DE2135770A1 - Polyamidmasse - Google Patents
PolyamidmasseInfo
- Publication number
- DE2135770A1 DE2135770A1 DE19712135770 DE2135770A DE2135770A1 DE 2135770 A1 DE2135770 A1 DE 2135770A1 DE 19712135770 DE19712135770 DE 19712135770 DE 2135770 A DE2135770 A DE 2135770A DE 2135770 A1 DE2135770 A1 DE 2135770A1
- Authority
- DE
- Germany
- Prior art keywords
- polyamide
- acid
- synthetic linear
- reaction product
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004952 Polyamide Substances 0.000 title claims description 56
- 229920002647 polyamide Polymers 0.000 title claims description 56
- 239000000203 mixture Substances 0.000 claims description 21
- 239000007795 chemical reaction product Substances 0.000 claims description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- -1 ether ester Chemical class 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 229920001281 polyalkylene Polymers 0.000 claims description 7
- 239000002216 antistatic agent Substances 0.000 claims 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 10
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 9
- 125000002947 alkylene group Chemical group 0.000 description 6
- 150000007519 polyprotic acids Polymers 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000001361 adipic acid Substances 0.000 description 5
- 235000011037 adipic acid Nutrition 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 229920002302 Nylon 6,6 Polymers 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- 239000005871 repellent Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 150000003951 lactams Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229960002684 aminocaproic acid Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229920001600 hydrophobic polymer Polymers 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- DPJRMOMPQZCRJU-UHFFFAOYSA-M thiamine hydrochloride Chemical compound Cl.[Cl-].CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N DPJRMOMPQZCRJU-UHFFFAOYSA-M 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L77/00—Compositions of polyamides obtained by reactions forming a carboxylic amide link in the main chain; Compositions of derivatives of such polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3480470 | 1970-07-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2135770A1 true DE2135770A1 (de) | 1972-01-20 |
Family
ID=10370131
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712135770 Pending DE2135770A1 (de) | 1970-07-17 | 1971-07-16 | Polyamidmasse |
Country Status (5)
| Country | Link |
|---|---|
| AU (1) | AU3073771A (enrdf_load_stackoverflow) |
| BE (1) | BE769828A (enrdf_load_stackoverflow) |
| DE (1) | DE2135770A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2099430A1 (enrdf_load_stackoverflow) |
| NL (1) | NL7109761A (enrdf_load_stackoverflow) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2315753A1 (de) * | 1972-03-30 | 1973-10-11 | Unilever Emery | Antistatisches mittel |
| DE2523991A1 (de) * | 1974-05-31 | 1975-12-18 | Ato Chimie | Verfahren zur herstellung von polyaether-ester-amid-blockmischpolymerisaten als verformbare oder extrudierbare produkte |
| DE2527885A1 (de) * | 1974-06-24 | 1976-01-15 | Monsanto Co | Verfahren zur herstellung von terpolymerisaten |
| DE2712987A1 (de) * | 1977-03-24 | 1978-10-05 | Huels Chemische Werke Ag | Verfahren zur herstellung von polyetheresteramiden mit statistisch in der polymerkette verteilten einheiten der ausgangskomponenten |
| US4345064A (en) * | 1979-09-13 | 1982-08-17 | Chemische Werke Huls Ag | Preparation of polyether ester amides |
| US4349661A (en) * | 1979-09-13 | 1982-09-14 | Chemische Werke Huls Ag | Preparation of polyether ester amides |
| EP0095893A3 (en) * | 1982-05-27 | 1984-08-22 | Toray Industries, Inc. | Polyamide elastomer |
-
1971
- 1971-07-02 AU AU30737/71A patent/AU3073771A/en not_active Expired
- 1971-07-09 BE BE769828A patent/BE769828A/xx unknown
- 1971-07-15 NL NL7109761A patent/NL7109761A/xx unknown
- 1971-07-16 DE DE19712135770 patent/DE2135770A1/de active Pending
- 1971-07-16 FR FR7126115A patent/FR2099430A1/fr active Granted
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2315753A1 (de) * | 1972-03-30 | 1973-10-11 | Unilever Emery | Antistatisches mittel |
| DE2523991A1 (de) * | 1974-05-31 | 1975-12-18 | Ato Chimie | Verfahren zur herstellung von polyaether-ester-amid-blockmischpolymerisaten als verformbare oder extrudierbare produkte |
| DE2527885A1 (de) * | 1974-06-24 | 1976-01-15 | Monsanto Co | Verfahren zur herstellung von terpolymerisaten |
| DE2712987A1 (de) * | 1977-03-24 | 1978-10-05 | Huels Chemische Werke Ag | Verfahren zur herstellung von polyetheresteramiden mit statistisch in der polymerkette verteilten einheiten der ausgangskomponenten |
| US4345064A (en) * | 1979-09-13 | 1982-08-17 | Chemische Werke Huls Ag | Preparation of polyether ester amides |
| US4349661A (en) * | 1979-09-13 | 1982-09-14 | Chemische Werke Huls Ag | Preparation of polyether ester amides |
| EP0095893A3 (en) * | 1982-05-27 | 1984-08-22 | Toray Industries, Inc. | Polyamide elastomer |
Also Published As
| Publication number | Publication date |
|---|---|
| AU3073771A (en) | 1973-01-04 |
| FR2099430B1 (enrdf_load_stackoverflow) | 1974-04-05 |
| FR2099430A1 (en) | 1972-03-17 |
| BE769828A (enrdf_load_stackoverflow) | 1972-01-10 |
| NL7109761A (enrdf_load_stackoverflow) | 1972-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1945111A1 (de) | Polyamidmasse | |
| DE1816163C3 (de) | Verwendung von in Wasser löslichen linearen Polyestern als Schlichtemittel | |
| DE2266030C3 (de) | Verwendung eines stickstoffhaltigen Polyäthers als antistatischer Zusatz in aus der Schmelze formbaren Polymermassen | |
| DE2315753A1 (de) | Antistatisches mittel | |
| DE2006810B2 (de) | Antistatische polyesterformmasse | |
| DE68920006T2 (de) | Weichspülmittel. | |
| EP1313787A1 (de) | Fliessfähige, amphiphile und nichtionische oligoester | |
| DE2135770A1 (de) | Polyamidmasse | |
| DE2615704A1 (de) | Zusammensetzungen zur behandlung von textilien | |
| EP1661933A1 (de) | Fließfähige, amphiphile und nichtionische Oligoester | |
| DE1046826B (de) | Verfahren zum Schmaelzen und Antistatischmachen von geformten Erzeugnissen, insbesondere Fasern oder Faeden, aus Acrylnitrilpolymerisaten | |
| CH682918A5 (de) | Polyätherester, Verfahren zu deren Herstellung und deren Verwendung. | |
| DE2019458A1 (de) | Synthetische Fasern mit dauerhaften antistatischen und hydrophilen Eigenschaften | |
| DE2134463C2 (de) | Antistatische thermoplastische Polyestermasse mit guter Beständigkeit gegen Verschmutzung | |
| DE2523270B2 (de) | Verfahren zur Behandlung von Keratinfasern | |
| DE2624159A1 (de) | Waermestabilisierte press- und formmassen auf der basis von polyalkylenterephthalatharzen | |
| DE2245335A1 (de) | Synthetische fasern und folien mit permanent antistatischen eigenschaften | |
| DE2048444B2 (de) | Antielektrostatische und anfaerbbare thermoplastische formmassen aus polyolefinen | |
| DE2246617C2 (de) | Polymere Masse auf der Basis eines Polyester-, Polyamid-, Polyolefin- oder Polyacrylnitrilgrundmaterials | |
| DE1669819C3 (de) | Antistatische thermoplastische Massen und Formteile | |
| DE1544887A1 (de) | Verfahren zur antistatischen Ausruestung hochmolekularer Verbindungen | |
| DE2239466C3 (de) | Polyestermasse mit dauerhaft antistatischen Eigenschaften | |
| DE1795263A1 (de) | Triazinderivate,Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1908809C3 (de) | Verfahren zur antistatischen Ausrüstung hochmolekularer Polymerer | |
| DE2311982B2 (de) | Verfahren zur Herstellung von homogenen modifizierten Polycaprolactamen und deren Verwendung für Fäden und Fasern |