DE2132504A1 - Verfahren zur Herstellung von eine Halogen-Carbonyl-Gruppe enthaltenden,neuen Penicillinderivaten - Google Patents
Verfahren zur Herstellung von eine Halogen-Carbonyl-Gruppe enthaltenden,neuen PenicillinderivatenInfo
- Publication number
- DE2132504A1 DE2132504A1 DE19712132504 DE2132504A DE2132504A1 DE 2132504 A1 DE2132504 A1 DE 2132504A1 DE 19712132504 DE19712132504 DE 19712132504 DE 2132504 A DE2132504 A DE 2132504A DE 2132504 A1 DE2132504 A1 DE 2132504A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- salts
- amino
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 27
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000002960 penicillins Chemical class 0.000 title description 4
- 229910052736 halogen Inorganic materials 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 32
- -1 carboxylic acid halides Chemical class 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 19
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000002723 alicyclic group Chemical group 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000007514 bases Chemical class 0.000 claims description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 83
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 30
- 239000011541 reaction mixture Substances 0.000 description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 5
- BGMIRDHBNWQSGE-UHFFFAOYSA-N hypochlorous acid;pyridine Chemical compound ClO.C1=CC=NC=C1 BGMIRDHBNWQSGE-UHFFFAOYSA-N 0.000 description 5
- DLTWEQZAWUHBDH-UHFFFAOYSA-N 2-phenylpropanedioyl dichloride Chemical compound ClC(=O)C(C(Cl)=O)C1=CC=CC=C1 DLTWEQZAWUHBDH-UHFFFAOYSA-N 0.000 description 4
- 125000004104 aryloxy group Chemical group 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Natural products N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229940056360 penicillin g Drugs 0.000 description 2
- 230000004043 responsiveness Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000005051 trimethylchlorosilane Substances 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- FFROVMUQYGYXBN-UHFFFAOYSA-N 2-(2-chlorophenyl)propanedioyl dichloride Chemical compound ClC1=C(C=CC=C1)C(C(=O)Cl)C(=O)Cl FFROVMUQYGYXBN-UHFFFAOYSA-N 0.000 description 1
- XBORLURSNSIVPI-UHFFFAOYSA-N 2-(4-chlorophenyl)propanedioyl dichloride Chemical compound ClC1=CC=C(C=C1)C(C(=O)Cl)C(=O)Cl XBORLURSNSIVPI-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ZQXDUKMRLYGEHT-UHFFFAOYSA-N ethene hydrochloride Chemical compound Cl.C=C.C=C ZQXDUKMRLYGEHT-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 238000003918 potentiometric titration Methods 0.000 description 1
- 238000009417 prefabrication Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Catalysts (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001006 | 1970-07-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2132504A1 true DE2132504A1 (de) | 1972-01-05 |
Family
ID=10994382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712132504 Pending DE2132504A1 (de) | 1970-07-03 | 1971-06-30 | Verfahren zur Herstellung von eine Halogen-Carbonyl-Gruppe enthaltenden,neuen Penicillinderivaten |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3846407A (https=) |
| AT (1) | AT310352B (https=) |
| BE (1) | BE769465A (https=) |
| CA (1) | CA984831A (https=) |
| CH (1) | CH562827A5 (https=) |
| DE (1) | DE2132504A1 (https=) |
| ES (1) | ES392823A1 (https=) |
| IL (1) | IL37124A (https=) |
| NL (1) | NL7109164A (https=) |
| PL (1) | PL83609B1 (https=) |
| SU (1) | SU471723A3 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2334343A1 (de) * | 1972-07-12 | 1974-01-31 | Pfizer | Verfahren zur herstellung von 6-eckige klammer auf alpha-(carboxy)arylacetamido eckige klammer zu- penicillansaeureestern |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1494902A (en) * | 1974-05-09 | 1977-12-14 | Glaxo Lab Ltd | Penicillins |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB959853A (en) * | 1962-02-28 | 1964-06-03 | Beecham Res Lab | Penicillins |
| US3478018A (en) * | 1967-10-02 | 1969-11-11 | American Home Prod | Process for producing alpha-amino penicillins |
| US3595855A (en) * | 1968-12-05 | 1971-07-27 | American Home Prod | Process for producing aminopenicillins |
-
1971
- 1971-06-22 IL IL37124A patent/IL37124A/en unknown
- 1971-06-30 DE DE19712132504 patent/DE2132504A1/de active Pending
- 1971-07-01 AT AT569871A patent/AT310352B/de not_active IP Right Cessation
- 1971-07-01 US US00159041A patent/US3846407A/en not_active Expired - Lifetime
- 1971-07-02 ES ES392823A patent/ES392823A1/es not_active Expired
- 1971-07-02 BE BE769465A patent/BE769465A/xx unknown
- 1971-07-02 SU SU1680492A patent/SU471723A3/ru active
- 1971-07-02 CA CA117,210A patent/CA984831A/en not_active Expired
- 1971-07-02 NL NL7109164A patent/NL7109164A/xx unknown
- 1971-07-02 CH CH979571A patent/CH562827A5/xx not_active IP Right Cessation
- 1971-07-03 PL PL1971149228A patent/PL83609B1/pl unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2334343A1 (de) * | 1972-07-12 | 1974-01-31 | Pfizer | Verfahren zur herstellung von 6-eckige klammer auf alpha-(carboxy)arylacetamido eckige klammer zu- penicillansaeureestern |
Also Published As
| Publication number | Publication date |
|---|---|
| IL37124A0 (en) | 1971-08-25 |
| SU471723A3 (ru) | 1975-05-25 |
| IL37124A (en) | 1974-10-22 |
| CH562827A5 (https=) | 1975-06-13 |
| PL83609B1 (en) | 1975-12-31 |
| ES392823A1 (es) | 1973-08-16 |
| NL7109164A (https=) | 1972-01-05 |
| BE769465A (fr) | 1971-11-16 |
| AT310352B (de) | 1973-09-25 |
| US3846407A (en) | 1974-11-05 |
| CA984831A (en) | 1976-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2110387C3 (de) | Verfahren zur Herstellung von Cephalosporinverbindungen | |
| DE1146486B (de) | Verfahren zur Herstellung von O, O-Dialkyl-dithiophosphorylfettsaeure-amiden | |
| DE2147023A1 (de) | Verfahren zur herstellung von 1htetrazol-verbindungen | |
| DE2312976A1 (de) | Penicilline, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2132504A1 (de) | Verfahren zur Herstellung von eine Halogen-Carbonyl-Gruppe enthaltenden,neuen Penicillinderivaten | |
| AT328085B (de) | Verfahren zur herstellung neuer penicilline | |
| DE2166561A1 (de) | 6-aminopenicillansulfoxidsilylester | |
| DE1155115B (de) | Verfahren zur Herstellung von N-Monoalkylamiden der O, O-Dimethyldithiophosphorylessigsaeure | |
| DE1951012A1 (de) | Ester der 7-(alpha-Amino-alpha-phenylacctamido)-3-methyl-delta?-cephem-4-carbonsaeure | |
| CH589653A5 (en) | Acyloxyalkyl esters of penicillin and cephalosporin cpds - - readily absorbed after oral admin and less toxic | |
| DE2613172A1 (de) | Verfahren zur herstellung von penicillinen und cephalosporinen | |
| DE2065489A1 (de) | Cephalosporin c-derivate | |
| DE1670382C3 (de) | Derivate der 6-Aminopenicillansäure und Verfahren zu ihrer Herstellung | |
| DE2222094A1 (de) | Verfahren zur herstellung von aminoazetidinonen | |
| DE2426977A1 (de) | N,n'-disubstituierte amidine und verfahren zu ihrer herstellung | |
| DE2938065A1 (de) | Verfahren zur herstellung von cephalosporinverbindungen | |
| DE1137012B (de) | Verfahren zur Herstellung von Phosphon- bzw. Thionophosphonsaeureestern | |
| DE2150267C3 (de) | Verfahren zur Herstellung von Peptiden | |
| DE2721731C2 (de) | Verfahren zur Herstellung eines N-geschützten Cephalosporin-C-Diesters | |
| AT341091B (de) | Verfahren zur herstellung von cephalosporinen | |
| DE2046349A1 (de) | Neue Cephalosporansaurederivate | |
| AT303959B (de) | Verfahren zur Herstellung von neuen 3-Halogenmethyl-δ<3>-cephalosporinestern und deren Sulfoxyden | |
| AT323323B (de) | Verfahren zur herstellung neuer 6-aminopenicillansulfoxydsilylester | |
| DE2243242A1 (de) | Verfahren zur herstellung von 7-amino3-cephem-4-carbonsaeurederivaten | |
| DE2507117A1 (de) | Verfahren zur herstellung von alkyl- beziehungsweise arylsulfonamiden von cephalosporin c beziehungsweise derivaten desselben, insbesondere zur gewinnung von cephalosporin c beziehungsweise derivaten desselben und/oder 7-aminocephalosporansaeure |