DE2216343B2 - SicherheitsschraubverschluB - Google Patents
SicherheitsschraubverschluBInfo
- Publication number
- DE2216343B2 DE2216343B2 DE2216343A DE2216343A DE2216343B2 DE 2216343 B2 DE2216343 B2 DE 2216343B2 DE 2216343 A DE2216343 A DE 2216343A DE 2216343 A DE2216343 A DE 2216343A DE 2216343 B2 DE2216343 B2 DE 2216343B2
- Authority
- DE
- Germany
- Prior art keywords
- cap
- inner cap
- guarantee ring
- closure
- safety screw
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000011324 bead Substances 0.000 claims description 14
- 230000000994 depressogenic effect Effects 0.000 claims description 9
- 230000008878 coupling Effects 0.000 claims description 6
- 238000010168 coupling process Methods 0.000 claims description 6
- 238000005859 coupling reaction Methods 0.000 claims description 6
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 3
- 239000011354 acetal resin Substances 0.000 claims description 3
- 229920006324 polyoxymethylene Polymers 0.000 claims description 3
- 229920001169 thermoplastic Polymers 0.000 claims description 3
- 239000004416 thermosoftening plastic Substances 0.000 claims description 3
- POIUWJQBRNEFGX-XAMSXPGMSA-N cathelicidin Chemical compound C([C@@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C1=CC=CC=C1 POIUWJQBRNEFGX-XAMSXPGMSA-N 0.000 description 7
- 210000002105 tongue Anatomy 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 235000003642 hunger Nutrition 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65D—CONTAINERS FOR STORAGE OR TRANSPORT OF ARTICLES OR MATERIALS, e.g. BAGS, BARRELS, BOTTLES, BOXES, CANS, CARTONS, CRATES, DRUMS, JARS, TANKS, HOPPERS, FORWARDING CONTAINERS; ACCESSORIES, CLOSURES, OR FITTINGS THEREFOR; PACKAGING ELEMENTS; PACKAGES
- B65D50/00—Closures with means for discouraging unauthorised opening or removal thereof, with or without indicating means, e.g. child-proof closures
- B65D50/02—Closures with means for discouraging unauthorised opening or removal thereof, with or without indicating means, e.g. child-proof closures openable or removable by the combination of plural actions
- B65D50/04—Closures with means for discouraging unauthorised opening or removal thereof, with or without indicating means, e.g. child-proof closures openable or removable by the combination of plural actions requiring the combination of simultaneous actions, e.g. depressing and turning, lifting and turning, maintaining a part and turning another one
- B65D50/041—Closures with means for discouraging unauthorised opening or removal thereof, with or without indicating means, e.g. child-proof closures openable or removable by the combination of plural actions requiring the combination of simultaneous actions, e.g. depressing and turning, lifting and turning, maintaining a part and turning another one the closure comprising nested inner and outer caps or an inner cap and an outer coaxial annular member, which can be brought into engagement to enable removal by rotation
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Closures For Containers (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2216343A DE2216343B2 (de) | 1972-04-05 | 1972-04-05 | SicherheitsschraubverschluB |
| IT20876/73A IT979497B (it) | 1972-04-05 | 1973-02-26 | Tappo di chiusura a vite di sicurezza |
| AR247156A AR198501A1 (es) | 1972-04-05 | 1973-03-20 | Cierre de seguridad a rosca |
| DD169645A DD102665A5 (enExample) | 1972-04-05 | 1973-03-22 | |
| US05/346,582 US3944102A (en) | 1972-04-05 | 1973-03-30 | Safety screw closure |
| SE7304611A SE382608B (sv) | 1972-04-05 | 1973-04-02 | Gengad sekerhetsforslutning for flaskor |
| CH475873A CH557267A (de) | 1972-04-05 | 1973-04-03 | Schraubverschluss an einer flasche. |
| FR7311909A FR2179029B1 (enExample) | 1972-04-05 | 1973-04-03 | |
| BR732421A BR7302421D0 (pt) | 1972-04-05 | 1973-04-04 | Fecho rosqueado de seguranca fecho rosqueado de seguranca |
| JP1973040552U JPS5327648Y2 (enExample) | 1972-04-05 | 1973-04-05 | |
| GB1642773A GB1426792A (en) | 1972-04-05 | 1973-04-05 | Safety closure for a container |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2216343A DE2216343B2 (de) | 1972-04-05 | 1972-04-05 | SicherheitsschraubverschluB |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2216343A1 DE2216343A1 (de) | 1973-10-18 |
| DE2216343B2 true DE2216343B2 (de) | 1975-05-15 |
| DE2216343C3 DE2216343C3 (enExample) | 1975-12-18 |
Family
ID=5841055
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2216343A Granted DE2216343B2 (de) | 1972-04-05 | 1972-04-05 | SicherheitsschraubverschluB |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3944102A (enExample) |
| JP (1) | JPS5327648Y2 (enExample) |
| AR (1) | AR198501A1 (enExample) |
| BR (1) | BR7302421D0 (enExample) |
| CH (1) | CH557267A (enExample) |
| DD (1) | DD102665A5 (enExample) |
| DE (1) | DE2216343B2 (enExample) |
| FR (1) | FR2179029B1 (enExample) |
| GB (1) | GB1426792A (enExample) |
| IT (1) | IT979497B (enExample) |
| SE (1) | SE382608B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3336908A1 (de) * | 1983-10-11 | 1985-04-18 | Zeller Plastik Koehn, Gräbner & Co, 5583 Zell | Originalitaetsverschluss aus kunststoff |
Families Citing this family (79)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2314873A1 (fr) * | 1975-06-20 | 1977-01-14 | Captocap Ltd | Dispositif de bouchage inviolable, avec mecanisme de securite |
| SE407926B (sv) * | 1975-11-19 | 1979-04-30 | Ziristor Ab | Behallarforslutning |
| US4020965A (en) * | 1976-05-03 | 1977-05-03 | Northup John D | Child resistant closure |
| US4291813A (en) * | 1978-02-17 | 1981-09-29 | Buckeye Molding Company | Containers and closures |
| US4165813A (en) * | 1978-05-01 | 1979-08-28 | Societe Nouvelle De Bouchons Plastique | Security closure device for bottles |
| GB2066792B (en) * | 1979-11-19 | 1983-10-26 | Deussen Stella Kg | Container closure with childproof lock and original package seal |
| US4461390A (en) * | 1980-04-21 | 1984-07-24 | General Kap (P.R.) Corporation | Tamper-evident plastic closure |
| DE3125397A1 (de) * | 1981-06-27 | 1983-01-13 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Roentgenuntersuchungsgeraet mit wenigstens einem filmvorratsmagazin |
| US4529096A (en) * | 1982-06-07 | 1985-07-16 | Consumers Glass Company Limited | Pilferproof cap |
| US4433789A (en) | 1982-12-20 | 1984-02-28 | Merck & Co., Inc. | Convertible child resistant closure |
| US4474301A (en) * | 1983-03-14 | 1984-10-02 | Johnsen & Jorgensen (Plastics) Ltd. | Tamper-resistant and childproof closure |
| GB2142612B (en) * | 1983-07-01 | 1987-06-10 | Puresevic Peter J | A child proof and tamper indicating closure |
| US4454955A (en) * | 1983-07-11 | 1984-06-19 | Owens-Illinois, Inc. | Child resistant package |
| US4553678A (en) * | 1984-06-21 | 1985-11-19 | Thorsbakken Arden L | Tamper indicating container safety cover |
| US4567993A (en) * | 1984-07-06 | 1986-02-04 | Aluminum Company Of America | Tamper-evident closure |
| US4782965A (en) * | 1985-05-18 | 1988-11-08 | Victor Wassilieff | Childproof closure system |
| JPH0621955B2 (ja) * | 1986-04-18 | 1994-03-23 | 富士写真フイルム株式会社 | フイルム供給装置 |
| US4669620A (en) * | 1986-05-16 | 1987-06-02 | Daniel Coifman | Tamper-evident, child-resistant closure and method |
| US4664278A (en) * | 1986-06-25 | 1987-05-12 | Owens-Illinois, Inc. | Tamper indicating package |
| US5112628A (en) * | 1988-12-27 | 1992-05-12 | General Electric Company | Nipple fitment with safety overcap |
| DE4002967A1 (de) * | 1989-11-02 | 1991-05-08 | Huebner Gmbh & Co Max | Schraubverschluss fuer originalitaetssicherung fuer insbesondere weithalsbehaelter |
| US4997096A (en) * | 1990-04-27 | 1991-03-05 | Owens-Illinois Closure, Inc. | Child resistant closures |
| GB2262280B (en) * | 1991-12-11 | 1995-09-20 | Beeson & Sons Ltd | A container neck and a closure therefor |
| US5411157A (en) * | 1990-05-30 | 1995-05-02 | Beeson And Sons Limited | Container and the manufacture thereof |
| JPH06509307A (ja) * | 1991-07-10 | 1994-10-20 | ビーソン・アンド・サンズ・リミテッド | 容器、容器の首、その蓋およびこれらの製造方法 |
| ES2084290T3 (es) * | 1991-07-30 | 1996-05-01 | Wellcome Found | Tapa para un recipiente. |
| US5588545A (en) * | 1991-09-23 | 1996-12-31 | Beeson And Sons Limited | Child-resistant and elderly friendly closure for containers |
| US5743419A (en) * | 1991-09-23 | 1998-04-28 | Beeson And Sons Limited | Container closure with a reinforced resilient blade |
| CA2148370C (en) * | 1992-11-13 | 2005-05-10 | Witney Milner King | Improvements relating to a tamper evident ring for a container closure |
| GB9320389D0 (en) * | 1993-10-04 | 1993-11-24 | Beeson & Sons Ltd | Improvements relating to container closures |
| GB2298194A (en) * | 1995-02-24 | 1996-08-28 | Beeson & Sons Ltd | Child resistant closures for containers |
| GB2299985A (en) * | 1995-04-18 | 1996-10-23 | Beeson & Sons Ltd | Child resistant closure assemblies |
| US5609262A (en) * | 1995-09-22 | 1997-03-11 | Rieke Corporation | Tamper evident, child-resistant closure |
| US6082564A (en) * | 1997-07-29 | 2000-07-04 | Trout; Brett J. | Key actuated locking cap |
| DE29807243U1 (de) * | 1998-04-22 | 1999-08-26 | Friedrich Sanner GmbH & Co KG Spritzgußwerk, 64625 Bensheim | Kindersicherer und originalitätsgesicherter Behälter-Verschluß |
| ATE310680T1 (de) * | 1998-06-24 | 2005-12-15 | Alpha Entpr Inc | Öffnungssicherung für flaschen |
| FR2793216B1 (fr) * | 1999-04-20 | 2001-06-08 | Pechiney Emballage Alimentaire | Capsule de bouchage composite |
| WO2003006334A2 (en) * | 2001-07-09 | 2003-01-23 | Crown Cork & Seal Technologies Corporation | Container and closure cap |
| AU2002309246A1 (en) * | 2002-05-02 | 2003-11-17 | Bormioli Rocco And Figlio S.P.A. | Child-proof capsule with security strip |
| CA2495191C (en) | 2002-07-12 | 2012-06-05 | Bericap | Closure comprising a hinged cap moulded in closed position |
| US20050173367A1 (en) * | 2002-07-12 | 2005-08-11 | Philippe Nusbaum | Closure device comprising a hinged cap moulded in the closed position |
| US20050116382A1 (en) * | 2002-07-12 | 2005-06-02 | Philippe Nusbaum | Closure device comprising a hinged cap moulded in the closed position |
| US6912878B2 (en) * | 2003-02-24 | 2005-07-05 | Alpha Security Products, Inc. | Bottle security device |
| EP1471293B1 (en) * | 2003-04-24 | 2005-07-27 | Olab S.r.l. | Safety cap for pressure vessels, particularly boilers for electrical household appliances and the like |
| JP3968050B2 (ja) * | 2003-05-09 | 2007-08-29 | 株式会社資生堂 | 安全容器 |
| US7004340B2 (en) * | 2003-07-25 | 2006-02-28 | Alpha Security Products, Inc. | Bottle security device |
| US7128233B2 (en) * | 2003-09-23 | 2006-10-31 | Jamie Hogan | Tamper-resistant container and methods |
| US7527159B2 (en) | 2004-03-11 | 2009-05-05 | Rexam Closure Systems Inc. | Threaded child-resistant package having linerless closure |
| US7819264B2 (en) * | 2003-12-03 | 2010-10-26 | Rexam Closure Systems Inc. | Child-resistant closure, container and package |
| US20060124501A1 (en) * | 2004-11-30 | 2006-06-15 | Mcneely Kevin | Dosage reminder cap |
| US20070175897A1 (en) | 2006-01-24 | 2007-08-02 | Labcyte Inc. | Multimember closures whose members change relative position |
| US7815061B1 (en) * | 2006-03-31 | 2010-10-19 | Rexam Closures And Containers | Friction surface for push and turn child resistant closure |
| US8109396B1 (en) | 2006-03-31 | 2012-02-07 | Rexam Healthcare Packaging Inc. | Slide rails and friction surfaces for closure |
| DE102006040888B3 (de) * | 2006-08-31 | 2007-11-08 | Lts Lohmann Therapie-Systeme Ag | Verschlusssystem für Behältnisse |
| FR2916741B1 (fr) * | 2007-05-29 | 2009-08-28 | Airsec Soc Par Actions Simplif | Dispositif de fermeture a securite enfant,a vis et a bague temoin de premiere ouverture |
| GB2454511B (en) * | 2007-11-09 | 2012-03-07 | Beeson & Sons Ltd | Container closure with overcap |
| US7866497B2 (en) | 2007-12-12 | 2011-01-11 | Checkpoint Systems, Inc. | Bottle security device |
| US9957076B2 (en) * | 2008-01-15 | 2018-05-01 | Rexam Beverage Can Company | Outsert for a metal container |
| US20100126996A1 (en) * | 2008-11-25 | 2010-05-27 | Stull Technologies, Inc. | Lightweight Child-Resistant Closure |
| IT1394229B1 (it) * | 2009-04-16 | 2012-06-01 | Tapi S R L | Tappo a vite per contenitori per liquidi |
| US8316622B2 (en) * | 2009-06-10 | 2012-11-27 | Shriji Polymers India Limited | Child-resistant cap |
| US8474634B1 (en) * | 2010-04-30 | 2013-07-02 | Rexam Healthcare Packaging Inc. | Child resistant closure with vents |
| US8286811B1 (en) * | 2010-08-05 | 2012-10-16 | Gregory Mark Adamczak | Child proof closure cap for containers having curved skirt |
| US9045265B2 (en) | 2010-08-05 | 2015-06-02 | Gregory Mark Adamczak | Child proof closure cap for container with combined tilting and rotating operation |
| US8968564B2 (en) * | 2011-11-30 | 2015-03-03 | Hb Spider, Llc | Filter turning mechanism |
| WO2014041325A2 (en) * | 2012-09-13 | 2014-03-20 | Max-Gear Innovations Limited | Security device for a bottle |
| USD747201S1 (en) | 2013-09-18 | 2016-01-12 | Bericap | Closure |
| CN104309919B (zh) * | 2013-09-30 | 2017-02-22 | 青海春天药用资源科技利用有限公司 | 防盗瓶盖和防盗瓶 |
| EP3071492A4 (en) * | 2013-11-18 | 2017-05-24 | Rieke Corporation | Closure for a container |
| FR3015442B1 (fr) | 2013-12-24 | 2016-02-05 | Bericap | Dispositif de bouchage articule avec indicateur de premiere ouverture |
| USD833278S1 (en) | 2014-09-03 | 2018-11-13 | Bericap | Closure for a container |
| CA2984291C (en) * | 2015-06-16 | 2022-04-26 | Amcor Limited | Child resistant dropper closure |
| ES2774070T3 (es) * | 2015-10-13 | 2020-07-16 | Vinventions Usa Llc | Cierre para un recipiente de retención de productos y método para su fabricación |
| IT201700046734A1 (it) * | 2017-04-28 | 2018-10-28 | Bormioli Pharma S R L | Capsula di sicurezza con bandella |
| EP3434616B1 (en) * | 2017-07-25 | 2020-04-01 | Incap International Ltd. | Closure cap for a container |
| RU2710774C1 (ru) * | 2018-10-12 | 2020-01-13 | Виталий Дмитриевич Горчаков | Устройство блокировки открывания, по меньшей мере, одной створки |
| US12227337B2 (en) * | 2019-03-11 | 2025-02-18 | Alpla Werke Alwin Lehner Gmbh & Co. Kg | Container closure |
| GB2582792B (en) * | 2019-04-03 | 2021-04-07 | Greif Int Holding Bv | Screw cap with core seal |
| WO2023147127A1 (en) * | 2022-01-28 | 2023-08-03 | Berry Global, Inc. | Selectively openable closure for a container |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2140732A (en) * | 1934-11-10 | 1938-12-20 | James P Burke | Nonrefillable closure |
| US2961119A (en) * | 1957-11-25 | 1960-11-22 | Charles F Leach | Closure devices |
| US2964207A (en) * | 1958-04-15 | 1960-12-13 | Bryant W Griffin | Closure for poison bottles |
| US3260393A (en) * | 1965-05-10 | 1966-07-12 | Roberts Simon | Safety cap for containers |
| US3374912A (en) * | 1966-07-18 | 1968-03-26 | Evert D. Velt | Safety bottle top |
| US3394829A (en) * | 1967-04-10 | 1968-07-30 | Harris M. Peterson | Safety cap |
| US3455478A (en) * | 1967-07-21 | 1969-07-15 | Roehr Metals & Plastics Co | Tamper-indicating closure |
| CH505005A (de) * | 1968-03-30 | 1971-03-31 | Ciba Geigy Ag | Verfahren zur Herstellung eines Garantieverschlusses und nach diesem Verfahren hergestellter Garantieverschluss |
| US3650426A (en) * | 1970-03-30 | 1972-03-21 | V C A Corp | Safety cap |
| US3679085A (en) * | 1971-04-16 | 1972-07-25 | Sunbeam Plastics Corp | Child-proof cap for medicine bottles |
| US3795338A (en) * | 1972-07-19 | 1974-03-05 | Owens Illinois Inc | Ratchet drive child-resistant closure |
-
1972
- 1972-04-05 DE DE2216343A patent/DE2216343B2/de active Granted
-
1973
- 1973-02-26 IT IT20876/73A patent/IT979497B/it active
- 1973-03-20 AR AR247156A patent/AR198501A1/es active
- 1973-03-22 DD DD169645A patent/DD102665A5/xx unknown
- 1973-03-30 US US05/346,582 patent/US3944102A/en not_active Expired - Lifetime
- 1973-04-02 SE SE7304611A patent/SE382608B/xx unknown
- 1973-04-03 CH CH475873A patent/CH557267A/xx not_active IP Right Cessation
- 1973-04-03 FR FR7311909A patent/FR2179029B1/fr not_active Expired
- 1973-04-04 BR BR732421A patent/BR7302421D0/pt unknown
- 1973-04-05 JP JP1973040552U patent/JPS5327648Y2/ja not_active Expired
- 1973-04-05 GB GB1642773A patent/GB1426792A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3336908A1 (de) * | 1983-10-11 | 1985-04-18 | Zeller Plastik Koehn, Gräbner & Co, 5583 Zell | Originalitaetsverschluss aus kunststoff |
Also Published As
| Publication number | Publication date |
|---|---|
| US3944102A (en) | 1976-03-16 |
| DE2216343A1 (de) | 1973-10-18 |
| GB1426792A (en) | 1976-03-03 |
| IT979497B (it) | 1974-09-30 |
| JPS5327648Y2 (enExample) | 1978-07-13 |
| FR2179029B1 (enExample) | 1977-04-29 |
| CH557267A (de) | 1974-12-31 |
| DE2216343C3 (enExample) | 1975-12-18 |
| BR7302421D0 (pt) | 1974-06-27 |
| FR2179029A1 (enExample) | 1973-11-16 |
| SE382608B (sv) | 1976-02-09 |
| AR198501A1 (es) | 1974-06-28 |
| DD102665A5 (enExample) | 1973-12-20 |
| JPS4917641U (enExample) | 1974-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2216343C3 (enExample) | ||
| DE2357789C3 (de) | Verschlußkappe für das Verschließen von einen Füllstutzen mit Innengewinde aufweisenden Behältern | |
| EP0069168B1 (de) | Bausatz für einen Kappenverschluss | |
| EP0593396A1 (de) | Garantieverschluss aus Kunststoff | |
| DE2459030B2 (de) | Sicherheitsverschluss fuer behaelter | |
| DE2543453A1 (de) | Flaschen-sicherheitsverschluss | |
| DE3336908A1 (de) | Originalitaetsverschluss aus kunststoff | |
| DE2338069A1 (de) | Flaschenverschluss mit garantiesicherung | |
| DE2106152A1 (de) | Garantieverschluß | |
| DE69915291T2 (de) | Abgabevorrichtung für fliessfähige Produkte | |
| EP0251259A1 (de) | Verfahren zum Verschliessen von mit Behälterhals-Aussengewinde versehenen Behältern | |
| DE1154369B (de) | Als Originalverschluss ausgebildete Schraubkappe | |
| DE112019002692T5 (de) | Fälschungssicherer Flaschenverschluss | |
| DE3010769C2 (de) | Verschluß für einen Behälter | |
| EP0123810A1 (de) | Verschluss, insbesondere kindergesicherter Verschluss | |
| DE4109654A1 (de) | Ausgusskappe | |
| EP3002228B1 (de) | Flasche mit flaschenverschluss | |
| DE2115741B1 (de) | Sicherheitsverschluß | |
| DE9300042U1 (de) | Gewindeteil aus Kunststoff zum Aufsetzen auf einen Tubenhals | |
| CH634790A5 (de) | Verschlussvorrichtung fuer eine auslassoeffnung, z.b. fuer tuben oder flaschen. | |
| EP2989018B1 (de) | Flaschenverschluss zum verschliessen einer flasche | |
| DE2458600A1 (de) | Schraubverschluss fuer behaelter, flaschen oder dergleichen | |
| DE2854966A1 (de) | Halter fuer geraetesicherungen | |
| DE1122393B (de) | Schraubverschluss mit Sicherung gegen unbefugtes OEffnen | |
| DE2115741C (de) | Sicherheitsverschluß |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |