DE2115625B2 - Verfahren zur Herstellung von N-o-Cyanophenyl-N', N'-disubstituierten Formamidinen und deren Salzen - Google Patents
Verfahren zur Herstellung von N-o-Cyanophenyl-N', N'-disubstituierten Formamidinen und deren SalzenInfo
- Publication number
- DE2115625B2 DE2115625B2 DE19712115625 DE2115625A DE2115625B2 DE 2115625 B2 DE2115625 B2 DE 2115625B2 DE 19712115625 DE19712115625 DE 19712115625 DE 2115625 A DE2115625 A DE 2115625A DE 2115625 B2 DE2115625 B2 DE 2115625B2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- chloride
- cyanophenyl
- reaction
- salts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 7
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical class NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 title description 2
- 150000003839 salts Chemical class 0.000 title description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 13
- -1 amide chlorides Chemical class 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- GTCCMGFBIWUBLQ-UHFFFAOYSA-N formamide;hydrochloride Chemical class Cl.NC=O GTCCMGFBIWUBLQ-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- SOBQOVZAFJDEJI-UHFFFAOYSA-N 2-amino-5-nitrobenzamide Chemical compound NC(=O)C1=CC([N+]([O-])=O)=CC=C1N SOBQOVZAFJDEJI-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- PRKRQUUATBDWTL-UHFFFAOYSA-N 2-amino-3,5-dichlorobenzamide Chemical compound NC(=O)C1=CC(Cl)=CC(Cl)=C1N PRKRQUUATBDWTL-UHFFFAOYSA-N 0.000 description 2
- RUHKZVAPXHIWJH-UHFFFAOYSA-N 2-amino-4-methylbenzamide Chemical compound CC1=CC=C(C(N)=O)C(N)=C1 RUHKZVAPXHIWJH-UHFFFAOYSA-N 0.000 description 2
- DNRVZOZGQHHDAT-UHFFFAOYSA-N 2-amino-5-chlorobenzamide Chemical compound NC(=O)C1=CC(Cl)=CC=C1N DNRVZOZGQHHDAT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000005521 carbonamide group Chemical group 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000003948 formamides Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 1
- AGRIQBHIKABLPJ-UHFFFAOYSA-N 1-Pyrrolidinecarboxaldehyde Chemical compound O=CN1CCCC1 AGRIQBHIKABLPJ-UHFFFAOYSA-N 0.000 description 1
- MMKNBFSDCOALQO-UHFFFAOYSA-N 1-amino-9,10-dioxoanthracene-2-carboxylic acid Chemical group O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(C(O)=O)=C2N MMKNBFSDCOALQO-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- HCUQSJIDFFREGO-UHFFFAOYSA-N 2-amino-3-chloro-5-nitrobenzamide Chemical compound NC(=O)C1=CC([N+]([O-])=O)=CC(Cl)=C1N HCUQSJIDFFREGO-UHFFFAOYSA-N 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical compound C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZJWUHVMDFOZRIP-UHFFFAOYSA-N CCN(C)C=O.Cl Chemical compound CCN(C)C=O.Cl ZJWUHVMDFOZRIP-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- NMVVJCLUYUWBSZ-UHFFFAOYSA-N aminomethylideneazanium;chloride Chemical compound Cl.NC=N NMVVJCLUYUWBSZ-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SAVROPQJUYSBDD-UHFFFAOYSA-N formyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CO SAVROPQJUYSBDD-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712115625 DE2115625B2 (de) | 1971-03-31 | 1971-03-31 | Verfahren zur Herstellung von N-o-Cyanophenyl-N', N'-disubstituierten Formamidinen und deren Salzen |
| CH307072A CH572901A5 (cg-RX-API-DMAC10.html) | 1971-03-31 | 1972-03-02 | |
| NL7203075A NL7203075A (cg-RX-API-DMAC10.html) | 1971-03-31 | 1972-03-08 | |
| CS203872A CS161794B2 (cg-RX-API-DMAC10.html) | 1971-03-31 | 1972-03-27 | |
| FR7210996A FR2131712A5 (cg-RX-API-DMAC10.html) | 1971-03-31 | 1972-03-29 | |
| GB1470372A GB1377275A (en) | 1971-03-31 | 1972-03-29 | N-o-cyanophenyl-n,n,- disubstituted formamidines and their salts |
| DD16189572A DD94990A5 (cg-RX-API-DMAC10.html) | 1971-03-31 | 1972-03-29 | |
| JP3085772A JPS5527053B1 (cg-RX-API-DMAC10.html) | 1971-03-31 | 1972-03-29 | |
| BE781474A BE781474A (fr) | 1971-03-31 | 1972-03-30 | Procede de preparation de derives bisubstitues en n' de la n-o-cyanophenyl-formamidine et de leurs sels |
| IT4935872A IT954405B (it) | 1971-03-31 | 1972-03-30 | Procedimento per la produzione di formammidine n o cianofenil n n bisostituite e loro sali |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712115625 DE2115625B2 (de) | 1971-03-31 | 1971-03-31 | Verfahren zur Herstellung von N-o-Cyanophenyl-N', N'-disubstituierten Formamidinen und deren Salzen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2115625A1 DE2115625A1 (cg-RX-API-DMAC10.html) | 1972-10-12 |
| DE2115625B2 true DE2115625B2 (de) | 1978-07-06 |
| DE2115625C3 DE2115625C3 (cg-RX-API-DMAC10.html) | 1979-03-15 |
Family
ID=5803409
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712115625 Granted DE2115625B2 (de) | 1971-03-31 | 1971-03-31 | Verfahren zur Herstellung von N-o-Cyanophenyl-N', N'-disubstituierten Formamidinen und deren Salzen |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS5527053B1 (cg-RX-API-DMAC10.html) |
| BE (1) | BE781474A (cg-RX-API-DMAC10.html) |
| CH (1) | CH572901A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS161794B2 (cg-RX-API-DMAC10.html) |
| DD (1) | DD94990A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2115625B2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2131712A5 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1377275A (cg-RX-API-DMAC10.html) |
| IT (1) | IT954405B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7203075A (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2203051A1 (de) * | 1972-01-22 | 1973-07-26 | Basf Ag | Verfahren zur herstellung von n-(2cyan-4-nitrophenyl)-n',n'-disubstituierten formamidinen und n-(2-cyan-6-nitrophenyl)n',n'-disubstituierten formamidinen |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2628055A1 (de) | 1976-06-23 | 1978-01-05 | Basf Ag | Verfahren zur herstellung von n-(2- cyanphenyl)-formamidinen |
| DE10228732A1 (de) * | 2002-06-27 | 2004-01-15 | Bayer Cropscience Ag | Verfahren zur Herstellung von 3,4-Dichlor-N-(2-cyano-phenyl)-5-isothiazolcarboxamid |
| DE10228731A1 (de) * | 2002-06-27 | 2004-01-22 | Bayer Cropscience Ag | Verfahren zur Herstellung von 3,4-Dichlor-N-(2-cyanophenyl)-5-isothiazolcarboxamid |
| TWI363756B (en) * | 2004-12-07 | 2012-05-11 | Du Pont | Method for preparing n-phenylpyrazole-1-carboxamides |
| DE102005035617A1 (de) | 2005-07-29 | 2007-02-15 | Bayer Cropscience Ag | Verfahren zur Herstellung von 3,4-Dichlor-N-(2-cyano-phenyl)-5-isothiazolcarboxamid |
| IL271148B (en) | 2017-06-14 | 2022-08-01 | Bayer Ag | Process for preparing 3,4-dichloro-n-(2-cyanophenyl)-5-isothiazolecarboxamide |
-
1971
- 1971-03-31 DE DE19712115625 patent/DE2115625B2/de active Granted
-
1972
- 1972-03-02 CH CH307072A patent/CH572901A5/xx not_active IP Right Cessation
- 1972-03-08 NL NL7203075A patent/NL7203075A/xx unknown
- 1972-03-27 CS CS203872A patent/CS161794B2/cs unknown
- 1972-03-29 GB GB1470372A patent/GB1377275A/en not_active Expired
- 1972-03-29 DD DD16189572A patent/DD94990A5/xx unknown
- 1972-03-29 FR FR7210996A patent/FR2131712A5/fr not_active Expired
- 1972-03-29 JP JP3085772A patent/JPS5527053B1/ja active Pending
- 1972-03-30 IT IT4935872A patent/IT954405B/it active
- 1972-03-30 BE BE781474A patent/BE781474A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2203051A1 (de) * | 1972-01-22 | 1973-07-26 | Basf Ag | Verfahren zur herstellung von n-(2cyan-4-nitrophenyl)-n',n'-disubstituierten formamidinen und n-(2-cyan-6-nitrophenyl)n',n'-disubstituierten formamidinen |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2115625A1 (cg-RX-API-DMAC10.html) | 1972-10-12 |
| JPS5527053B1 (cg-RX-API-DMAC10.html) | 1980-07-17 |
| NL7203075A (cg-RX-API-DMAC10.html) | 1972-10-03 |
| CH572901A5 (cg-RX-API-DMAC10.html) | 1976-02-27 |
| IT954405B (it) | 1973-08-30 |
| BE781474A (fr) | 1972-10-02 |
| GB1377275A (en) | 1974-12-11 |
| DE2115625C3 (cg-RX-API-DMAC10.html) | 1979-03-15 |
| DD94990A5 (cg-RX-API-DMAC10.html) | 1973-01-12 |
| FR2131712A5 (cg-RX-API-DMAC10.html) | 1972-11-10 |
| CS161794B2 (cg-RX-API-DMAC10.html) | 1975-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1956384C3 (de) | 1 -Isopropyl-4-phenyl-2-( 1 H)-chinazolinonderivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE1227445B (de) | Verfahren zur Herstellung von Harnstoffderivaten | |
| DE2115625C3 (cg-RX-API-DMAC10.html) | ||
| DE2610675C3 (de) | Verfahren zur Herstellung von Cyanazofarbstoffen | |
| DE1927921A1 (de) | s-Triazinderivate | |
| DE2233889C3 (de) | Verfahren zur Herstellung von Dimethylmaleinsäureanhydrid | |
| DE2518587C2 (de) | Verfahren zur Herstellung basischer Oxazinfarbstoffe | |
| DE2265779C2 (de) | 5-Chlor-oder 5-Brom-2-amino-3-hydroxypyridin und Verfahren zu dessen Herstellung | |
| DE2856384C3 (de) | Quartäre Ammoniumgruppen enthaltende Acrylyl- bzw. Methacrylylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1670932A1 (de) | Verfahren zur Herstellung von N-Trityl-imidazolen | |
| DE2553621A1 (de) | Verfahren zur herstellung von 2-amino- 3-cyanothiophenen | |
| DE2125229C3 (de) | Verfahren zur Herstellung von Chinazolinen | |
| DE2744655A1 (de) | Kationische azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1925654A1 (de) | Neue Aminoverbindungen und Verfahren zu deren Herstellung | |
| DE1518903C3 (de) | Verfahren zur Herstellung von ungesättigten Sulfonsäurebetainen | |
| DE3504073A1 (de) | Verfahren zur herstellung von 2-arylamino-4,6-dichlor-s-triazinen | |
| DE2201673C3 (de) | Verfahren zur Herstellung von 3.5- Dinitro-2-amino-benzonitril | |
| DE3015124A1 (de) | 2,5-diiminopyrrolin-verbindungen | |
| DE2636309A1 (de) | Neue organische verbindungen, ihre verwendung und herstellung | |
| DE1944789C3 (de) | Verfahren zur Herstellung von 4-Chlorderivaten der Phenylformamidine und deren Salzen | |
| CH341247A (de) | Verfahren zur Herstellung von wasserlöslichen Salzen von Azofarbstoffen | |
| DE2214488A1 (de) | Verfahren zur Herstellung 1-substituierter 4-Aminopyrrolin-3-one-(2) | |
| DE1545629A1 (de) | Verfahren zur Herstellung von Isothioharnstoffen | |
| DE3150629A1 (de) | Verfahren zur herstellung von 1,2-benzisothiazolin-3-onen | |
| DE2422955A1 (de) | Verfahren zur herstellung von dithiocarbamidsauren ammoniumsalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| EI | Miscellaneous see part 3 | ||
| 8330 | Complete disclaimer |