DE2211251A1 - Halogensulfony 1-sulfoxonium-Verbindungen - Google Patents
Halogensulfony 1-sulfoxonium-VerbindungenInfo
- Publication number
- DE2211251A1 DE2211251A1 DE19722211251 DE2211251A DE2211251A1 DE 2211251 A1 DE2211251 A1 DE 2211251A1 DE 19722211251 DE19722211251 DE 19722211251 DE 2211251 A DE2211251 A DE 2211251A DE 2211251 A1 DE2211251 A1 DE 2211251A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- chlorine
- compound according
- sulfur trioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000460 chlorine Substances 0.000 claims description 50
- 150000001875 compounds Chemical class 0.000 claims description 36
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 5
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- -1 fluorobromomethyl Chemical group 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- HRWBWLXKQWNCQY-UHFFFAOYSA-N 1,2,3,4-tetrachloro-5-(trichloromethyl)benzene Chemical compound ClC1=CC(C(Cl)(Cl)Cl)=C(Cl)C(Cl)=C1Cl HRWBWLXKQWNCQY-UHFFFAOYSA-N 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 3
- 150000003934 aromatic aldehydes Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical class O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- XFFTWZZGUGZURK-UHFFFAOYSA-N 2,3,4,5,6-pentachlorobenzaldehyde Chemical compound ClC1=C(Cl)C(Cl)=C(C=O)C(Cl)=C1Cl XFFTWZZGUGZURK-UHFFFAOYSA-N 0.000 description 2
- HJTJOWBGKFNDFZ-UHFFFAOYSA-N 2,3,5,6-tetrachloroterephthalaldehyde Chemical compound ClC1=C(Cl)C(C=O)=C(Cl)C(Cl)=C1C=O HJTJOWBGKFNDFZ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- 238000004445 quantitative analysis Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000010183 spectrum analysis Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ZXUJWPHOPHHZLR-UHFFFAOYSA-N 1,1,1-trichloro-2-fluoroethane Chemical compound FCC(Cl)(Cl)Cl ZXUJWPHOPHHZLR-UHFFFAOYSA-N 0.000 description 1
- AWLHOCSHUCRWFB-UHFFFAOYSA-N 1,2,3,4,5-pentachloro-6-(dichloromethyl)benzene Chemical class ClC(Cl)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl AWLHOCSHUCRWFB-UHFFFAOYSA-N 0.000 description 1
- SXPRVMIZFRCAGC-UHFFFAOYSA-N 1,2,3,4,5-pentafluoro-6-methylbenzene Chemical compound CC1=C(F)C(F)=C(F)C(F)=C1F SXPRVMIZFRCAGC-UHFFFAOYSA-N 0.000 description 1
- GCFQDFMIAJMFGU-UHFFFAOYSA-N 2,4,5,6-tetrachlorobenzene-1,3-dicarbaldehyde Chemical compound ClC1=C(Cl)C(C=O)=C(Cl)C(C=O)=C1Cl GCFQDFMIAJMFGU-UHFFFAOYSA-N 0.000 description 1
- MRVNKBNZHOHVER-UHFFFAOYSA-N 2h-anthracen-1-one Chemical compound C1=CC=C2C=C3C(=O)CC=CC3=CC2=C1 MRVNKBNZHOHVER-UHFFFAOYSA-N 0.000 description 1
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000004773 chlorofluoromethyl group Chemical group [H]C(F)(Cl)* 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- UHOVQNZJYSORNB-MICDWDOJSA-N deuteriobenzene Chemical compound [2H]C1=CC=CC=C1 UHOVQNZJYSORNB-MICDWDOJSA-N 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000006371 dihalo methyl group Chemical group 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 229940042472 mineral oil Drugs 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 210000003739 neck Anatomy 0.000 description 1
- 150000002898 organic sulfur compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 150000002987 phenanthrenes Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C381/00—Compounds containing carbon and sulfur and having functional groups not covered by groups C07C301/00 - C07C337/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US123015A US3869491A (en) | 1971-03-10 | 1971-03-10 | Halosulfonyl sulfooxonium compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2211251A1 true DE2211251A1 (de) | 1972-09-14 |
Family
ID=22406235
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722211251 Pending DE2211251A1 (de) | 1971-03-10 | 1972-03-08 | Halogensulfony 1-sulfoxonium-Verbindungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3869491A (enExample) |
| BE (1) | BE780305A (enExample) |
| CA (1) | CA996130A (enExample) |
| DE (1) | DE2211251A1 (enExample) |
| FR (1) | FR2129527A5 (enExample) |
| GB (1) | GB1366557A (enExample) |
| NL (1) | NL7202946A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4141912A (en) * | 1973-10-29 | 1979-02-27 | Hooker Chemicals & Plastics Corp. | Process for the preparation of polyhalobenzylic disulfooxonium compounds |
| US4075238A (en) * | 1973-10-29 | 1978-02-21 | Hooker Chemicals & Plastics Corporation | Polyhalobenzylic disulfooxonium compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1931203A (en) * | 1932-03-02 | 1933-10-17 | Robert T Mcllor | Insulating support for electrical conductors |
| US2621168A (en) * | 1949-09-27 | 1952-12-09 | Sprague Electric Co | Condensation resins of halogenated benzene compounds |
| US3146086A (en) * | 1960-07-01 | 1964-08-25 | Diamond Alkali Co | Herbicidal and pesticidal halogenated terephthalaldehyde compositions |
| BE639328A (enExample) * | 1962-11-02 |
-
1971
- 1971-03-10 US US123015A patent/US3869491A/en not_active Expired - Lifetime
-
1972
- 1972-02-21 CA CA135,238A patent/CA996130A/en not_active Expired
- 1972-03-06 NL NL7202946A patent/NL7202946A/xx unknown
- 1972-03-07 BE BE780305A patent/BE780305A/xx unknown
- 1972-03-08 FR FR7208093A patent/FR2129527A5/fr not_active Expired
- 1972-03-08 DE DE19722211251 patent/DE2211251A1/de active Pending
- 1972-03-09 GB GB1107372A patent/GB1366557A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1366557A (en) | 1974-09-11 |
| BE780305A (fr) | 1972-07-03 |
| CA996130A (en) | 1976-08-31 |
| US3869491A (en) | 1975-03-04 |
| FR2129527A5 (enExample) | 1972-10-27 |
| NL7202946A (enExample) | 1972-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2756169C2 (de) | Verfahren zur Herstellung von Perfluorcarbonsäuren oder Perfluoralkansulfonylchloriden | |
| DE2211251A1 (de) | Halogensulfony 1-sulfoxonium-Verbindungen | |
| EP0136566B1 (de) | Verfahren zur Herstellung von 3,4-Dichlorbenzotrihalogeniden | |
| DE1123663B (de) | Verfahren zur Herstellung von hochchlorierten Arylsulfiden | |
| EP0011208B1 (de) | Verfahren zur Herstellung von 3-Phenoxy-benzaldehyden | |
| DE2513801A1 (de) | Neue fluorierte indazolderivate und verfahren zu ihrer herstellung | |
| EP1110939B1 (de) | Verfahren zur Herstellung von Poly(fluoralkyl)-acetophenonen | |
| DE2138829A1 (de) | Bei Polykondensationen verwendbare bifunküonelle heterocyclische Verbmdun gen und Verfahren zu deren Herstellung | |
| DE895151C (de) | Verfahren zur Herstellung von Chlormethylsulfiden | |
| DE2651371A1 (de) | Quaternaere ammoniumsalze | |
| DE837536C (de) | Verfahren zur Herstellung von Chlornitrophenthiazin-9-oxyden | |
| DE2211735A1 (de) | Polyhalogenbenzyldisulfoxoniumverbindungen und Verfahren zu ihrer Herstellung | |
| DE1085522B (de) | Verfahren zur Herstellung von 6-(2', 6', 6'-Trimethylcyclohexen-(1')-yl)-4-methylhexadien-(3, 5)-in-(1) | |
| DE804572C (de) | Verfahren zur Herstellung von Sulfensaeurehalogeniden | |
| EP0013395B1 (de) | Verfahren zur Herstellung von 3-Nitro-naphthalin-1,5-disulfonsäure | |
| DE900933C (de) | Verfahren zur Herstellung von o-Oxyarylcarbonsaeure-ª -naphthylamiden | |
| DE888701C (de) | Verfahren zur Herstellung von Pentachlorphenol | |
| AT205804B (de) | Schädlingsbekämpfungsmittel auf Basis von Polyhalogen-diphenyl-sulfonen, -sulfoxyden oder -sulfiden | |
| EP0014835B1 (de) | Bis-(brom- und chlor-substituiertes propenyl)-äther, Verfahren zu seiner Herstellung und seine Verwendung bei der Herstellung von Trichloracrolein | |
| DE883904C (de) | Verfahren zur Herstellung von quaternaeren Ammoniumverbindungen | |
| AT339613B (de) | Verfahren zur polykondensation von anthracen | |
| DE922650C (de) | Verfahren zur Herstellung von Bibenzothiazolabkoemmlingen bzw. deren Salzen | |
| DE2837690A1 (de) | Fluorierungsverfahren in fluessiger phase | |
| DE19962011A1 (de) | Verfahren zur Herstellung von Poly-(fluoralkyl)-acetophenonen | |
| AT231469B (de) | Verfahren zur Herstellung neuer Organophosphorverbindungen |