DE2117615A1 - Inhibierung vorzeitiger Vulkanisation von Kautschuken - Google Patents
Inhibierung vorzeitiger Vulkanisation von KautschukenInfo
- Publication number
- DE2117615A1 DE2117615A1 DE19712117615 DE2117615A DE2117615A1 DE 2117615 A1 DE2117615 A1 DE 2117615A1 DE 19712117615 DE19712117615 DE 19712117615 DE 2117615 A DE2117615 A DE 2117615A DE 2117615 A1 DE2117615 A1 DE 2117615A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- radicals
- carbon atoms
- methyl
- composition according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920001971 elastomer Polymers 0.000 title claims description 25
- 238000004073 vulcanization Methods 0.000 title claims description 24
- 239000005060 rubber Substances 0.000 title claims description 23
- 230000002028 premature Effects 0.000 title claims description 11
- 230000005764 inhibitory process Effects 0.000 title claims description 5
- -1 heterocyclic radical Chemical class 0.000 claims description 79
- 125000004432 carbon atom Chemical group C* 0.000 claims description 50
- 229910052757 nitrogen Inorganic materials 0.000 claims description 43
- 150000001875 compounds Chemical class 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 26
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 17
- 239000011593 sulfur Substances 0.000 claims description 17
- 239000003795 chemical substances by application Substances 0.000 claims description 15
- 150000003254 radicals Chemical class 0.000 claims description 13
- 125000004708 n-butylthio group Chemical group C(CCC)S* 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- 239000004215 Carbon black (E152) Substances 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- 150000002430 hydrocarbons Chemical class 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 6
- 229920006395 saturated elastomer Polymers 0.000 claims description 6
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 5
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 claims 2
- 150000005840 aryl radicals Chemical class 0.000 claims 2
- 125000002091 cationic group Chemical group 0.000 claims 1
- 125000002993 cycloalkylene group Chemical group 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 1
- 150000008427 organic disulfides Chemical class 0.000 claims 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- WHALSQRTWNBBCV-UHFFFAOYSA-N s-aminosulfanylthiohydroxylamine Chemical compound NSSN WHALSQRTWNBBCV-UHFFFAOYSA-N 0.000 claims 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000003112 inhibitor Substances 0.000 description 14
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 12
- 230000000704 physical effect Effects 0.000 description 12
- 241001441571 Hiodontidae Species 0.000 description 11
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 230000002829 reductive effect Effects 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 238000005299 abrasion Methods 0.000 description 6
- 239000011787 zinc oxide Substances 0.000 description 6
- 244000043261 Hevea brasiliensis Species 0.000 description 5
- 235000021355 Stearic acid Nutrition 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229920003052 natural elastomer Polymers 0.000 description 5
- 229920001194 natural rubber Polymers 0.000 description 5
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 5
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000008117 stearic acid Substances 0.000 description 5
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- MHKLKWCYGIBEQF-UHFFFAOYSA-N 4-(1,3-benzothiazol-2-ylsulfanyl)morpholine Chemical compound C1COCCN1SC1=NC2=CC=CC=C2S1 MHKLKWCYGIBEQF-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000004071 soot Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 229960002447 thiram Drugs 0.000 description 3
- SDYMYAFSQACTQP-UHFFFAOYSA-N 1,3-benzothiazole-2-sulfonamide Chemical class C1=CC=C2SC(S(=O)(=O)N)=NC2=C1 SDYMYAFSQACTQP-UHFFFAOYSA-N 0.000 description 2
- QRYFCNPYGUORTK-UHFFFAOYSA-N 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine Chemical compound C1COCCN1SSC1=NC2=CC=CC=C2S1 QRYFCNPYGUORTK-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 239000005062 Polybutadiene Substances 0.000 description 2
- 241000872198 Serjania polyphylla Species 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- GVPWHKZIJBODOX-UHFFFAOYSA-N dibenzyl disulfide Chemical compound C=1C=CC=CC=1CSSCC1=CC=CC=C1 GVPWHKZIJBODOX-UHFFFAOYSA-N 0.000 description 2
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 2
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229920002857 polybutadiene Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 2
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 2
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 2
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 2
- OPFTUNCRGUEPRZ-UHFFFAOYSA-N (+)-beta-Elemen Natural products CC(=C)C1CCC(C)(C=C)C(C(C)=C)C1 OPFTUNCRGUEPRZ-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N (-)-beta-elemene Chemical compound CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- BKJVBHJVNBHTTA-UHFFFAOYSA-N (dimethylsulfamoylamino)methane Chemical compound CNS(=O)(=O)N(C)C BKJVBHJVNBHTTA-UHFFFAOYSA-N 0.000 description 1
- TZOVOULUMXXLOJ-UHFFFAOYSA-N 1-methyl-4-[(4-methylphenyl)disulfanyl]benzene Chemical compound C1=CC(C)=CC=C1SSC1=CC=C(C)C=C1 TZOVOULUMXXLOJ-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical class CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BUZICZZQJDLXJN-UHFFFAOYSA-N 3-azaniumyl-4-hydroxybutanoate Chemical compound OCC(N)CC(O)=O BUZICZZQJDLXJN-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 241000272808 Anser Species 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101100260565 Dictyostelium discoideum thyA gene Proteins 0.000 description 1
- 229920002943 EPDM rubber Polymers 0.000 description 1
- YMXRMUMOSNKPOZ-UHFFFAOYSA-N N,4-dimethyl-N-phenylsulfanylbenzenesulfonamide Chemical compound C1(=CC=CC=C1)SN(S(=O)(=O)C1=CC=C(C=C1)C)C YMXRMUMOSNKPOZ-UHFFFAOYSA-N 0.000 description 1
- HPFDOSARLPDBRL-UHFFFAOYSA-N N-benzylsulfanyl-4-methyl-N-propan-2-ylbenzenesulfonamide Chemical compound C(C1=CC=CC=C1)SN(S(=O)(=O)C1=CC=C(C=C1)C)C(C)C HPFDOSARLPDBRL-UHFFFAOYSA-N 0.000 description 1
- GTDJVQSCXDIYME-UHFFFAOYSA-N N-benzylsulfanyl-N-methylbenzenesulfonamide Chemical compound C(C1=CC=CC=C1)SN(S(=O)(=O)C1=CC=CC=C1)C GTDJVQSCXDIYME-UHFFFAOYSA-N 0.000 description 1
- IZTQWMHAXLYSAP-UHFFFAOYSA-N N-cyclohexylsulfanyl-N,4-dimethylbenzenesulfonamide Chemical compound C1(CCCCC1)SN(S(=O)(=O)C1=CC=C(C=C1)C)C IZTQWMHAXLYSAP-UHFFFAOYSA-N 0.000 description 1
- 241001602876 Nata Species 0.000 description 1
- 241000238633 Odonata Species 0.000 description 1
- 241000287107 Passer Species 0.000 description 1
- 241000269435 Rana <genus> Species 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical class CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- VREVKZLUMZQJRI-UHFFFAOYSA-N [SH2]=N Chemical class [SH2]=N VREVKZLUMZQJRI-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004171 alkoxy aryl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- IIQFIDKGTDXLBU-UHFFFAOYSA-N benzyl thiohypochlorite Chemical compound ClSCC1=CC=CC=C1 IIQFIDKGTDXLBU-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UJXBZCDDWHNWNG-UHFFFAOYSA-N butyl thiohypochlorite Chemical compound CCCCSCl UJXBZCDDWHNWNG-UHFFFAOYSA-N 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 229920003193 cis-1,4-polybutadiene polymer Polymers 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000004656 dimethylamines Chemical class 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- ZCRZCMUDOWDGOB-UHFFFAOYSA-N ethanesulfonimidic acid Chemical compound CCS(N)(=O)=O ZCRZCMUDOWDGOB-UHFFFAOYSA-N 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006232 furnace black Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000003106 haloaryl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000006682 monohaloalkyl group Chemical group 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- SVDVKEBISAOWJT-UHFFFAOYSA-N n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1 SVDVKEBISAOWJT-UHFFFAOYSA-N 0.000 description 1
- 125000004999 nitroaryl group Chemical group 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000010057 rubber processing Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 description 1
- 238000010059 sulfur vulcanization Methods 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 101150068774 thyX gene Proteins 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/43—Compounds containing sulfur bound to nitrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/43—Compounds containing sulfur bound to nitrogen
- C08K5/44—Sulfenamides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2643170A | 1970-04-07 | 1970-04-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2117615A1 true DE2117615A1 (de) | 1971-10-21 |
Family
ID=21831781
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712117615 Pending DE2117615A1 (de) | 1970-04-07 | 1971-04-05 | Inhibierung vorzeitiger Vulkanisation von Kautschuken |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3678017A (enExample) |
| BE (1) | BE765178A (enExample) |
| BR (1) | BR7101964D0 (enExample) |
| CA (1) | CA1003427A (enExample) |
| DE (1) | DE2117615A1 (enExample) |
| FR (1) | FR2092517A5 (enExample) |
| GB (1) | GB1348057A (enExample) |
| NL (1) | NL7104607A (enExample) |
| SE (1) | SE367424B (enExample) |
| ZA (1) | ZA711531B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3915940A (en) * | 1970-12-28 | 1975-10-28 | Monsanto Co | Inhibiting premature vulcanization of diene rubbers with n-thiosulfonamides |
| US3725361A (en) * | 1971-06-07 | 1973-04-03 | K Boustany | Inhibiting premature vulcanization of rubber with n-thiohydrazodicarboxylate |
| US3985717A (en) * | 1972-03-22 | 1976-10-12 | Imperial Chemical Industries Limited | Vulcanizable rubber compositions comprising organic derivatives of hydrazine |
| US3855261A (en) * | 1972-03-27 | 1974-12-17 | Goodrich Co B F | (hydrocarbonthio)oxamide vulcanization retarders |
| US3898205A (en) * | 1972-06-26 | 1975-08-05 | Goodyear Tire & Rubber | Sulfonamide additives for sulfur vulcanizable polymers |
| US3856762A (en) * | 1972-06-26 | 1974-12-24 | Goodyear Tire & Rubber | Sulfonamide additives for sulfur vulcanizable polymers |
| US3898206A (en) * | 1972-06-26 | 1975-08-05 | Goodyear Tire & Rubber | Sulfonamide additives for sulfur vulcanizable polymers |
| US4209596A (en) * | 1973-04-28 | 1980-06-24 | Mitsuboshi Belting, Ltd. | Two step process for producing vulcanized rubber |
| US4244843A (en) * | 1973-04-28 | 1981-01-13 | Mitsubishi Belting, Ltd. | Covulcanized rubber |
| US4053458A (en) * | 1974-03-25 | 1977-10-11 | Uop Inc. | Vulcanizable rubber formulations with bis(sulfonamido)sulfide |
| US4160845A (en) * | 1976-01-02 | 1979-07-10 | Chevron Research Company | Fungicidal N-(haloaliphaticthio)halovinylsulfonamides |
| US4085093A (en) * | 1976-07-23 | 1978-04-18 | The Goodyear Tire & Rubber Company | Sulfilimines as premature vulcanization inhibitors |
| US4068000A (en) * | 1976-08-16 | 1978-01-10 | Chevron Research Company | Method for controlling mites |
| US4112237A (en) * | 1976-10-22 | 1978-09-05 | Chevron Research Company | Fungicidal, miticidal and ovicidal alkoxycarbonylalkyl-substituted and carbamylalkyl-substituted N-haloalkylthiosulfonamides |
| US4230875A (en) * | 1976-10-22 | 1980-10-28 | Chevron Research Company | Fungicidal, miticidal and ovicidal alkoxycarbonylalkyl-substituted and carbamylalkyl-substituted N-haloalkylthiosulfonamides |
| US4208348A (en) * | 1977-01-17 | 1980-06-17 | Chevron Research Company | Quaternary ammonium salt catalyzed preparation of sulfonamides |
| US4107332A (en) * | 1977-01-17 | 1978-08-15 | Chevron Research Company | Mite and mite-ovicidal compositions |
| US4269856A (en) * | 1978-06-02 | 1981-05-26 | Chevron Research Company | Mite and mite ovicidal compositions |
| US4283416A (en) * | 1978-07-03 | 1981-08-11 | Chevron Research Company | Fungicidal, miticidal and ovicidal alkoxycarbonylalkyl-substituted and carbamylalkyl-substituted N-haloalkylthiosulfonamides |
| US4350831A (en) * | 1979-09-10 | 1982-09-21 | Chevron Research Company | Miticidal and mite ovicidal, compounds |
| DE2942677A1 (de) * | 1979-10-23 | 1981-05-21 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von neuen sulfonsaeurecycloalkylamiden und ihre mikrobizide verwendung |
| US4271050A (en) * | 1979-11-23 | 1981-06-02 | Monsanto Company | Vulcanizable rubber compositions inhibited from premature vulcanization by methylene thioethers |
| US4295874A (en) * | 1980-01-28 | 1981-10-20 | Chevron Research | N-Alkyl or aryl-N-(trichlorovinylthio)-halomethane sulfonamides |
| DE3014717A1 (de) * | 1980-04-17 | 1981-10-22 | Bayer Ag, 5090 Leverkusen | Vulkanisationssystem, dieses enthaltende kautschukmischung, sowie ein verfahren zur vulkanisation |
| DE3027634C2 (de) * | 1980-07-22 | 1985-09-26 | Sanshin Kagaku Kogyo Co., Ltd., Yanai, Yamaguchi | N-Substituierte Benzothiazol-2-sulfonamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Vorvulkanisationsverzögerer |
| CA2805546A1 (en) | 2010-06-30 | 2012-01-05 | Girindus America, Inc. | A new method of using n-thio compounds for oligonucleotide synthesis |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2653155A (en) * | 1951-04-21 | 1953-09-22 | Standard Oil Dev Co | Manufacture of n-trichloromethylthio imides |
| DE951719C (de) * | 1954-06-24 | 1956-10-31 | Bayer Ag | Verfahren zur Herstellung von N,N'-Dithio-bis-sulfonsaeureamiden |
| NL277492A (enExample) * | 1960-11-03 | |||
| GB922367A (en) * | 1960-11-23 | 1963-03-27 | Monsanto Chemicals | Rubber-resin blends having improved processability |
-
1970
- 1970-04-07 US US26431A patent/US3678017A/en not_active Expired - Lifetime
-
1971
- 1971-03-09 ZA ZA711531A patent/ZA711531B/xx unknown
- 1971-03-11 CA CA107,428A patent/CA1003427A/en not_active Expired
- 1971-03-30 FR FR7111084A patent/FR2092517A5/fr not_active Expired
- 1971-03-30 SE SE04127/71A patent/SE367424B/xx unknown
- 1971-04-01 BR BR1964/71A patent/BR7101964D0/pt unknown
- 1971-04-01 BE BE765178A patent/BE765178A/xx unknown
- 1971-04-05 DE DE19712117615 patent/DE2117615A1/de active Pending
- 1971-04-06 NL NL7104607A patent/NL7104607A/xx unknown
- 1971-04-19 GB GB2386071*A patent/GB1348057A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1348057A (en) | 1974-03-13 |
| CA1003427A (en) | 1977-01-11 |
| FR2092517A5 (enExample) | 1972-01-21 |
| NL7104607A (enExample) | 1971-10-11 |
| BR7101964D0 (pt) | 1973-04-26 |
| SE367424B (enExample) | 1974-05-27 |
| BE765178A (fr) | 1971-08-30 |
| ZA711531B (en) | 1971-11-24 |
| US3678017A (en) | 1972-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2117615A1 (de) | Inhibierung vorzeitiger Vulkanisation von Kautschuken | |
| DE2265382C2 (de) | Polysulfidderivate zur Vernetzung von Kautschuk | |
| DE2552617C2 (de) | Verfahren zur Herstellung eines modifizierten kautschukartigen Terpolymeren und seine Verwendung | |
| DE10296456T5 (de) | Polyisopren-Gegenstände und Verfahren zur Herstellung derselben | |
| DE3888760T2 (de) | Arylendiaminosubstituiertes Triazin. | |
| DE1720132A1 (de) | Verfahren zur Hemmung einer vorzeitigen Vulkanisation von Kautschuk | |
| DE2008479A1 (de) | Verfahren zum Vulkanisieren von Homobzw. Copoiymerisaten konjugierter Diene | |
| DE2142648C3 (de) | Gegen die vorzeitige Vulkanisation inhibierte Schwefel-vulkanisierbare Masse auf der Basis von Dienkautschuk | |
| DE1929742C3 (de) | Halogenhaltige polymere elastomere Massen | |
| DE2136066C3 (de) | N-Sulfenyllactame und deren Verwendung | |
| DE2314838A1 (de) | Kohlenwasserstoffthiooxamide | |
| DE2732994C2 (de) | Verwendung von N-Sulfonylsulfiliminen und N-Sulfonylsulfilimine als solche | |
| DE2329431A1 (de) | Neue imide | |
| DE2337642C3 (de) | Phosphorsäureamide und ihre Verwendung bei der Vulkanisation von Kautschuk | |
| DE1770905C3 (de) | Vulkanisierbare Masse und ihre Verwendung für vulkanisierte Formkörper | |
| DD270302A5 (de) | N,n'-Substituierte Bis-(2,4-Diamino-S-triazin-6-yl)-tetra-sulfide und ihre Disproportionierungsprodukte, Verfahren zu ihrer Herstellung und ihre Verwendung in vulkanisierbaren Kautschukmischungen | |
| DE4241447A1 (de) | Polysulfid-Verbindungen und Vulkanisationssysteme | |
| DE19931043A1 (de) | Schwefel-vulkanisierbarer Butylgummi und Gummizusammensetzung, enthalted denselben | |
| EP0432406B1 (de) | Polysulfidderivate, Verfahren zu ihrer Herstellung und Verwendung zur Vernetzung von Natur- und Synthesekautschuken | |
| DE2110844A1 (de) | Cycloalkylsulfenamide als Vorvulkanisationsinhibitoren | |
| DE2005692A1 (de) | Vulkanisationsverzogerer | |
| DE2323466C3 (de) | Vulkanisierbare Kautschukmasse | |
| DE1720110C3 (de) | Verfahren zur Peptisierung schwefelhaltiger Polychloroprene | |
| DE2339986A1 (de) | Thiazolidinone | |
| DE1794423C3 (de) | Vulkanisierbare Masse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |