DE2152968A1 - Neue penicilline - Google Patents
Neue penicillineInfo
- Publication number
- DE2152968A1 DE2152968A1 DE2152968A DE2152968A DE2152968A1 DE 2152968 A1 DE2152968 A1 DE 2152968A1 DE 2152968 A DE2152968 A DE 2152968A DE 2152968 A DE2152968 A DE 2152968A DE 2152968 A1 DE2152968 A1 DE 2152968A1
- Authority
- DE
- Germany
- Prior art keywords
- imidazolidin
- carbonylaminoj
- compounds
- cooh
- conh
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229930182555 Penicillin Natural products 0.000 title claims description 63
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title claims description 46
- 229940049954 penicillin Drugs 0.000 title claims description 35
- -1 p-hydroxyphenyl Chemical group 0.000 claims description 166
- 229940056360 penicillin g Drugs 0.000 claims description 112
- 150000001875 compounds Chemical class 0.000 claims description 77
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 63
- 150000001735 carboxylic acids Chemical class 0.000 claims description 54
- 150000002960 penicillins Chemical class 0.000 claims description 42
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 39
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims description 38
- 239000000203 mixture Substances 0.000 claims description 33
- 238000006243 chemical reaction Methods 0.000 claims description 32
- 239000002585 base Substances 0.000 claims description 31
- 239000000460 chlorine Substances 0.000 claims description 30
- 150000003839 salts Chemical class 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 23
- 239000002904 solvent Substances 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 14
- 239000003960 organic solvent Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 7
- 231100000252 nontoxic Toxicity 0.000 claims description 6
- 230000003000 nontoxic effect Effects 0.000 claims description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 5
- 229920002554 vinyl polymer Polymers 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 239000000872 buffer Substances 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 230000003287 optical effect Effects 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 230000006340 racemization Effects 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 150000001718 carbodiimides Chemical class 0.000 claims description 3
- 150000007529 inorganic bases Chemical class 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910003849 O-Si Inorganic materials 0.000 claims description 2
- 229910003872 O—Si Inorganic materials 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 239000003242 anti bacterial agent Substances 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 claims 1
- BAWFJGJZGIEFAR-NNYOXOHSSA-N NAD zwitterion Chemical compound NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 BAWFJGJZGIEFAR-NNYOXOHSSA-N 0.000 claims 1
- ALAMAKIJRBWNFG-UHFFFAOYSA-N methyl 2-oxoimidazolidine-1-carboxylate Chemical compound COC(=O)N1CCNC1=O ALAMAKIJRBWNFG-UHFFFAOYSA-N 0.000 claims 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 99
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- 239000000243 solution Substances 0.000 description 40
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 39
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 38
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 24
- UWMLSXCBFHQUTH-UHFFFAOYSA-M [chloro(dimethylamino)methylidene]-dimethylazanium;chloride Chemical compound [Cl-].CN(C)C(Cl)=[N+](C)C UWMLSXCBFHQUTH-UHFFFAOYSA-M 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 19
- WTCUHYRXLIHSLY-UHFFFAOYSA-N 1-methylsulfonylimidazolidin-2-one Chemical compound CS(=O)(=O)N1CCNC1=O WTCUHYRXLIHSLY-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 150000003952 β-lactams Chemical class 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 239000011734 sodium Substances 0.000 description 14
- 229910052708 sodium Inorganic materials 0.000 description 14
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 13
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 13
- 229960003424 phenylacetic acid Drugs 0.000 description 13
- 239000003279 phenylacetic acid Substances 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 235000011121 sodium hydroxide Nutrition 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 235000019371 penicillin G benzathine Nutrition 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 6
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- 241000894006 Bacteria Species 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- FPPNZSSZRUTDAP-UWFZAAFLSA-N carbenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(O)=O)C1=CC=CC=C1 FPPNZSSZRUTDAP-UWFZAAFLSA-N 0.000 description 5
- 229960003669 carbenicillin Drugs 0.000 description 5
- 230000020477 pH reduction Effects 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 239000004471 Glycine Substances 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 4
- 229960000723 ampicillin Drugs 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 4
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 239000005051 trimethylchlorosilane Substances 0.000 description 3
- JJWACYUTERPMBM-UHFFFAOYSA-N 1-acetylimidazolidin-2-one Chemical compound CC(=O)N1CCNC1=O JJWACYUTERPMBM-UHFFFAOYSA-N 0.000 description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 241000588748 Klebsiella Species 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000588769 Proteus <enterobacteria> Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- ZGUNAGUHMKGQNY-UHFFFAOYSA-N alpha-phenylglycine Chemical compound OC(=O)C(N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 244000144977 poultry Species 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- YJYMYJRAQYREBT-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylimidazole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1C=NC=C1 YJYMYJRAQYREBT-UHFFFAOYSA-N 0.000 description 1
- BIQCDDSVUJCAPM-UHFFFAOYSA-N 1-(piperidine-1-carbonyl)imidazolidin-2-one Chemical compound C1CCCCN1C(=O)N1CCNC1=O BIQCDDSVUJCAPM-UHFFFAOYSA-N 0.000 description 1
- HBPDMMUROGXKSJ-UHFFFAOYSA-N 1-acetyl-4-methylimidazolidin-2-one Chemical compound C(C)(=O)N1C(NC(C1)C)=O HBPDMMUROGXKSJ-UHFFFAOYSA-N 0.000 description 1
- LKNFGMRBLTWHDS-UHFFFAOYSA-N 1-acetyl-5-methylimidazolidin-2-one Chemical compound CC1CNC(=O)N1C(C)=O LKNFGMRBLTWHDS-UHFFFAOYSA-N 0.000 description 1
- UZYRVRUKMIIDLF-UHFFFAOYSA-N 1-ethylsulfonylimidazolidin-2-one Chemical compound CCS(=O)(=O)N1CCNC1=O UZYRVRUKMIIDLF-UHFFFAOYSA-N 0.000 description 1
- YXTPQCGLMDHWMJ-UHFFFAOYSA-N 1-imidazolidin-1-ylpropan-1-one Chemical compound CCC(=O)N1CCNC1 YXTPQCGLMDHWMJ-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- ROJMSPVWSGTTCX-UHFFFAOYSA-N 2-[(3-acetyl-2-oxoimidazolidine-1-carbonyl)amino]-2-(4-chlorophenyl)acetic acid Chemical compound O=C1N(C(=O)C)CCN1C(=O)NC(C(O)=O)C1=CC=C(Cl)C=C1 ROJMSPVWSGTTCX-UHFFFAOYSA-N 0.000 description 1
- GJGZXGAHWVHMME-UHFFFAOYSA-N 3-acetyl-1h-imidazol-2-one Chemical compound CC(=O)N1C=CNC1=O GJGZXGAHWVHMME-UHFFFAOYSA-N 0.000 description 1
- CCRQBNJTBJRTJD-UHFFFAOYSA-N 3-acetyl-2-oxoimidazolidine-1-carbonyl chloride Chemical compound CC(=O)N1CCN(C(Cl)=O)C1=O CCRQBNJTBJRTJD-UHFFFAOYSA-N 0.000 description 1
- LCZCFZFVIVTSBY-UHFFFAOYSA-N 3-ethylsulfonyl-2-oxoimidazolidine-1-carbonyl chloride Chemical compound CCS(=O)(=O)N1CCN(C(Cl)=O)C1=O LCZCFZFVIVTSBY-UHFFFAOYSA-N 0.000 description 1
- ZWTPALHHEULAPI-UHFFFAOYSA-N 3-methylsulfonyl-2-oxoimidazolidine-1-carbonyl chloride Chemical compound CS(=O)(=O)N1CCN(C(Cl)=O)C1=O ZWTPALHHEULAPI-UHFFFAOYSA-N 0.000 description 1
- ZMGMDXCADSRNCX-UHFFFAOYSA-N 5,6-dihydroxy-1,3-diazepan-2-one Chemical compound OC1CNC(=O)NCC1O ZMGMDXCADSRNCX-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- DZXSBEQAWXKUDI-UHFFFAOYSA-N C(=O)=NC(C(=O)O)C1=CC=C(C=C1)C Chemical compound C(=O)=NC(C(=O)O)C1=CC=C(C=C1)C DZXSBEQAWXKUDI-UHFFFAOYSA-N 0.000 description 1
- FSOZEJALTDJMAY-UHFFFAOYSA-N CC(C1)NCN1C=O Chemical compound CC(C1)NCN1C=O FSOZEJALTDJMAY-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000305071 Enterobacterales Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- NRYFWULEZLPARM-UHFFFAOYSA-N O=C1N(CCCN1)C(=O)NC Chemical compound O=C1N(CCCN1)C(=O)NC NRYFWULEZLPARM-UHFFFAOYSA-N 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- 239000001888 Peptone Substances 0.000 description 1
- 108010080698 Peptones Proteins 0.000 description 1
- 241000588768 Providencia Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- DKRPDJMYGSASOG-UHFFFAOYSA-M [chloro(diethylamino)methylidene]-diethylazanium;chloride Chemical compound [Cl-].CCN(CC)C(Cl)=[N+](CC)CC DKRPDJMYGSASOG-UHFFFAOYSA-M 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000003609 aryl vinyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- FCPVYOBCFFNJFS-LQDWTQKMSA-M benzylpenicillin sodium Chemical class [Na+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)CC1=CC=CC=C1 FCPVYOBCFFNJFS-LQDWTQKMSA-M 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- YPGCWEMNNLXISK-UHFFFAOYSA-N hydratropic acid Chemical compound OC(=O)C(C)C1=CC=CC=C1 YPGCWEMNNLXISK-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- IBIKHMZPHNKTHM-RDTXWAMCSA-N merck compound 25 Chemical compound C1C[C@@H](C(O)=O)[C@H](O)CN1C(C1=C(F)C=CC=C11)=NN1C(=O)C1=C(Cl)C=CC=C1C1CC1 IBIKHMZPHNKTHM-RDTXWAMCSA-N 0.000 description 1
- BUXLRCXHLUZGBC-UHFFFAOYSA-N methyl imidazolidine-1-carboxylate Chemical compound COC(=O)N1CCNC1 BUXLRCXHLUZGBC-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- AZCVBVRUYHKWHU-UHFFFAOYSA-N penicillin X Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)CC1=CC=C(O)C=C1 AZCVBVRUYHKWHU-UHFFFAOYSA-N 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 235000019319 peptone Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/38—One oxygen atom with acyl radicals or hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Fodder In General (AREA)
Priority Applications (43)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE790441D BE790441A (fr) | 1971-10-23 | Nouvelles penicillines, leur procede de preparation et medicament les contenant | |
| DE2152968A DE2152968A1 (de) | 1971-10-23 | 1971-10-23 | Neue penicilline |
| SU1839116A SU522802A3 (ru) | 1971-10-23 | 1972-10-12 | Способ получени пенициллинов или их солей |
| RO197272545A RO60671A (https=) | 1971-10-23 | 1972-10-17 | |
| PH14019A PH10000A (en) | 1971-10-23 | 1972-10-17 | 6-acylbiuredido methyl penicillins and compositions thereof |
| HUBA2816A HU166539B (https=) | 1971-10-23 | 1972-10-19 | |
| CS7200007049A CS186766B2 (en) | 1971-10-23 | 1972-10-19 | Method for producing novel derivatives of penicilline |
| DD72166351A DD106045B3 (de) | 1971-10-23 | 1972-10-19 | Verfahren zur herstellung neuer penicilline |
| BG021666A BG19376A3 (bg) | 1971-10-23 | 1972-10-19 | Метод за получаване на заместени бензилпеницилин |
| FI2898/72A FI57108C (fi) | 1971-10-23 | 1972-10-19 | Foerfarande foer framstaellning av saosom antibakteriella aemnen anvaendbara imidazolidinylkarbonylaminopenicilliner |
| SE7213593A SE401186B (sv) | 1971-10-23 | 1972-10-20 | Forfarande for framstellning av nya penicilliner |
| IE1423/72A IE37096B1 (en) | 1971-10-23 | 1972-10-20 | New penicillin compounds their production and their medicinal use |
| CH1531972A CH591496A5 (https=) | 1971-10-23 | 1972-10-20 | |
| DK523372A DK138855C (da) | 1971-10-23 | 1972-10-20 | Analogifremgangsmaade til fremstilling af penicilliner eller ikke-toksiske farmaceutisk acceptable salte deraf |
| NLAANVRAGE7214254,A NL175419C (nl) | 1971-10-23 | 1972-10-20 | Werkwijze ter bereiding of vervaardiging van antibiotisch werkzame farmaceutische preparaten, alsmede werkwijze ter bereiding van antibiotisch werkzame alfa-gesubstitueerde 6-(alfa-(3-acylureido)acetylamino) penicillanzuurderivaten. |
| LU66333A LU66333A1 (https=) | 1971-10-23 | 1972-10-20 | |
| AT901172A AT321462B (de) | 1971-10-23 | 1972-10-20 | Verfahren zur Herstellung von neuen Penicillinen |
| IL7240627A IL40627A (en) | 1971-10-23 | 1972-10-20 | Alpha-imidazolinonylcarbonylamino derivatives of benzyl-and thienyl-2-methyl-penicillins,their preparation and pharmaceutical compositions or feed additives containing them |
| ZA727474A ZA727474B (en) | 1971-10-23 | 1972-10-20 | New penicillin compounds,their production and their medicinal use |
| CA154,339A CA1012531A (en) | 1971-10-23 | 1972-10-20 | Penicillin compounds, their production and their medicinal use |
| NL7214255A NL7214255A (https=) | 1971-10-23 | 1972-10-20 | |
| PL1972158393A PL89072B1 (https=) | 1971-10-23 | 1972-10-21 | |
| JP10490372A JPS5538955B2 (https=) | 1971-10-23 | 1972-10-21 | |
| EG438/72A EG11092A (en) | 1971-10-23 | 1972-10-21 | Process for preparing of new penicillin compounds |
| JP47104904A JPS4849911A (https=) | 1971-10-23 | 1972-10-21 | |
| ES407852A ES407852A1 (es) | 1971-10-23 | 1972-10-21 | Procedimiento para la obtencion de penicilinas. |
| NO723809A NO143908C (no) | 1971-10-23 | 1972-10-23 | Analogifremgangsmaate til fremstilling av terapeutisk virksomme, nye penicilliner |
| AR244771A AR196634A1 (es) | 1971-10-23 | 1972-10-23 | Procedimiento para la produccion de nuevas penicilinas |
| AU48067/72A AU485090B2 (en) | 1971-10-23 | 1972-10-23 | New penicillin compounds, their production and their medicinal use |
| YU2638/72A YU36179B (en) | 1971-10-23 | 1972-10-23 | Process for preparing novel penicillins |
| GB4870072A GB1392850A (en) | 1971-10-23 | 1972-10-23 | Penicillin compounds their production and their medicinal use |
| FR7237484A FR2157909B1 (https=) | 1971-10-23 | 1972-10-23 | |
| CY948A CY948A (en) | 1971-10-23 | 1972-10-23 | New penicillin compounds, their production and their medicinal use |
| US05/502,770 US3978056A (en) | 1971-10-23 | 1974-09-03 | Penicillins |
| US05/502,956 US3974142A (en) | 1971-10-23 | 1974-09-03 | Penicillins |
| US05/502,662 US3983105A (en) | 1971-10-23 | 1974-09-03 | Penicillins |
| US05/502,835 US3972870A (en) | 1971-10-23 | 1974-09-03 | Penicillins |
| US05/502,765 US3972869A (en) | 1971-10-23 | 1974-09-03 | Penicillins |
| US05/502,753 US3975375A (en) | 1971-10-23 | 1974-09-03 | Penicillins |
| US05/502,668 US3974141A (en) | 1971-10-23 | 1974-09-03 | Penicillins |
| US05/605,742 US4009272A (en) | 1971-10-23 | 1975-08-18 | Penicillins |
| KE2825A KE2825A (en) | 1971-10-23 | 1978-03-14 | New penicillin compounds, their production and their medicinal use |
| HK153/78A HK15378A (en) | 1971-10-23 | 1978-03-16 | New penicillin compounds, their production and their medicinal use |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2152968A DE2152968A1 (de) | 1971-10-23 | 1971-10-23 | Neue penicilline |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2152968A1 true DE2152968A1 (de) | 1973-04-26 |
Family
ID=5823252
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2152968A Pending DE2152968A1 (de) | 1971-10-23 | 1971-10-23 | Neue penicilline |
Country Status (32)
| Country | Link |
|---|---|
| JP (2) | JPS5538955B2 (https=) |
| AR (1) | AR196634A1 (https=) |
| AT (1) | AT321462B (https=) |
| BE (1) | BE790441A (https=) |
| BG (1) | BG19376A3 (https=) |
| CA (1) | CA1012531A (https=) |
| CH (1) | CH591496A5 (https=) |
| CS (1) | CS186766B2 (https=) |
| CY (1) | CY948A (https=) |
| DD (1) | DD106045B3 (https=) |
| DE (1) | DE2152968A1 (https=) |
| DK (1) | DK138855C (https=) |
| EG (1) | EG11092A (https=) |
| ES (1) | ES407852A1 (https=) |
| FI (1) | FI57108C (https=) |
| FR (1) | FR2157909B1 (https=) |
| GB (1) | GB1392850A (https=) |
| HK (1) | HK15378A (https=) |
| HU (1) | HU166539B (https=) |
| IE (1) | IE37096B1 (https=) |
| IL (1) | IL40627A (https=) |
| KE (1) | KE2825A (https=) |
| LU (1) | LU66333A1 (https=) |
| NL (1) | NL7214255A (https=) |
| NO (1) | NO143908C (https=) |
| PH (1) | PH10000A (https=) |
| PL (1) | PL89072B1 (https=) |
| RO (1) | RO60671A (https=) |
| SE (1) | SE401186B (https=) |
| SU (1) | SU522802A3 (https=) |
| YU (1) | YU36179B (https=) |
| ZA (1) | ZA727474B (https=) |
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2403512A1 (de) * | 1973-12-14 | 1975-06-19 | Pfizer | Neue penicilline und verfahren zu ihrer herstellung |
| US3972869A (en) * | 1971-10-23 | 1976-08-03 | Bayer Aktiengesellschaft | Penicillins |
| US3972870A (en) * | 1971-10-23 | 1976-08-03 | Bayer Aktiengesellschaft | Penicillins |
| US3974142A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3974141A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3975375A (en) * | 1971-10-23 | 1976-08-17 | Bayer Aktiengesellschaft | Penicillins |
| US3978056A (en) * | 1971-10-23 | 1976-08-31 | Bayer Aktiengesellschaft | Penicillins |
| US3983105A (en) * | 1971-10-23 | 1976-09-28 | Bayer Aktiengesellschaft | Penicillins |
| US4009272A (en) * | 1971-10-23 | 1977-02-22 | Bayer Aktiengesellschaft | Penicillins |
| US4147693A (en) * | 1974-11-28 | 1979-04-03 | Bayer Aktiengesellschaft | βLactam antibiotics and process for their use |
| US4200576A (en) * | 1976-12-24 | 1980-04-29 | Bayer Aktiengesellschaft | Beta-lactam antibiotics |
| US4235774A (en) | 1978-03-08 | 1980-11-25 | Bayer Aktiengesellschaft | Penicillin derivatives |
| US4294827A (en) * | 1976-12-24 | 1981-10-13 | Bayer Aktiengesellschaft | Antibacterial and growth promoting β-lactam antibiotics carrying an -ylidene-2-pyrrolidinon-1-yl radical |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5852996B2 (ja) * | 1975-03-25 | 1983-11-26 | バイエル・アクチエンゲゼルシヤフト | β−ラクタム及び抗バクテリア剤 |
| DE2817228A1 (de) * | 1978-04-20 | 1979-10-31 | Bayer Ag | Verfahren zur herstellung halbsynthetischer beta-lactamantibiotika |
| JP7122236B2 (ja) * | 2018-11-28 | 2022-08-19 | 東京エレクトロン株式会社 | 検査装置、メンテナンス方法、及びプログラム |
-
0
- BE BE790441D patent/BE790441A/xx not_active IP Right Cessation
-
1971
- 1971-10-23 DE DE2152968A patent/DE2152968A1/de active Pending
-
1972
- 1972-10-12 SU SU1839116A patent/SU522802A3/ru active
- 1972-10-17 RO RO197272545A patent/RO60671A/ro unknown
- 1972-10-17 PH PH14019A patent/PH10000A/en unknown
- 1972-10-19 DD DD72166351A patent/DD106045B3/de unknown
- 1972-10-19 FI FI2898/72A patent/FI57108C/fi active
- 1972-10-19 HU HUBA2816A patent/HU166539B/hu not_active IP Right Cessation
- 1972-10-19 BG BG021666A patent/BG19376A3/xx unknown
- 1972-10-19 CS CS7200007049A patent/CS186766B2/cs unknown
- 1972-10-20 IL IL7240627A patent/IL40627A/en unknown
- 1972-10-20 LU LU66333A patent/LU66333A1/xx unknown
- 1972-10-20 DK DK523372A patent/DK138855C/da not_active IP Right Cessation
- 1972-10-20 IE IE1423/72A patent/IE37096B1/xx unknown
- 1972-10-20 SE SE7213593A patent/SE401186B/xx unknown
- 1972-10-20 CH CH1531972A patent/CH591496A5/xx not_active IP Right Cessation
- 1972-10-20 CA CA154,339A patent/CA1012531A/en not_active Expired
- 1972-10-20 NL NL7214255A patent/NL7214255A/xx not_active Application Discontinuation
- 1972-10-20 AT AT901172A patent/AT321462B/de not_active IP Right Cessation
- 1972-10-20 ZA ZA727474A patent/ZA727474B/xx unknown
- 1972-10-21 ES ES407852A patent/ES407852A1/es not_active Expired
- 1972-10-21 PL PL1972158393A patent/PL89072B1/pl unknown
- 1972-10-21 JP JP10490372A patent/JPS5538955B2/ja not_active Expired
- 1972-10-21 JP JP47104904A patent/JPS4849911A/ja active Pending
- 1972-10-21 EG EG438/72A patent/EG11092A/xx active
- 1972-10-23 CY CY948A patent/CY948A/xx unknown
- 1972-10-23 YU YU2638/72A patent/YU36179B/xx unknown
- 1972-10-23 AR AR244771A patent/AR196634A1/es active
- 1972-10-23 FR FR7237484A patent/FR2157909B1/fr not_active Expired
- 1972-10-23 NO NO723809A patent/NO143908C/no unknown
- 1972-10-23 GB GB4870072A patent/GB1392850A/en not_active Expired
-
1978
- 1978-03-14 KE KE2825A patent/KE2825A/xx unknown
- 1978-03-16 HK HK153/78A patent/HK15378A/xx unknown
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3978056A (en) * | 1971-10-23 | 1976-08-31 | Bayer Aktiengesellschaft | Penicillins |
| US3972869A (en) * | 1971-10-23 | 1976-08-03 | Bayer Aktiengesellschaft | Penicillins |
| US3972870A (en) * | 1971-10-23 | 1976-08-03 | Bayer Aktiengesellschaft | Penicillins |
| US3974142A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3974141A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3975375A (en) * | 1971-10-23 | 1976-08-17 | Bayer Aktiengesellschaft | Penicillins |
| US3983105A (en) * | 1971-10-23 | 1976-09-28 | Bayer Aktiengesellschaft | Penicillins |
| US4009272A (en) * | 1971-10-23 | 1977-02-22 | Bayer Aktiengesellschaft | Penicillins |
| DE2403512A1 (de) * | 1973-12-14 | 1975-06-19 | Pfizer | Neue penicilline und verfahren zu ihrer herstellung |
| US4147693A (en) * | 1974-11-28 | 1979-04-03 | Bayer Aktiengesellschaft | βLactam antibiotics and process for their use |
| US4200576A (en) * | 1976-12-24 | 1980-04-29 | Bayer Aktiengesellschaft | Beta-lactam antibiotics |
| US4294827A (en) * | 1976-12-24 | 1981-10-13 | Bayer Aktiengesellschaft | Antibacterial and growth promoting β-lactam antibiotics carrying an -ylidene-2-pyrrolidinon-1-yl radical |
| US4235774A (en) | 1978-03-08 | 1980-11-25 | Bayer Aktiengesellschaft | Penicillin derivatives |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2152967A1 (de) | Neue penicilline | |
| DE2152968A1 (de) | Neue penicilline | |
| DE2407715C2 (de) | Cephalosporine, Verfahren zu ihrer Herstellung sowie Arzneimittel | |
| EP0000392B1 (de) | Cephalosporin und Penicillin-derivate, Verfahren zu deren Herstellung, und deren pharmazeutische Präparate | |
| DE2104580A1 (en) | Alpha-3-acylureido benzyl penicillins antibacterial agents esp - against klebsiella | |
| DE2720579A1 (de) | Beta-lactam-verbindungen, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2440268A1 (de) | Beta-lactamantibiotika, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2354219A1 (de) | Beta-lactam-antibiotica, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2055531B2 (de) | Anüdinopenicillansaurederivate, Verfahren zur Herstellung dieser Verbindungen und ihre Verwendung bei der Bekämpfung von Infektionskrankheiten | |
| DE2528079A1 (de) | Penicilline, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2025414C3 (de) | Cyclische Acylureidophenylacetamidopenicillansäuren | |
| DE2258973A1 (de) | Penicilline, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| EP0073454B1 (de) | Neue 6alpha-Methoxy-penicilline, ihre Salze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2104579C3 (de) | Cyclische Acylureidopenicilline und sie enthaltende Arzneimittel | |
| DE2720580A1 (de) | Beta-lactam-verbindungen, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2025415A1 (en) | Alpha-3-acylureido-substd-methyl penicillins antibacterial agents - esp against klebsiella | |
| DE3028451A1 (de) | Neue lactame, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0049814B1 (de) | Neue Cephalosporine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3027530A1 (de) | Neue lactame, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2318955A1 (de) | Penicillinsaeuren, ein verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel | |
| DE2658906A1 (de) | Beta-lactam-antibiotika, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE3039223A1 (de) | Neue substituierte oxadethiacephaosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2548247A1 (de) | Cephalosporine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2050087A1 (en) | Alpha-benzamido-ampicillin-type derivs - with antibacterial activity | |
| EP0053693A1 (de) | Neue Penicilline, ihre Salze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |