DE2136571C2 - Phenyl-2-pyrrolidinone, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel - Google Patents
Phenyl-2-pyrrolidinone, Verfahren zu ihrer Herstellung und diese enthaltende ArzneimittelInfo
- Publication number
- DE2136571C2 DE2136571C2 DE2136571A DE2136571A DE2136571C2 DE 2136571 C2 DE2136571 C2 DE 2136571C2 DE 2136571 A DE2136571 A DE 2136571A DE 2136571 A DE2136571 A DE 2136571A DE 2136571 C2 DE2136571 C2 DE 2136571C2
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- pyrrolidinone
- chlorophenyl
- general formula
- same meaning
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- JMVIVASFFKKFQK-UHFFFAOYSA-N 1-phenylpyrrolidin-2-one Chemical class O=C1CCCN1C1=CC=CC=C1 JMVIVASFFKKFQK-UHFFFAOYSA-N 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 3
- 230000008569 process Effects 0.000 title claims description 3
- 239000003814 drug Substances 0.000 title 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 claims description 12
- -1 alkyl 4-aminobutyrate Chemical compound 0.000 claims description 10
- 125000005907 alkyl ester group Chemical group 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 238000011065 in-situ storage Methods 0.000 claims description 9
- UCFURURGGMKGCC-UHFFFAOYSA-N 4-(4-chlorophenyl)-3-phenylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 UCFURURGGMKGCC-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 229960003692 gamma aminobutyric acid Drugs 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 claims description 4
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- AKNFFBJZEBREQB-UHFFFAOYSA-N 4-(4-chlorophenyl)-3-methylpyrrolidin-2-one Chemical compound C1NC(=O)C(C)C1C1=CC=C(Cl)C=C1 AKNFFBJZEBREQB-UHFFFAOYSA-N 0.000 claims description 3
- SDVNHWAFTHMIQR-UHFFFAOYSA-N 4-(4-fluorophenyl)-3-phenylpyrrolidin-2-one Chemical compound C1=CC(F)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 SDVNHWAFTHMIQR-UHFFFAOYSA-N 0.000 claims description 3
- IOMOVAPYJQVJDK-UHFFFAOYSA-N 1-(4-aminophenyl)pyrrolidin-2-one Chemical compound C1=CC(N)=CC=C1N1C(=O)CCC1 IOMOVAPYJQVJDK-UHFFFAOYSA-N 0.000 claims description 2
- BXYQHDXDCJQOFD-UHFFFAOYSA-N 3-cyanopropanoic acid Chemical compound OC(=O)CCC#N BXYQHDXDCJQOFD-UHFFFAOYSA-N 0.000 claims description 2
- SUFKNMKUIYHURJ-UHFFFAOYSA-N 4-nitrobutanoic acid Chemical compound OC(=O)CCC[N+]([O-])=O SUFKNMKUIYHURJ-UHFFFAOYSA-N 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 238000006114 decarboxylation reaction Methods 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000002585 base Substances 0.000 claims 1
- 239000001582 butter acid Substances 0.000 claims 1
- 229910017464 nitrogen compound Inorganic materials 0.000 claims 1
- 150000002830 nitrogen compounds Chemical class 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 84
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 41
- 239000000203 mixture Substances 0.000 description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 238000011287 therapeutic dose Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 230000035939 shock Effects 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 5
- 229910000564 Raney nickel Inorganic materials 0.000 description 5
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- ANTSCNMPPGJYLG-UHFFFAOYSA-N chlordiazepoxide Chemical compound O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 ANTSCNMPPGJYLG-UHFFFAOYSA-N 0.000 description 5
- 229960004782 chlordiazepoxide Drugs 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 150000003385 sodium Chemical class 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000000949 anxiolytic effect Effects 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- UVBRSVOWDMKKEA-UHFFFAOYSA-N 4-(4-aminophenyl)-3-methylpyrrolidin-2-one Chemical compound C1NC(=O)C(C)C1C1=CC=C(N)C=C1 UVBRSVOWDMKKEA-UHFFFAOYSA-N 0.000 description 3
- SBTIQUODTCRTSV-UHFFFAOYSA-N 4-(4-chlorophenyl)-1-methyl-3-phenylpyrrolidin-2-one Chemical compound O=C1N(C)CC(C=2C=CC(Cl)=CC=2)C1C1=CC=CC=C1 SBTIQUODTCRTSV-UHFFFAOYSA-N 0.000 description 3
- 206010003591 Ataxia Diseases 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002249 anxiolytic agent Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000007912 intraperitoneal administration Methods 0.000 description 3
- 238000006396 nitration reaction Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- KECBOARJOOAZSP-UHFFFAOYSA-N 3-(2-chlorophenyl)-4-(4-chlorophenyl)pyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(C=2C(=CC=CC=2)Cl)C(=O)NC1 KECBOARJOOAZSP-UHFFFAOYSA-N 0.000 description 2
- RSDNYMNFOFESRE-UHFFFAOYSA-N 4-(2,4-dimethylphenyl)-2-methyl-4-oxobutanoic acid Chemical compound OC(=O)C(C)CC(=O)C1=CC=C(C)C=C1C RSDNYMNFOFESRE-UHFFFAOYSA-N 0.000 description 2
- PPIQXRKSDLUXBV-UHFFFAOYSA-N 4-(4-chlorophenyl)-1-cyclopentyl-3-phenylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(C=2C=CC=CC=2)C(=O)N(C2CCCC2)C1 PPIQXRKSDLUXBV-UHFFFAOYSA-N 0.000 description 2
- NWDHDAMENJOGCF-UHFFFAOYSA-N 4-(4-chlorophenyl)-4-phenylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1(C=2C=CC=CC=2)CC(=O)NC1 NWDHDAMENJOGCF-UHFFFAOYSA-N 0.000 description 2
- ZSLUNSAWUBLQEU-UHFFFAOYSA-N 4-(4-chlorophenyl)-5-methylpyrrolidin-2-one Chemical compound CC1NC(=O)CC1C1=CC=C(Cl)C=C1 ZSLUNSAWUBLQEU-UHFFFAOYSA-N 0.000 description 2
- ZARAHWGKXSGKCL-UHFFFAOYSA-N 4-(4-chlorophenyl)-5-phenylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(C=2C=CC=CC=2)NC(=O)C1 ZARAHWGKXSGKCL-UHFFFAOYSA-N 0.000 description 2
- SWBIFAFSOYNKLZ-UHFFFAOYSA-N 4-(4-fluorophenyl)-3-methylpyrrolidin-2-one Chemical compound C1NC(=O)C(C)C1C1=CC=C(F)C=C1 SWBIFAFSOYNKLZ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 238000000297 Sandmeyer reaction Methods 0.000 description 2
- 239000002262 Schiff base Substances 0.000 description 2
- 150000004753 Schiff bases Chemical class 0.000 description 2
- 241000011102 Thera Species 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- MHZFMMSRIDAQIB-VMPITWQZSA-N ethyl (e)-3-(4-chlorophenyl)prop-2-enoate Chemical compound CCOC(=O)\C=C\C1=CC=C(Cl)C=C1 MHZFMMSRIDAQIB-VMPITWQZSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 231100000189 neurotoxic Toxicity 0.000 description 2
- 230000002887 neurotoxic effect Effects 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000010825 rotarod performance test Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- YYYMDBUHBOEDTC-UHFFFAOYSA-N 1-(4-nitrophenyl)pyrrolidin-2-one Chemical class C1=CC([N+](=O)[O-])=CC=C1N1C(=O)CCC1 YYYMDBUHBOEDTC-UHFFFAOYSA-N 0.000 description 1
- GFTNVIGZGQGHDP-UHFFFAOYSA-N 1-benzyl-4-(4-chlorophenyl)-3-phenylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(C=2C=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)C1 GFTNVIGZGQGHDP-UHFFFAOYSA-N 0.000 description 1
- FGLBSLMDCBOPQK-UHFFFAOYSA-N 2-nitropropane Chemical compound CC(C)[N+]([O-])=O FGLBSLMDCBOPQK-UHFFFAOYSA-N 0.000 description 1
- LQXDJXZIHRGXPS-UHFFFAOYSA-N 3-(4-chlorophenyl)-4-phenylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(=O)NCC1C1=CC=CC=C1 LQXDJXZIHRGXPS-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- YRVIJUAJJQDMCG-UHFFFAOYSA-N 3-methyl-4-phenylpyrrolidin-2-one Chemical compound C1NC(=O)C(C)C1C1=CC=CC=C1 YRVIJUAJJQDMCG-UHFFFAOYSA-N 0.000 description 1
- BNWOFLCLCRHUTF-UHFFFAOYSA-N 3-phenylpyrrolidin-2-one Chemical compound O=C1NCCC1C1=CC=CC=C1 BNWOFLCLCRHUTF-UHFFFAOYSA-N 0.000 description 1
- AXKWQHHRWNPPGK-UHFFFAOYSA-N 4-(2-chlorophenyl)-3-phenylpyrrolidin-2-one Chemical compound ClC1=CC=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 AXKWQHHRWNPPGK-UHFFFAOYSA-N 0.000 description 1
- UXGIXJLEBICYQD-UHFFFAOYSA-N 4-(3-chlorophenyl)-3-phenylpyrrolidin-2-one Chemical compound ClC1=CC=CC(C2C(C(=O)NC2)C=2C=CC=CC=2)=C1 UXGIXJLEBICYQD-UHFFFAOYSA-N 0.000 description 1
- ZZHGJFSYYCLGTL-UHFFFAOYSA-N 4-(3-fluorophenyl)-3-phenylpyrrolidin-2-one Chemical compound FC1=CC=CC(C2C(C(=O)NC2)C=2C=CC=CC=2)=C1 ZZHGJFSYYCLGTL-UHFFFAOYSA-N 0.000 description 1
- AOSFHVGNNILIJS-UHFFFAOYSA-N 4-(4-bromophenyl)-3-methylpyrrolidin-2-one Chemical compound C1NC(=O)C(C)C1C1=CC=C(Br)C=C1 AOSFHVGNNILIJS-UHFFFAOYSA-N 0.000 description 1
- VOWSRSMEEKXWPO-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-oxo-5-phenylpyrrolidine-3-carboxylic acid Chemical compound N1C(=O)C(C(=O)O)C(C=2C=CC(Cl)=CC=2)C1C1=CC=CC=C1 VOWSRSMEEKXWPO-UHFFFAOYSA-N 0.000 description 1
- SXPVSKHWEMHONA-UHFFFAOYSA-N 4-(4-chlorophenyl)-3-ethylpyrrolidin-2-one Chemical compound C1NC(=O)C(CC)C1C1=CC=C(Cl)C=C1 SXPVSKHWEMHONA-UHFFFAOYSA-N 0.000 description 1
- WKKBVTLOYSTYAZ-UHFFFAOYSA-N 4-(4-chlorophenyl)-3-phenyl-1-prop-2-ynylpyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1C(C=2C=CC=CC=2)C(=O)N(CC#C)C1 WKKBVTLOYSTYAZ-UHFFFAOYSA-N 0.000 description 1
- DAXOYKWNODTNBB-UHFFFAOYSA-N 4-(4-chlorophenyl)-4-methyl-3-phenylpyrrolidin-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C)CNC(=O)C1C1=CC=CC=C1 DAXOYKWNODTNBB-UHFFFAOYSA-N 0.000 description 1
- WKMZKZNJUHYDBF-UHFFFAOYSA-N 4-(4-chlorophenyl)-5,5-dimethylpyrrolidin-2-one Chemical compound CC1(C)NC(=O)CC1C1=CC=C(Cl)C=C1 WKMZKZNJUHYDBF-UHFFFAOYSA-N 0.000 description 1
- WBEOHHMLXHODRK-UHFFFAOYSA-N 4-(4-chlorophenyl)-5-ethyl-3-phenylpyrrolidin-2-one Chemical compound CCC1NC(=O)C(C=2C=CC=CC=2)C1C1=CC=C(Cl)C=C1 WBEOHHMLXHODRK-UHFFFAOYSA-N 0.000 description 1
- IVYMIRMKXZAHRV-UHFFFAOYSA-N 4-chlorophenylacetonitrile Chemical compound ClC1=CC=C(CC#N)C=C1 IVYMIRMKXZAHRV-UHFFFAOYSA-N 0.000 description 1
- BUCORZSTKDOEKQ-UHFFFAOYSA-N 7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine Chemical compound C=12C=C(Cl)C=CC2=NC(=NC)CN(O)C=1C1=CC=CC=C1 BUCORZSTKDOEKQ-UHFFFAOYSA-N 0.000 description 1
- 206010002660 Anoxia Diseases 0.000 description 1
- 241000976983 Anoxia Species 0.000 description 1
- LHTNAPYEMAQTHY-UHFFFAOYSA-N CC1=C(C=CC(=C1)C)C1CC(C(N1)=O)C Chemical compound CC1=C(C=CC(=C1)C)C1CC(C(N1)=O)C LHTNAPYEMAQTHY-UHFFFAOYSA-N 0.000 description 1
- 206010058842 Cerebrovascular insufficiency Diseases 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- KFAUTPDTSLQZBS-UHFFFAOYSA-N ClC1=CC=C(C=C1)C(CC(=O)OCC)C(C)([N+](=O)[O-])C Chemical compound ClC1=CC=C(C=C1)C(CC(=O)OCC)C(C)([N+](=O)[O-])C KFAUTPDTSLQZBS-UHFFFAOYSA-N 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- OBMQTXZOWBACKO-UHFFFAOYSA-N NC(CC(C(=O)O)C)C1=C(C=C(C=C1)C)C Chemical compound NC(CC(C(=O)O)C)C1=C(C=C(C=C1)C)C OBMQTXZOWBACKO-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000007673 Origanum vulgare Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000007953 anoxia Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N benzyl-alpha-carboxylic acid Natural products OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229960003369 butacaine Drugs 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 description 1
- HMWQPUXBOXLRFQ-UHFFFAOYSA-N ethyl 2-(2-chlorophenyl)-3-(4-chlorophenyl)-3-cyanopropanoate Chemical compound C=1C=CC=C(Cl)C=1C(C(=O)OCC)C(C#N)C1=CC=C(Cl)C=C1 HMWQPUXBOXLRFQ-UHFFFAOYSA-N 0.000 description 1
- SULYAUOQFUABKE-UHFFFAOYSA-N ethyl 2-(4-chlorophenyl)pent-4-enoate Chemical compound CCOC(=O)C(CC=C)C1=CC=C(Cl)C=C1 SULYAUOQFUABKE-UHFFFAOYSA-N 0.000 description 1
- BKTKLDMYHTUESO-UHFFFAOYSA-N ethyl 2-bromo-2-phenylacetate Chemical compound CCOC(=O)C(Br)C1=CC=CC=C1 BKTKLDMYHTUESO-UHFFFAOYSA-N 0.000 description 1
- CLLUFLLBRNCOLB-UHFFFAOYSA-N ethyl 2-phenylbutanoate Chemical compound CCOC(=O)C(CC)C1=CC=CC=C1 CLLUFLLBRNCOLB-UHFFFAOYSA-N 0.000 description 1
- SEQCOERBKGIFMR-UHFFFAOYSA-N ethyl 3-(3-chlorophenyl)-3-cyano-2-phenylpropanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(C#N)C1=CC=CC(Cl)=C1 SEQCOERBKGIFMR-UHFFFAOYSA-N 0.000 description 1
- LJQMBZHQVCOYKP-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-3-cyano-2-phenylpropanoate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)C(C#N)C1=CC=C(Cl)C=C1 LJQMBZHQVCOYKP-UHFFFAOYSA-N 0.000 description 1
- TZCJWZDCNUGDDN-UHFFFAOYSA-N ethyl 4-amino-3-(4-chlorophenyl)pentanoate Chemical compound CCOC(=O)CC(C(C)N)C1=CC=C(Cl)C=C1 TZCJWZDCNUGDDN-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000010575 fractional recrystallization Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 229950009215 phenylbutanoic acid Drugs 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 231100000816 toxic dose Toxicity 0.000 description 1
- 230000008733 trauma Effects 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003953 γ-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/267—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3594870 | 1970-07-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2136571A1 DE2136571A1 (de) | 1972-01-27 |
| DE2136571C2 true DE2136571C2 (de) | 1982-03-25 |
Family
ID=10383283
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2136571A Expired DE2136571C2 (de) | 1970-07-24 | 1971-07-22 | Phenyl-2-pyrrolidinone, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
Country Status (26)
| Country | Link |
|---|---|
| JP (1) | JPS5417734B1 (show.php) |
| AT (2) | AT304530B (show.php) |
| AU (1) | AU461836B2 (show.php) |
| BE (1) | BE770308A (show.php) |
| BG (2) | BG21025A3 (show.php) |
| CA (1) | CA954870A (show.php) |
| CH (2) | CH537921A (show.php) |
| CS (2) | CS174849B2 (show.php) |
| DE (1) | DE2136571C2 (show.php) |
| DK (1) | DK135584B (show.php) |
| ES (1) | ES393496A1 (show.php) |
| FI (1) | FI55184C (show.php) |
| FR (1) | FR2100946B1 (show.php) |
| GB (1) | GB1350582A (show.php) |
| HU (1) | HU162344B (show.php) |
| IL (1) | IL37147A (show.php) |
| IN (1) | IN132195B (show.php) |
| IT (1) | IT1046928B (show.php) |
| MY (1) | MY7500123A (show.php) |
| NL (1) | NL7109930A (show.php) |
| PL (1) | PL82184B1 (show.php) |
| RO (2) | RO61127A (show.php) |
| SE (1) | SE379347B (show.php) |
| SU (2) | SU488410A3 (show.php) |
| YU (1) | YU34671B (show.php) |
| ZA (1) | ZA714911B (show.php) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2413935A1 (de) * | 1974-03-20 | 1975-10-16 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone |
| NL7412694A (nl) * | 1974-09-26 | 1976-03-30 | Stamicarbon | Werkwijze voor de bereiding van een pyrrolidon- -2. |
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| AU518986B2 (en) * | 1977-10-11 | 1981-10-29 | Takeda Chemical Industries Ltd. | Lactams |
| IL57266A (en) | 1978-06-12 | 1982-12-31 | Mundipharma Ag | Production of pyrrolidin-2-ones and of 3-pyrrolin-2-ones |
| US4548947A (en) * | 1984-05-07 | 1985-10-22 | Warner-Lambert Company | 1-(Substituted-aryl)-dihydro-1H-pyrrolizine-3,5-[2H,6H-]diones and use for reversing amnesia |
| DE3823299A1 (de) * | 1988-07-07 | 1990-01-11 | Schering Ag | Substituierte phenyl-pyrrolidin-2-one, -oxazolidin-2-one und -imidazolidin-2-one, ihre herstellung sowie verwendung in arzneimitteln |
| YU162789A (en) * | 1988-09-01 | 1990-12-31 | Lonza Ag | 2-aza-4-(alcoxycarbonyl) spiro/4,5/decan-3-ones |
| JP2833817B2 (ja) * | 1989-03-15 | 1998-12-09 | 三井化学株式会社 | 4―エチル―3―(置換フェニル)―1―(3―トリフルオロメチルフェニル)―2―ピロリジノン誘導体、その製造法およびこれらを有効成分とする除草剤 |
| PT100441A (pt) * | 1991-05-02 | 1993-09-30 | Smithkline Beecham Corp | Pirrolidinonas, seu processo de preparacao, composicoes farmaceuticas que as contem e uso |
| WO1993007141A1 (en) * | 1991-10-11 | 1993-04-15 | Smithkline Beecham Corporation | Heterocyclic 3-phenylpyrrolidin-2-ones, their preparation and use for the manufacture of a medicament for inhibiting tumor necrosis factor production |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| RU2126392C1 (ru) * | 1993-11-19 | 1999-02-20 | Е.И.Дю Пон де Немурс энд Компани | Циклические амиды или их сельскохозяйственно пригодные соли, фунгицидная композиция, способ борьбы с болезнями растений, вызванными фитопатогенными грибами |
| US6022870A (en) * | 1998-01-14 | 2000-02-08 | E. I. Du Pont De Nemours And Company | Fungicidal cyclic amides |
| DE10205862A1 (de) * | 2002-02-13 | 2003-08-21 | Bayer Cropscience Ag | DELTA1-Pyrroline |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR67024E (fr) * | 1954-10-22 | 1957-11-04 | Anciens Ets Barbier | Appareil d'éclairage |
| US2984672A (en) * | 1958-05-14 | 1961-05-16 | Rohm & Haas | Method for the preparation of pyrrolinones |
-
1970
- 1970-07-24 GB GB3594870A patent/GB1350582A/en not_active Expired
-
1971
- 1971-06-24 IL IL37147A patent/IL37147A/xx unknown
- 1971-07-19 NL NL7109930A patent/NL7109930A/xx unknown
- 1971-07-20 FR FR7126784A patent/FR2100946B1/fr not_active Expired
- 1971-07-21 DK DK358071AA patent/DK135584B/da unknown
- 1971-07-21 RO RO67732A patent/RO61127A/ro unknown
- 1971-07-21 ES ES393496A patent/ES393496A1/es not_active Expired
- 1971-07-21 YU YU1921/71A patent/YU34671B/xx unknown
- 1971-07-21 CS CS6089A patent/CS174849B2/cs unknown
- 1971-07-21 RO RO7181864A patent/RO71354A/ro unknown
- 1971-07-21 HU HUUI178A patent/HU162344B/hu unknown
- 1971-07-21 CS CS5382A patent/CS174822B2/cs unknown
- 1971-07-21 FI FI2068/71A patent/FI55184C/fi active
- 1971-07-22 BE BE770308A patent/BE770308A/xx not_active IP Right Cessation
- 1971-07-22 DE DE2136571A patent/DE2136571C2/de not_active Expired
- 1971-07-22 IN IN132195A patent/IN132195B/en unknown
- 1971-07-22 CA CA118,906A patent/CA954870A/en not_active Expired
- 1971-07-22 BG BG018136A patent/BG21025A3/xx unknown
- 1971-07-22 BG BG019868A patent/BG20582A3/xx unknown
- 1971-07-22 JP JP5490271A patent/JPS5417734B1/ja active Pending
- 1971-07-22 IT IT51830/71A patent/IT1046928B/it active
- 1971-07-23 CH CH1016072A patent/CH537921A/fr not_active IP Right Cessation
- 1971-07-23 ZA ZA714911A patent/ZA714911B/xx unknown
- 1971-07-23 AT AT643071A patent/AT304530B/de not_active IP Right Cessation
- 1971-07-23 AT AT180572A patent/AT310150B/de not_active IP Right Cessation
- 1971-07-23 CH CH1085771A patent/CH538474A/fr not_active IP Right Cessation
- 1971-07-23 SE SE7109515A patent/SE379347B/xx unknown
- 1971-07-23 PL PL1971149583A patent/PL82184B1/pl unknown
- 1971-07-23 AU AU31575/71A patent/AU461836B2/en not_active Expired
- 1971-07-23 SU SU1689301A patent/SU488410A3/ru active
- 1971-07-23 SU SU1891416A patent/SU479293A3/ru active
-
1975
- 1975-12-31 MY MY1975123A patent/MY7500123A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2136571C2 (de) | Phenyl-2-pyrrolidinone, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2733868C2 (de) | Neue 1,2,4,5-Tetrahydro-3H-2-benzazepin-3-one, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE69107250T2 (de) | Neue 4-Aminobuttersäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneizubereitungen. | |
| DE2047658C3 (de) | 2-Styryl- und 2-Phenyläthinylbenzylaminderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2851028A1 (de) | Neue indolo eckige klammer auf 2.3-a eckige klammer zu chinolizidine, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische zubereitung | |
| DE1620501A1 (de) | Neue Sydnonimin-Derivate und Verfahren zu ihrer Herstellung | |
| DE69116237T2 (de) | Derivate von Hexahydroazepine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2314636A1 (de) | Pharmakodynamisch aktive, basisch substituierte indanderivate | |
| DE1568277A1 (de) | Verfahren zur Herstellung von neuen,optisch aktiven Phenylisopylamin-Derivaten | |
| DE2044172C3 (de) | Pyrrolderivate, ein Verfahren zu ihrer Herstellung und Arzneimittel | |
| US3956314A (en) | Derivatives of 2-pyrrolidinone | |
| DE3300522C2 (show.php) | ||
| DE2833892C2 (de) | 12H-Dibenzo[d,g][1,3,6]dioxazocinderivate, solche enthaltende Arzneimittel und Verfahren zur Herstellung derselben | |
| DE2526966A1 (de) | Tricyclische alkylaminverbindungen, verfahren zu ihrer herstellung und sie enthaltende mittel | |
| DE2526965A1 (de) | Benzylamine, verfahren zu ihrer herstellung und diese verbindung enthaltende arzneimittel | |
| DE2834312C2 (de) | Verfahren zur Herstellung von 2[N-(2-Hydroxyäthyl)-N-niederalkylaminomethyl]-benzhydrolen | |
| DE2653477A1 (de) | Spiro eckige klammer auf cyclopropan- 1,2'-indolin eckige klammer zu -3'-one | |
| DE2513197A1 (de) | Cyclische verbindungen | |
| DE1203269B (de) | Verfahren zur Herstellung von Imidazolon-2-derivaten und ihren Salzen | |
| DE1643265C3 (de) | Kernsubstituierte 2-Aminomethylbenzhydrole, Verfahren zu deren Herstellung und Arzneimittel auf der Basis dieser Verbindungen | |
| EP0338435A1 (de) | 3.4-Dihydroxypyrrolidin-2-on-Derivate, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und ihre Verwendung sowie die bei der Herstellung anfallenden Zwischenprodukte | |
| DE3017815A1 (de) | Derivate des phenylcyclohexans mit antidepressiver wirkung | |
| DE2004818C3 (de) | Basisch substituierte Chinobenzazepine | |
| AT318557B (de) | Verfahren zur Herstellung von neuen 2-exo-Aminobornanen und von deren Säureadditionssalzen | |
| AT216003B (de) | Verfahren zur Herstellung von basisch substituierten Thiaxanthenen sowie von deren Säureadditionssalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |