DE2145320A1 - Substituierte Benzopyranderivate, Verfahren zu ihrer Herstellung sowie solche Benzopyranderivate enthaltende pharmazeutische Präparate - Google Patents
Substituierte Benzopyranderivate, Verfahren zu ihrer Herstellung sowie solche Benzopyranderivate enthaltende pharmazeutische PräparateInfo
- Publication number
- DE2145320A1 DE2145320A1 DE19712145320 DE2145320A DE2145320A1 DE 2145320 A1 DE2145320 A1 DE 2145320A1 DE 19712145320 DE19712145320 DE 19712145320 DE 2145320 A DE2145320 A DE 2145320A DE 2145320 A1 DE2145320 A1 DE 2145320A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- dimethyl
- group
- chromen
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 31
- 150000001562 benzopyrans Chemical class 0.000 title claims description 12
- 239000000825 pharmaceutical preparation Substances 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 90
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 54
- 150000003839 salts Chemical class 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 125000001931 aliphatic group Chemical group 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001033 ether group Chemical group 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001204 N-oxides Chemical class 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 75
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 56
- -1 2-octyl Chemical group 0.000 description 39
- 238000001953 recrystallisation Methods 0.000 description 34
- 229910000033 sodium borohydride Inorganic materials 0.000 description 20
- 239000012279 sodium borohydride Substances 0.000 description 20
- 239000000203 mixture Substances 0.000 description 17
- 238000010626 work up procedure Methods 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000003480 eluent Substances 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 5
- 150000002170 ethers Chemical class 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- GLWHCXRACKOPRO-UHFFFAOYSA-M 1-benzylpyridin-1-ium;bromide Chemical class [Br-].C=1C=CC=C[N+]=1CC1=CC=CC=C1 GLWHCXRACKOPRO-UHFFFAOYSA-M 0.000 description 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 4
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 229960000956 coumarin Drugs 0.000 description 4
- 235000001671 coumarin Nutrition 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 230000003276 anti-hypertensive effect Effects 0.000 description 3
- 229940030600 antihypertensive agent Drugs 0.000 description 3
- 239000002220 antihypertensive agent Substances 0.000 description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 3
- 229940073608 benzyl chloride Drugs 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- MCDZAXCSYDQTAB-UHFFFAOYSA-N chromenol Natural products CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C)Oc2ccc(O)cc2C=C1)C)C)C)C)C)C MCDZAXCSYDQTAB-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XUGUKMIWGIQSJB-UHFFFAOYSA-M 1-(2-phenylethyl)pyridin-1-ium;bromide Chemical class [Br-].C=1C=CC=CC=1CC[N+]1=CC=CC=C1 XUGUKMIWGIQSJB-UHFFFAOYSA-M 0.000 description 2
- GNPSDJOWGWWXSS-UHFFFAOYSA-M 1-benzylpyridin-1-ium;chloride Chemical class [Cl-].C=1C=CC=C[N+]=1CC1=CC=CC=C1 GNPSDJOWGWWXSS-UHFFFAOYSA-M 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- UNVNVCMGCFNMQD-UHFFFAOYSA-N 2h-chromen-5-ol Chemical compound O1CC=CC2=C1C=CC=C2O UNVNVCMGCFNMQD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004775 coumarins Chemical class 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 2
- PCJNYGPKMQQCPX-UHFFFAOYSA-N ethyl 3-oxo-3-pyridin-4-ylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=NC=C1 PCJNYGPKMQQCPX-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000005942 tetrahydropyridyl group Chemical group 0.000 description 2
- GRZXIBFEOLYART-UHFFFAOYSA-M 1-benzhydrylpyridin-1-ium;chloride Chemical class [Cl-].C1=CC=CC=C1C([N+]=1C=CC=CC=1)C1=CC=CC=C1 GRZXIBFEOLYART-UHFFFAOYSA-M 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- ABFDKXBSQCTIKH-UHFFFAOYSA-M 1-ethylpyridin-1-ium;bromide Chemical class [Br-].CC[N+]1=CC=CC=C1 ABFDKXBSQCTIKH-UHFFFAOYSA-M 0.000 description 1
- HLNJFEXZDGURGZ-UHFFFAOYSA-M 1-methylpyridin-1-ium;iodide Chemical class [I-].C[N+]1=CC=CC=C1 HLNJFEXZDGURGZ-UHFFFAOYSA-M 0.000 description 1
- ZORDDOAHFBBJHY-UHFFFAOYSA-N 2,2,7-trimethyl-4-pyridin-4-ylchromen-5-ol Chemical compound N1=CC=C(C=C1)C1=CC(OC=2C=C(C=C(C12)O)C)(C)C ZORDDOAHFBBJHY-UHFFFAOYSA-N 0.000 description 1
- BTHVFYRQUYYELD-UHFFFAOYSA-N 2,2-dimethyl-4-pyridin-4-ylchromen-5-ol Chemical compound CC1(C)OC2=CC=CC(O)=C2C(=C1)C1=CC=NC=C1 BTHVFYRQUYYELD-UHFFFAOYSA-N 0.000 description 1
- YHUDSHIRWOVVCV-UHFFFAOYSA-N 2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-ol Chemical compound C=1C(C)(C)OC2=CC(C(C)C(C)CCCCC)=CC(O)=C2C=1C1=CC=NC=C1 YHUDSHIRWOVVCV-UHFFFAOYSA-N 0.000 description 1
- UJRMEIJVOPHCGQ-UHFFFAOYSA-N 2-(diethylamino)butanal Chemical compound CCC(C=O)N(CC)CC UJRMEIJVOPHCGQ-UHFFFAOYSA-N 0.000 description 1
- YHZCTZGJKHNVQY-UHFFFAOYSA-N 2-(diethylazaniumyl)propanoate Chemical compound CCN(CC)C(C)C(O)=O YHZCTZGJKHNVQY-UHFFFAOYSA-N 0.000 description 1
- MELCWEWUZODSIS-UHFFFAOYSA-N 2-[2-(diethylamino)ethoxy]-n,n-diethylethanamine Chemical group CCN(CC)CCOCCN(CC)CC MELCWEWUZODSIS-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- JGFUFQSXEHUHTN-UHFFFAOYSA-N 4-(1-benzyl-3,6-dihydro-2h-pyridin-4-yl)-2,2,7-trimethylchromen-5-ol Chemical compound C=1C(C)(C)OC2=CC(C)=CC(O)=C2C=1C(CC1)=CCN1CC1=CC=CC=C1 JGFUFQSXEHUHTN-UHFFFAOYSA-N 0.000 description 1
- JOZMGUQZTOWLAS-UHFFFAOYSA-N 5-butylbenzene-1,3-diol Chemical compound CCCCC1=CC(O)=CC(O)=C1 JOZMGUQZTOWLAS-UHFFFAOYSA-N 0.000 description 1
- XECRVULUEJSGBY-UHFFFAOYSA-N 5-hexylbenzene-1,3-diol Chemical compound CCCCCCC1=CC(O)=CC(O)=C1 XECRVULUEJSGBY-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical class COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- ZDVDCDLBOLSVGM-UHFFFAOYSA-N [chloro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)C1=CC=CC=C1 ZDVDCDLBOLSVGM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000005792 cardiovascular activity Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- NBEMQPLNBYYUAZ-UHFFFAOYSA-N ethyl acetate;propan-2-one Chemical compound CC(C)=O.CCOC(C)=O NBEMQPLNBYYUAZ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- GVLGAFRNYJVHBC-UHFFFAOYSA-N hydrate;hydrobromide Chemical compound O.Br GVLGAFRNYJVHBC-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- KXAVXHYIOCQWIB-UHFFFAOYSA-N n-(dimethylaminooxy)-n-methylmethanamine Chemical compound CN(C)ON(C)C KXAVXHYIOCQWIB-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000007344 nucleophilic reaction Methods 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 150000007519 polyprotic acids Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7221770A | 1970-09-14 | 1970-09-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2145320A1 true DE2145320A1 (de) | 1972-03-16 |
Family
ID=22106286
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712145320 Pending DE2145320A1 (de) | 1970-09-14 | 1971-09-10 | Substituierte Benzopyranderivate, Verfahren zu ihrer Herstellung sowie solche Benzopyranderivate enthaltende pharmazeutische Präparate |
Country Status (14)
| Country | Link |
|---|---|
| AT (1) | AT308108B (cs) |
| BE (1) | BE772492A (cs) |
| CA (1) | CA965421A (cs) |
| CH (1) | CH559209A5 (cs) |
| DE (1) | DE2145320A1 (cs) |
| DK (1) | DK135994B (cs) |
| ES (1) | ES394980A1 (cs) |
| FR (1) | FR2106490B1 (cs) |
| GB (1) | GB1360009A (cs) |
| IE (1) | IE35636B1 (cs) |
| NL (1) | NL7112521A (cs) |
| NO (1) | NO134743C (cs) |
| SE (1) | SE372943B (cs) |
| ZA (1) | ZA716039B (cs) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4995978A (cs) * | 1973-01-24 | 1974-09-11 |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3960880A (en) * | 1974-03-26 | 1976-06-01 | Beecham Group Limited | Tetrahydropyrid-4-yl-chroman-5-ol derivatives |
| GB1417745A (en) * | 1973-07-07 | 1975-12-17 | Beecham Group Ltd | Chromene compounds |
-
1971
- 1971-09-09 ZA ZA716039A patent/ZA716039B/xx unknown
- 1971-09-09 GB GB4206671A patent/GB1360009A/en not_active Expired
- 1971-09-10 SE SE7111539A patent/SE372943B/xx unknown
- 1971-09-10 NL NL7112521A patent/NL7112521A/xx not_active Application Discontinuation
- 1971-09-10 IE IE1154/71A patent/IE35636B1/xx unknown
- 1971-09-10 CH CH1332671A patent/CH559209A5/xx not_active IP Right Cessation
- 1971-09-10 FR FR7132675A patent/FR2106490B1/fr not_active Expired
- 1971-09-10 ES ES394980A patent/ES394980A1/es not_active Expired
- 1971-09-10 DK DK446771AA patent/DK135994B/da unknown
- 1971-09-10 NO NO3374/71A patent/NO134743C/no unknown
- 1971-09-10 CA CA122,575A patent/CA965421A/en not_active Expired
- 1971-09-10 BE BE772492A patent/BE772492A/xx unknown
- 1971-09-10 AT AT787271A patent/AT308108B/de not_active IP Right Cessation
- 1971-09-10 DE DE19712145320 patent/DE2145320A1/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4995978A (cs) * | 1973-01-24 | 1974-09-11 |
Also Published As
| Publication number | Publication date |
|---|---|
| SE372943B (cs) | 1975-01-20 |
| GB1360009A (en) | 1974-07-17 |
| AT308108B (de) | 1973-06-25 |
| ZA716039B (en) | 1972-07-26 |
| FR2106490B1 (cs) | 1975-04-18 |
| IE35636B1 (en) | 1976-04-14 |
| CA965421A (en) | 1975-04-01 |
| IE35636L (en) | 1972-03-14 |
| BE772492A (fr) | 1972-03-10 |
| NO134743C (cs) | 1976-12-08 |
| ES394980A1 (es) | 1974-12-01 |
| DK135994B (da) | 1977-07-25 |
| NO134743B (cs) | 1976-08-30 |
| DK135994C (cs) | 1977-12-27 |
| FR2106490A1 (cs) | 1972-05-05 |
| NL7112521A (cs) | 1972-03-16 |
| AU3336571A (en) | 1973-03-15 |
| CH559209A5 (cs) | 1975-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2058295C3 (de) | Xanthen-9-on-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2527993A1 (de) | Quaternaere ammoniumsalze und deren verwendung | |
| DE2065636A1 (de) | Neue tricyclische verbindungen | |
| DE2940833C2 (cs) | ||
| DE2122643A1 (de) | 5-Chromenolester oder -äther, Verfahren zu ihrer Herstellung und Arzneipräparate | |
| DE2458638C2 (de) | 4'-substituierte 2-Methyl-3-piperidinopropiophenonderivate, Verfahren zu deren Herstellung und pharmakologische Zubereitungen, welche diese enthalten | |
| DE60217934T2 (de) | Verfahren zur herstellung von desloratadin | |
| DE2549568C3 (de) | 2,6-Dimethyl-3-methoxycarbonyl-4- (2'-nitrophenyl)-1,4-dihydropyridin-5- carbonsäureisobutylester, mehrere Verfahren zu seiner Herstellung sowie ihn enthaltende Arzneimittel | |
| DE2145320A1 (de) | Substituierte Benzopyranderivate, Verfahren zu ihrer Herstellung sowie solche Benzopyranderivate enthaltende pharmazeutische Präparate | |
| DE2364685A1 (de) | Phenoxyalkylamine und verfahren zu ihrer herstellung | |
| DE2404946C3 (de) | Verfahren zur Herstellung von 7alpha-Acylthio-Steroidspirolactonen | |
| DE2456098C3 (de) | Xanthen- und Thioxanthen-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1962442C3 (de) | 2-Benzoylalkylbenzomorphane, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE1922280C3 (de) | l-Methyl-5-(3'-dimethylaminopropyliden)-5Hdibenzo [a,d] -cyelohepten-N- oxid und dessen Säureadditionssalze, sowie Verfahren zu deren Herstellung und diese Verbindungen enthaltende Präparate | |
| DE2135521A1 (de) | Neue Esterdenvate des Pyndylben zopyrans, Verfahren zu ihrer Herstellung sowie ihre Verwendung in pharmazeutischen Präparaten | |
| DE1695914C3 (de) | Verfahren zur Herstellung von 1 Di alkylaminoathyl 2 methyl 3 aryl 4 oxo 1,2,3,4 tetrahydrochinazolinen | |
| DE2247828A1 (de) | Sulfamoyl-anthranilsaeuren und verfahren zu ihrer herstellung | |
| DE2021747A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| DE2614836A1 (de) | Neue chromonverbindungen, verfahren zu ihrer herstellung und sie enthaltende arzneimittelzubereitungen | |
| DE1543744C3 (de) | 3-Alkylflavanone und Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| AT274248B (de) | Verfahren zur Herstellung neuer Derivate von Bufadienolidglykosiden | |
| DE1493567C3 (de) | Ester von alpha-Alkylthyroxinderivaten und Verfahren zu ihrer Herstellung | |
| DE1445518C (de) | 1 (3 Chlorallyl) piperidine und Ver fahren zu deren Herstellung | |
| DE1545746C (de) | 2 eckige Klammer auf 2 (5 Nitro 2 furyl) vinyl eckige Klammer zu pyridine und Verfahren zu deren Herstellung | |
| AT368494B (de) | Verfahren zur herstellung von neuen nitrosubstituierten 1,4-dihydropyridinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OHN | Withdrawal |