DE2049038C3 - Wäßriges saures galvanisches Verchromungsbad - Google Patents
Wäßriges saures galvanisches VerchromungsbadInfo
- Publication number
- DE2049038C3 DE2049038C3 DE2049038A DE2049038A DE2049038C3 DE 2049038 C3 DE2049038 C3 DE 2049038C3 DE 2049038 A DE2049038 A DE 2049038A DE 2049038 A DE2049038 A DE 2049038A DE 2049038 C3 DE2049038 C3 DE 2049038C3
- Authority
- DE
- Germany
- Prior art keywords
- fluoride
- ions
- cerium
- iii
- bath
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 17
- 238000007747 plating Methods 0.000 title claims description 15
- 229910052804 chromium Inorganic materials 0.000 title claims description 11
- 239000011651 chromium Substances 0.000 title claims description 11
- 230000002378 acidificating effect Effects 0.000 title claims description 6
- -1 fluoride ions Chemical class 0.000 claims description 35
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 25
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 claims description 21
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 claims description 21
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 13
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 claims description 10
- 229910052684 Cerium Inorganic materials 0.000 claims description 8
- QCCDYNYSHILRDG-UHFFFAOYSA-K cerium(3+);trifluoride Chemical compound [F-].[F-].[F-].[Ce+3] QCCDYNYSHILRDG-UHFFFAOYSA-K 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 3
- 229910021653 sulphate ion Inorganic materials 0.000 claims 2
- 150000002222 fluorine compounds Chemical class 0.000 description 12
- XQTIWNLDFPPCIU-UHFFFAOYSA-N cerium(3+) Chemical compound [Ce+3] XQTIWNLDFPPCIU-UHFFFAOYSA-N 0.000 description 8
- 230000008021 deposition Effects 0.000 description 6
- 238000005868 electrolysis reaction Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- UBXAKNTVXQMEAG-UHFFFAOYSA-L strontium sulfate Chemical compound [Sr+2].[O-]S([O-])(=O)=O UBXAKNTVXQMEAG-UHFFFAOYSA-L 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- MBWMIEZHOLGJBM-UHFFFAOYSA-N 3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC1=CC=C(C(CC(O)=O)NC(=O)OC(C)(C)C)C=C1 MBWMIEZHOLGJBM-UHFFFAOYSA-N 0.000 description 1
- 150000000703 Cerium Chemical class 0.000 description 1
- 229910052688 Gadolinium Inorganic materials 0.000 description 1
- 229910052779 Neodymium Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910000978 Pb alloy Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910052772 Samarium Inorganic materials 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- INHCSSUBVCNVSK-UHFFFAOYSA-L lithium sulfate Inorganic materials [Li+].[Li+].[O-]S([O-])(=O)=O INHCSSUBVCNVSK-UHFFFAOYSA-L 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 230000000754 repressing effect Effects 0.000 description 1
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- NVKTUNLPFJHLCG-UHFFFAOYSA-N strontium chromate Chemical compound [Sr+2].[O-][Cr]([O-])(=O)=O NVKTUNLPFJHLCG-UHFFFAOYSA-N 0.000 description 1
- 150000003438 strontium compounds Chemical class 0.000 description 1
- 159000000008 strontium salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- RBTVSNLYYIMMKS-UHFFFAOYSA-N tert-butyl 3-aminoazetidine-1-carboxylate;hydrochloride Chemical compound Cl.CC(C)(C)OC(=O)N1CC(N)C1 RBTVSNLYYIMMKS-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25D—PROCESSES FOR THE ELECTROLYTIC OR ELECTROPHORETIC PRODUCTION OF COATINGS; ELECTROFORMING; APPARATUS THEREFOR
- C25D3/00—Electroplating: Baths therefor
- C25D3/02—Electroplating: Baths therefor from solutions
- C25D3/04—Electroplating: Baths therefor from solutions of chromium
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electroplating And Plating Baths Therefor (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US86417069A | 1969-10-06 | 1969-10-06 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2049038A1 DE2049038A1 (de) | 1971-04-29 |
| DE2049038B2 DE2049038B2 (de) | 1981-06-11 |
| DE2049038C3 true DE2049038C3 (de) | 1982-03-25 |
Family
ID=25342674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2049038A Expired DE2049038C3 (de) | 1969-10-06 | 1970-10-06 | Wäßriges saures galvanisches Verchromungsbad |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3634211A (enExample) |
| JP (1) | JPS4911539B1 (enExample) |
| CA (1) | CA975709A (enExample) |
| DE (1) | DE2049038C3 (enExample) |
| ES (1) | ES384095A1 (enExample) |
| FR (1) | FR2064156B1 (enExample) |
| GB (1) | GB1322939A (enExample) |
| NL (1) | NL171074C (enExample) |
| SE (1) | SE368723B (enExample) |
| ZA (1) | ZA706489B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3758390A (en) * | 1971-06-18 | 1973-09-11 | M & T Chemicals Inc | Novel cromium plating compositions |
| JPS52125319U (enExample) * | 1976-03-19 | 1977-09-22 | ||
| JPS5312245U (enExample) * | 1976-07-15 | 1978-02-01 | ||
| JPS53132158A (en) * | 1977-04-21 | 1978-11-17 | Kouji Makimoto | Door |
| JPS53148545U (enExample) * | 1977-04-27 | 1978-11-22 | ||
| JPS5521488U (enExample) * | 1978-07-31 | 1980-02-12 | ||
| GB2071151B (en) * | 1980-03-10 | 1983-04-07 | Ibm | Trivalent chromium electroplating |
| US4392922A (en) * | 1980-11-10 | 1983-07-12 | Occidental Chemical Corporation | Trivalent chromium electrolyte and process employing vanadium reducing agent |
| JPS5960287U (ja) * | 1982-10-15 | 1984-04-19 | 星 三喜人 | 仕切用木製パネル |
| CA1244376A (en) * | 1983-05-12 | 1988-11-08 | Thaddeus W. Tomaszewski | Trivalent chromium electrolyte and process |
| JPS59190884U (ja) * | 1983-06-03 | 1984-12-18 | 不二サッシ株式会社 | フラツシユドアのコア材 |
| US4680099A (en) * | 1986-04-07 | 1987-07-14 | Raymund Singleton | Electroplating apparatus |
| RU2125125C1 (ru) * | 1997-12-24 | 1999-01-20 | Малинин Владимир Федорович | Способ электролитического хромирования |
| RU2125126C1 (ru) * | 1998-01-27 | 1999-01-20 | Малинин Владимир Федорович | Способ электролитического хромирования в низкоконцентрированном электролите |
| ITTO20070704A1 (it) * | 2007-10-05 | 2009-04-06 | Create New Technology S R L | Sistema e metodo di placcatura di leghe metalliche mediante tecnologia galvanica |
| CN114076721B (zh) * | 2020-08-12 | 2023-09-12 | 宝山钢铁股份有限公司 | 钢板镀铬溶液使用寿命的检测方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1864014A (en) * | 1927-01-03 | 1932-06-21 | Dwight T Ewing | Chromium plating process |
| US3334033A (en) * | 1964-09-11 | 1967-08-01 | Udylite Corp | Chromium plating |
-
1969
- 1969-10-06 US US864170A patent/US3634211A/en not_active Expired - Lifetime
-
1970
- 1970-09-10 GB GB4337770A patent/GB1322939A/en not_active Expired
- 1970-09-22 ZA ZA706489A patent/ZA706489B/xx unknown
- 1970-09-28 JP JP45084917A patent/JPS4911539B1/ja active Pending
- 1970-09-29 ES ES384095A patent/ES384095A1/es not_active Expired
- 1970-10-01 CA CA094,545A patent/CA975709A/en not_active Expired
- 1970-10-02 SE SE13382/70A patent/SE368723B/xx unknown
- 1970-10-05 FR FR7035891A patent/FR2064156B1/fr not_active Expired
- 1970-10-05 NL NLAANVRAGE7014597,A patent/NL171074C/xx not_active IP Right Cessation
- 1970-10-06 DE DE2049038A patent/DE2049038C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3634211A (en) | 1972-01-11 |
| FR2064156B1 (enExample) | 1974-08-23 |
| JPS4911539B1 (enExample) | 1974-03-18 |
| GB1322939A (en) | 1973-07-11 |
| FR2064156A1 (enExample) | 1971-07-16 |
| ZA706489B (en) | 1971-05-27 |
| NL171074B (nl) | 1982-09-01 |
| ES384095A1 (es) | 1972-12-16 |
| CA975709A (en) | 1975-10-07 |
| NL7014597A (enExample) | 1971-04-08 |
| SE368723B (enExample) | 1974-07-15 |
| NL171074C (nl) | 1983-02-01 |
| DE2049038B2 (de) | 1981-06-11 |
| DE2049038A1 (de) | 1971-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2049038C3 (de) | Wäßriges saures galvanisches Verchromungsbad | |
| DE1279424B (de) | Bad zum galvanischen UEberziehen von Metallen mit Iridium | |
| DE3005159C2 (de) | Verfahren zur Plattierung von Stahlbändern mit einer Zink-Nickel-Legierung | |
| DE2500730C3 (de) | Galvanisches Chrombad | |
| DE3875227T2 (de) | Verfahren zur herstellung eines bades fuer die elektroplattierung einer binaeren zinn-kobalt-, zinn-nickel- oder zinn-blei- legierung und damit hergestelltes elektroplattierungsbad. | |
| DE2600654B2 (de) | Verfahren zur gleichzeitigen kathodischen abscheidung einer chromschicht und einer darueberliegenden schicht aus hydratisierten chromoxiden auf stahlblechen | |
| DE2819685C3 (de) | Elektrolyt für eine galvanische Primärzelle mit wenigstens einer negativen Elektrode aus Aluminium oder einer Aluminiumlegierung | |
| WO1984000982A1 (fr) | Procede de recompression | |
| DE1213695B (de) | Saures/galvanisches Chrombad zum Abscheiden rissfreier Chromueberzuege und Trockenmischung zur Herstellung des Bades | |
| DE2653984A1 (de) | Verfahren zur herstellung von fuer galvanische zellen geeigneten elektroden, insbesondere positiven nickelelektroden | |
| DE3417416C2 (enExample) | ||
| DE1621337B2 (de) | Bad fuer die stromlose nickelabscheidung | |
| DE1248412B (de) | Galvanisches Verchromungsbad | |
| DE2943399C2 (de) | Verfahren und Zusammensetzung zur galvanischen Abscheidung von Palladium | |
| DE2147257A1 (de) | Galvanisches Bad und Verfahren zur Abscheidung halbglanzender Nickeluber züge | |
| DE2432044A1 (de) | Verfahren zur elektrolytischen nachbehandlung einer elektrolytisch chromatisierten oder metallisch verchromten stahlblechoberflaeche | |
| DE1194674B (de) | Verfahren zum Regenerieren von Chromatierungsloesungen | |
| AT345052B (de) | Badzusatz fuer chrom-elektroplattierbaeder | |
| DE1521071A1 (de) | Bad und Verfahren zur Abscheidung von Chrom | |
| DE2207702C3 (de) | Wäßriges galvanisches Glanzchrombad | |
| DE1521071C (de) | Galvanisches Chrombad | |
| DE860445C (de) | Verfahren und Loesung zur Behandlung von metallischen Oberflaechen | |
| DE1947548C (de) | Galvanisches Bad fur die Schwarzver chromung und Verfahren zur elektrolytischen Abscheidung schwarzer Chromüberzüge | |
| DE843785C (de) | Verfahren zur Herstellung harter galvanischer Silberueberzuege | |
| DE2049790C3 (de) | Galvanisches Chrombad zum Abscheiden mikrorissiger Chromüberzüge |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: M & T CHEMICALS, INC., WOODBRIDGE, N.J., US |