DE2220295C3 - Waschmittel - Google Patents
WaschmittelInfo
- Publication number
- DE2220295C3 DE2220295C3 DE2220295A DE2220295A DE2220295C3 DE 2220295 C3 DE2220295 C3 DE 2220295C3 DE 2220295 A DE2220295 A DE 2220295A DE 2220295 A DE2220295 A DE 2220295A DE 2220295 C3 DE2220295 C3 DE 2220295C3
- Authority
- DE
- Germany
- Prior art keywords
- coona
- acid
- salt
- coom
- detergents
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003599 detergent Substances 0.000 title claims description 70
- 150000003839 salts Chemical class 0.000 claims description 30
- 239000004094 surface-active agent Substances 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 8
- -1 alkyl radical Chemical class 0.000 description 26
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 21
- 239000011734 sodium Substances 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 19
- 150000001875 compounds Chemical class 0.000 description 16
- 229910052708 sodium Inorganic materials 0.000 description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- UURYKQHCLJWXEU-UHFFFAOYSA-N 2-(2-hydroxypropanoyloxy)butanedioic acid Chemical compound CC(O)C(=O)OC(C(O)=O)CC(O)=O UURYKQHCLJWXEU-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 11
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 9
- 229940009098 aspartate Drugs 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 150000008064 anhydrides Chemical class 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 239000011575 calcium Substances 0.000 description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 229940077388 benzenesulfonate Drugs 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000013522 chelant Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 235000019832 sodium triphosphate Nutrition 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000006957 Michael reaction Methods 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- 239000004115 Sodium Silicate Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000003729 cation exchange resin Substances 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 238000004851 dishwashing Methods 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 3
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 239000002888 zwitterionic surfactant Substances 0.000 description 3
- ZBDUGIBUMZADLJ-UHFFFAOYSA-N 2-(carboxymethoxymethyl)butanedioic acid Chemical compound OC(=O)COCC(C(O)=O)CC(O)=O ZBDUGIBUMZADLJ-UHFFFAOYSA-N 0.000 description 2
- JPHVSDWIWBDHOC-UHFFFAOYSA-N 2-(carboxymethylsulfanyl)butanedioic acid Chemical compound OC(=O)CSC(C(O)=O)CC(O)=O JPHVSDWIWBDHOC-UHFFFAOYSA-N 0.000 description 2
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- XRRDRNPBBNMFSP-BHRFRFAJSA-K [O-]C(CCCN[C@@H](CC([O-])=O)C([O-])=O)=O.[Na+].[Na+].[Na+] Chemical compound [O-]C(CCCN[C@@H](CC([O-])=O)C([O-])=O)=O.[Na+].[Na+].[Na+] XRRDRNPBBNMFSP-BHRFRFAJSA-K 0.000 description 2
- VMRUEEJRPSTRJG-SMZBABNXSA-K [O-]C(CO/C(\C([O-])=O)=C/C([O-])=O)=O.[Na+].[Na+].[Na+] Chemical compound [O-]C(CO/C(\C([O-])=O)=C/C([O-])=O)=O.[Na+].[Na+].[Na+] VMRUEEJRPSTRJG-SMZBABNXSA-K 0.000 description 2
- NUZVIGHHHRSAEQ-BHRFRFAJSA-K [O-]C(C[C@@H](C([O-])=O)N(CCO)CC([O-])=O)=O.[Na+].[Na+].[Na+] Chemical compound [O-]C(C[C@@H](C([O-])=O)N(CCO)CC([O-])=O)=O.[Na+].[Na+].[Na+] NUZVIGHHHRSAEQ-BHRFRFAJSA-K 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 239000002280 amphoteric surfactant Substances 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 238000005341 cation exchange Methods 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000012459 cleaning agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- ROBFUDYVXSDBQM-UHFFFAOYSA-N hydroxymalonic acid Chemical compound OC(=O)C(O)C(O)=O ROBFUDYVXSDBQM-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 2
- 239000006174 pH buffer Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 241000894007 species Species 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate group Chemical group S(=O)(=O)([O-])[O-] QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- 239000000271 synthetic detergent Substances 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- 229940104261 taurate Drugs 0.000 description 2
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- AINPCLWBWFSAQV-BYPYZUCNSA-N (2s)-2-(2-carboxyethylamino)butanedioic acid Chemical compound OC(=O)CCN[C@H](C(O)=O)CC(O)=O AINPCLWBWFSAQV-BYPYZUCNSA-N 0.000 description 1
- LLSHAMSYHZEJBZ-BYPYZUCNSA-N (2s)-2-(2-sulfoethylamino)butanedioic acid Chemical compound OC(=O)C[C@@H](C(O)=O)NCCS(O)(=O)=O LLSHAMSYHZEJBZ-BYPYZUCNSA-N 0.000 description 1
- DCCWEYXHEXDZQW-BYPYZUCNSA-N (2s)-2-[bis(carboxymethyl)amino]butanedioic acid Chemical class OC(=O)C[C@@H](C(O)=O)N(CC(O)=O)CC(O)=O DCCWEYXHEXDZQW-BYPYZUCNSA-N 0.000 description 1
- MUCMKTPAZLSKTL-UHFFFAOYSA-N (3RS)-3-hydroxydodecanoic acid Natural products CCCCCCCCCC(O)CC(O)=O MUCMKTPAZLSKTL-UHFFFAOYSA-N 0.000 description 1
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- SNKQZBUXAMDJAQ-HNQUOIGGSA-N (e)-2-(carboxymethoxy)but-2-enedioic acid Chemical compound OC(=O)CO\C(C(O)=O)=C\C(O)=O SNKQZBUXAMDJAQ-HNQUOIGGSA-N 0.000 description 1
- LUOZTUYAYLNGTG-UHFFFAOYSA-N 1,3,2-dioxathiepane-4,7-dione Chemical compound O=C1CCC(=O)OSO1 LUOZTUYAYLNGTG-UHFFFAOYSA-N 0.000 description 1
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 1
- LVVHPVXWEIZKLA-UHFFFAOYSA-N 2-(carboxymethoxy)-3-methylbutanedioic acid Chemical compound OC(=O)C(C)C(C(O)=O)OCC(O)=O LVVHPVXWEIZKLA-UHFFFAOYSA-N 0.000 description 1
- BTLHODXEDLCLAD-UHFFFAOYSA-N 2-(carboxymethylamino)butanedioic acid Chemical compound OC(=O)CNC(C(O)=O)CC(O)=O BTLHODXEDLCLAD-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- OXOHMAPRQAJJIR-UHFFFAOYSA-N 3-(2,3-dihydroxypropoxy)propane-1,2-diol;sulfuric acid Chemical compound OS(O)(=O)=O.OCC(O)COCC(O)CO OXOHMAPRQAJJIR-UHFFFAOYSA-N 0.000 description 1
- AYKYXWQEBUNJCN-UHFFFAOYSA-N 3-methylfuran-2,5-dione Chemical compound CC1=CC(=O)OC1=O AYKYXWQEBUNJCN-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 206010013911 Dysgeusia Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- BZBXJZPUQVKGMV-UHFFFAOYSA-N OC(CCC(OCOCC(O)=O)=O)=O Chemical compound OC(CCC(OCOCC(O)=O)=O)=O BZBXJZPUQVKGMV-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- GHZJNQOPIUVAMZ-UHFFFAOYSA-K [Na+].[Na+].[Na+].OC(=O)COC(=S)CCC([O-])=O.OC(=O)COC(=S)CCC([O-])=O.OC(=O)COC(=S)CCC([O-])=O Chemical compound [Na+].[Na+].[Na+].OC(=O)COC(=S)CCC([O-])=O.OC(=O)COC(=S)CCC([O-])=O.OC(=O)COC(=S)CCC([O-])=O GHZJNQOPIUVAMZ-UHFFFAOYSA-K 0.000 description 1
- VEUACKUBDLVUAC-UHFFFAOYSA-N [Na].[Ca] Chemical compound [Na].[Ca] VEUACKUBDLVUAC-UHFFFAOYSA-N 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000005791 algae growth Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- YDZIJQXINJLRLL-UHFFFAOYSA-N alpha-hydroxydodecanoic acid Natural products CCCCCCCCCCC(O)C(O)=O YDZIJQXINJLRLL-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940000635 beta-alanine Drugs 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 229920002678 cellulose Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000003657 drainage water Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- WSYUEVRAMDSJKL-UHFFFAOYSA-N ethanolamine-o-sulfate Chemical compound NCCOS(O)(=O)=O WSYUEVRAMDSJKL-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000003673 groundwater Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- NBZBKCUXIYYUSX-UHFFFAOYSA-N iminodiacetic acid Chemical compound OC(=O)CNCC(O)=O NBZBKCUXIYYUSX-UHFFFAOYSA-N 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 238000010412 laundry washing Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-O morpholinium Chemical compound [H+].C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-O 0.000 description 1
- 235000012149 noodles Nutrition 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000004028 organic sulfates Chemical class 0.000 description 1
- 239000001254 oxidized starch Chemical class 0.000 description 1
- 235000013808 oxidized starch Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920000867 polyelectrolyte Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- IWZKICVEHNUQTL-UHFFFAOYSA-M potassium hydrogen phthalate Chemical compound [K+].OC(=O)C1=CC=CC=C1C([O-])=O IWZKICVEHNUQTL-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 235000013966 potassium salts of fatty acid Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000013875 sodium salts of fatty acid Nutrition 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- 229910001866 strontium hydroxide Inorganic materials 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 150000003900 succinic acid esters Chemical class 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/20—Organic compounds containing oxygen
- C11D3/2075—Carboxylic acids-salts thereof
- C11D3/2089—Ether acids-salts thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/235—Saturated compounds containing more than one carboxyl group
- C07C59/305—Saturated compounds containing more than one carboxyl group containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13922571A | 1971-04-30 | 1971-04-30 | |
| US05/274,954 US3954858A (en) | 1971-04-30 | 1972-07-25 | Novel sequestrant builders and method of making the same |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2220295A1 DE2220295A1 (enExample) | 1972-11-16 |
| DE2220295B2 DE2220295B2 (de) | 1980-10-30 |
| DE2220295C3 true DE2220295C3 (de) | 1981-11-12 |
Family
ID=26837002
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2220295A Expired DE2220295C3 (de) | 1971-04-30 | 1972-04-25 | Waschmittel |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3954858A (enExample) |
| AT (1) | AT326247B (enExample) |
| CA (1) | CA973771A (enExample) |
| CH (2) | CH589029A5 (enExample) |
| DE (1) | DE2220295C3 (enExample) |
| FR (1) | FR2134688B1 (enExample) |
| GB (1) | GB1389732A (enExample) |
| NL (1) | NL7205873A (enExample) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4080376A (en) * | 1975-10-10 | 1978-03-21 | Monsanto Company | Amide carboxylates |
| US4058554A (en) * | 1975-12-22 | 1977-11-15 | Lever Brothers Company | Novel ester derivatives of ether polycarboxylic acids and process for making same |
| US4170607A (en) * | 1977-05-16 | 1979-10-09 | Lever Brothers Company | Carboxymethyloxysuccinic anhydrides, halides and derivatives thereof |
