DE2036681A1 - Verfahren zur Herstellung von Nitro ximen - Google Patents
Verfahren zur Herstellung von Nitro ximenInfo
- Publication number
- DE2036681A1 DE2036681A1 DE19702036681 DE2036681A DE2036681A1 DE 2036681 A1 DE2036681 A1 DE 2036681A1 DE 19702036681 DE19702036681 DE 19702036681 DE 2036681 A DE2036681 A DE 2036681A DE 2036681 A1 DE2036681 A1 DE 2036681A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- water
- nitro
- reaction
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 title 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 9
- QDYBCIWLGJMJGO-UHFFFAOYSA-N dinitromethanone Chemical class [O-][N+](=O)C(=O)[N+]([O-])=O QDYBCIWLGJMJGO-UHFFFAOYSA-N 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 230000007062 hydrolysis Effects 0.000 claims description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- LZDSILRDTDCIQT-UHFFFAOYSA-N dinitrogen trioxide Chemical compound [O-][N+](=O)N=O LZDSILRDTDCIQT-UHFFFAOYSA-N 0.000 claims description 4
- 239000012429 reaction media Substances 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 2
- 150000002170 ethers Chemical class 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- BLNWTAHYTCHDJH-UHFFFAOYSA-O hydroxy(oxo)azanium Chemical compound O[NH+]=O BLNWTAHYTCHDJH-UHFFFAOYSA-O 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 150000003462 sulfoxides Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical group O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 20
- 239000000203 mixture Substances 0.000 description 18
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 9
- 150000002923 oximes Chemical class 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 235000010288 sodium nitrite Nutrition 0.000 description 7
- 238000004821 distillation Methods 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000001556 precipitation Methods 0.000 description 5
- JTWHVBNYYWFXSI-UHFFFAOYSA-N 2-nitro-1-phenylethanone Chemical compound [O-][N+](=O)CC(=O)C1=CC=CC=C1 JTWHVBNYYWFXSI-UHFFFAOYSA-N 0.000 description 4
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- UPUZSBSTYMFQCK-RMKNXTFCSA-N (ne)-n-[1-(2-nitrophenyl)ethylidene]hydroxylamine Chemical compound O\N=C(/C)C1=CC=CC=C1[N+]([O-])=O UPUZSBSTYMFQCK-RMKNXTFCSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- XRKYNSVQSJOJCU-UHFFFAOYSA-N C(C)(=O)OCC.[S] Chemical compound C(C)(=O)OCC.[S] XRKYNSVQSJOJCU-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 101150046432 Tril gene Proteins 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- -1 for example Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- VZXWHAIIKCIOBN-UHFFFAOYSA-N n-(2-nitro-1-phenylethylidene)hydroxylamine Chemical compound [O-][N+](=O)CC(=NO)C1=CC=CC=C1 VZXWHAIIKCIOBN-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C249/00—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C249/04—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of oximes
- C07C249/06—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of oximes by nitrosation of hydrocarbons or substituted hydrocarbons
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR6925146A FR2054700A5 (enExample) | 1969-07-23 | 1969-07-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2036681A1 true DE2036681A1 (de) | 1971-02-18 |
Family
ID=9037913
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702036681 Pending DE2036681A1 (de) | 1969-07-23 | 1970-07-23 | Verfahren zur Herstellung von Nitro ximen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3822314A (enExample) |
| JP (1) | JPS4823431B1 (enExample) |
| BE (1) | BE753775A (enExample) |
| CH (1) | CH513823A (enExample) |
| DE (1) | DE2036681A1 (enExample) |
| FR (1) | FR2054700A5 (enExample) |
| GB (1) | GB1308055A (enExample) |
| NL (1) | NL7010463A (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS508691U (enExample) * | 1973-05-22 | 1975-01-29 | ||
| DE2825565A1 (de) * | 1978-06-10 | 1979-12-20 | Bayer Ag | Verfahren zur herstellung von 2-oximinophenylacetonitril |
| US4490167A (en) * | 1979-08-06 | 1984-12-25 | Ciba-Geigy Corporation | Oxime derivatives of diphenyl ethers and their use in herbicidal compositions |
| GB2092128B (en) * | 1981-01-30 | 1984-11-21 | Kodak Ltd | Preparation of 2-halo-3/nitro-5-acyl thiophenes and intermediate compounds |
| JP6524901B2 (ja) | 2015-12-08 | 2019-06-05 | 信越化学工業株式会社 | シリコーンゴム組成物及びその硬化物 |
| CN108863843A (zh) * | 2018-08-06 | 2018-11-23 | 信阳师范学院 | 一种β-羟亚胺硝基类化合物的合成新方法 |
-
1969
- 1969-07-23 FR FR6925146A patent/FR2054700A5/fr not_active Expired
-
1970
- 1970-07-15 NL NL7010463A patent/NL7010463A/xx unknown
- 1970-07-22 BE BE753775D patent/BE753775A/xx unknown
- 1970-07-22 CH CH1111370A patent/CH513823A/fr not_active IP Right Cessation
- 1970-07-22 JP JP45063655A patent/JPS4823431B1/ja active Pending
- 1970-07-22 US US00057304A patent/US3822314A/en not_active Expired - Lifetime
- 1970-07-23 DE DE19702036681 patent/DE2036681A1/de active Pending
- 1970-07-23 GB GB3579870A patent/GB1308055A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE753775A (fr) | 1971-01-22 |
| CH513823A (fr) | 1971-10-15 |
| NL7010463A (enExample) | 1971-01-26 |
| GB1308055A (en) | 1973-02-21 |
| FR2054700A5 (enExample) | 1971-05-07 |
| JPS4823431B1 (enExample) | 1973-07-13 |
| US3822314A (en) | 1974-07-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2816637C2 (enExample) | ||
| DE2155495A1 (de) | Verfahren zur herstellung von benzylidenverbindungen | |
| DE2036681A1 (de) | Verfahren zur Herstellung von Nitro ximen | |
| DE1129153B (de) | Verfahren zur Herstellung von ª-Cyan-ª-Alkyl-ª-phenylacrylsaeureestern | |
| EP0012983B1 (de) | Diaminophenylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Aminobenzimidazolonen-(2) | |
| DE2355897C3 (de) | Verfahren zur Herstellung von Dithiazolyl (2,2,')- disulfiden | |
| DE2606299C2 (de) | Verfahren zur Herstellung von 3-Ethoxy-11β-hydroxy-Δ3,5-pregnadien-Derivaten | |
| DE2200984A1 (de) | Derivate von Isocyanursaeure und Verfahren zu ihrer Herstellung | |
| CH459219A (de) | Verfahren zur Herstellung von 6- und 7 gliedrigen A-Ringlaktamen der Androstanreihe | |
| DE876240C (de) | Verfahren zur Herstellung von Thiosemicarbazonen | |
| DE2321003A1 (de) | Verfahren zur herstellung von 5nitro-naphthochinon-(1,4) | |
| DE3020236A1 (de) | Verfahren zur herstellung von o- beziehungsweise p-nitrophenylalkoholen | |
| DE2058002C3 (de) | Verfahren zur Herstellung von 6,7disubstituierten 4-Hydroxy-3-chinolincarbonsäure-alkylestern | |
| DE870698C (de) | Verfahren zur Herstellung von Hydrochinonen | |
| DE2602340A1 (de) | 5-benzylpikolinsaeurederivate | |
| DE496979C (de) | Verfahren zur Herstellung von schwefel- und stickstoffhaltigen Kondensationsprodukten | |
| DE819992C (de) | Verfahren zur Herstellung von Amiden und Thioamiden | |
| DE915938C (de) | Verfahren zur Herstellung von Oxoacylaminen der Cyclopentanopolyhydrophenanthrenreihe | |
| DE2127902A1 (de) | Verfahren zur Herstellung von Chinoxalindioxidderivaten | |
| DE814450C (de) | Verfahren zur Herstellung von N-Acylamidodiolen | |
| DE1118191B (de) | Verfahren zur Herstellung von ungesaettigten Ketonen | |
| DE2602965A1 (de) | Verfahren zur herstellung von 3,5- diphenylpyrazolen | |
| DE1670967A1 (de) | Verfahren zur Herstellung von 3-Imino-1,2-benzisothiazolinen | |
| DE1926047A1 (de) | Verfahren zur Herstellung 6-nitro-2-substituierter Hexansaeureester | |
| DE2354288B1 (de) | Verfahren zur Herstellung von Aminophenylalkylaethern |