GB1327308A - Process for preparing aroyl-substituted pyrroles and product prepared thereby - Google Patents
Process for preparing aroyl-substituted pyrroles and product prepared therebyInfo
- Publication number
- GB1327308A GB1327308A GB2020071A GB2020071A GB1327308A GB 1327308 A GB1327308 A GB 1327308A GB 2020071 A GB2020071 A GB 2020071A GB 2020071 A GB2020071 A GB 2020071A GB 1327308 A GB1327308 A GB 1327308A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkyl
- compound
- methyl
- produce
- conh
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003233 pyrroles Chemical class 0.000 title abstract 2
- 238000004519 manufacturing process Methods 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 22
- 150000001875 compounds Chemical class 0.000 abstract 19
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 abstract 6
- -1 trifluoro methyl phenyl Chemical group 0.000 abstract 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 3
- 239000003795 chemical substances by application Substances 0.000 abstract 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 3
- 229910052736 halogen Inorganic materials 0.000 abstract 3
- 150000002367 halogens Chemical group 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- 230000007062 hydrolysis Effects 0.000 abstract 3
- 238000006460 hydrolysis reaction Methods 0.000 abstract 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 239000002841 Lewis acid Substances 0.000 abstract 2
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 2
- 238000006114 decarboxylation reaction Methods 0.000 abstract 2
- 238000005886 esterification reaction Methods 0.000 abstract 2
- 150000007517 lewis acids Chemical class 0.000 abstract 2
- 238000000034 method Methods 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- 239000002904 solvent Substances 0.000 abstract 2
- 125000001544 thienyl group Chemical group 0.000 abstract 2
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 abstract 1
- AALRHBLMAVGWRR-UHFFFAOYSA-N 1-chlorobutan-2-one Chemical compound CCC(=O)CCl AALRHBLMAVGWRR-UHFFFAOYSA-N 0.000 abstract 1
- OIMRLHCSLQUXLL-UHFFFAOYSA-N 3-chlorobutan-2-one Chemical compound CC(Cl)C(C)=O OIMRLHCSLQUXLL-UHFFFAOYSA-N 0.000 abstract 1
- 150000003973 alkyl amines Chemical class 0.000 abstract 1
- 230000003110 anti-inflammatory effect Effects 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 239000006227 byproduct Substances 0.000 abstract 1
- 238000005660 chlorination reaction Methods 0.000 abstract 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 abstract 1
- 125000004122 cyclic group Chemical group 0.000 abstract 1
- 230000000911 decarboxylating effect Effects 0.000 abstract 1
- ZSANYRMTSBBUCA-UHFFFAOYSA-N diethyl 3-oxopentanedioate Chemical compound CCOC(=O)CC(=O)CC(=O)OCC ZSANYRMTSBBUCA-UHFFFAOYSA-N 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 abstract 1
- 238000010438 heat treatment Methods 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 125000003944 tolyl group Chemical group 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/337—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US595870A | 1970-01-26 | 1970-01-26 | |
| US338461A US3865840A (en) | 1970-01-26 | 1973-02-16 | Process of preparing 1,4-diloweralkyl-3-loweralkoxy-carbonyl-2-acetates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1327308A true GB1327308A (en) | 1973-08-22 |
Family
ID=26674970
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB2020071A Expired GB1327308A (en) | 1970-01-26 | 1971-04-19 | Process for preparing aroyl-substituted pyrroles and product prepared thereby |
Country Status (10)
| Country | Link |
|---|---|
| US (3) | US3752826A (https=) |
| JP (4) | JPS582935B2 (https=) |
| AT (4) | AT313271B (https=) |
| BE (1) | BE762060R (https=) |
| CH (2) | CH566984A5 (https=) |
| DE (1) | DE2102746A1 (https=) |
| FR (1) | FR2081455B2 (https=) |
| GB (1) | GB1327308A (https=) |
| NL (1) | NL7101016A (https=) |
| SE (1) | SE389670B (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4396626A (en) | 1980-10-09 | 1983-08-02 | Beecham Group Limited | Cyclic compounds and their use |
| WO1996010013A1 (en) * | 1994-09-27 | 1996-04-04 | Ono Pharmaceutical Co., Ltd. | Five membered heterocyclic compounds |
| US5859042A (en) * | 1995-09-27 | 1999-01-12 | Ono Pharmaceutical Co., Ltd. | Five membered heterocyclic compounds |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3998844A (en) * | 1975-06-02 | 1976-12-27 | Mcneil Laboratories, Incorporated | Uncatalyzed aroylation of 1-alkylpyrrole-2-acetic acid derivatives |
| US4048191A (en) * | 1975-06-27 | 1977-09-13 | Mcneil Laboratories, Incorporated | Halo-substituted 1-loweralkyl-5-aroylpyrrole-2-acetic acid compounds |
| US4185100A (en) * | 1976-05-13 | 1980-01-22 | Johnson & Johnson | Topical anti-inflammatory drug therapy |
| US4125537A (en) * | 1977-02-07 | 1978-11-14 | Mcneil Laboratories, Incorporated | Preparation of pyrrole-2-acetates |
| DE2819463A1 (de) * | 1977-05-10 | 1978-11-16 | Beecham Group Ltd | N-methyl-pyrrol-verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende pharmazeutische praeparate |
| US4200645A (en) * | 1977-05-10 | 1980-04-29 | Beecham Group Limited | Pyrrole derivatives |
| GB1592996A (en) * | 1977-10-10 | 1981-07-15 | Rolland Sa A | Acylated pyrrole carboxylic acids and derivatives thereof |
| GB1592997A (en) * | 1977-10-14 | 1981-07-15 | Rolland Sa A | Aroyl-pyrrole carboxylic acids and derivatives thereof |
| SE435278B (sv) * | 1977-12-08 | 1984-09-17 | Sagami Chem Res | 5-cyano-1-legre(c?711?71-?714)alkyl-pyrrol-2-ettiksyra, framstellning derav och anvendningen som mellanprodukt vid framstellning av terapeutiskt verksamma pyrrolderivat |
| DE2861595D1 (en) * | 1978-07-10 | 1982-03-11 | Mcneilab Inc | Pharmaceutical composition comprising a 5-aroyl-1-c1-5 alkyl-pyrrole-2-acetic acid compound and acetaminophen or acetylsalicylic acid |
| JPS5517305A (en) * | 1978-07-21 | 1980-02-06 | Mcneilab Inc | Antiiarthritis synergism |
| CA1105039A (en) * | 1978-10-19 | 1981-07-14 | Douglas A. Robinson | Process for producing substituted pyrrole diesters |
| EP0010553B1 (en) * | 1978-10-27 | 1983-05-18 | McNeilab, Inc. | Process of reducing a loweralkyl 1-loweralkyl-pyrrole-2-glyoxylate to a loweralkyl 1-loweralkyl-pyrrole-2-acetate |
| US4246175A (en) * | 1979-05-29 | 1981-01-20 | Ethyl Corporation | Synthesis of 5-cyano-1-hydrocarbylpyrrole-2-acetic acid |
| US4213905A (en) * | 1979-06-25 | 1980-07-22 | Mcneilab, Inc. | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid salts |
| EP0023938B1 (en) * | 1979-08-13 | 1983-07-20 | McNeilab, Inc. | Preparation of pyrrole-2-acetates |
| US4363918A (en) * | 1979-09-11 | 1982-12-14 | Janssen Pharmaceutica N.V. | Method of preparing 1-alkyl-3-carboxy-1H pyrrole-2-acetic acids |
| US4284562A (en) * | 1979-11-27 | 1981-08-18 | Mcneilab, Inc. | Process for preparing pyrrole-2-acetic acids |
| US4255335A (en) * | 1980-04-03 | 1981-03-10 | Mcneilab, Inc. | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid derivatives |
| US4388468A (en) * | 1980-04-04 | 1983-06-14 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4565878A (en) * | 1980-04-04 | 1986-01-21 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4333878A (en) * | 1980-04-04 | 1982-06-08 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4374255A (en) * | 1980-04-04 | 1983-02-15 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4565879A (en) * | 1980-04-04 | 1986-01-21 | Ethyl Corporation | Process for producing substituted pyrroles |
| NZ196700A (en) * | 1980-04-18 | 1983-04-12 | Smith & Nephew Ass | Anti-inflammatory compositions containing 5-benzoyl-1-methylpyrrole-2-acetic acid derivatives |
| US4299770A (en) * | 1980-05-29 | 1981-11-10 | Mallinckrodt, Inc. | Recovery of substituted pyrrole acetate |
| CA1161851A (en) * | 1980-11-03 | 1984-02-07 | G. Patrick Stahly | Process for producing substituted pyrroles |
| ES497136A0 (es) * | 1980-11-11 | 1981-10-16 | Calzada & Co | Procedimiento para la sintesis de esteres de la n-(4'hidro- xifenil) acetamida con acidos 5-benzoil-1-metilpirrol-2-ace-tico |
| US4451658A (en) * | 1980-11-24 | 1984-05-29 | Ethyl Corporation | Process for producing substituted pyrroles |
| WO1982002044A1 (en) * | 1980-12-15 | 1982-06-24 | Corp Ethyl | Preparation of pyrrole esters |
| US4374254A (en) * | 1981-01-23 | 1983-02-15 | Ethyl Corporation | Process for producing substituted pyrroles |
| AT370721B (de) * | 1981-02-24 | 1983-04-25 | Ciba Geigy Ag | Verfahren zur herstellung von neuen salzen der 2- (2,6-dichloranilino)-phenylessigsaeure, der |
| US4322427A (en) * | 1981-04-16 | 1982-03-30 | Bristol-Myers Company | Analgetic compositions and methods of use |
| US4511576A (en) * | 1981-04-23 | 1985-04-16 | Pfizer Inc. | Antidiabetic pyrrolecarboxylic acids |
| US4374997A (en) * | 1981-06-04 | 1983-02-22 | Merck & Co., Inc. | Process for the preparation of zomepirac and related compounds |
| US4380645A (en) * | 1981-12-11 | 1983-04-19 | Merck & Co., Inc. | Process for preparing Benzoxepino- or Benzthiapino[4,3-b]pyrrole-2-acetic acids |
| US4383117A (en) * | 1981-11-02 | 1983-05-10 | Ethyl Corporation | Process for producing substituted pyrroles |
| US4455433A (en) * | 1981-11-02 | 1984-06-19 | Ethyl Corporation | Process for producing substituted pyrroles |
| ES507179A0 (es) * | 1981-11-16 | 1982-08-16 | Pharmedical Sa Lab | Procedimiento de preparacion de derivados del acido 2-pirrol-acetico. |
| DE3145510A1 (de) * | 1981-11-17 | 1983-05-26 | Rütgerswerke AG, 6000 Frankfurt | Verbessertes verfahren zur herstellung von 1h-pyrrol-2-essigsaeureestern |
| IT1210673B (it) * | 1982-02-26 | 1989-09-20 | Medosan Ind Biochimi | Antinfiammatoria amidi pirrolacetiche ad attivita' |
| IT1148117B (it) * | 1982-03-05 | 1986-11-26 | Medosan Ind Biochimi | Attivita'antiflogistica,analgesica,antipiretica,mucolitica e seda tiva della tosse dell'1 metil-5-p-tolilpirrol-2-acetato di 2'metossi-fenile |
| EP0089393A1 (en) * | 1982-03-23 | 1983-09-28 | Ethyl Corporation | Process for producing substituted pyrroles |
| IT1151731B (it) * | 1982-04-21 | 1986-12-24 | Montedison Spa | Processo per la preparazione dell'acido 3-carbossi-1,4-dimetilpirrol-2-acetico |
| HU187137B (en) * | 1982-06-22 | 1985-11-28 | Richter Gedeon Vegyeszet | Process for producing esters of 1-alkyl- orl,4-dialkyl-1h-pyrrol-acetic acid |
| IT1153750B (it) * | 1982-09-21 | 1987-01-14 | Montedison Spa | Processo per la preparazione dell'acido 3-carbossi-1-metilpirrol-2-acetico |
| YU251283A (en) * | 1983-01-26 | 1986-04-30 | Mcneilab Inc | Process for obtaining pyrrol-2-acetylamino acid derivatives |
| US4585784A (en) * | 1983-01-26 | 1986-04-29 | Mcneilab, Inc. | Pyrrole-2-acetylamino acid derivative compounds |
| IT1203656B (it) * | 1983-06-10 | 1989-02-15 | Medosan Ind Biochimi | Attivita' antiaggregante piastrinica,antiinfiammatoria e broncolitica di esteri aroilpirrol e pirrilfenil acetici delle 7 (w-ossialchil) teofilline |
| IT1197688B (it) * | 1983-07-29 | 1988-12-06 | Medosan Ind Biochimi | Attivita' antiflogistica,analgesica,antipiretica ed antiaggregante piastrinica di 1-metil-5-metilbenzoilpirrol-2-acetamido acetanilidi |
| FR2564831B3 (fr) * | 1984-05-25 | 1986-09-05 | Rolland Sa A | Nouveaux derives des acides aroyl- ou hydroaroyl n-alcoyl pyrrolyl-2 carboxyliques et nouvelles compositions pharmaceutiques a action immuno-suppressive |
| JPS61277704A (ja) * | 1985-06-03 | 1986-12-08 | 発研株式会社 | 路面円形切断機 |
| JPS61206707U (https=) * | 1985-06-11 | 1986-12-27 | ||
| US4874872A (en) * | 1987-01-14 | 1989-10-17 | Syntex (U.S.A.) Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-A]pyrrole-1,7-dicarboxylates |
| US4835288A (en) * | 1987-01-14 | 1989-05-30 | Syntex Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-a]pyrrole-1,7-dicarboxylates |
| US4937368A (en) * | 1987-01-14 | 1990-06-26 | Syntex (U.S.A.) Inc. | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-A]pyrrole-1,7-dicarboxylates |
| US5235068A (en) * | 1988-04-28 | 1993-08-10 | Sumitomo Chemical Company, Limited | Process for producing acylaromatic compounds |
| JPH0830014B2 (ja) * | 1988-04-28 | 1996-03-27 | 住友化学工業株式会社 | 芳香族化合物のアシル化方法 |
| US5360881A (en) * | 1989-06-14 | 1994-11-01 | Societe Francaise Hoechst | Method of cross-linking ethylene monomers using diallyloxyacetic acid and its basic addition salts as cross-linking agents |
| AU658373B2 (en) * | 1990-11-06 | 1995-04-13 | Fgn, Inc. | Esters and amides of substituted pyrrole acetic acids |
| US5622948A (en) * | 1994-12-01 | 1997-04-22 | Syntex (U.S.A.) Inc. | Pyrrole pyridazine and pyridazinone anti-inflammatory agents |
| CA2205757C (en) * | 1996-05-30 | 2006-01-24 | F. Hoffmann-La Roche Ag | Pyridazinone derivatives and their use as inhibitors of prostaglandin g/h synthase i and ii(cox i and ii) |
| EP0906279B1 (en) * | 1996-05-30 | 2002-10-02 | F. Hoffmann-La Roche Ag | Pyrrole derivatives |
| CA2238283C (en) * | 1997-05-30 | 2002-08-20 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of neoplastic lesions, pharmaceutical compositions from such compounds and uses of such compounds and compositions for treating neoplastic lesions |
| US5858694A (en) * | 1997-05-30 | 1999-01-12 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of cancerous lesions |
| US6410584B1 (en) * | 1998-01-14 | 2002-06-25 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells with indole derivatives |
| US6130053A (en) * | 1999-08-03 | 2000-10-10 | Cell Pathways, Inc. | Method for selecting compounds for inhibition of neoplastic lesions |
| US5939417A (en) * | 1998-10-19 | 1999-08-17 | Cell Pathways Inc | 1,3,6-trihydro-6-aza-3-oxapentalen-2-one derivatives for the treatment of neoplasia |
| US6133271A (en) * | 1998-11-19 | 2000-10-17 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure thienopyrimidine derivatives |
| US6187779B1 (en) | 1998-11-20 | 2001-02-13 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 2,8-disubstituted quinazoline derivatives |
| US6369092B1 (en) | 1998-11-23 | 2002-04-09 | Cell Pathways, Inc. | Method for treating neoplasia by exposure to substituted benzimidazole derivatives |
| US6034099A (en) * | 1998-11-24 | 2000-03-07 | Cell Pathways, Inc. | Method for inhibiting neoplastic lesions by administering 4-(arylmethylene)- 2, 3- dihydro-pyrazol-3-ones |
| US6077842A (en) * | 1998-11-24 | 2000-06-20 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with pyrazolopyridylpyridazinone derivatives |
| US6486155B1 (en) | 1998-11-24 | 2002-11-26 | Cell Pathways Inc | Method of inhibiting neoplastic cells with isoquinoline derivatives |
| US6025394A (en) | 1999-01-29 | 2000-02-15 | Cell Pathways, Inc. | Method for treating patients with acne by administering substituted sulfonyl indenyl acetic acids, amides and alcohols |
| US6020379A (en) * | 1999-02-19 | 2000-02-01 | Cell Pathways, Inc. | Position 7 substituted indenyl-3-acetic acid derivatives and amides thereof for the treatment of neoplasia |
| US6555547B1 (en) | 2000-02-28 | 2003-04-29 | Cell Pathways, Inc. | Method for treating a patient with neoplasia by treatment with a vinca alkaloid derivative |
| US6569638B1 (en) | 2000-03-03 | 2003-05-27 | Cell Pathways, Inc | Method for screening compounds for the treatment of neoplasia |
| US20030162824A1 (en) * | 2001-11-12 | 2003-08-28 | Krul Elaine S. | Methods of treating or preventing a cardiovascular condition using a cyclooxygenase-1 inhibitor |
| PT1590314E (pt) * | 2003-02-06 | 2015-11-19 | Dompã Farmaceutici S P A | Ácidos 2-aril-acéticos, seus derivados e composições farmacêuticas que os contêm |
| WO2009072139A1 (en) * | 2007-12-07 | 2009-06-11 | Matrix Laboratories Limited | Process for producing 2-[1-methyl-5-(4-methylbenzoyl)- pyrrol-2- yl]acetic acid or salt thereof |
| US8470857B2 (en) * | 2008-08-15 | 2013-06-25 | N30 Pharmaceuticals, Inc. | Pyrrole inhibitors of S-nitrosoglutathione reductase as therapeutic agents |
| DK2315590T3 (da) * | 2008-08-15 | 2012-11-19 | N30 Pharmaceuticals Inc | Pyrrolinhibitorer af S-nitrosoglutathionreduktase |
| ES2572615T3 (es) | 2008-08-15 | 2016-06-01 | Nivalis Therapeutics, Inc. | Nuevos inhibidores pirrólicos de S-nitrosoglutatión reductasa como agentes terapéuticos |
| CN103435527B (zh) * | 2013-09-03 | 2015-09-23 | 张家港市信谊化工有限公司 | 一种非甾体抗炎药托美汀的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4317963Y1 (https=) * | 1966-05-04 | 1968-07-25 | ||
| SE338993B (https=) * | 1967-07-26 | 1971-09-27 | Mcneilab Inc |
-
1970
- 1970-01-26 US US00005958A patent/US3752826A/en not_active Expired - Lifetime
-
1971
- 1971-01-21 DE DE19712102746 patent/DE2102746A1/de not_active Withdrawn
- 1971-01-22 CH CH667973A patent/CH566984A5/xx not_active IP Right Cessation
- 1971-01-22 CH CH101571A patent/CH547279A/xx not_active IP Right Cessation
- 1971-01-25 SE SE7100820A patent/SE389670B/xx unknown
- 1971-01-25 AT AT700772A patent/AT313271B/de active
- 1971-01-25 AT AT700672A patent/AT313270B/de not_active IP Right Cessation
- 1971-01-25 FR FR7102343A patent/FR2081455B2/fr not_active Expired
- 1971-01-25 AT AT700572A patent/AT308735B/de not_active IP Right Cessation
- 1971-01-25 AT AT59271A patent/AT313268B/de not_active IP Right Cessation
- 1971-01-26 BE BE762060A patent/BE762060R/xx active
- 1971-01-26 NL NL7101016A patent/NL7101016A/xx not_active Application Discontinuation
- 1971-04-19 GB GB2020071A patent/GB1327308A/en not_active Expired
-
1973
- 1973-02-16 US US338461A patent/US3865840A/en not_active Expired - Lifetime
-
1974
- 1974-06-17 US US05/479,733 patent/US4070368A/en not_active Expired - Lifetime
-
1978
- 1978-01-25 JP JP53007118A patent/JPS582935B2/ja not_active Expired
- 1978-01-25 JP JP53007119A patent/JPS582936B2/ja not_active Expired
-
1980
- 1980-06-05 JP JP55076034A patent/JPS591711B2/ja not_active Expired
- 1980-06-05 JP JP7603380A patent/JPS55162767A/ja active Granted
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4396626A (en) | 1980-10-09 | 1983-08-02 | Beecham Group Limited | Cyclic compounds and their use |
| WO1996010013A1 (en) * | 1994-09-27 | 1996-04-04 | Ono Pharmaceutical Co., Ltd. | Five membered heterocyclic compounds |
| US5859042A (en) * | 1995-09-27 | 1999-01-12 | Ono Pharmaceutical Co., Ltd. | Five membered heterocyclic compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5533401A (en) | 1980-03-08 |
| US3865840A (en) | 1975-02-11 |
| JPS55162767A (en) | 1980-12-18 |
| FR2081455B2 (https=) | 1974-09-06 |
| JPS582936B2 (ja) | 1983-01-19 |
| US4070368A (en) | 1978-01-24 |
| FR2081455A2 (https=) | 1971-12-03 |
| AT313268B (de) | 1974-02-11 |
| US3752826A (en) | 1973-08-14 |
| JPS591711B2 (ja) | 1984-01-13 |
| JPS5745428B2 (https=) | 1982-09-28 |
| CH547279A (de) | 1974-03-29 |
| AT313271B (de) | 1974-02-11 |
| AT308735B (de) | 1973-07-25 |
| JPS582935B2 (ja) | 1983-01-19 |
| JPS55162766A (en) | 1980-12-18 |
| JPS5533402A (en) | 1980-03-08 |
| BE762060R (https=) | 1971-07-26 |
| NL7101016A (https=) | 1971-07-28 |
| DE2102746A1 (de) | 1971-08-12 |
| CH566984A5 (https=) | 1975-09-30 |
| AT313270B (de) | 1974-02-11 |
| SE389670B (sv) | 1976-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1327308A (en) | Process for preparing aroyl-substituted pyrroles and product prepared thereby | |
| GB1180749A (en) | A New Polycyclic Amine and Processes for its Production | |
| IE39835L (en) | Oxepin derivatives | |
| GB1491510A (en) | 1-nitrophenylquinazoline-2,4(1h,3h)-diones | |
| GB1478364A (en) | 3-5-nitro-2-imidazolyl-pyrazoles | |
| GB1506914A (en) | 2-dihalophenylamino-2-imidazoline derivatives | |
| ES362861A1 (es) | Procedimiento para la preparacion de di-n-oxidos-(1,4) qui-noxalinas 2 - metil-3-carboxamidas. | |
| GB706022A (en) | Improvements in new dialkylaminobenzylidene dyes and in their preparation | |
| GB991586A (en) | Process for the preparation of penicillins | |
| GB1492717A (en) | Process for preparing a methyl-isoxazolyl compound | |
| GB1495305A (en) | 3-phenyl-4-oxo-4h-benzopyran derivatives | |
| GB1335606A (en) | Process for the production of acyl isocyanide dichlorides and carboxylic acid chlorides | |
| ES408156A1 (es) | Procedimiento para la obtencion de quinazolinonas. | |
| GB1492865A (en) | Benzopyrano-benzopyran derivatives | |
| GB1201977A (en) | Penicilloic acid derivatives and a process for the manufacture thereof | |
| FR2042302A1 (en) | Therapeutic indole derivs. prodn. | |
| IE35137B1 (en) | New n-methyl-imidazole derivatives processes for their manufacture and their use as medicines | |
| GB1512537A (en) | 2-(2'-aryl-6'-chromonyl) propionic acids and analgesic and anti-inflammatory derivatives thereof | |
| ES424204A1 (es) | Un procedimiento para la preparacion del acido 6 beta-aci- lamido-1-oxadestiapenicilanico y derivados del mismo. | |
| 菊池康男 et al. | Electrochemical Polymerization of N-Vinylcarbazole by Rectangular Wave Form Current | |
| GB1146857A (en) | Improvements in or relating to benzodiazepines | |
| GB1488412A (en) | Imidazo(1,2-a)quinolines | |
| GB1387306A (en) | Derivatives of pyrazole-5 acetic acid process for their preparation and their use in therapy | |
| GB1134344A (en) | The preparation of maleamic acid derivatives | |
| GB1456946A (en) | 6-phenyl-4h-imidazo-1,2-a-1,4-benzodiazepines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PE20 | Patent expired after termination of 20 years |