| FR2485545A1 (fr) * | 1980-06-25 | 1981-12-31 | Charbonnages Ste Chimique | Cotelomeres a terminaison sulfonate contenant des motifs acide acrylique et vinylamine, procede pour leur preparation et leur application dans des compositions detergentes |
| CA1238917A (en) * | 1984-01-31 | 1988-07-05 | Vivian B. Valenty | Detergent builder |
| US4524009A (en) * | 1984-01-31 | 1985-06-18 | A. E. Staley Manufacturing Company | Detergent builder |
| US4533486A (en) * | 1984-09-24 | 1985-08-06 | Olin Corporation | Sulfated addition products of selected unsaturated dicarboxylic acids and poly(oxyalkylated) alcohols as anionic surfactants |
| US4639325A (en) * | 1984-10-24 | 1987-01-27 | A. E. Staley Manufacturing Company | Detergent builder |
| US4654159A (en) * | 1985-06-24 | 1987-03-31 | The Procter & Gamble Company | Ether hydroxypolycarboxylate detergency builders |
| US4663071A (en) * | 1986-01-30 | 1987-05-05 | The Procter & Gamble Company | Ether carboxylate detergent builders and process for their preparation |
| US4847410A (en) * | 1987-07-30 | 1989-07-11 | Olin Corporation | Block co-polymers useful as aqueous dispersants |
| US4959156A (en) * | 1987-07-30 | 1990-09-25 | Olin Corporation | Block co-polymers useful as aqueous dispersants |
| US4798907A (en) * | 1988-02-26 | 1989-01-17 | The Procter & Gamble Company | Controlled temperature process for making 2,2'-oxodisuccinates useful as laundry detergent builders |
| US5001245A (en) * | 1988-02-12 | 1991-03-19 | Nippon Shokubai Kagaku Kogyo Company, Ltd. | Process for producing metallic salt of ethercarboxylic acid |
| JP2634268B2 (ja) * | 1988-07-05 | 1997-07-23 | オリン コーポレイション | マレイン又はフマール酸とポリ(エトキシ)アルコールとのアニオン界面活性附加生成物 |
| US4983315A (en) * | 1989-08-10 | 1991-01-08 | The Procter & Gamble Company | N,N'-(1-oxo-1,2-ethanediyl)-bis(aspartic acid), salts and use in detergent compositions |
| US5061396A (en) * | 1989-10-16 | 1991-10-29 | National Starch And Chemical Investment Holding Corporation | Detergent compositions containing polyether polycarboxylates |
| US6200499B1 (en) * | 1990-02-06 | 2001-03-13 | Solutia Inc. | Compositions for corrosion inhibition of ferrous metals |
| US5135681A (en) * | 1991-10-24 | 1992-08-04 | W. R. Grace & Co.-Conn. | Substituted carboxymethoxysuccinic acid corrosion inhibitors |
| EP0628624A1 (en) | 1993-06-09 | 1994-12-14 | The Procter & Gamble Company | Protease containing dye transfer inhibiting compositions |
| GB2294268A (en) | 1994-07-07 | 1996-04-24 | Procter & Gamble | Bleaching composition for dishwasher use |
| EP0709452A1 (en) | 1994-10-27 | 1996-05-01 | The Procter & Gamble Company | Cleaning compositions comprising xylanases |
| US5755990A (en) * | 1995-06-02 | 1998-05-26 | U.S. Borax Inc. | Sequestrant compositions |
| US6420329B1 (en) * | 1995-10-26 | 2002-07-16 | S. C. Johnson & Son, Inc. | Cleaning compositions |
| EP0783034B1 (en) * | 1995-12-22 | 2010-08-18 | Mitsubishi Rayon Co., Ltd. | Chelating agent and detergent comprising the same |
| JP3581469B2 (ja) * | 1995-12-25 | 2004-10-27 | 大三工業株式会社 | 洗浄剤組成物 |
| ATE409743T1 (de) | 1996-11-04 | 2008-10-15 | Novozymes As | Subtilase varianten und verbindungen |
| WO1998020115A1 (en) | 1996-11-04 | 1998-05-14 | Novo Nordisk A/S | Subtilase variants and compositions |
| EP1067172B1 (en) * | 1997-03-12 | 2004-03-24 | Showa Denko Kabushiki Kaisha | Detergent composition |
| GB2325243A (en) * | 1997-05-13 | 1998-11-18 | Procter & Gamble | Removing tarnish from tarnished silverware |
| DE69811786T2 (de) * | 1997-07-16 | 2003-10-23 | Nagase Chemtex Corp., Osaka | Verwendung von Chelat bildenden Zusammensetzungen zum Reinigen |
| DE19800437A1 (de) * | 1998-01-08 | 1999-07-15 | Basf Ag | Verfahren zur Herstellung von (S,S)-N,N'-Ethylendiamindibernsteinsäure, analogen Verbindungen oder Salzen davon |
| MXPA00012241A (es) | 1998-06-10 | 2002-06-04 | Novozymes As | Mananasas novedosas. |
| US6740713B1 (en) | 1999-07-08 | 2004-05-25 | Procter & Gamble Company | Process for producing particles of amine reaction products |
| US6764986B1 (en) | 1999-07-08 | 2004-07-20 | Procter & Gamble Company | Process for producing particles of amine reaction products |
| US6972276B1 (en) | 1999-07-09 | 2005-12-06 | Procter & Gamble Company | Process for making amine compounds |
| US6365774B1 (en) * | 2000-01-28 | 2002-04-02 | Applied Carbo Chemicals Inc. | Carboxylated surfactants |
| US6649578B1 (en) * | 2000-01-28 | 2003-11-18 | Applied Carbo Chemicals Inc. | Di-carboxy alkyl phosphate esters in personal care applications |
| GB2369094A (en) | 2000-11-17 | 2002-05-22 | Procter & Gamble | Packaging assembly for sheets of water-soluble sachets |
| GB0103871D0 (en) | 2001-02-16 | 2001-04-04 | Unilever Plc | Bleaching composition of enhanced stability and a process for making such a composition |
| JP4222787B2 (ja) * | 2002-06-11 | 2009-02-12 | 株式会社日本触媒 | アミノポリカルボン酸類の安定化方法及びアミノポリカルボン酸類水溶液組成物 |
| ATE526390T1 (de) * | 2002-08-13 | 2011-10-15 | Rhodia Operations | Hochkonzentrierte tensidzusammensetzungen und verfahren |
| GB2393968A (en) | 2002-10-12 | 2004-04-14 | Reckitt Benckiser Nv | Carpet cleaning composition |
| AU2003302905A1 (en) | 2002-12-11 | 2004-06-30 | Novozymes A/S | Detergent composition comprising endo-glucanase |
| JP2006517989A (ja) | 2003-02-18 | 2006-08-03 | ノボザイムス アクティーゼルスカブ | 洗剤組成物 |
| GB0415516D0 (en) | 2004-07-10 | 2004-08-11 | Reckitt Benckiser Nv | Apparatus and method of using the same |
| GB0902959D0 (en) | 2009-02-23 | 2009-04-08 | Reckitt Benckiser Nv | Composition |
| PL2609181T3 (pl) | 2010-08-26 | 2014-08-29 | Reckitt & Colman Overseas | Produkt detergentowy |
| GB201103974D0 (en) | 2011-03-09 | 2011-04-20 | Reckitt Benckiser Nv | Composition |
| GB201106377D0 (en) | 2011-04-15 | 2011-06-01 | Reckitt & Colman Overseas | Novel composite |
| GB201106391D0 (en) | 2011-04-15 | 2011-06-01 | Reckitt & Colman Overseas | Novel composite |
| PH12014500552A1 (en) | 2011-09-13 | 2014-04-21 | Reckitt Benckiser Vanish Bv | Apparatus and method of using the same |
| US8865638B2 (en) | 2013-03-15 | 2014-10-21 | Church & Dwight Co., Inc. | Unit dose laundry compositions |
| US9273270B2 (en) | 2014-02-20 | 2016-03-01 | Church & Dwight Co., Inc. | Unit dose cleaning products for delivering a peroxide-containing bleaching agent |
| CA3180702A1 (en) * | 2020-04-24 | 2021-10-28 | Chevron U.S.A. Inc. | Polyanionic surfactants and methods of making and using thereof |
| CN113735724B (zh) * | 2021-09-08 | 2022-09-13 | 合肥艾普拉斯环保科技有限公司 | 天冬氨酸二乙酸钠及其制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2098190A (en) * | 1935-04-25 | 1937-11-02 | Monsanto Chemicals | Substituted succinic acids and esters thereof and uses therefor |
| US2281394A (en) * | 1940-05-17 | 1942-04-28 | Du Pont | Oxy-esters of alpha-beta acids and unsaturated alcohols |
| US2346612A (en) * | 1940-10-14 | 1944-04-11 | Du Pont | Allyl ether of diallyl malate |
| US2797231A (en) | 1955-03-25 | 1957-06-25 | Cyril D Evans | Stabilization of oils with beta-(carboxymethylmercapto) tricarballylic acid |
| DK138997C (da) * | 1969-11-24 | 1979-05-07 | Unilever Nv | Vaskemiddel,herunder opvaskemiddel |
-
1972
- 1972-04-25 CA CA140,482A patent/CA973771A/en not_active Expired
- 1972-04-25 DE DE2220295A patent/DE2220295C3/de not_active Expired
- 1972-04-27 CH CH1296675A patent/CH589029A5/xx not_active IP Right Cessation
- 1972-04-27 CH CH630972A patent/CH571056A5/xx not_active IP Right Cessation
- 1972-04-28 FR FR7215371A patent/FR2134688B1/fr not_active Expired
- 1972-04-28 GB GB1983072A patent/GB1389732A/en not_active Expired
- 1972-04-28 NL NL7205873A patent/NL7205873A/xx not_active Application Discontinuation
- 1972-04-28 AT AT374272A patent/AT326247B/de not_active IP Right Cessation
- 1972-07-25 US US05/274,954 patent/US3954858A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH589029A5 (enExample) | 1977-06-30 |
| DE2220295B2 (de) | 1980-10-30 |
| NL7205873A (enExample) | 1972-11-01 |
| CA973771A (en) | 1975-09-02 |
| AT326247B (de) | 1975-11-25 |
| CH571056A5 (enExample) | 1975-12-31 |
| FR2134688B1 (enExample) | 1976-08-06 |
| GB1389732A (en) | 1975-04-09 |
| AU4161372A (en) | 1973-11-01 |
| DE2220295A1 (enExample) | 1972-11-16 |
| FR2134688A1 (enExample) | 1972-12-08 |
| US3954858A (en) | 1976-05-04 |
| ATA374272A (de) | 1975-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2220295C3 (de) | Waschmittel | |
| DE2057258C2 (de) | Neue Gerüststoffe, Verfahren zu ihrer Herstellung und Wasch- und Reinigungsmittel, die diese Gerüststoffe enthalten | |
| DE2533758C2 (de) | Waschmittel | |
| AT394205B (de) | Stabilisiertes, enzymhaltiges, fluessiges reinigungsmittel | |
| DE2230073A1 (de) | alpha-substituierte beta-Sulfobernsteinsäuren und ihre Verwendung als Builder in Waschmitteln | |
| DE2248708C3 (de) | Detergensmittel | |
| DE2342461B2 (de) | Reinigungsmittelzusammensetzungen | |
| DE2359234A1 (de) | Ampholytische verbindung | |
| DE2161768A1 (de) | Gerüststoffmischungen | |
| DE2657518A1 (de) | Neue verbindungen und dieselben enthaltende detergensgemische | |
| DE2637890C2 (de) | Reinigungsmittel-Zusammensetzung | |
| DE2337266A1 (de) | Weichspuelende grobwaschmittel | |
| DE69511112T2 (de) | Diaminoalkyldi(sulfosuccinate) und diese enthaltende waschmittelzusammensetzungen | |
| DE2701663B2 (enExample) | ||
| DE2544035A1 (de) | Verfahren zum waschen von textilien, sowie mittel zur durchfuehrung des verfahrens | |
| DE2523588A1 (de) | Polyglykolaethermischformale und deren verwendung als aetzalkalibestaendige netz-, wasch- und reinigungsmittel | |
| DE2057259C3 (de) | Wasch- und Reinigungsmittel | |
| DE2057354A1 (de) | Gerueststoffhaltige Wasch- und Reinigungsmittelmischung | |
| DE2242093C2 (de) | Phosphatfreie alkyläthersulfathaltige Waschmittel | |
| US4011264A (en) | Carboxymethyloxysuccinates | |
| DE2265613C2 (de) | Polycarbonsäuren und deren Salze | |
| DE2218763A1 (de) | Trockenpulver-Waschzubereitung | |
| DE2411479A1 (de) | Reinigungsmittelmischung | |
| DE2331057A1 (de) | Zwitterionische, oberflaechenaktive mittel | |
| DE2449901A1 (de) | Mittel zum weichmachen von textilien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| AH | Division in |
Ref country code: DE Ref document number: 2265613 Format of ref document f/p: P |
|
| 8339 | Ceased/non-payment of the annual fee |