DE2103360B - - Google Patents
Info
- Publication number
- DE2103360B DE2103360B DE2103360B DE 2103360 B DE2103360 B DE 2103360B DE 2103360 B DE2103360 B DE 2103360B
- Authority
- DE
- Germany
- Prior art keywords
- anthraquinone
- nitric acid
- reaction
- parts
- phosphoric acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 34
- 150000004056 anthraquinones Chemical class 0.000 claims description 27
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 26
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 17
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 17
- 229910017604 nitric acid Inorganic materials 0.000 claims description 17
- YCANAXVBJKNANM-UHFFFAOYSA-N 1-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] YCANAXVBJKNANM-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 10
- 239000011541 reaction mixture Substances 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 239000000047 product Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- QCVMOSGPTRRUQZ-UHFFFAOYSA-N 2-nitroanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC([N+](=O)[O-])=CC=C3C(=O)C2=C1 QCVMOSGPTRRUQZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 4
- 239000006227 byproduct Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 230000000802 nitrating effect Effects 0.000 claims 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 3
- 239000000706 filtrate Substances 0.000 claims 3
- 229910052698 phosphorus Inorganic materials 0.000 claims 3
- 239000011574 phosphorus Substances 0.000 claims 3
- 229920000137 polyphosphoric acid Polymers 0.000 claims 3
- 239000002253 acid Substances 0.000 claims 2
- RHZUVFJBSILHOK-UHFFFAOYSA-N anthracen-1-ylmethanolate Chemical compound C1=CC=C2C=C3C(C[O-])=CC=CC3=CC2=C1 RHZUVFJBSILHOK-UHFFFAOYSA-N 0.000 claims 2
- 239000003830 anthracite Substances 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 238000006396 nitration reaction Methods 0.000 claims 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 claims 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims 1
- -1 B. ammonium nitrate Chemical class 0.000 claims 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 claims 1
- KADDEZWVEAQOCJ-UHFFFAOYSA-N anthracene-9,10-dione;nitric acid Chemical compound O[N+]([O-])=O.C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 KADDEZWVEAQOCJ-UHFFFAOYSA-N 0.000 claims 1
- 238000009835 boiling Methods 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 238000001816 cooling Methods 0.000 claims 1
- 230000007935 neutral effect Effects 0.000 claims 1
- 150000002823 nitrates Chemical class 0.000 claims 1
- 238000000746 purification Methods 0.000 claims 1
- 238000003756 stirring Methods 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 238000004809 thin layer chromatography Methods 0.000 claims 1
- NMNSBFYYVHREEE-UHFFFAOYSA-N 1,2-dinitroanthracene-9,10-dione Chemical class C1=CC=C2C(=O)C3=C([N+]([O-])=O)C([N+](=O)[O-])=CC=C3C(=O)C2=C1 NMNSBFYYVHREEE-UHFFFAOYSA-N 0.000 description 9
- 238000001035 drying Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2524747C3 (de) | Verfahren zur Isolierung von 1,5-/1,8-Dinitroanthrachinon mit einem hohen Gehalt an a , a '-Duutroverbindungen | |
| DE2103360B (OSRAM) | ||
| DE2103360C (OSRAM) | ||
| DE2206960B2 (de) | Verfahren zur herstellung von dinitroanthrachinon-freiem 1-nitroanthrachinon | |
| DE927333C (de) | Verfahren zur Reduktion von Nitroanthrachinonen und Trennung der Reduktionsprodukte | |
| DE2103360A1 (de) | Verfahren zur Herstellung von I -Nitro anthrachinonen | |
| DE2637732C3 (de) | Verfahren zur Herstellung von Dinitroanthrachinon-Gemischen mit hohem 1,5- und 1,8-Dinitroanthrachinon-Gehalt | |
| DE2346317C3 (de) | Verfahren zur Herstellung von Dinitroanthrachinonen | |
| CH526484A (de) | Verfahren zur Herstellung von 1-Nitroanthrachinonen | |
| DE2259074C3 (de) | Verfahren zur Herstellung von praktisch 1,5-Dinitro-anthrachinon-freiem 1-Nitro-anthrachinon | |
| DE2219216C3 (de) | Verfahren zur Herstellung von 1 -Nitro-anthrachinon | |
| DE2256644C2 (de) | Verfahren zur Herstellung von reinem 1-Nitro-anthrachinon | |
| DE2459164C3 (de) | Verfahren zur Herstellung von Dinitroanthrachinongemischen, die einen hohen Gehalt an 1,5- und 1,8-Dinitroverbindungen aufweisen | |
| DE2306611C3 (de) | Verfahren zur Herstellung von 1,5und 1,8-Dinitroanthrachinon | |
| EP0751115B1 (de) | Verfahren zur Herstellung von 5-Fluor-2-nitrobenzoesäure | |
| EP0015486B1 (de) | Verfahren zur Herstellung von 4,5-Dinitro-1,8-dihydroxyanthrachinon | |
| DE829168C (de) | Verfahren zur Herstellung von reinem, gut kristallisiertem Hexanitrodiphenylamin | |
| DE2452413A1 (de) | Verfahren zur herstellung von monound dihydroxylaminoanthrachinonen | |
| DE2438210A1 (de) | Verfahren zur nitrierung von anthrachinon und dessen derivaten | |
| DE977654C (de) | Verfahren zur Herstellung von Salpetersaeureestern des Polyvinylalkohols | |
| EP0019744B1 (de) | Verfahren zur Herstellung von Chlorameisensäure-(3-nitro-4-methyl)-phenylester | |
| DE2439280A1 (de) | Verfahren zur herstellung von 1,5dinitroanthrachinon und 1,8-dinitroanthrachinon | |
| DE2541800A1 (de) | Verfahren zur herstellung von 1,4-diaminoanthrachinon-2-carbonsaeure | |
| DE1136692B (de) | Verfahren zur Herstellung von Ammoniumphthalamat | |
| DE1205516B (de) | Verfahren zur Herstellung von Alkyladipinsaeuren |