DE2038749C3 - - Google Patents
Info
- Publication number
- DE2038749C3 DE2038749C3 DE2038749*A DE2038749A DE2038749C3 DE 2038749 C3 DE2038749 C3 DE 2038749C3 DE 2038749 A DE2038749 A DE 2038749A DE 2038749 C3 DE2038749 C3 DE 2038749C3
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- propylene
- acrolein
- nitrate
- potassium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 claims description 47
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 42
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 35
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 23
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 21
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 20
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 12
- 230000003647 oxidation Effects 0.000 claims description 11
- 238000007254 oxidation reaction Methods 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 6
- 239000007789 gas Substances 0.000 claims description 6
- 239000011574 phosphorus Substances 0.000 claims description 6
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 5
- 239000010941 cobalt Substances 0.000 claims description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 229910052797 bismuth Inorganic materials 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 239000012808 vapor phase Substances 0.000 claims description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 14
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 12
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 229910052700 potassium Inorganic materials 0.000 description 11
- 239000011591 potassium Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 10
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 9
- 239000012153 distilled water Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 description 7
- 239000004323 potassium nitrate Substances 0.000 description 7
- 235000010333 potassium nitrate Nutrition 0.000 description 7
- 229910052701 rubidium Inorganic materials 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- 229910052792 caesium Inorganic materials 0.000 description 6
- 235000011007 phosphoric acid Nutrition 0.000 description 6
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical compound O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 3
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 3
- 229940010552 ammonium molybdate Drugs 0.000 description 3
- 235000018660 ammonium molybdate Nutrition 0.000 description 3
- 239000011609 ammonium molybdate Substances 0.000 description 3
- 229910052785 arsenic Inorganic materials 0.000 description 3
- 229940000488 arsenic acid Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910000476 molybdenum oxide Inorganic materials 0.000 description 3
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical compound [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- 241001026509 Kata Species 0.000 description 2
- 229910017709 Ni Co Inorganic materials 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910000416 bismuth oxide Inorganic materials 0.000 description 2
- PPNKDDZCLDMRHS-UHFFFAOYSA-N bismuth(III) nitrate Inorganic materials [Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PPNKDDZCLDMRHS-UHFFFAOYSA-N 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- NLSCHDZTHVNDCP-UHFFFAOYSA-N caesium nitrate Chemical compound [Cs+].[O-][N+]([O-])=O NLSCHDZTHVNDCP-UHFFFAOYSA-N 0.000 description 2
- 239000003426 co-catalyst Substances 0.000 description 2
- 150000001869 cobalt compounds Chemical class 0.000 description 2
- 229910000428 cobalt oxide Inorganic materials 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 2
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 2
- 229910000480 nickel oxide Inorganic materials 0.000 description 2
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 238000002479 acid--base titration Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229910000413 arsenic oxide Inorganic materials 0.000 description 1
- -1 bismuth nitrate phosphorus Chemical compound 0.000 description 1
- 150000001622 bismuth compounds Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- UFMZWBIQTDUYBN-UHFFFAOYSA-N cobalt dinitrate Chemical compound [Co+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O UFMZWBIQTDUYBN-UHFFFAOYSA-N 0.000 description 1
- 229910001981 cobalt nitrate Inorganic materials 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 235000014510 cooky Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- RXPAJWPEYBDXOG-UHFFFAOYSA-N hydron;methyl 4-methoxypyridine-2-carboxylate;chloride Chemical compound Cl.COC(=O)C1=CC(OC)=CC=N1 RXPAJWPEYBDXOG-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002506 iron compounds Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 1
- KYUXVFNRXMHCDN-UHFFFAOYSA-N potassium rubidium(1+) dinitrate Chemical compound [Rb+].[N+](=O)([O-])[O-].[K+].[N+](=O)([O-])[O-] KYUXVFNRXMHCDN-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- RTHYXYOJKHGZJT-UHFFFAOYSA-N rubidium nitrate Inorganic materials [Rb+].[O-][N+]([O-])=O RTHYXYOJKHGZJT-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- KHAUBYTYGDOYRU-IRXASZMISA-N trospectomycin Chemical compound CN[C@H]([C@H]1O2)[C@@H](O)[C@@H](NC)[C@H](O)[C@H]1O[C@H]1[C@]2(O)C(=O)C[C@@H](CCCC)O1 KHAUBYTYGDOYRU-IRXASZMISA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/70—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of the iron group metals or copper
- B01J23/76—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of the iron group metals or copper combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36
- B01J23/84—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of the iron group metals or copper combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36 with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium
- B01J23/85—Chromium, molybdenum or tungsten
- B01J23/88—Molybdenum
- B01J23/887—Molybdenum containing in addition other metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36
- B01J23/8876—Arsenic, antimony or bismuth
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J27/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- B01J27/14—Phosphorus; Compounds thereof
- B01J27/186—Phosphorus; Compounds thereof with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium
- B01J27/188—Phosphorus; Compounds thereof with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium with chromium, molybdenum, tungsten or polonium
- B01J27/19—Molybdenum
- B01J27/192—Molybdenum with bismuth
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3359769 | 1969-05-02 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2038749A1 DE2038749A1 (de) | 1971-02-11 |
| DE2038749B2 DE2038749B2 (de) | 1973-04-19 |
| DE2038749C3 true DE2038749C3 (enExample) | 1973-11-08 |
Family
ID=12390883
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702038749 Granted DE2038749B2 (de) | 1969-05-02 | 1970-04-28 | Verfahren zur herstellung von (meth) acrolein durch oxydation von propylen oder isobuten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3778386A (enExample) |
| BE (1) | BE749305A (enExample) |
| CA (1) | CA919702A (enExample) |
| DE (1) | DE2038749B2 (enExample) |
| FR (1) | FR2047199A5 (enExample) |
| GB (1) | GB1249290A (enExample) |
| NL (1) | NL7006454A (enExample) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL175175C (nl) * | 1970-10-30 | 1984-10-01 | Standard Oil Co Ohio | Werkwijze voor de omzetting van propeen en/of isobuteen met een moleculaire zuurstof bevattend gas en ammoniak in aanwezigheid van een katalysator. |
| JPS494441B1 (enExample) * | 1970-11-07 | 1974-02-01 | ||
| US4008280A (en) * | 1970-12-29 | 1977-02-15 | Mitsubishi Petrochemical Company Limited | Process for production of acrolein |
| CA975382A (en) * | 1971-02-04 | 1975-09-30 | Arthur F. Miller | Process for the manufacture of acrylonitrile and methacrylonitrile |
| FR2173203B1 (enExample) * | 1972-02-22 | 1978-03-10 | Asahi Glass Co Ltd | |
| US3803204A (en) * | 1972-03-27 | 1974-04-09 | Standard Oil Co | Preparation of aromatic nitriles |
| US3887631A (en) * | 1973-05-14 | 1975-06-03 | Texaco Inc | Oxidative dehydrogenation of hydrocarbons |
| JPS5324403B2 (enExample) * | 1973-06-11 | 1978-07-20 | ||
| PH12128A (en) * | 1973-09-04 | 1978-11-07 | Standard Oil Co | Chromium-containing catalysts useful for oxidation reactions |
| GB1489399A (en) * | 1973-12-11 | 1977-10-19 | Daicel Ltd | Catalyst for production of alpha,beta-unsaturated aldehydes |
| JPS5230278B2 (enExample) * | 1973-12-11 | 1977-08-06 | ||
| DE2436818C3 (de) * | 1974-07-31 | 1985-05-09 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Acrylsäure durch Oxidation von Propylen mit Sauerstoff enthaltenden Gasen in zwei getrennten Oxidationsstufen |
| JPS5163112A (en) * | 1974-11-27 | 1976-06-01 | Nippon Kayaku Kk | Metakuroreinno seizoho |
| US4168246A (en) * | 1975-11-28 | 1979-09-18 | Monsanto Company | Production of (amm)oxidation catalyst |
| US4040978A (en) * | 1975-11-28 | 1977-08-09 | Monsanto Company | Production of (amm)oxidation catalyst |
| JPS5945415B2 (ja) * | 1976-12-13 | 1984-11-06 | 日本ゼオン株式会社 | オレフイン酸化用触媒 |
| US4170570A (en) * | 1978-01-03 | 1979-10-09 | Standard Oil Company (Ohio) | Process for preparing oxidation catalysts |
| US4267386A (en) * | 1978-11-13 | 1981-05-12 | Celanese Corporation | Olefin oxidation catalyst |
| US4224193A (en) * | 1978-11-13 | 1980-09-23 | Celanese Corporation | Olefin oxidation catalyst and process for its preparation |
| US4224187A (en) * | 1978-11-13 | 1980-09-23 | Celanese Corporation | Olefin oxidation catalyst and process for its preparation |
| DE2909670A1 (de) * | 1979-03-12 | 1980-10-02 | Basf Ag | Verfahren zur herstellung von schalenkatalysatoren |
| US4276196A (en) * | 1979-08-09 | 1981-06-30 | Celanese Corporation | Attrition resistant catalysts |
| US4332971A (en) * | 1979-08-09 | 1982-06-01 | Celanese Corporation | Process for the oxidation of olefinically unsaturated hydrocarbons to aldehydes using attrition resistant catalysts |
| US4248803A (en) * | 1979-09-19 | 1981-02-03 | Celanese Corporation | Olefin oxidation catalyst |
| JPS58119346A (ja) * | 1982-01-06 | 1983-07-15 | Nippon Shokubai Kagaku Kogyo Co Ltd | プロピレン酸化用触媒 |
| DE59602040D1 (de) * | 1995-03-10 | 1999-07-08 | Basf Ag | Verfahren der kontinuierlich betriebenen heterogen katalysierten Gasphasenoxidation von Propylen zu Acrolein, Acrylsäure oder deren Gemisch |
| CN111116934B (zh) * | 2020-01-20 | 2021-07-27 | 福州大学 | 一种空心结构的MOFs衍生物的制备及其在催化烯烃环氧化中应用 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3345427A (en) * | 1963-12-04 | 1967-10-03 | Sinclair Research Inc | Dehydrogenation process and aluminasupported nickel, molybdenum and alkali metal catalyst therefor |
| US3471556A (en) * | 1964-12-07 | 1969-10-07 | Nippon Kayaku Kk | Production of unsaturated aliphatic acids |
| US3522299A (en) * | 1965-11-17 | 1970-07-28 | Nippon Kayaku Kk | Process for the oxidation of olefins to aldehydes and acids and catalyst therefor |
-
1970
- 1970-04-22 BE BE749305D patent/BE749305A/xx not_active IP Right Cessation
- 1970-04-23 CA CA080907A patent/CA919702A/en not_active Expired
- 1970-04-23 GB GB09626/70A patent/GB1249290A/en not_active Expired
- 1970-04-24 US US00031757A patent/US3778386A/en not_active Expired - Lifetime
- 1970-04-28 DE DE19702038749 patent/DE2038749B2/de active Granted
- 1970-04-30 FR FR7016028A patent/FR2047199A5/fr not_active Expired
- 1970-05-01 NL NL7006454A patent/NL7006454A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2020791B2 (de) | 1976-03-18 |
| DE2038749B2 (de) | 1973-04-19 |
| DE2038749A1 (de) | 1971-02-11 |
| DE2020791A1 (de) | 1970-11-26 |
| GB1249290A (en) | 1971-10-13 |
| BE749305A (fr) | 1970-10-01 |
| US3778386A (en) | 1973-12-11 |
| NL7006454A (enExample) | 1970-11-04 |
| CA919702A (en) | 1973-01-23 |
| FR2047199A5 (enExample) | 1971-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2038749C3 (enExample) | ||
| DE3300044C2 (de) | Katalysator für die Oxidation von Propylen | |
| DE1958290C2 (de) | Oxydehydrierungskatalysator und seine Verwendung zur Umwandlung von Isoamylenen, Methylbutanolen und Gemischen hiervon in Isopren | |
| DE2460541C3 (de) | Phosphor, Molybdän und Vanadium sowie gegebenenfalls Kupfer, Kobalt, Zirkon, Wismut, Antimon und/oder Arsen enthaltender Oxydkatalysator und dessen Verwendung zur Herstellung von Methacrylsäure | |
| DE69102245T2 (de) | Fliessbett-Katalysator für die Herstellung von Acrylnitril. | |
| DE2125032C3 (de) | Verfahren zur Herstellung von (Meth) Acrolein neben geringen Mengen (Meth) Acrylsäure | |
| EP0194541B1 (de) | Heteropolysäure H8PMo10VO39, deren Anhydrid PMo10VO35 und ihre Verwendung | |
| EP0088328B1 (de) | Oxidationskatalysator, inbesondere für die Herstellung von Methacrylsäure durch Gasphasenoxidation von Methacrolein | |
| DE2155109C3 (de) | Verfahren zur gleichzeitigen Herstellung von 13-Butadien und Methacrolein | |
| EP0088327B1 (de) | Verfahren zur Herstellung von Methacrylsäure | |
| DE1268609B (de) | Verfahren zur Herstellung von (Meth) Acrolein und (Meth) Acrylsaeure durch katalytische Oxydation von Propylen bzw. Isobutylen | |
| DE2529537A1 (de) | Verfahren zur herstellung von acrylsaeure oder methacrylsaeure | |
| DE1908965B1 (de) | Verfahren zur Herstellung von Acrylsaeure durch Oxydation von Acrolein | |
| DE2303383A1 (de) | Verfahren zur herstellung ungesaettigter saeuren | |
| DE2429095A1 (de) | Verfahren zur herstellung von methacrylsaeure | |
| DE2228989C3 (de) | Molybdän, Eisen, Wismut, Nickel, Thallium sowie gegebenenfalls Magnesium, Mangan, Kobalt und Phosphor enthaltender Oxid-Trägerkatalysator und seine Verwendung zur Herstellung von Acrolein | |
| DE2133110C3 (de) | Verfahren zur Herstellung von Acrolein | |
| DE2155411A1 (en) | Methacrolein prepn - by catalytic vapour phase oxidation of isobutylene with molecular oxygen | |
| DE1207367B (de) | Verfahren zur Herstellung von Acrolein bzw. Methacrolein | |
| DE2203439B2 (de) | Verfahren zur Herstellung von Acrylnitril aus Propylen | |
| DE2264529C3 (de) | Verfahren zur Herstellung von Butadien durch oxydative Dehydrierung von Butenen | |
| DE2020791C3 (de) | Oxydationskatalysator und seine Verwendung | |
| DE2403716A1 (de) | Katalytisches verfahren zur herstellung von methacrylnitril | |
| DE1965401C3 (de) | Verfahren zur Herstellung eines Katalysators für die Maleinsäureanhydridsynthese | |
| DE2165751C3 (de) | Oxid-Trägerkatalysator und dessen Verwendung zur gleichzeitigen Herstellung von Methacrolein und 13-Butadien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |