |
| CH561758A5 (OSRAM) | 1975-05-15 |
| GB1374048A (en) | 1974-11-13 |
| FR2154588B1 (OSRAM) | 1976-01-30 |
| US3847895A (en) | 1974-11-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2340569C2 (de) | Azofarbstoffe | |
| DE2247418A1 (de) | Neue azofarbstoffe und verfahren zu ihrer herstellung | |
| DE1930261C3 (de) | Disazofarbstoffe und ihre Verwendung zum Färben stickstoffhaltiger Fasermaterialien | |
| DE1923680B2 (de) | Disazofarbstoffe und ihre verwendung zum faerben und bedrucken von natuerlichen und synthetischen fasermaterialien | |
| DE1644340C3 (de) | Monoazofarbstoffe und ein Verfahren zu ihrer Herstellung. Ausscheidung aus: 1225323 | |
| DE2154942B2 (de) | Faserreaktive Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von nativen oder regenerierten Cellulosefasern, natürlichen oder synthetischen Polyamidfasern oder von Polyurethanfasern | |
| DE1107356B (de) | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen | |
| DE2453209C2 (de) | Disazofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2163389B2 (de) | Wasserlösliche Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Fasermaterial | |
| DE2161698C3 (de) | Wasserlösliche, faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamidfasern, Polyurethanfasern, nativen oder regenerierten Cellulosefasern | |
| DE2716503A1 (de) | Azofarbstoff-zwischenprodukt | |
| DE1644074B2 (de) | Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen | |
| AT220742B (de) | Verfahren zur Herstellung von neuen Azofarbstoffen | |
| DE914300C (de) | Verfahren zur Herstellung von kupferbaren Polyazofarbstoffen | |
| AT162592B (de) | Verfahren zur Herstellung von neuen Disazofarbstoffen | |
| DE955884C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE2305616C3 (de) | Trisazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1544347C (de) | Monoazostilbenverbindungen sowie deren Herstellung und Verwendung | |
| AT227852B (de) | Verfahren zur Herstellung neuer wasserunlöslicher Monoazofarbstoffe | |
| DE2811189A1 (de) | Wasserloesliche saure azofarbstoffe | |
| DE2514856A1 (de) | Neue wasserloesliche disazofarbstoffe und verfahren zu ihrer herstellung | |
| CH302404A (de) | Verfahren zur Herstellung eines Trisazofarbstoffes. | |
| EP0891395A1 (de) | Trisazofarbstoffe | |
| DE3905810A1 (de) | Azofarbstoffe, verfahren zu deren herstellung und deren verwendung | |
| CH341586A (de) | Verfahren zur Herstellung walkechter Monoazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |