DE2147947C2 - Lichtempfindliches Gemisch - Google Patents
Lichtempfindliches GemischInfo
- Publication number
- DE2147947C2 DE2147947C2 DE2147947A DE2147947A DE2147947C2 DE 2147947 C2 DE2147947 C2 DE 2147947C2 DE 2147947 A DE2147947 A DE 2147947A DE 2147947 A DE2147947 A DE 2147947A DE 2147947 C2 DE2147947 C2 DE 2147947C2
- Authority
- DE
- Germany
- Prior art keywords
- positive
- layer
- negative
- exposed
- developer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 32
- 239000007859 condensation product Substances 0.000 claims description 25
- 239000012954 diazonium Substances 0.000 claims description 10
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 9
- 150000001989 diazonium salts Chemical class 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- 239000010410 layer Substances 0.000 description 67
- 239000000243 solution Substances 0.000 description 41
- 239000000463 material Substances 0.000 description 26
- 238000007639 printing Methods 0.000 description 26
- 238000011161 development Methods 0.000 description 24
- 230000002378 acidificating effect Effects 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 229920005989 resin Polymers 0.000 description 15
- 239000011347 resin Substances 0.000 description 15
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 14
- 238000000034 method Methods 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- 238000005530 etching Methods 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 150000003839 salts Chemical group 0.000 description 12
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 11
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 11
- 239000010949 copper Substances 0.000 description 11
- 229910052802 copper Inorganic materials 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 229910052782 aluminium Inorganic materials 0.000 description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 239000001488 sodium phosphate Substances 0.000 description 8
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 7
- 238000007792 addition Methods 0.000 description 7
- -1 aliphatic alcohols Chemical class 0.000 description 7
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 7
- 150000008049 diazo compounds Chemical class 0.000 description 7
- 239000011888 foil Substances 0.000 description 7
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 7
- 235000019801 trisodium phosphate Nutrition 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical group COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 6
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 238000007598 dipping method Methods 0.000 description 5
- 238000007645 offset printing Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229930192627 Naphthoquinone Natural products 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 3
- 229930188620 butyrolactone Natural products 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 230000004069 differentiation Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- QVEIBLDXZNGPHR-UHFFFAOYSA-N naphthalene-1,4-dione;diazide Chemical class [N-]=[N+]=[N-].[N-]=[N+]=[N-].C1=CC=C2C(=O)C=CC(=O)C2=C1 QVEIBLDXZNGPHR-UHFFFAOYSA-N 0.000 description 3
- 150000002791 naphthoquinones Chemical class 0.000 description 3
- 229920001568 phenolic resin Polymers 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 230000033458 reproduction Effects 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- RTMBGDBBDQKNNZ-UHFFFAOYSA-L C.I. Acid Blue 3 Chemical compound [Ca+2].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=C(O)C=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1.C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=C(O)C=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 RTMBGDBBDQKNNZ-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229920000180 alkyd Polymers 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 241001233037 catfish Species 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical group CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000007646 gravure printing Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 238000007644 letterpress printing Methods 0.000 description 2
- YXKZOOQDQQINBJ-UHFFFAOYSA-N naphthalene-1,4-dione;azide Chemical class [N-]=[N+]=[N-].C1=CC=C2C(=O)C=CC(=O)C2=C1 YXKZOOQDQQINBJ-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 229920003986 novolac Polymers 0.000 description 2
- 235000012736 patent blue V Nutrition 0.000 description 2
- 239000004177 patent blue V Substances 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 229920006267 polyester film Polymers 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- KKVTYAVXTDIPAP-UHFFFAOYSA-M sodium;methanesulfonate Chemical compound [Na+].CS([O-])(=O)=O KKVTYAVXTDIPAP-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000004071 soot Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- WTQZSMDDRMKJRI-UHFFFAOYSA-N 4-diazoniophenolate Chemical compound [O-]C1=CC=C([N+]#N)C=C1 WTQZSMDDRMKJRI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- YCUVUDODLRLVIC-UHFFFAOYSA-N Sudan black B Chemical compound C1=CC(=C23)NC(C)(C)NC2=CC=CC3=C1N=NC(C1=CC=CC=C11)=CC=C1N=NC1=CC=CC=C1 YCUVUDODLRLVIC-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- ZCSRMKWFMUDWAH-UHFFFAOYSA-N [5-(hydroxymethyl)-2,4-di(propan-2-yl)phenyl]methanol Chemical compound CC(C)C1=CC(C(C)C)=C(CO)C=C1CO ZCSRMKWFMUDWAH-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000002519 antifouling agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- ZXVICPNEDFOIRW-UHFFFAOYSA-N butyl acetate;2-methoxyethanol Chemical compound COCCO.CCCCOC(C)=O ZXVICPNEDFOIRW-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- CJTRGWNHVKRZEB-UHFFFAOYSA-N cyclohexanone;formaldehyde Chemical compound O=C.O=C1CCCCC1 CJTRGWNHVKRZEB-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 125000001752 diazonium salt group Chemical group 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000009189 diving Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229940082150 encore Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012052 hydrophilic carrier Substances 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000008379 phenol ethers Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920002120 photoresistant polymer Polymers 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000005496 tempering Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008207 working material Substances 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/09—Photosensitive materials characterised by structural details, e.g. supports, auxiliary layers
- G03F7/095—Photosensitive materials characterised by structural details, e.g. supports, auxiliary layers having more than one photosensitive layer
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Structural Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE789196D BE789196A (fr) | 1971-09-25 | Matiere a copier photosensible | |
| DE2147947A DE2147947C2 (de) | 1971-09-25 | 1971-09-25 | Lichtempfindliches Gemisch |
| NLAANVRAGE7212548,A NL172274C (nl) | 1971-09-25 | 1972-09-15 | Werkwijze voor het bereiden van een lichtgevoelige kopieermassa, lichtgevoelig kopieermateriaal dat is voorzien van een laag gevormd uit een aldus bereide kopieermassa, alsmede werkwijze voor het vervaardigen van een kopie onder toepassing van een dergelijk lichtgevoelig kopieermateriaal. |
| SE7212123A SE381752B (sv) | 1971-09-25 | 1972-09-20 | Ljuskenslig kopieringsmassa |
