DE2015568C3 - S.e-Dimethoxyindazol-S-carbonsäureamide - Google Patents
S.e-Dimethoxyindazol-S-carbonsäureamideInfo
- Publication number
- DE2015568C3 DE2015568C3 DE2015568A DE2015568A DE2015568C3 DE 2015568 C3 DE2015568 C3 DE 2015568C3 DE 2015568 A DE2015568 A DE 2015568A DE 2015568 A DE2015568 A DE 2015568A DE 2015568 C3 DE2015568 C3 DE 2015568C3
- Authority
- DE
- Germany
- Prior art keywords
- dimethoxyindazole
- carboxylic acid
- acid
- general formula
- theory
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 20
- -1 methyl - Chemical class 0.000 claims description 13
- CGODQEMLWTXHAT-UHFFFAOYSA-N 5,6-dimethoxy-1h-indazole-3-carboxamide Chemical class C1=C(OC)C(OC)=CC2=C1C(C(N)=O)=NN2 CGODQEMLWTXHAT-UHFFFAOYSA-N 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims 1
- 125000003884 phenylalkyl group Chemical group 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 43
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 40
- IWUGDDTXRWFNJY-UHFFFAOYSA-N 5,6-dimethoxy-1h-indazole-3-carboxylic acid Chemical compound C1=C(OC)C(OC)=CC2=C1C(C(O)=O)=NN2 IWUGDDTXRWFNJY-UHFFFAOYSA-N 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical class O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 238000000034 method Methods 0.000 description 26
- 239000000203 mixture Substances 0.000 description 25
- 239000000243 solution Substances 0.000 description 22
- 238000001953 recrystallisation Methods 0.000 description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 238000001816 cooling Methods 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000002253 acid Substances 0.000 description 10
- 150000002431 hydrogen Chemical class 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 206010030113 Oedema Diseases 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- 235000010288 sodium nitrite Nutrition 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 7
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 229960001138 acetylsalicylic acid Drugs 0.000 description 6
- 230000003110 anti-inflammatory effect Effects 0.000 description 6
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 230000005764 inhibitory process Effects 0.000 description 6
- BHXVYTQDWMQVBI-UHFFFAOYSA-N 1h-indazole-3-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=NNC2=C1 BHXVYTQDWMQVBI-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 229960002895 phenylbutazone Drugs 0.000 description 5
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 5
- 230000002265 prevention Effects 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 208000009386 Experimental Arthritis Diseases 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 241000699666 Mus <mouse, genus> Species 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 150000001718 carbodiimides Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000011835 investigation Methods 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 230000028327 secretion Effects 0.000 description 3
- ZLPGHGTXXQDDBE-UHFFFAOYSA-N (5,6-dimethoxy-1H-indazol-3-yl)-piperidin-1-ylmethanone Chemical compound COC=1C=C2C(=NNC2=CC1OC)C(=O)N1CCCCC1 ZLPGHGTXXQDDBE-UHFFFAOYSA-N 0.000 description 2
- KGSZIBUGIUSUAU-UHFFFAOYSA-N 2-(2-amino-4,5-dimethoxyphenyl)-N-benzylacetamide Chemical compound C(C1=CC=CC=C1)NC(CC1=C(C=C(C(=C1)OC)OC)N)=O KGSZIBUGIUSUAU-UHFFFAOYSA-N 0.000 description 2
- KDJKRNXBPGDZOC-UHFFFAOYSA-N 2-(2-amino-4,5-dimethoxyphenyl)acetic acid Chemical compound COC1=CC(N)=C(CC(O)=O)C=C1OC KDJKRNXBPGDZOC-UHFFFAOYSA-N 0.000 description 2
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- CXSCAKRTHWIKBT-UHFFFAOYSA-N COC1=C(C=C2C(=C1)C(=NN2)C(=O)NC3=CC=C(C=C3)Cl)OC Chemical compound COC1=C(C=C2C(=C1)C(=NN2)C(=O)NC3=CC=C(C=C3)Cl)OC CXSCAKRTHWIKBT-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- 229920002307 Dextran Polymers 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- VPENMKGNEHQVBB-UHFFFAOYSA-N N-benzyl-5,6-dimethoxy-1H-indazole-3-carboxamide Chemical compound C(C1=CC=CC=C1)NC(=O)C1=NNC2=CC(=C(C=C12)OC)OC VPENMKGNEHQVBB-UHFFFAOYSA-N 0.000 description 2
- NKTNBRNGYMAPIC-UHFFFAOYSA-N N-cyclohexyl-5,6-dimethoxy-1H-indazole-3-carboxamide Chemical compound C1(CCCCC1)NC(=O)C1=NNC2=CC(=C(C=C12)OC)OC NKTNBRNGYMAPIC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 2
- 230000036760 body temperature Effects 0.000 description 2
- OROGSEYTTFOCAN-DNJOTXNNSA-N codeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC OROGSEYTTFOCAN-DNJOTXNNSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000002473 indoazoles Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 2
- SKRDXYBATCVEMS-UHFFFAOYSA-N isopropyl nitrite Chemical compound CC(C)ON=O SKRDXYBATCVEMS-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 210000003097 mucus Anatomy 0.000 description 2
- 125000002560 nitrile group Chemical group 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 229940124641 pain reliever Drugs 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- HCCZVQJOQLXTEZ-UHFFFAOYSA-N (5,6-dimethoxy-1H-indazol-3-yl)-(4-methylpiperazin-1-yl)methanone hydrochloride Chemical compound Cl.CN1CCN(CC1)C(=O)C1=NNC2=CC(=C(C=C12)OC)OC HCCZVQJOQLXTEZ-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- TZNZKGWWQCPHML-UHFFFAOYSA-N 1-acetyl-N,N-diethyl-5,6-dimethoxyindazole-3-carboxamide Chemical compound C(C)N(C(=O)C1=NN(C2=CC(=C(C=C12)OC)OC)C(C)=O)CC TZNZKGWWQCPHML-UHFFFAOYSA-N 0.000 description 1
- DITBWPUMEUDVLU-UHFFFAOYSA-N 1h-indazole-3-carboxamide Chemical class C1=CC=C2C(C(=O)N)=NNC2=C1 DITBWPUMEUDVLU-UHFFFAOYSA-N 0.000 description 1
- GPAYAISCBLZIBB-UHFFFAOYSA-N 2-(2-amino-4,5-dimethoxyphenyl)-1-(4-methylpiperazin-1-yl)ethanone Chemical compound CN1CCN(CC1)C(CC1=C(C=C(C(=C1)OC)OC)N)=O GPAYAISCBLZIBB-UHFFFAOYSA-N 0.000 description 1
- OHHWADZCASYOTQ-UHFFFAOYSA-N 2-(2-amino-4,5-dimethoxyphenyl)-N-propan-2-ylacetamide Chemical compound C(C)(C)NC(CC1=C(C=C(C(=C1)OC)OC)N)=O OHHWADZCASYOTQ-UHFFFAOYSA-N 0.000 description 1
- TVRCHSIHBKEBHQ-UHFFFAOYSA-N 2-(2-amino-4,5-dimethoxyphenyl)acetonitrile Chemical compound COC1=CC(N)=C(CC#N)C=C1OC TVRCHSIHBKEBHQ-UHFFFAOYSA-N 0.000 description 1
- TXMURLRUEUBDHN-UHFFFAOYSA-N 2-(2-aminophenyl)acetamide Chemical class NC(=O)CC1=CC=CC=C1N TXMURLRUEUBDHN-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- HGEDPIMZZWIYDG-UHFFFAOYSA-N 5,6-dimethoxy-1h-indazole Chemical compound C1=C(OC)C(OC)=CC2=C1NN=C2 HGEDPIMZZWIYDG-UHFFFAOYSA-N 0.000 description 1
- HBNMEXSXIIAELS-UHFFFAOYSA-N 5,6-dimethoxy-1h-indole-2,3-dione Chemical compound C1=C(OC)C(OC)=CC2=NC(=O)C(O)=C21 HBNMEXSXIIAELS-UHFFFAOYSA-N 0.000 description 1
- GVLBJYPYCNGUID-UHFFFAOYSA-N 5,6-dimethoxy-N-phenyl-1H-indazole-3-carboxamide Chemical compound COC=1C=C2C(=NNC2=CC1OC)C(=O)NC1=CC=CC=C1 GVLBJYPYCNGUID-UHFFFAOYSA-N 0.000 description 1
- 101800004538 Bradykinin Proteins 0.000 description 1
- TWYPJORASOYYSL-UHFFFAOYSA-N C(C)(=O)N1N=C(C2=CC(=C(C=C12)OC)OC)C(=O)N Chemical compound C(C)(=O)N1N=C(C2=CC(=C(C=C12)OC)OC)C(=O)N TWYPJORASOYYSL-UHFFFAOYSA-N 0.000 description 1
- DIWVVZUPEGFCAN-UHFFFAOYSA-N C(C)(C)NC(=O)C1=NNC2=CC(=C(C=C12)OC)OC Chemical compound C(C)(C)NC(=O)C1=NNC2=CC(=C(C=C12)OC)OC DIWVVZUPEGFCAN-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102100035792 Kininogen-1 Human genes 0.000 description 1
- PPYWFFYAEPRLBP-UHFFFAOYSA-N N,N-diethyl-5,6-dimethoxy-1H-indazole-3-carboxamide Chemical compound C(C)N(C(=O)C1=NNC2=CC(=C(C=C12)OC)OC)CC PPYWFFYAEPRLBP-UHFFFAOYSA-N 0.000 description 1
- ORNGSMNLHUFLEW-UHFFFAOYSA-N N-(2-amino-4,5-dimethoxyphenyl)acetamide Chemical compound COC1=CC(N)=C(NC(C)=O)C=C1OC ORNGSMNLHUFLEW-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- WNJGBLAKQOETDI-UHFFFAOYSA-N N-hexyl-5,6-dimethoxy-1H-indazole-3-carboxamide Chemical compound C(CCCCC)NC(=O)C1=NNC2=CC(=C(C=C12)OC)OC WNJGBLAKQOETDI-UHFFFAOYSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 1
- 229960002327 chloral hydrate Drugs 0.000 description 1
- 229960004126 codeine Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- FIHSLNDIKXNHHG-UHFFFAOYSA-N ethyl 5,6-dimethoxy-1h-indazole-3-carboxylate Chemical compound COC1=C(OC)C=C2C(C(=O)OCC)=NNC2=C1 FIHSLNDIKXNHHG-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical compound CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 1
- OROGSEYTTFOCAN-UHFFFAOYSA-N hydrocodone Natural products C1C(N(CCC234)C)C2C=CC(O)C3OC2=C4C1=CC=C2OC OROGSEYTTFOCAN-UHFFFAOYSA-N 0.000 description 1
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 238000002061 vacuum sublimation Methods 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains three hetero rings
- C07D487/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE001639 | 1969-04-01 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2015568A1 DE2015568A1 (de) | 1970-10-15 |
| DE2015568B2 DE2015568B2 (de) | 1974-07-11 |
| DE2015568C3 true DE2015568C3 (de) | 1975-02-20 |
Family
ID=10995298
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2015568A Expired DE2015568C3 (de) | 1969-04-01 | 1970-04-01 | S.e-Dimethoxyindazol-S-carbonsäureamide |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3705175A (enExample) |
| JP (1) | JPS4920590B1 (enExample) |
| AT (2) | AT304542B (enExample) |
| CA (1) | CA918664A (enExample) |
| CH (1) | CH550804A (enExample) |
| CS (1) | CS188303B1 (enExample) |
| DE (1) | DE2015568C3 (enExample) |
| DK (1) | DK123820B (enExample) |
| FR (1) | FR2038107B1 (enExample) |
| GB (1) | GB1301882A (enExample) |
| NL (1) | NL146161B (enExample) |
| PL (1) | PL80614B1 (enExample) |
| SE (2) | SE386440B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH575397A5 (enExample) * | 1971-11-09 | 1976-05-14 | Basf Ag | |
| US3928596A (en) * | 1973-05-17 | 1975-12-23 | Upjohn Co | Pharmaceutical compositions of 5,6-dialkoxy-2-aminobenzimidazoles and method for treating hypertension |
| CH612674A5 (enExample) * | 1973-08-16 | 1979-08-15 | Egyt Gyogyszervegyeszeti Gyar | |
| US4009177A (en) * | 1974-05-23 | 1977-02-22 | Morton-Norwich Products, Inc. | Compound 2-(2-thiazolyl)-5,6-dimethoxyindazoles |
| US3966760A (en) * | 1974-05-23 | 1976-06-29 | Morton-Norwich Products, Inc. | 2-Substituted-5,6-dimethoxyindazoles |
| US4001269A (en) * | 1976-01-29 | 1977-01-04 | Morton-Norwich Products, Inc. | 3-amino-5,6-dimethoxyindazole hydrochloride |
| JPH08277287A (ja) * | 1995-02-09 | 1996-10-22 | Mitsubishi Chem Corp | インダゾール類およびその用途 |
| CN1656079A (zh) * | 2002-05-31 | 2005-08-17 | 卫材株式会社 | 吡唑化合物和含有该化合物的药物组合物 |
| ITMI20030287A1 (it) | 2003-02-18 | 2004-08-19 | Acraf | Indazolammidi dotate di attivita' analgesica metodo, per |
| WO2009106980A2 (en) * | 2008-02-29 | 2009-09-03 | Pfizer Inc. | Indazole derivatives |
| US8815892B2 (en) | 2008-03-25 | 2014-08-26 | Affectis Pharmaceuticals Ag | P2X7R antagonists and their use |
| US8232290B2 (en) * | 2008-03-25 | 2012-07-31 | Affectis Pharmaceuticals Ag | P2X7R antagonists and their use |
| EP2243772B1 (en) * | 2009-04-14 | 2012-01-18 | Affectis Pharmaceuticals AG | Novel P2X7R antagonists and their use |
| GB201511382D0 (en) | 2015-06-29 | 2015-08-12 | Imp Innovations Ltd | Novel compounds and their use in therapy |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US457269A (en) * | 1891-08-04 | Neck-yoke |
-
1970
- 1970-03-26 US US23069A patent/US3705175A/en not_active Expired - Lifetime
- 1970-03-31 SE SE7004399-7A patent/SE386440B/xx unknown
- 1970-03-31 CS CS702104A patent/CS188303B1/cs unknown
- 1970-03-31 FR FR7011477A patent/FR2038107B1/fr not_active Expired
- 1970-03-31 DK DK158670AA patent/DK123820B/da not_active IP Right Cessation
- 1970-03-31 GB GB1521870A patent/GB1301882A/en not_active Expired
- 1970-03-31 PL PL1970139722A patent/PL80614B1/pl unknown
- 1970-04-01 CH CH481570A patent/CH550804A/xx not_active IP Right Cessation
- 1970-04-01 DE DE2015568A patent/DE2015568C3/de not_active Expired
- 1970-04-01 CA CA078818A patent/CA918664A/en not_active Expired
- 1970-04-01 NL NL707004647A patent/NL146161B/xx not_active IP Right Cessation
- 1970-04-01 AT AT214371A patent/AT304542B/de not_active IP Right Cessation
- 1970-04-01 AT AT295470A patent/AT295529B/de not_active IP Right Cessation
- 1970-04-01 JP JP45027770A patent/JPS4920590B1/ja active Pending
-
1973
- 1973-11-23 SE SE7315895A patent/SE402287B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2015568A1 (de) | 1970-10-15 |
| FR2038107A1 (enExample) | 1971-01-08 |
| DK123820B (da) | 1972-08-07 |
| NL7004647A (enExample) | 1970-10-05 |
| SE386440B (sv) | 1976-08-09 |
| AT304542B (de) | 1973-01-10 |
| FR2038107B1 (enExample) | 1974-02-01 |
| US3705175A (en) | 1972-12-05 |
| CA918664A (en) | 1973-01-09 |
| DE2015568B2 (de) | 1974-07-11 |
| GB1301882A (enExample) | 1973-01-04 |
| JPS4920590B1 (enExample) | 1974-05-25 |
| AT295529B (de) | 1972-01-10 |
| CH550804A (de) | 1974-06-28 |
| SE402287B (sv) | 1978-06-26 |
| PL80614B1 (enExample) | 1975-08-30 |
| CS188303B1 (en) | 1979-03-30 |
| NL146161B (nl) | 1975-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2015568C3 (de) | S.e-Dimethoxyindazol-S-carbonsäureamide | |
| DE2419970C3 (de) | 3-<l-Pyrrolidinyl)-4-phenoxy-5sulfamoylbenzoesäure und Verfahren zu ihrer Herstellung | |
| DE1795769A1 (de) | Tetrahydrohomopyrimidazolderivate, deren saeureadditionssalze und quaternaeren salze sowie verfahren zu deren herstellung | |
| DE2356900A1 (de) | Substituierte chromon-3-carbonitrile, -carboxamide und -carbonsaeuren, deren salze und diese verbindungen enthaltende arzneimittel | |
| DE2310031A1 (de) | Substituierte 1-benzyl-indazol-3carbonsaeuren | |
| DE2461802C2 (de) | Pyrazincarboxamidderivate | |
| DE2356903A1 (de) | Verfahren zur herstellung substituierter chromon-3-carbonitrile, -carboxamide und -carbonsaeuren | |
| DE2023000C2 (de) | Neue 5-Cycloalkyl-1-indancarbonsäuren, 6-Cycloalkyltetralin-1-carbonsäuren, Derivate davon und Verfahren zu ihrer Herstellung | |
| DE1618465C3 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1468758B1 (de) | 3-Amino-tricyclo[4,3,1,1?]-undekan-Derivate und Verfahren zu ihrer Herstellung | |
| DE2347015C2 (de) | Neue Pyrazolyloxyessigsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende Mittel | |
| DE2008692A1 (de) | Verfahren zur Herstellung von Indol-3carbonsäurederivaten und nach dem Verfahren erhältliche, neue Verbindungen | |
| DE2022694C3 (de) | alpha-(3,4-Dihydro-4-oxo-1H-2,3benzothiazin-S-dioxyd-3-yl)-N,N-dimethylacetamid und Verfahren zur Herstellung desselben | |
| DE2653251A1 (de) | Azabicyclo eckige klammer auf 3.1.o eckige klammer zu hexan-derivate, ihre herstellung und verwendung | |
| DE2406490C2 (de) | 1,4-Dihydro-3(2H)-isochinolinonverbindungen und ihre Salze, Verfahren zur Herstellung derselben und diese Verbindungen enthaltende Arzneimittel | |
| DE1670143C3 (enExample) | ||
| DE2137538A1 (de) | Methoxyaminderivate und ihre Salze sowie ihre Verwendimg und Verfahren zur Herstellung derselben | |
| DE2029991C3 (de) | 2-Hydroxy-5-aminobenzamide, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen enthalten | |
| DE1770984C3 (de) | 5 Aroyl-pyrrol-2-essigsäurederivate | |
| AT229874B (de) | Verfahren zur Herstellung von neuen (5- oder 6)-Alkyl- und 5, 6-Dialkyl-3-alkoxy-pyrazinen | |
| DE2215999A1 (de) | Nitroimidazolyl-triazolo-pyridazine und verfahren zu ihrer herstellung | |
| DE2131888A1 (de) | 5-Nitrothiazolderivate und Verfahren zu ihrer Herstellung | |
| AT270630B (de) | Verfahren zur Herstellung von neuen Pyrrolinderivaten und ihren Salzen | |
| DE1443604C3 (de) | 1 -Aminomethyl-1,2-dihydro-benzocyclobuten und einige seiner Derivate, Salze dieser Verbindungen, Verfahren zur Herstellung dieser Verbindungen und diese Verbindungen enthaltende pharmazeutische Präparate | |
| AT376417B (de) | Verfahren zur herstellung von phenylaethanolaminen und ihren salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |