DE2102746A1 - 5 Aroylpyrrole - Google Patents
5 AroylpyrroleInfo
- Publication number
- DE2102746A1 DE2102746A1 DE19712102746 DE2102746A DE2102746A1 DE 2102746 A1 DE2102746 A1 DE 2102746A1 DE 19712102746 DE19712102746 DE 19712102746 DE 2102746 A DE2102746 A DE 2102746A DE 2102746 A1 DE2102746 A1 DE 2102746A1
- Authority
- DE
- Germany
- Prior art keywords
- lower alkyl
- radical
- methylpyrrole
- formula
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 aroyl pyrroles Chemical class 0.000 title claims description 155
- 150000001875 compounds Chemical class 0.000 claims description 104
- 125000000217 alkyl group Chemical group 0.000 claims description 63
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 60
- 239000002253 acid Substances 0.000 claims description 59
- 238000000034 method Methods 0.000 claims description 40
- 150000007513 acids Chemical class 0.000 claims description 34
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 claims description 30
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 25
- 238000002360 preparation method Methods 0.000 claims description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 22
- 150000001408 amides Chemical class 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 21
- 230000007062 hydrolysis Effects 0.000 claims description 20
- 238000006460 hydrolysis reaction Methods 0.000 claims description 20
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 17
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 16
- 150000003973 alkyl amines Chemical class 0.000 claims description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 14
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 150000003254 radicals Chemical class 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 229910021529 ammonia Inorganic materials 0.000 claims description 11
- GVUHUYQEAGMUNJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetic acid Chemical compound OC(=O)CC1=CC=CN1 GVUHUYQEAGMUNJ-UHFFFAOYSA-N 0.000 claims description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 8
- 150000001447 alkali salts Chemical class 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 239000012442 inert solvent Substances 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 6
- 238000005804 alkylation reaction Methods 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- PSQLTUWNLHJFKV-UHFFFAOYSA-N methyl 2-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OC)=CC=C1C(=O)C1=CC=C(Cl)C=C1 PSQLTUWNLHJFKV-UHFFFAOYSA-N 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 5
- WUVRICUWYGUYGL-UHFFFAOYSA-N 2-[1-methyl-5-(thiophene-2-carbonyl)pyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=CS1 WUVRICUWYGUYGL-UHFFFAOYSA-N 0.000 claims description 4
- YHEAVHQIEBAMND-UHFFFAOYSA-N 2-methyl-2-(1h-pyrrol-2-yl)propanoic acid Chemical compound OC(=O)C(C)(C)C1=CC=CN1 YHEAVHQIEBAMND-UHFFFAOYSA-N 0.000 claims description 4
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 4
- 125000005907 alkyl ester group Chemical group 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- PISHKRUMARWBKY-UHFFFAOYSA-N ethyl 2-(1,4-dimethylpyrrol-2-yl)acetate Chemical compound CCOC(=O)CC1=CC(C)=CN1C PISHKRUMARWBKY-UHFFFAOYSA-N 0.000 claims description 4
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical class [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 4
- 125000001874 trioxidanyl group Chemical group [*]OOO[H] 0.000 claims description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 3
- DWNSCXBFXCAWCI-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-4-ethyl-1-methylpyrrol-2-yl]acetic acid Chemical compound C1=C(CC(O)=O)N(C)C(C(=O)C=2C=CC(Cl)=CC=2)=C1CC DWNSCXBFXCAWCI-UHFFFAOYSA-N 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 3
- 238000007126 N-alkylation reaction Methods 0.000 claims description 3
- 229960001171 acetohydroxamic acid Drugs 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 238000005915 ammonolysis reaction Methods 0.000 claims description 3
- 229940121363 anti-inflammatory agent Drugs 0.000 claims description 3
- 239000002260 anti-inflammatory agent Substances 0.000 claims description 3
- OJUCFBOBBVZQFT-UHFFFAOYSA-N ethyl 2-[5-(4-fluorobenzoyl)-1,4-dimethylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(C)=C1C(=O)C1=CC=C(F)C=C1 OJUCFBOBBVZQFT-UHFFFAOYSA-N 0.000 claims description 3
- 150000007517 lewis acids Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- JYLBSWKLEBNIFH-UHFFFAOYSA-N 2-(1,4-dimethylpyrrol-2-yl)acetic acid Chemical compound CC=1C=C(CC(O)=O)N(C)C=1 JYLBSWKLEBNIFH-UHFFFAOYSA-N 0.000 claims description 2
- ROSYAUHHRKAPHX-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)acetonitrile Chemical compound CN1C=CC=C1CC#N ROSYAUHHRKAPHX-UHFFFAOYSA-N 0.000 claims description 2
- BBEMODAZBLHGCE-UHFFFAOYSA-N 2-[1-methyl-5-(2-methylbenzoyl)pyrrol-2-yl]acetic acid Chemical compound CC1=CC=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C BBEMODAZBLHGCE-UHFFFAOYSA-N 0.000 claims description 2
- FYMAORSCZGLQAG-UHFFFAOYSA-N 2-[1-methyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(C(F)(F)F)C=C1 FYMAORSCZGLQAG-UHFFFAOYSA-N 0.000 claims description 2
- DMOJOLJLBHTLQK-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]-n-hydroxyacetamide Chemical compound CN1C(CC(=O)NO)=CC=C1C(=O)C1=CC=C(Cl)C=C1 DMOJOLJLBHTLQK-UHFFFAOYSA-N 0.000 claims description 2
- DJCGIWVUKCNCAT-UHFFFAOYSA-N 5-methylthiophene-2-carbonyl chloride Chemical compound CC1=CC=C(C(Cl)=O)S1 DJCGIWVUKCNCAT-UHFFFAOYSA-N 0.000 claims description 2
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims description 2
- VEQOALNAAJBPNY-UHFFFAOYSA-N antipyrine Chemical compound CN1C(C)=CC(=O)N1C1=CC=CC=C1 VEQOALNAAJBPNY-UHFFFAOYSA-N 0.000 claims description 2
- DMYZMTCHVFJVLM-UHFFFAOYSA-N ethyl 2-[5-(4-chlorobenzoyl)-4-ethyl-1-methylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(CC)=C1C(=O)C1=CC=C(Cl)C=C1 DMYZMTCHVFJVLM-UHFFFAOYSA-N 0.000 claims description 2
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- QIQITDHWZYEEPA-UHFFFAOYSA-N thiophene-2-carbonyl chloride Chemical compound ClC(=O)C1=CC=CS1 QIQITDHWZYEEPA-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 claims 1
- NUOGEPIJFRZXIN-UHFFFAOYSA-N 4-fluoro-n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=C(F)C=C1 NUOGEPIJFRZXIN-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000004494 ethyl ester group Chemical group 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- CGYVDYLHQYNGFC-UHFFFAOYSA-N methyl 2-(1-methylpyrrol-2-yl)acetate Chemical compound COC(=O)CC1=CC=CN1C CGYVDYLHQYNGFC-UHFFFAOYSA-N 0.000 claims 1
- SIXINSDWVSIFEY-UHFFFAOYSA-N methyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OC)=CC=C1C(=O)C1=CC=C(C)C=C1 SIXINSDWVSIFEY-UHFFFAOYSA-N 0.000 claims 1
- ULKWBVNMJZUEBD-UHFFFAOYSA-N n,n,4-trimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=C(C)C=C1 ULKWBVNMJZUEBD-UHFFFAOYSA-N 0.000 claims 1
- 125000000168 pyrrolyl group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 78
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- 238000002844 melting Methods 0.000 description 46
- 230000008018 melting Effects 0.000 description 46
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 43
- 239000000203 mixture Substances 0.000 description 41
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- 150000002148 esters Chemical class 0.000 description 35
- 239000007787 solid Substances 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000000047 product Substances 0.000 description 29
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 25
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- 238000010992 reflux Methods 0.000 description 18
- 239000000725 suspension Substances 0.000 description 18
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 238000000921 elemental analysis Methods 0.000 description 11
- 150000002825 nitriles Chemical class 0.000 description 11
- 239000012267 brine Substances 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- 241000700159 Rattus Species 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 9
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 9
- 235000019341 magnesium sulphate Nutrition 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000013078 crystal Substances 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Substances FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 6
- 150000001805 chlorine compounds Chemical class 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 239000000575 pesticide Substances 0.000 description 6
- 150000003140 primary amides Chemical class 0.000 description 6
- 239000005995 Aluminium silicate Substances 0.000 description 5
- 235000012211 aluminium silicate Nutrition 0.000 description 5
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 150000003334 secondary amides Chemical class 0.000 description 5
- 150000003511 tertiary amides Chemical class 0.000 description 5
- LFVOFEQFKPBRJY-UHFFFAOYSA-N 2-[1-methyl-5-(thiophene-2-carbonyl)pyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=CS1 LFVOFEQFKPBRJY-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 206010030113 Oedema Diseases 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- AALRHBLMAVGWRR-UHFFFAOYSA-N 1-chlorobutan-2-one Chemical compound CCC(=O)CCl AALRHBLMAVGWRR-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 238000005874 Vilsmeier-Haack formylation reaction Methods 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- AGKFMUXEONTGAH-UHFFFAOYSA-N ethyl 2-[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(C)=C1C(=O)C1=CC=C(Cl)C=C1 AGKFMUXEONTGAH-UHFFFAOYSA-N 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- FVXNLWRKEVZHKO-UHFFFAOYSA-N 1-chlorohexan-2-one Chemical compound CCCCC(=O)CCl FVXNLWRKEVZHKO-UHFFFAOYSA-N 0.000 description 2
- RFQXZWAOEPMHCE-UHFFFAOYSA-N 2,3,5-tribromobenzoyl chloride Chemical compound ClC(=O)C1=CC(Br)=CC(Br)=C1Br RFQXZWAOEPMHCE-UHFFFAOYSA-N 0.000 description 2
- SYYOUHJJSOLSJD-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)acetic acid Chemical compound CN1C=CC=C1CC(O)=O SYYOUHJJSOLSJD-UHFFFAOYSA-N 0.000 description 2
- FASPXTNRUAOAGU-UHFFFAOYSA-N 2-(carboxymethyl)-1,4-dimethylpyrrole-3-carboxylic acid Chemical compound CC1=CN(C)C(CC(O)=O)=C1C(O)=O FASPXTNRUAOAGU-UHFFFAOYSA-N 0.000 description 2
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- APSWAFZHMYVSMV-UHFFFAOYSA-N 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetonitrile Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC#N)N1C APSWAFZHMYVSMV-UHFFFAOYSA-N 0.000 description 2
- MYONKQXVOJJQNF-UHFFFAOYSA-N 2-[1-methyl-5-(5-methylthiophene-2-carbonyl)pyrrol-2-yl]acetic acid Chemical compound S1C(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C MYONKQXVOJJQNF-UHFFFAOYSA-N 0.000 description 2
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 2
- XIUGDICADCHKIA-UHFFFAOYSA-N 5-(4-chlorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-1,4-dimethylpyrrole-3-carboxylic acid Chemical compound CN1C(CC(=O)OCC)=C(C(O)=O)C(C)=C1C(=O)C1=CC=C(Cl)C=C1 XIUGDICADCHKIA-UHFFFAOYSA-N 0.000 description 2
- 238000005601 Bruylants amination reaction Methods 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000005265 dialkylamine group Chemical group 0.000 description 2
- KIVBKPDSRUIKOD-UHFFFAOYSA-N ethyl 2-(4-methyl-1h-pyrrol-2-yl)acetate Chemical compound CCOC(=O)CC1=CC(C)=CN1 KIVBKPDSRUIKOD-UHFFFAOYSA-N 0.000 description 2
- AMRFWXQTCZWLIN-UHFFFAOYSA-N ethyl 2-[1,4-dimethyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(C)=C1C(=O)C1=CC=C(C)C=C1 AMRFWXQTCZWLIN-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 2
- 230000011987 methylation Effects 0.000 description 2
- 238000007069 methylation reaction Methods 0.000 description 2
- 238000000199 molecular distillation Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 2
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 2
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 229960002895 phenylbutazone Drugs 0.000 description 2
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- ZXVNMYWKKDOREA-UHFFFAOYSA-N zomepirac Chemical compound C1=C(CC(O)=O)N(C)C(C(=O)C=2C=CC(Cl)=CC=2)=C1C ZXVNMYWKKDOREA-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- GSOKJSHWRGQMGP-UHFFFAOYSA-N 2-(1,3-dimethylpyrrol-2-yl)acetic acid Chemical compound CC=1C=CN(C)C=1CC(O)=O GSOKJSHWRGQMGP-UHFFFAOYSA-N 0.000 description 1
- MKVATVUOVMCHJJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetonitrile Chemical compound N#CCC1=CC=CN1 MKVATVUOVMCHJJ-UHFFFAOYSA-N 0.000 description 1
- GNNUZWRIYLKQRD-UHFFFAOYSA-N 2-(2-ethoxy-2-oxoethyl)-1,4-dimethyl-5-(4-methylbenzoyl)pyrrole-3-carboxylic acid Chemical compound CN1C(CC(=O)OCC)=C(C(O)=O)C(C)=C1C(=O)C1=CC=C(C)C=C1 GNNUZWRIYLKQRD-UHFFFAOYSA-N 0.000 description 1
- GZXHYAYAYYEGCV-UHFFFAOYSA-N 2-(3-methyl-1H-pyrrol-2-yl)acetamide Chemical compound CC1=C(NC=C1)CC(=O)N GZXHYAYAYYEGCV-UHFFFAOYSA-N 0.000 description 1
- PDICHLBXZGIZJW-UHFFFAOYSA-N 2-(4-methylphenyl)-1h-pyrrole Chemical compound C1=CC(C)=CC=C1C1=CC=CN1 PDICHLBXZGIZJW-UHFFFAOYSA-N 0.000 description 1
- BFCPYFZSBDOZRG-UHFFFAOYSA-N 2-(5-benzoyl-1-benzylpyrrol-2-yl)-n-[2-(diethylamino)ethyl]acetamide Chemical compound C=1C=CC=CC=1CN1C(CC(=O)NCCN(CC)CC)=CC=C1C(=O)C1=CC=CC=C1 BFCPYFZSBDOZRG-UHFFFAOYSA-N 0.000 description 1
- WVKPVCGHCFYVKZ-UHFFFAOYSA-N 2-(5-benzoyl-1-methylpyrrol-2-yl)acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=CC=C1 WVKPVCGHCFYVKZ-UHFFFAOYSA-N 0.000 description 1
- AKYFABNQLYZJJJ-UHFFFAOYSA-N 2-(carboxymethyl)-1,4-dimethyl-5-(4-methylbenzoyl)pyrrole-3-carboxylic acid Chemical compound OC(=O)C1=C(CC(O)=O)N(C)C(C(=O)C=2C=CC(C)=CC=2)=C1C AKYFABNQLYZJJJ-UHFFFAOYSA-N 0.000 description 1
- CJYLRPYNZFZRCI-UHFFFAOYSA-N 2-(carboxymethyl)-4-methyl-1h-pyrrole-3-carboxylic acid Chemical compound CC1=CNC(CC(O)=O)=C1C(O)=O CJYLRPYNZFZRCI-UHFFFAOYSA-N 0.000 description 1
- DPCBHULRLBCPAE-UHFFFAOYSA-N 2-(carboxymethyl)-5-(4-chlorobenzoyl)-1,4-dimethylpyrrole-3-carboxylic acid Chemical compound OC(=O)C1=C(CC(O)=O)N(C)C(C(=O)C=2C=CC(Cl)=CC=2)=C1C DPCBHULRLBCPAE-UHFFFAOYSA-N 0.000 description 1
- YDMBECGMOOFWQV-UHFFFAOYSA-N 2-[1,4-dimethyl-5-(2-methylbenzoyl)pyrrol-2-yl]-n,n-dimethylacetamide Chemical compound CN1C(CC(=O)N(C)C)=CC(C)=C1C(=O)C1=CC=CC=C1C YDMBECGMOOFWQV-UHFFFAOYSA-N 0.000 description 1
- VDGYLCAHPDYXOE-UHFFFAOYSA-N 2-[1,4-dimethyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetamide Chemical compound C1=C(CC(N)=O)N(C)C(C(=O)C=2C=CC(C)=CC=2)=C1C VDGYLCAHPDYXOE-UHFFFAOYSA-N 0.000 description 1
- AXQBDYAXJNCIFH-UHFFFAOYSA-N 2-[1,4-dimethyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetic acid Chemical compound C1=C(CC(O)=O)N(C)C(C(=O)C=2C=CC(C)=CC=2)=C1C AXQBDYAXJNCIFH-UHFFFAOYSA-N 0.000 description 1
- VKMINBJGZTZSQT-UHFFFAOYSA-N 2-[1-benzyl-5-(4-chlorobenzoyl)pyrrol-2-yl]-n-[2-(diethylamino)ethyl]acetamide Chemical compound C=1C=CC=CC=1CN1C(CC(=O)NCCN(CC)CC)=CC=C1C(=O)C1=CC=C(Cl)C=C1 VKMINBJGZTZSQT-UHFFFAOYSA-N 0.000 description 1
- NFXGEJYIVFHILY-UHFFFAOYSA-N 2-[1-benzyl-5-(4-chlorobenzoyl)pyrrol-2-yl]-n-hydroxyacetamide Chemical compound C=1C=CC=CC=1CN1C(CC(=O)NO)=CC=C1C(=O)C1=CC=C(Cl)C=C1 NFXGEJYIVFHILY-UHFFFAOYSA-N 0.000 description 1
- RVVJEUOAPMNYLC-UHFFFAOYSA-N 2-[1-benzyl-5-(4-chlorobenzoyl)pyrrol-2-yl]acetic acid Chemical compound C=1C=CC=CC=1CN1C(CC(=O)O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 RVVJEUOAPMNYLC-UHFFFAOYSA-N 0.000 description 1
- YKWWOZLIAHBKMV-UHFFFAOYSA-N 2-[1-methyl-4-(thiophene-2-carbonyl)pyrrol-2-yl]acetonitrile Chemical compound C1=C(CC#N)N(C)C=C1C(=O)C1=CC=CS1 YKWWOZLIAHBKMV-UHFFFAOYSA-N 0.000 description 1
- HFSPORPSCFUVRI-UHFFFAOYSA-N 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetamide Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC(N)=O)N1C HFSPORPSCFUVRI-UHFFFAOYSA-N 0.000 description 1
- MFAVVOIZTMLUFI-UHFFFAOYSA-N 2-[1-methyl-5-(5-methylthiophene-2-carbonyl)pyrrol-2-yl]acetonitrile Chemical compound S1C(C)=CC=C1C(=O)C1=CC=C(CC#N)N1C MFAVVOIZTMLUFI-UHFFFAOYSA-N 0.000 description 1
- BTEFBXINRCAVSF-UHFFFAOYSA-N 2-[1-methyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C(C(F)(F)F)C=C1 BTEFBXINRCAVSF-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- DCPQSDRGXGSUKZ-UHFFFAOYSA-N 2-[5-(2,4-dichlorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1Cl DCPQSDRGXGSUKZ-UHFFFAOYSA-N 0.000 description 1
- NXSLAADQLANKHM-UHFFFAOYSA-N 2-[5-(2-chlorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=CC=C1Cl NXSLAADQLANKHM-UHFFFAOYSA-N 0.000 description 1
- UNDQNPGQMIEGRR-UHFFFAOYSA-N 2-[5-(4-aminobenzoyl)-1,4-dimethylpyrrol-2-yl]acetamide Chemical compound C1=C(CC(N)=O)N(C)C(C(=O)C=2C=CC(N)=CC=2)=C1C UNDQNPGQMIEGRR-UHFFFAOYSA-N 0.000 description 1
- IYHCQYYGQKJKMI-UHFFFAOYSA-N 2-[5-(4-aminobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(N)C=C1 IYHCQYYGQKJKMI-UHFFFAOYSA-N 0.000 description 1
- GJPFRHFVVYRSQW-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]-n,n-diethylacetamide Chemical compound CN1C(CC(=O)N(CC)CC)=CC(C)=C1C(=O)C1=CC=C(Cl)C=C1 GJPFRHFVVYRSQW-UHFFFAOYSA-N 0.000 description 1
- GTVPEIYWQRQCBZ-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]acetamide Chemical compound C1=C(CC(N)=O)N(C)C(C(=O)C=2C=CC(Cl)=CC=2)=C1C GTVPEIYWQRQCBZ-UHFFFAOYSA-N 0.000 description 1
- ZXVNMYWKKDOREA-UHFFFAOYSA-M 2-[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]acetate Chemical compound C1=C(CC([O-])=O)N(C)C(C(=O)C=2C=CC(Cl)=CC=2)=C1C ZXVNMYWKKDOREA-UHFFFAOYSA-M 0.000 description 1
- OFSSFIWENVBKOB-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-ethylpyrrol-2-yl]acetic acid Chemical compound CCN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 OFSSFIWENVBKOB-UHFFFAOYSA-N 0.000 description 1
- ZWUBGDPUVGOZMR-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 ZWUBGDPUVGOZMR-UHFFFAOYSA-N 0.000 description 1
- GDRPXPPAYAOCIK-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C(Cl)C=C1 GDRPXPPAYAOCIK-UHFFFAOYSA-N 0.000 description 1
- VJYBXSPJIFMJQO-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1h-pyrrol-2-yl]acetic acid Chemical compound N1C(CC(=O)O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 VJYBXSPJIFMJQO-UHFFFAOYSA-N 0.000 description 1
- KBHBZLXMVLDFMX-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-4-methyl-1h-pyrrol-3-yl]acetic acid Chemical compound OC(=O)CC1=CNC(C(=O)C=2C=CC(Cl)=CC=2)=C1C KBHBZLXMVLDFMX-UHFFFAOYSA-N 0.000 description 1
- JGKDVCWHDCMRTN-UHFFFAOYSA-N 2-[5-(4-fluorobenzoyl)-1,4-dimethylpyrrol-2-yl]acetic acid Chemical compound C1=C(CC(O)=O)N(C)C(C(=O)C=2C=CC(F)=CC=2)=C1C JGKDVCWHDCMRTN-UHFFFAOYSA-N 0.000 description 1
- IJORGWGJHZNCNN-UHFFFAOYSA-N 2-[5-(4-fluorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(F)C=C1 IJORGWGJHZNCNN-UHFFFAOYSA-N 0.000 description 1
- QDZACITZLASKAX-UHFFFAOYSA-N 2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C QDZACITZLASKAX-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- XDNDSAQVXNZKGP-UHFFFAOYSA-N 3-(1h-pyrrol-2-yl)propanoic acid Chemical compound OC(=O)CCC1=CC=CN1 XDNDSAQVXNZKGP-UHFFFAOYSA-N 0.000 description 1
- OIMRLHCSLQUXLL-UHFFFAOYSA-N 3-chlorobutan-2-one Chemical compound CC(Cl)C(C)=O OIMRLHCSLQUXLL-UHFFFAOYSA-N 0.000 description 1
- ZEBBLOXDLGIMEG-UHFFFAOYSA-N 3-ethyl-2,4-dimethyl-1h-pyrrole Chemical compound CCC=1C(C)=CNC=1C ZEBBLOXDLGIMEG-UHFFFAOYSA-N 0.000 description 1
- GSNKRSKIWFBWEG-UHFFFAOYSA-N 3-ethylpentan-2-one Chemical compound CCC(CC)C(C)=O GSNKRSKIWFBWEG-UHFFFAOYSA-N 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- YTQYCKKPBNWOOR-UHFFFAOYSA-N 5-(4-chlorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-ethyl-1-methylpyrrole-3-carboxylic acid Chemical compound CN1C(CC(=O)OCC)=C(C(O)=O)C(CC)=C1C(=O)C1=CC=C(Cl)C=C1 YTQYCKKPBNWOOR-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 235000009161 Espostoa lanata Nutrition 0.000 description 1
- 240000001624 Espostoa lanata Species 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- GSEKYIWUAPZIEF-UHFFFAOYSA-N Ismine Chemical compound CNC1=CC=CC=C1C(C(=C1)CO)=CC2=C1OCO2 GSEKYIWUAPZIEF-UHFFFAOYSA-N 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- YVDWMBAZNAOWHG-UHFFFAOYSA-N acetic acid;1h-pyrrole Chemical class CC(O)=O.C=1C=CNC=1 YVDWMBAZNAOWHG-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M acrylate group Chemical group C(C=C)(=O)[O-] NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000003936 benzamides Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- CSDIELVFGGMRBB-UHFFFAOYSA-N butyl 2-[1,4-dimethyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCCCC)=CC(C)=C1C(=O)C1=CC=C(C)C=C1 CSDIELVFGGMRBB-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- WJYHCYBNUJVCEH-UHFFFAOYSA-N cyclohexane;ethoxyethane Chemical compound CCOCC.C1CCCCC1 WJYHCYBNUJVCEH-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ZSANYRMTSBBUCA-UHFFFAOYSA-N diethyl 3-oxopentanedioate Chemical compound CCOC(=O)CC(=O)CC(=O)OCC ZSANYRMTSBBUCA-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- SBNKFTQSBPKMBZ-UHFFFAOYSA-N ethenzamide Chemical compound CCOC1=CC=CC=C1C(N)=O SBNKFTQSBPKMBZ-UHFFFAOYSA-N 0.000 description 1
- YWLMDVDPKZKLNL-UHFFFAOYSA-N ethyl 2-(2-ethoxy-2-oxoethyl)-1,4-dimethylpyrrole-3-carboxylate Chemical compound CCOC(=O)CC1=C(C(=O)OCC)C(C)=CN1C YWLMDVDPKZKLNL-UHFFFAOYSA-N 0.000 description 1
- ZTLIMKAFEGDINL-UHFFFAOYSA-N ethyl 2-(2-ethoxy-2-oxoethyl)-4-ethyl-1-methylpyrrole-3-carboxylate Chemical compound CCOC(=O)CC1=C(C(=O)OCC)C(CC)=CN1C ZTLIMKAFEGDINL-UHFFFAOYSA-N 0.000 description 1
- XJEDRWZSHYNYGV-UHFFFAOYSA-N ethyl 2-(4-butyl-1-methylpyrrol-2-yl)acetate Chemical compound CCCCC=1C=C(CC(=O)OCC)N(C)C=1 XJEDRWZSHYNYGV-UHFFFAOYSA-N 0.000 description 1
- JZCHXMPVTCORDD-UHFFFAOYSA-N ethyl 2-(5-benzoyl-2,4-dimethyl-1h-pyrrol-3-yl)acetate Chemical group CCOC(=O)CC1=C(C)NC(C(=O)C=2C=CC=CC=2)=C1C JZCHXMPVTCORDD-UHFFFAOYSA-N 0.000 description 1
- IOZMHVNJLWDFLK-UHFFFAOYSA-N ethyl 2-[1,4-dimethyl-5-(4-methylbenzenecarbothioyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(C)=C1C(=S)C1=CC=C(C)C=C1 IOZMHVNJLWDFLK-UHFFFAOYSA-N 0.000 description 1
- PXRRXXGYCFSERC-UHFFFAOYSA-N ethyl 2-[1,4-dimethyl-5-(4-nitrobenzoyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(C)=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1 PXRRXXGYCFSERC-UHFFFAOYSA-N 0.000 description 1
- ODMLPMMYWSXAHH-UHFFFAOYSA-N ethyl 2-[1,4-dimethyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(C)=C1C(=O)C1=CC=C(C(F)(F)F)C=C1 ODMLPMMYWSXAHH-UHFFFAOYSA-N 0.000 description 1
- QEEXKXWGSJYDHY-UHFFFAOYSA-N ethyl 2-[1-butyl-4-ethyl-5-(4-methylbenzenecarbothioyl)pyrrol-2-yl]acetate Chemical compound CCCCN1C(CC(=O)OCC)=CC(CC)=C1C(=S)C1=CC=C(C)C=C1 QEEXKXWGSJYDHY-UHFFFAOYSA-N 0.000 description 1
- BOGYFFNQFOMZDK-UHFFFAOYSA-N ethyl 2-[1-butyl-4-ethyl-5-[4-(trifluoromethyl)benzoyl]pyrrol-2-yl]acetate Chemical compound CCCCN1C(CC(=O)OCC)=CC(CC)=C1C(=O)C1=CC=C(C(F)(F)F)C=C1 BOGYFFNQFOMZDK-UHFFFAOYSA-N 0.000 description 1
- MIKVPGGJHLICOB-UHFFFAOYSA-N ethyl 2-[1-methyl-5-(thiophene-2-carbonyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC=C1C(=O)C1=CC=CS1 MIKVPGGJHLICOB-UHFFFAOYSA-N 0.000 description 1
- MXFMGCFRMFVABL-UHFFFAOYSA-N ethyl 2-[4-butyl-1-methyl-5-(4-nitrobenzoyl)pyrrol-2-yl]acetate Chemical compound C1=C(CC(=O)OCC)N(C)C(C(=O)C=2C=CC(=CC=2)[N+]([O-])=O)=C1CCCC MXFMGCFRMFVABL-UHFFFAOYSA-N 0.000 description 1
- HASURWXSEQMUFQ-UHFFFAOYSA-N ethyl 2-[5-(4-aminobenzoyl)-1,4-dimethylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC(C)=C1C(=O)C1=CC=C(N)C=C1 HASURWXSEQMUFQ-UHFFFAOYSA-N 0.000 description 1
- CNLUWSAILNXHRJ-UHFFFAOYSA-N ethyl 2-[5-(4-chlorobenzoyl)-3-ethoxy-1,4-dimethylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=C(OCC)C(C)=C1C(=O)C1=CC=C(Cl)C=C1 CNLUWSAILNXHRJ-UHFFFAOYSA-N 0.000 description 1
- NXCXUUSRXIDGRA-UHFFFAOYSA-N ethyl 5-(4-chlorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-1,4-dimethylpyrrole-3-carboxylate Chemical compound CN1C(CC(=O)OCC)=C(C(=O)OCC)C(C)=C1C(=O)C1=CC=C(Cl)C=C1 NXCXUUSRXIDGRA-UHFFFAOYSA-N 0.000 description 1
- RYXYLCADRVYOKV-UHFFFAOYSA-N ethyl 5-(4-chlorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-ethyl-1-methylpyrrole-3-carboxylate Chemical compound CN1C(CC(=O)OCC)=C(C(=O)OCC)C(CC)=C1C(=O)C1=CC=C(Cl)C=C1 RYXYLCADRVYOKV-UHFFFAOYSA-N 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- DBZAKDWHLMMQHL-UHFFFAOYSA-N methyl 2-(2-methoxy-2-oxoethyl)-4-methyl-1h-pyrrole-3-carboxylate Chemical compound COC(=O)CC=1NC=C(C)C=1C(=O)OC DBZAKDWHLMMQHL-UHFFFAOYSA-N 0.000 description 1
- DBPNAHBQVFPAJR-UHFFFAOYSA-N n-[2-(diethylamino)ethyl]-2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]acetamide Chemical compound CN1C(CC(=O)NCCN(CC)CC)=CC=C1C(=O)C1=CC=C(OC)C=C1 DBPNAHBQVFPAJR-UHFFFAOYSA-N 0.000 description 1
- CJHSLNGTLIKHNX-UHFFFAOYSA-N n-[2-(dimethylamino)propyl]-2-[1-methyl-5-(4-methylbenzenecarbothioyl)pyrrol-2-yl]acetamide Chemical compound CN1C(CC(=O)NCC(C)N(C)C)=CC=C1C(=S)C1=CC=C(C)C=C1 CJHSLNGTLIKHNX-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- FSCDWXKDDODGQP-UHFFFAOYSA-N n-hydroxy-2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]acetamide Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(CC(=O)NO)N1C FSCDWXKDDODGQP-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- UPSPUYADGBWSHF-UHFFFAOYSA-N tolmetin Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C UPSPUYADGBWSHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/337—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US595870A | 1970-01-26 | 1970-01-26 | |
| US338461A US3865840A (en) | 1970-01-26 | 1973-02-16 | Process of preparing 1,4-diloweralkyl-3-loweralkoxy-carbonyl-2-acetates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2102746A1 true DE2102746A1 (de) | 1971-08-12 |
Family
ID=26674970
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712102746 Withdrawn DE2102746A1 (de) | 1970-01-26 | 1971-01-21 | 5 Aroylpyrrole |
Country Status (10)
| Country | Link |
|---|---|
| US (3) | US3752826A (https=) |
| JP (4) | JPS582936B2 (https=) |
| AT (4) | AT313270B (https=) |
| BE (1) | BE762060R (https=) |
| CH (2) | CH547279A (https=) |
| DE (1) | DE2102746A1 (https=) |
| FR (1) | FR2081455B2 (https=) |
| GB (1) | GB1327308A (https=) |
| NL (1) | NL7101016A (https=) |
| SE (1) | SE389670B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2628475A1 (de) * | 1975-06-27 | 1977-01-13 | Mcneilab Inc | Halogensubstituierte 5-aroylpyrrol- 2-essigsaeure-derivate |
Families Citing this family (87)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3998844A (en) * | 1975-06-02 | 1976-12-27 | Mcneil Laboratories, Incorporated | Uncatalyzed aroylation of 1-alkylpyrrole-2-acetic acid derivatives |
| US4185100A (en) * | 1976-05-13 | 1980-01-22 | Johnson & Johnson | Topical anti-inflammatory drug therapy |
| US4125537A (en) * | 1977-02-07 | 1978-11-14 | Mcneil Laboratories, Incorporated | Preparation of pyrrole-2-acetates |
| DE2819463A1 (de) * | 1977-05-10 | 1978-11-16 | Beecham Group Ltd | N-methyl-pyrrol-verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende pharmazeutische praeparate |
| US4200645A (en) * | 1977-05-10 | 1980-04-29 | Beecham Group Limited | Pyrrole derivatives |
| GB1592996A (en) * | 1977-10-10 | 1981-07-15 | Rolland Sa A | Acylated pyrrole carboxylic acids and derivatives thereof |
| GB1592997A (en) * | 1977-10-14 | 1981-07-15 | Rolland Sa A | Aroyl-pyrrole carboxylic acids and derivatives thereof |
| SE435278B (sv) * | 1977-12-08 | 1984-09-17 | Sagami Chem Res | 5-cyano-1-legre(c?711?71-?714)alkyl-pyrrol-2-ettiksyra, framstellning derav och anvendningen som mellanprodukt vid framstellning av terapeutiskt verksamma pyrrolderivat |
| DE2861595D1 (en) * | 1978-07-10 | 1982-03-11 | Mcneilab Inc | Pharmaceutical composition comprising a 5-aroyl-1-c1-5 alkyl-pyrrole-2-acetic acid compound and acetaminophen or acetylsalicylic acid |
| JPS5517305A (en) * | 1978-07-21 | 1980-02-06 | Mcneilab Inc | Antiiarthritis synergism |
| CA1105039A (en) * | 1978-10-19 | 1981-07-14 | Douglas A. Robinson | Process for producing substituted pyrrole diesters |
| EP0010553B1 (en) * | 1978-10-27 | 1983-05-18 | McNeilab, Inc. | Process of reducing a loweralkyl 1-loweralkyl-pyrrole-2-glyoxylate to a loweralkyl 1-loweralkyl-pyrrole-2-acetate |
| US4246175A (en) * | 1979-05-29 | 1981-01-20 | Ethyl Corporation | Synthesis of 5-cyano-1-hydrocarbylpyrrole-2-acetic acid |
| US4213905A (en) * | 1979-06-25 | 1980-07-22 | Mcneilab, Inc. | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid salts |
| ATE4202T1 (de) * | 1979-08-13 | 1983-08-15 | Mcneilab, Inc. | Verfahren zur herstellung von pyrrol-2essigs[ureestern. |
| US4363918A (en) * | 1979-09-11 | 1982-12-14 | Janssen Pharmaceutica N.V. | Method of preparing 1-alkyl-3-carboxy-1H pyrrole-2-acetic acids |
| US4284562A (en) * | 1979-11-27 | 1981-08-18 | Mcneilab, Inc. | Process for preparing pyrrole-2-acetic acids |
| US4255335A (en) * | 1980-04-03 | 1981-03-10 | Mcneilab, Inc. | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid derivatives |
| US4388468A (en) * | 1980-04-04 | 1983-06-14 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4333878A (en) * | 1980-04-04 | 1982-06-08 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4565878A (en) * | 1980-04-04 | 1986-01-21 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4374255A (en) * | 1980-04-04 | 1983-02-15 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4565879A (en) * | 1980-04-04 | 1986-01-21 | Ethyl Corporation | Process for producing substituted pyrroles |
| NZ196700A (en) * | 1980-04-18 | 1983-04-12 | Smith & Nephew Ass | Anti-inflammatory compositions containing 5-benzoyl-1-methylpyrrole-2-acetic acid derivatives |
| US4299770A (en) * | 1980-05-29 | 1981-11-10 | Mallinckrodt, Inc. | Recovery of substituted pyrrole acetate |
| US4396626A (en) * | 1980-10-09 | 1983-08-02 | Beecham Group Limited | Cyclic compounds and their use |
| CA1161851A (en) * | 1980-11-03 | 1984-02-07 | G. Patrick Stahly | Process for producing substituted pyrroles |
| ES497136A0 (es) * | 1980-11-11 | 1981-10-16 | Calzada & Co | Procedimiento para la sintesis de esteres de la n-(4'hidro- xifenil) acetamida con acidos 5-benzoil-1-metilpirrol-2-ace-tico |
| US4451658A (en) * | 1980-11-24 | 1984-05-29 | Ethyl Corporation | Process for producing substituted pyrroles |
| JPS57501964A (https=) * | 1980-12-15 | 1982-11-04 | ||
| US4374254A (en) * | 1981-01-23 | 1983-02-15 | Ethyl Corporation | Process for producing substituted pyrroles |
| AT370721B (de) * | 1981-02-24 | 1983-04-25 | Ciba Geigy Ag | Verfahren zur herstellung von neuen salzen der 2- (2,6-dichloranilino)-phenylessigsaeure, der |
| US4322427A (en) * | 1981-04-16 | 1982-03-30 | Bristol-Myers Company | Analgetic compositions and methods of use |
| US4511576A (en) * | 1981-04-23 | 1985-04-16 | Pfizer Inc. | Antidiabetic pyrrolecarboxylic acids |
| US4374997A (en) * | 1981-06-04 | 1983-02-22 | Merck & Co., Inc. | Process for the preparation of zomepirac and related compounds |
| US4380645A (en) * | 1981-12-11 | 1983-04-19 | Merck & Co., Inc. | Process for preparing Benzoxepino- or Benzthiapino[4,3-b]pyrrole-2-acetic acids |
| US4455433A (en) * | 1981-11-02 | 1984-06-19 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4383117A (en) * | 1981-11-02 | 1983-05-10 | Ethyl Corporation | Process for producing substituted pyrroles |
| ES8206468A1 (es) * | 1981-11-16 | 1982-08-16 | Pharmedical Sa Lab | Procedimiento de preparacion de derivados del acido 2-pirrol-acetico. |
| DE3145510A1 (de) * | 1981-11-17 | 1983-05-26 | Rütgerswerke AG, 6000 Frankfurt | Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureestern |
| IT1210673B (it) * | 1982-02-26 | 1989-09-20 | Medosan Ind Biochimi | Antinfiammatoria amidi pirrolacetiche ad attivita' |
| IT1148117B (it) * | 1982-03-05 | 1986-11-26 | Medosan Ind Biochimi | Attivita'antiflogistica,analgesica,antipiretica,mucolitica e seda tiva della tosse dell'1 metil-5-p-tolilpirrol-2-acetato di 2'metossi-fenile |
| EP0089393A1 (en) * | 1982-03-23 | 1983-09-28 | Ethyl Corporation | Process for producing substituted pyrroles |
| IT1151731B (it) * | 1982-04-21 | 1986-12-24 | Montedison Spa | Processo per la preparazione dell'acido 3-carbossi-1,4-dimetilpirrol-2-acetico |
| HU187137B (en) * | 1982-06-22 | 1985-11-28 | Richter Gedeon Vegyeszet | Process for producing esters of 1-alkyl- orl,4-dialkyl-1h-pyrrol-acetic acid |
| IT1153750B (it) * | 1982-09-21 | 1987-01-14 | Montedison Spa | Processo per la preparazione dell'acido 3-carbossi-1-metilpirrol-2-acetico |
| US4585784A (en) * | 1983-01-26 | 1986-04-29 | Mcneilab, Inc. | Pyrrole-2-acetylamino acid derivative compounds |
| YU251283A (en) * | 1983-01-26 | 1986-04-30 | Mcneilab Inc | Process for obtaining pyrrol-2-acetylamino acid derivatives |
| IT1203656B (it) * | 1983-06-10 | 1989-02-15 | Medosan Ind Biochimi | Attivita' antiaggregante piastrinica,antiinfiammatoria e broncolitica di esteri aroilpirrol e pirrilfenil acetici delle 7 (w-ossialchil) teofilline |
| IT1197688B (it) * | 1983-07-29 | 1988-12-06 | Medosan Ind Biochimi | Attivita' antiflogistica,analgesica,antipiretica ed antiaggregante piastrinica di 1-metil-5-metilbenzoilpirrol-2-acetamido acetanilidi |
| FR2564831B3 (fr) * | 1984-05-25 | 1986-09-05 | Rolland Sa A | Nouveaux derives des acides aroyl- ou hydroaroyl n-alcoyl pyrrolyl-2 carboxyliques et nouvelles compositions pharmaceutiques a action immuno-suppressive |
| JPS61277704A (ja) * | 1985-06-03 | 1986-12-08 | 発研株式会社 | 路面円形切断機 |
| JPS61206707U (https=) * | 1985-06-11 | 1986-12-27 | ||
| US4874872A (en) * | 1987-01-14 | 1989-10-17 | Syntex (U.S.A.) Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-A]pyrrole-1,7-dicarboxylates |
| US4835288A (en) * | 1987-01-14 | 1989-05-30 | Syntex Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-a]pyrrole-1,7-dicarboxylates |
| US4937368A (en) * | 1987-01-14 | 1990-06-26 | Syntex (U.S.A.) Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-A]pyrrole-1,7-dicarboxylates |
| JPH0830014B2 (ja) * | 1988-04-28 | 1996-03-27 | 住友化学工業株式会社 | 芳香族化合物のアシル化方法 |
| US5235068A (en) * | 1988-04-28 | 1993-08-10 | Sumitomo Chemical Company, Limited | Process for producing acylaromatic compounds |
| US5360881A (en) * | 1989-06-14 | 1994-11-01 | Societe Francaise Hoechst | Method of cross-linking ethylene monomers using diallyloxyacetic acid and its basic addition salts as cross-linking agents |
| AU658373B2 (en) * | 1990-11-06 | 1995-04-13 | Fgn, Inc. | Esters and amides of substituted pyrrole acetic acids |
| KR970706250A (ko) * | 1994-09-27 | 1997-11-03 | 우에노 도시오 | 5원 헤테로시클릭 화합물(five membered heterocyclic compounds) |
| US5622948A (en) * | 1994-12-01 | 1997-04-22 | Syntex (U.S.A.) Inc. | Pyrrole pyridazine and pyridazinone anti-inflammatory agents |
| US5859042A (en) * | 1995-09-27 | 1999-01-12 | Ono Pharmaceutical Co., Ltd. | Five membered heterocyclic compounds |
| DK0906279T3 (da) * | 1996-05-30 | 2003-02-03 | Hoffmann La Roche | Pyrrolderivater |
| CA2205757C (en) * | 1996-05-30 | 2006-01-24 | F. Hoffmann-La Roche Ag | Pyridazinone derivatives and their use as inhibitors of prostaglandin g/h synthase i and ii(cox i and ii) |
| US5858694A (en) * | 1997-05-30 | 1999-01-12 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of cancerous lesions |
| CA2238283C (en) | 1997-05-30 | 2002-08-20 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of neoplastic lesions, pharmaceutical compositions from such compounds and uses of such compounds and compositions for treating neoplastic lesions |
| US6410584B1 (en) * | 1998-01-14 | 2002-06-25 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells with indole derivatives |
| US6130053A (en) * | 1999-08-03 | 2000-10-10 | Cell Pathways, Inc. | Method for selecting compounds for inhibition of neoplastic lesions |
| US5939417A (en) * | 1998-10-19 | 1999-08-17 | Cell Pathways Inc | 1,3,6-trihydro-6-aza-3-oxapentalen-2-one derivatives for the treatment of neoplasia |
| US6133271A (en) * | 1998-11-19 | 2000-10-17 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure thienopyrimidine derivatives |
| US6187779B1 (en) | 1998-11-20 | 2001-02-13 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 2,8-disubstituted quinazoline derivatives |
| US6369092B1 (en) | 1998-11-23 | 2002-04-09 | Cell Pathways, Inc. | Method for treating neoplasia by exposure to substituted benzimidazole derivatives |
| US6077842A (en) * | 1998-11-24 | 2000-06-20 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with pyrazolopyridylpyridazinone derivatives |
| US6486155B1 (en) | 1998-11-24 | 2002-11-26 | Cell Pathways Inc | Method of inhibiting neoplastic cells with isoquinoline derivatives |
| US6034099A (en) * | 1998-11-24 | 2000-03-07 | Cell Pathways, Inc. | Method for inhibiting neoplastic lesions by administering 4-(arylmethylene)- 2, 3- dihydro-pyrazol-3-ones |
| US6025394A (en) | 1999-01-29 | 2000-02-15 | Cell Pathways, Inc. | Method for treating patients with acne by administering substituted sulfonyl indenyl acetic acids, amides and alcohols |
| US6020379A (en) * | 1999-02-19 | 2000-02-01 | Cell Pathways, Inc. | Position 7 substituted indenyl-3-acetic acid derivatives and amides thereof for the treatment of neoplasia |
| US6555547B1 (en) | 2000-02-28 | 2003-04-29 | Cell Pathways, Inc. | Method for treating a patient with neoplasia by treatment with a vinca alkaloid derivative |
| US6569638B1 (en) | 2000-03-03 | 2003-05-27 | Cell Pathways, Inc | Method for screening compounds for the treatment of neoplasia |
| US20030162824A1 (en) * | 2001-11-12 | 2003-08-28 | Krul Elaine S. | Methods of treating or preventing a cardiovascular condition using a cyclooxygenase-1 inhibitor |
| RU2356887C2 (ru) * | 2003-02-06 | 2009-05-27 | ДОМПЕ ФА.Р.МА.С.п.А. | 2-арилуксусные кислоты, их производные и содержащие их фармацевтические композиции |
| WO2009072139A1 (en) * | 2007-12-07 | 2009-06-11 | Matrix Laboratories Limited | Process for producing 2-[1-methyl-5-(4-methylbenzoyl)- pyrrol-2- yl]acetic acid or salt thereof |
| DK2315590T3 (da) | 2008-08-15 | 2012-11-19 | N30 Pharmaceuticals Inc | Pyrrolinhibitorer af S-nitrosoglutathionreduktase |
| DK2318007T3 (da) | 2008-08-15 | 2013-03-25 | N30 Pharmaceuticals Inc | Nye pyrrol-inhibitorer af s-nitrosoglutathion-reduktase som terapeutiske midler |
| WO2010019910A1 (en) | 2008-08-15 | 2010-02-18 | N30 Pharmaceuticals, Llc | Novel pyrrole inhibitors of s-nitrosoglutathione reductase as therapeutic agents |
| CN103435527B (zh) * | 2013-09-03 | 2015-09-23 | 张家港市信谊化工有限公司 | 一种非甾体抗炎药托美汀的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4317963Y1 (https=) * | 1966-05-04 | 1968-07-25 | ||
| ES356485A1 (es) * | 1967-07-26 | 1970-01-16 | Mcneilab Inc | Un procedimiento para la preparacion de nuevos acidos 5- aroilpirrol-2-carboxilicos y derivados de acido carboxilico. |
-
1970
- 1970-01-26 US US00005958A patent/US3752826A/en not_active Expired - Lifetime
-
1971
- 1971-01-21 DE DE19712102746 patent/DE2102746A1/de not_active Withdrawn
- 1971-01-22 CH CH101571A patent/CH547279A/xx not_active IP Right Cessation
- 1971-01-22 CH CH667973A patent/CH566984A5/xx not_active IP Right Cessation
- 1971-01-25 SE SE7100820A patent/SE389670B/xx unknown
- 1971-01-25 AT AT700672A patent/AT313270B/de not_active IP Right Cessation
- 1971-01-25 AT AT59271A patent/AT313268B/de not_active IP Right Cessation
- 1971-01-25 AT AT700772A patent/AT313271B/de active
- 1971-01-25 FR FR7102343A patent/FR2081455B2/fr not_active Expired
- 1971-01-25 AT AT700572A patent/AT308735B/de not_active IP Right Cessation
- 1971-01-26 NL NL7101016A patent/NL7101016A/xx not_active Application Discontinuation
- 1971-01-26 BE BE762060A patent/BE762060R/xx active
- 1971-04-19 GB GB2020071A patent/GB1327308A/en not_active Expired
-
1973
- 1973-02-16 US US338461A patent/US3865840A/en not_active Expired - Lifetime
-
1974
- 1974-06-17 US US05/479,733 patent/US4070368A/en not_active Expired - Lifetime
-
1978
- 1978-01-25 JP JP53007119A patent/JPS582936B2/ja not_active Expired
- 1978-01-25 JP JP53007118A patent/JPS582935B2/ja not_active Expired
-
1980
- 1980-06-05 JP JP7603380A patent/JPS55162767A/ja active Granted
- 1980-06-05 JP JP55076034A patent/JPS591711B2/ja not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2628475A1 (de) * | 1975-06-27 | 1977-01-13 | Mcneilab Inc | Halogensubstituierte 5-aroylpyrrol- 2-essigsaeure-derivate |
Also Published As
| Publication number | Publication date |
|---|---|
| US3865840A (en) | 1975-02-11 |
| JPS55162766A (en) | 1980-12-18 |
| FR2081455A2 (https=) | 1971-12-03 |
| AT308735B (de) | 1973-07-25 |
| AT313270B (de) | 1974-02-11 |
| US4070368A (en) | 1978-01-24 |
| SE389670B (sv) | 1976-11-15 |
| US3752826A (en) | 1973-08-14 |
| AT313268B (de) | 1974-02-11 |
| CH547279A (de) | 1974-03-29 |
| GB1327308A (en) | 1973-08-22 |
| JPS5533402A (en) | 1980-03-08 |
| JPS5745428B2 (https=) | 1982-09-28 |
| CH566984A5 (https=) | 1975-09-30 |
| BE762060R (https=) | 1971-07-26 |
| AT313271B (de) | 1974-02-11 |
| JPS5533401A (en) | 1980-03-08 |
| JPS591711B2 (ja) | 1984-01-13 |
| JPS582936B2 (ja) | 1983-01-19 |
| FR2081455B2 (https=) | 1974-09-06 |
| NL7101016A (https=) | 1971-07-28 |
| JPS55162767A (en) | 1980-12-18 |
| JPS582935B2 (ja) | 1983-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2102746A1 (de) | 5 Aroylpyrrole | |
| DE2835701C2 (de) | Cycloalkylidenmethylphenylessigsäurederivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische Zusammensetzungen | |
| DE2628475A1 (de) | Halogensubstituierte 5-aroylpyrrol- 2-essigsaeure-derivate | |
| DE2807623C2 (de) | 2-Phenoxyphenyl-pyrrolidinderivate, deren Salze, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE2165260A1 (de) | Verfahren zur Herstellung von N-substituierten Dibenzo eckige Klammer auf b,f eckige Klammer zu thiepin-10-methylaminen und zugehörige neue Zwischenprodukte | |
| DE3329628A1 (de) | Derivate der (omega)-aminsaeuren, deren herstellung und verwendung sowie diese derivate enthaltende zubereitungen | |
| DE4325204C2 (de) | Acylpyrrolalkansäuren und ihre Derivate als Hemmstoffe der Phospholipase A¶2¶ | |
| DE1695044C3 (de) | Neuep-(1-Pyrryl)-phenylessigsäuren und deren Salze | |
| CH518929A (de) | Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäurederivate | |
| DE1543639A1 (de) | Verfahren zur Herstellung von neuen substituierten Phenylessigsaeuren | |
| DE2023000C2 (de) | Neue 5-Cycloalkyl-1-indancarbonsäuren, 6-Cycloalkyltetralin-1-carbonsäuren, Derivate davon und Verfahren zu ihrer Herstellung | |
| DE2356903A1 (de) | Verfahren zur herstellung substituierter chromon-3-carbonitrile, -carboxamide und -carbonsaeuren | |
| DE1618465C3 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1959898A1 (de) | ortho-substituierte Phenaethylamine und Verfahren zu ihrer Herstellung | |
| DE2004038C3 (de) | 5-Cyclohexyl-1-indancarbonsäuren,,deren Niedrigalkyl- und tert.-Aminoniedrigalkylester, nicht-toxische pharmakologisch verträgliche Salze und Verfahren zu deren Herstellung | |
| DE2907379A1 (de) | Benzylidenderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE1643198A1 (de) | Diarylcyclopropanderivate und Verfahren zu ihrer Herstellung | |
| CH644861A5 (en) | Process for the preparation of 5-(2-furoyl)-, 5-(2-thenoyl)-, 5-(3-furoyl)- and 5-(3-thenoyl)-1,2-dihydro-3H-pyrrolo-[1,2-a]pyrrole-1-carboxylic acid derivatives | |
| DE2039426B2 (https=) | ||
| DE3317666A1 (de) | Verfahren zur herstellung von (alpha)-(n-pyrrolyl)-substituierten saeuren, deren salzen und estern, sowie dieselben enthaltende pharmazeutische zusammensetzungen | |
| DE2154525A1 (de) | Isoindolinderivate und Verfahren zu ihrer Herstellung | |
| DE1770984C3 (de) | 5 Aroyl-pyrrol-2-essigsäurederivate | |
| CH517092A (de) | Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäureamide | |
| DE1921651A1 (de) | Verfahren zur Herstellung von neuen,substituierten Phenylalkansaeuren | |
| DE2055264C3 (de) | Thienyl(2) -essigsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OI | Miscellaneous see part 1 | ||
| 8139 | Disposal/non-payment of the annual fee |