| US291095A US3890152A (en) | 1971-09-25 | 1972-09-21 | Light-sensitive copying composition containing diazo resin and quinone diazide |
| JP9564072A JPS5513016B2 (enExample) | 1971-09-25 | 1972-09-22 | |
| GB4398172A GB1396530A (en) | 1971-09-25 | 1972-09-22 | Light-sensitive compositions and reproduction materials including such compositions |
| AT817572A AT331826B (de) | 1971-09-25 | 1972-09-22 | Lichtempfindliche kopiermasse |
| IT52900/72A IT969442B (it) | 1971-09-25 | 1972-09-22 | Masse fotosensibili di copiatura e procedimento per ottenere con essa riproduzioni positive o negative |
| CA152,326A CA979270A (en) | 1971-09-25 | 1972-09-22 | Light-sensitive copying composition |
| FR7233837A FR2153468B1 (enExample) | 1971-09-25 | 1972-09-25 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2147947A DE2147947C2 (de) | 1971-09-25 | 1971-09-25 | Lichtempfindliches Gemisch |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2147947A1 DE2147947A1 (de) | 1973-03-29 |
| DE2147947C2 true DE2147947C2 (de) | 1983-12-01 |
Family
ID=5820560
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2147947A Expired DE2147947C2 (de) | 1971-09-25 | 1971-09-25 | Lichtempfindliches Gemisch |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3890152A (enExample) |
| JP (1) | JPS5513016B2 (enExample) |
| AT (1) | AT331826B (enExample) |
| BE (1) | BE789196A (enExample) |
| CA (1) | CA979270A (enExample) |
| DE (1) | DE2147947C2 (enExample) |
| FR (1) | FR2153468B1 (enExample) |
| GB (1) | GB1396530A (enExample) |
| IT (1) | IT969442B (enExample) |
| NL (1) | NL172274C (enExample) |
| SE (1) | SE381752B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0363571A1 (de) * | 1988-07-04 | 1990-04-18 | Hoechst Aktiengesellschaft | 1,2-Naphthochinon-2-diazid-sulfonsäureamide und lichtempfindliche Gemische, die diese enthalten |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4196003A (en) * | 1974-02-01 | 1980-04-01 | Fuji Photo Film Co., Ltd. | Light-sensitive o-quinone diazide copying composition |
| DE2447225C2 (de) * | 1974-10-03 | 1983-12-22 | Ibm Deutschland Gmbh, 7000 Stuttgart | Verfahren zum Ablösen von positiven Photolack |
| US4391894A (en) * | 1974-11-06 | 1983-07-05 | Polychrome Corporation | Colored photosensitive composition |
| US4032344A (en) * | 1975-01-16 | 1977-06-28 | Eastman Kodak Company | Polysulfonamide vesicular binders and processes of forming vesicular images |
| US4189320A (en) * | 1975-04-29 | 1980-02-19 | American Hoechst Corporation | Light-sensitive o-quinone diazide compositions and photographic reproduction processes and structures |
| DE2529054C2 (de) * | 1975-06-30 | 1982-04-29 | Ibm Deutschland Gmbh, 7000 Stuttgart | Verfahren zur Herstellung eines zur Vorlage negativen Resistbildes |
| US4486529A (en) * | 1976-06-10 | 1984-12-04 | American Hoechst Corporation | Dialo printing plate made from laser |
| DE2641099A1 (de) * | 1976-09-13 | 1978-03-16 | Hoechst Ag | Lichtempfindliche kopierschicht |
| GB1588417A (en) * | 1977-03-15 | 1981-04-23 | Agfa Gevaert | Photoresist materials |
| GB1604652A (en) * | 1977-04-12 | 1981-12-16 | Vickers Ltd | Radiation sensitive materials |
| CA1119447A (en) * | 1978-09-06 | 1982-03-09 | John P. Vikesland | Positive-acting photoresist composition containing a crosslinked urethane resin, a cured epoxy resin and a photosensitizer |
| US4247616A (en) * | 1979-07-27 | 1981-01-27 | Minnesota Mining And Manufacturing Company | Positive-acting photoresist composition |
| US4508813A (en) * | 1980-06-16 | 1985-04-02 | Fujitsu Limited | Method for producing negative resist images |
| US4326020A (en) * | 1980-09-10 | 1982-04-20 | Polychrome Corporation | Method of making positive acting diazo lithographic printing plate |
| US4377633A (en) * | 1981-08-24 | 1983-03-22 | International Business Machines Corporation | Methods of simultaneous contact and metal lithography patterning |
| DE3337315A1 (de) * | 1982-10-13 | 1984-04-19 | Tokyo Ohka Kogyo Co., Ltd., Kawasaki, Kanagawa | Zweifach-lichtempfindliche zusammensetzungen und verfahren zur erzeugung bildmustergemaesser photoresistschichten |
| JPS5979248A (ja) * | 1982-10-29 | 1984-05-08 | Tokyo Ohka Kogyo Co Ltd | 感光性組成物 |
| DE3323343A1 (de) * | 1983-06-29 | 1985-01-10 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches gemisch und daraus hergestelltes kopiermaterial |
| US4511640A (en) * | 1983-08-25 | 1985-04-16 | American Hoechst Corporation | Aqueous developable diazo lithographic printing plates with admixture of polyvinyl acetate and styrene maleic acid ester copolymer |
| FR2558274A1 (fr) * | 1984-01-17 | 1985-07-19 | Chemistry Technology Sa | Procede de production d'images positives sur un support a partir d'un cliche transparent positif utilisant une surface sensible diazoique |
| JPS60186837A (ja) * | 1984-03-07 | 1985-09-24 | Somar Corp | 感光性組成物 |
| EP0155231B2 (de) * | 1984-03-07 | 1997-01-15 | Ciba-Geigy Ag | Verfahren zur Herstellung von Abbildungen |
| DE3417645A1 (de) * | 1984-05-12 | 1985-11-14 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches aufzeichnungsmaterial fuer die herstellung von flachdruckplatten |
| DE3567294D1 (en) * | 1984-12-06 | 1989-02-09 | Hoechst Celanese Corp | Light-sensitive composition |
| DE3445276A1 (de) * | 1984-12-12 | 1986-06-19 | Hoechst Ag, 6230 Frankfurt | Strahlungsempfindliches gemisch, daraus hergestelltes lichtempfindliches aufzeichnungsmaterial und verfahren zur herstellung einer flachdruckform |
| US4618562A (en) * | 1984-12-27 | 1986-10-21 | American Hoechst Corporation | Aqueous developable lithographic printing plates containing an admixture of diazonium salts and polymers and composition therefor |
| DE3504658A1 (de) * | 1985-02-12 | 1986-08-14 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches gemisch und damit hergestelltes aufzeichnungsmaterial |
| JPS6238471A (ja) * | 1985-08-14 | 1987-02-19 | Fuji Photo Film Co Ltd | 感光性平版印刷版の製造方法 |
| JPS63181234A (ja) * | 1987-01-22 | 1988-07-26 | Toshiba Corp | カラ−受像管蛍光面の形成方法 |
| US5162510A (en) * | 1986-05-02 | 1992-11-10 | Hoechst Celanese Corporation | Process for the preparation of photosensitive compositions containing a mixed ester o-quinone photosensitizer |
| US4732836A (en) * | 1986-05-02 | 1988-03-22 | Hoechst Celanese Corporation | Novel mixed ester O-quinone photosensitizers |
| US4902785A (en) * | 1986-05-02 | 1990-02-20 | Hoechst Celanese Corporation | Phenolic photosensitizers containing quinone diazide and acidic halide substituents |
| US4732837A (en) * | 1986-05-02 | 1988-03-22 | Hoechst Celanese Corporation | Novel mixed ester O-quinone photosensitizers |
| US5035976A (en) * | 1986-05-02 | 1991-07-30 | Hoechst Celanese Corporation | Photosensitive article having phenolic photosensitizers containing quinone diazide and acid halide substituents |
| US4877711A (en) * | 1986-05-19 | 1989-10-31 | Fuji Photo Film Co., Ltd. | Light-sensitive diazo photopolymerizable composition with polyurethane having carbon-carbon unsaturated and a carboxyl group |
| US4816380A (en) * | 1986-06-27 | 1989-03-28 | Texas Instruments Incorporated | Water soluble contrast enhancement layer method of forming resist image on semiconductor chip |
| US5173390A (en) * | 1986-06-27 | 1992-12-22 | Texas Instruments Incorporated | Water soluble contrast enhancement composition and method of use |
| US4997742A (en) * | 1986-06-27 | 1991-03-05 | Texas Instruments Inc. | Water soluble contrast enhancement composition with 1-oxy-2 diazonaphthalene sulfonamide salt and polyvinyl alcohol |
| JPH07113773B2 (ja) * | 1986-07-04 | 1995-12-06 | 株式会社日立製作所 | パタ−ン形成方法 |
| JPH0721638B2 (ja) * | 1986-07-18 | 1995-03-08 | 東京応化工業株式会社 | 基板の処理方法 |
| US5128230A (en) * | 1986-12-23 | 1992-07-07 | Shipley Company Inc. | Quinone diazide containing photoresist composition utilizing mixed solvent of ethyl lactate, anisole and amyl acetate |
| US5182183A (en) * | 1987-03-12 | 1993-01-26 | Mitsubishi Kasei Corporation | Positive photosensitive planographic printing plates containing specific high-molecular weight compound and photosensitive ester of O-napthoquinonediazidosulfonic acid with polyhydroxybenzophenone |
| JPH07117746B2 (ja) * | 1987-04-16 | 1995-12-18 | 富士写真フイルム株式会社 | 感光性平版印刷版の製造方法 |
| JPH07117747B2 (ja) * | 1987-04-21 | 1995-12-18 | 富士写真フイルム株式会社 | 感光性組成物 |
| DE3729035A1 (de) * | 1987-08-31 | 1989-03-09 | Hoechst Ag | Positiv arbeitendes lichtempfindliches gemisch und daraus hergestelltes photolithographisches aufzeichnungsmaterial |
| US5002856A (en) * | 1989-08-02 | 1991-03-26 | E. I. Du Pont De Nemours And Company | Thermally stable carbazole diazonium salts as sources of photo-initiated strong acid |
| US5851736A (en) * | 1991-03-05 | 1998-12-22 | Nitto Denko Corporation | Heat-resistant photoresist composition, photosensitive substrate, and process for forming heat-resistant positive or negative pattern |
| US5227277A (en) * | 1991-04-17 | 1993-07-13 | Polaroid Corporation | Imaging process, and imaging medium for use therein |
| US5401607A (en) * | 1991-04-17 | 1995-03-28 | Polaroid Corporation | Processes and compositions for photogeneration of acid |
| US5225314A (en) * | 1991-04-17 | 1993-07-06 | Polaroid Corporation | Imaging process, and imaging medium for use therein |
| TW439016B (en) * | 1996-09-20 | 2001-06-07 | Sumitomo Chemical Co | Positive resist composition |
| US7354696B2 (en) * | 2004-07-08 | 2008-04-08 | Agfa Graphics Nv | Method for making a lithographic printing plate |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1967371A (en) * | 1931-03-28 | 1934-07-24 | Kalle & Co Ag | Process of preparing copies |
| US2702243A (en) * | 1950-06-17 | 1955-02-15 | Azoplate Corp | Light-sensitive photographic element and process of producing printing plates |
| DE1058845B (de) * | 1958-02-11 | 1959-06-04 | Kalle & Co Ag | Verfahren zur Herstellung von Kopien, besonders Druckformen, mit Hilfe von wasserunloeslichen Diazoverbindungen |
| NL270834A (enExample) * | 1960-10-31 | |||
| US3113023A (en) * | 1961-07-25 | 1963-12-03 | Polychrome Corp | Photosensitive lithographic plate comprising photosensitive diazo resins and method for preparing same |
| JPS4910841B1 (enExample) * | 1965-12-18 | 1974-03-13 | ||
| GB1136544A (en) * | 1966-02-28 | 1968-12-11 | Agfa Gevaert Nv | Photochemical cross-linking of polymers |
| GB1188527A (en) * | 1966-05-31 | 1970-04-15 | Algraphy Ltd | Development of Light-Sensitive Layers |
| ZA6801224B (enExample) * | 1967-03-08 | |||
| US3634082A (en) * | 1967-07-07 | 1972-01-11 | Shipley Co | Light-sensitive naphthoquinone diazide composition containing a polyvinyl ether |
| US3573917A (en) * | 1968-07-12 | 1971-04-06 | Takashi Okamoto | Light-sensitive printing plate composition |
| US3679419A (en) * | 1969-05-20 | 1972-07-25 | Azoplate Corp | Light-sensitive diazo condensate containing reproduction material |
-
0
- BE BE789196D patent/BE789196A/xx not_active IP Right Cessation
-
1971
- 1971-09-25 DE DE2147947A patent/DE2147947C2/de not_active Expired
-
1972
- 1972-09-15 NL NLAANVRAGE7212548,A patent/NL172274C/xx not_active IP Right Cessation
- 1972-09-20 SE SE7212123A patent/SE381752B/xx unknown
- 1972-09-21 US US291095A patent/US3890152A/en not_active Expired - Lifetime
- 1972-09-22 GB GB4398172A patent/GB1396530A/en not_active Expired
- 1972-09-22 IT IT52900/72A patent/IT969442B/it active
- 1972-09-22 CA CA152,326A patent/CA979270A/en not_active Expired
- 1972-09-22 JP JP9564072A patent/JPS5513016B2/ja not_active Expired
- 1972-09-22 AT AT817572A patent/AT331826B/de not_active IP Right Cessation
- 1972-09-25 FR FR7233837A patent/FR2153468B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0363571A1 (de) * | 1988-07-04 | 1990-04-18 | Hoechst Aktiengesellschaft | 1,2-Naphthochinon-2-diazid-sulfonsäureamide und lichtempfindliche Gemische, die diese enthalten |
Also Published As
| Publication number | Publication date |
|---|---|
| AT331826B (de) | 1976-08-25 |
| FR2153468B1 (enExample) | 1976-10-29 |
| US3890152A (en) | 1975-06-17 |
| NL172274B (nl) | 1983-03-01 |
| BE789196A (fr) | 1973-03-22 |
| JPS4841806A (enExample) | 1973-06-19 |
| NL7212548A (enExample) | 1973-03-27 |
| JPS5513016B2 (enExample) | 1980-04-05 |
| NL172274C (nl) | 1983-08-01 |
| IT969442B (it) | 1974-03-30 |
| GB1396530A (en) | 1975-06-04 |
| SE381752B (sv) | 1975-12-15 |
| ATA817572A (de) | 1975-12-15 |
| DE2147947A1 (de) | 1973-03-29 |
| CA979270A (en) | 1975-12-09 |
| FR2153468A1 (enExample) | 1973-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2147947C2 (de) | Lichtempfindliches Gemisch | |
| DE2744097C2 (de) | Verfahren zur Entwicklung einer bildweise belichteten lichtempfindlichen lithographischen Druckplatte sowie Verwendung einer Entwicklerlösung zum Entwickeln einer Druckplatte | |
| DE2657922C2 (de) | Lichtempfindliches Gemisch | |
| DE903529C (de) | Lichtempfindliche Schichten | |
| DE2512933C2 (de) | Lichtempfindliche Flachdruckplatte | |
| DE1195166B (de) | Auf Metallunterlagen haftende, aetzfaehige Kopierschichten | |
| EP0222297B1 (de) | Einbrenngummierung für Offsetdruckplatten | |
| DE1422474B2 (de) | Lichtempfindliches Gemisch | |
| DE1118606B (de) | Lichtempfindliche Schichten fuer die photomechanische Herstellung von Druckformen | |
| DE2626473A1 (de) | Verfahren zur herstellung von flachdruckformen | |
| DE3022473A1 (de) | Lichtempfindliches kopiermaterial und verfahren zu seiner herstellung | |
| DE3022362A1 (de) | Lichtempfindliches kopiermaterial und verfahren zu seiner herstellung | |
| DE2733267C2 (de) | Photolack | |
| DE1114705C2 (de) | Lichtempfindliche Schichten fuer die photomechanische Herstellung von Druckformen | |
| DE1597614A1 (de) | Lichtempfindliche Kopierschicht | |
| EP0008394A1 (de) | Verfahren zum Entwickeln von belichteten lichtempfindlichen Druckplatten auf Basis von o-Naphthochinondiaziden | |
| DE3144499A1 (de) | Lichtempfindliches gemisch und daraus hergestelltes lichtempfindliches kopiermaterial | |
| DE1224147B (de) | Verfahren zur Umkehrentwicklung von Diazo-verbindungen enthaltenden Kopierschichten | |
| DE69620556T2 (de) | Wässrig entwickelbare, negativ arbeitende, fotoempfindliche Zusammensetzung mit verbessertem Bildkontrast | |
| DE1572070C3 (de) | Lichtempfindliches Kopiermaterial | |
| DE1931026A1 (de) | Lichtempfindliche harzartige Zusammensetzungen | |
| DE1572302A1 (de) | Verfahren zur Entwicklung von positiv arbeitenden lichtempfindlichen Schichten | |
| EP0224162B1 (de) | Lichtempfindliches, Diazoniumgruppen enthaltendes Polykondensationsprodukt, Verfahren zu seiner Herstellung und lichtempfindliches Aufzeichnungsmaterial, das dieses Polykondensationsprodukt enthält | |
| DE1817107A1 (de) | Lichtempfindliches Material fuer die Herstellung einer Mehrmetall-Offsetdruckplatte | |
| DE3831290A1 (de) | Lichtempfindliches material und verfahren zur bildbildung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |