DE2007506A1 - Galvanische Primarzellen und aus ihnen bestehende Batterien - Google Patents
Galvanische Primarzellen und aus ihnen bestehende BatterienInfo
- Publication number
- DE2007506A1 DE2007506A1 DE19702007506 DE2007506A DE2007506A1 DE 2007506 A1 DE2007506 A1 DE 2007506A1 DE 19702007506 DE19702007506 DE 19702007506 DE 2007506 A DE2007506 A DE 2007506A DE 2007506 A1 DE2007506 A1 DE 2007506A1
- Authority
- DE
- Germany
- Prior art keywords
- anode
- cathode
- cell
- electrolyte
- cells
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003792 electrolyte Substances 0.000 claims description 36
- 239000000853 adhesive Substances 0.000 claims description 21
- 230000001070 adhesive effect Effects 0.000 claims description 21
- 229920002554 vinyl polymer Polymers 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 239000003566 sealing material Substances 0.000 claims description 4
- 239000002562 thickening agent Substances 0.000 claims description 4
- 235000019270 ammonium chloride Nutrition 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 230000002999 depolarising effect Effects 0.000 claims description 3
- 235000005074 zinc chloride Nutrition 0.000 claims description 3
- 239000011592 zinc chloride Substances 0.000 claims description 3
- 229920001169 thermoplastic Polymers 0.000 claims description 2
- 239000004416 thermosoftening plastic Substances 0.000 claims description 2
- 238000002844 melting Methods 0.000 claims 1
- 239000010410 layer Substances 0.000 description 27
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 229920002401 polyacrylamide Polymers 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 4
- 238000010276 construction Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- NVTGXPLADYDNKR-LZITWAFGSA-N (1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31S,33R,35R,36R,37R,38R,39R,40R,41R,42R,43R,44R,45R,46R,47R,48R,49R)-5-[(2-aminoethylamino)methyl]-10,15,20,25,30,35-hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane-36,37,38,39,40,41,42,43,44,45,46,47,48,49-tetradecol Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CNCCN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO NVTGXPLADYDNKR-LZITWAFGSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000004831 Hot glue Substances 0.000 description 1
- 229920000161 Locust bean gum Polymers 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000006230 acetylene black Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920002432 poly(vinyl methyl ether) polymer Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002717 polyvinylpyridine Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000012945 sealing adhesive Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M6/00—Primary cells; Manufacture thereof
- H01M6/04—Cells with aqueous electrolyte
- H01M6/06—Dry cells, i.e. cells wherein the electrolyte is rendered non-fluid
- H01M6/12—Dry cells, i.e. cells wherein the electrolyte is rendered non-fluid with flat electrodes
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M6/00—Primary cells; Manufacture thereof
- H01M6/42—Grouping of primary cells into batteries
- H01M6/46—Grouping of primary cells into batteries of flat cells
- H01M6/48—Grouping of primary cells into batteries of flat cells with bipolar electrodes
Landscapes
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Primary Cells (AREA)
- Sealing Battery Cases Or Jackets (AREA)
- Cell Electrode Carriers And Collectors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80098669A | 1969-02-20 | 1969-02-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2007506A1 true DE2007506A1 (de) | 1971-03-04 |
Family
ID=25179894
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702007506 Pending DE2007506A1 (de) | 1969-02-20 | 1970-02-19 | Galvanische Primarzellen und aus ihnen bestehende Batterien |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3563805A (en, 2012) |
| JP (1) | JPS498579B1 (en, 2012) |
| BE (1) | BE746335A (en, 2012) |
| CA (1) | CA930420A (en, 2012) |
| DE (1) | DE2007506A1 (en, 2012) |
| FR (1) | FR2032951A5 (en, 2012) |
| GB (1) | GB1288489A (en, 2012) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3427287A1 (de) * | 1983-07-26 | 1985-02-14 | Casio Computer Co Ltd | Kompaktes elektronisches geraet |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3706616A (en) * | 1970-12-21 | 1972-12-19 | Esb Inc | Duplex electrode construction using continuous metal carrier strip having at least one nonreactive metal side |
| US3770504A (en) * | 1970-12-21 | 1973-11-06 | Esb Inc | High discharge rate multicell battery |
| US3770505A (en) * | 1970-12-21 | 1973-11-06 | Esb Inc | Multicell battery comprising duplex electrode utilizing conductive plastic carrier strip |
| US3775188A (en) * | 1971-08-27 | 1973-11-27 | Esb Inc | Method of multicell battery production using pocketed continuous strip |
| US3954506A (en) * | 1971-11-16 | 1976-05-04 | Polaroid Corporation | Zinc anode and composition and method for producing same |
| US3985574A (en) * | 1973-05-18 | 1976-10-12 | Compagnie Generale D'electricite | Electrochemical elements in thin layers |
| US3833427A (en) * | 1973-07-27 | 1974-09-03 | Polaroid Corp | Planar battery, process of manufacture thereof and film cassette including the same |
| US3877045A (en) * | 1973-09-21 | 1975-04-08 | Polaroid Corp | Novel photographic film assemblies |
| US4001467A (en) * | 1973-10-23 | 1977-01-04 | Polaroid Corporation | Method for producing zinc anode |
| US3912543A (en) * | 1974-02-04 | 1975-10-14 | Polaroid Corp | Planar battery and a photographic film assembly |
| US3899355A (en) * | 1974-02-14 | 1975-08-12 | Polaroid Corp | Battery assembly |
| US4181778A (en) * | 1974-02-15 | 1980-01-01 | Polaroid Corporation | Novel battery anode |
| US3920477A (en) * | 1974-05-01 | 1975-11-18 | Du Pont | Compact battery |
| US4152825A (en) * | 1974-06-10 | 1979-05-08 | Polaroid Corporation | Method of making a flat battery |
| US3902922A (en) * | 1974-07-18 | 1975-09-02 | Union Carbide Corp | Conductive coated vented cathode collector for thin flat cells |
| US3901732A (en) * | 1974-07-18 | 1975-08-26 | Union Carbide Corp | Thin flat cell construction having a gas-permeable coated perforated anode |
| US4080728A (en) * | 1974-08-08 | 1978-03-28 | Polaroid Corporation | Method of making flat battery |
| US3944435A (en) * | 1974-12-24 | 1976-03-16 | Union Carbide Corporation | Bonded component assembly for flat cells and method therefor |
| US4070528A (en) * | 1975-04-30 | 1978-01-24 | Esb Incorporated | Battery having porous inherently sealable separator |
| FR2324128A1 (fr) * | 1975-09-10 | 1977-04-08 | Belyshev Leonid | Procede de preparation d'un electrolyte epais d'une source primaire de courant |
| US4232099A (en) * | 1976-02-06 | 1980-11-04 | Polaroid Corporation | Novel battery assembly |
| US4069578A (en) * | 1977-01-24 | 1978-01-24 | Polaroid Corporation | Method for sealing battery |
| US4254191A (en) * | 1977-01-24 | 1981-03-03 | Polaroid Corporation | Method for manufacturing battery vents and vented batteries |
| US4098965A (en) * | 1977-01-24 | 1978-07-04 | Polaroid Corporation | Flat batteries and method of making the same |
| US4125685A (en) * | 1977-06-30 | 1978-11-14 | Polaroid Corporation | Electrical cells and batteries and methods of making the same |
| US4125684A (en) * | 1977-06-30 | 1978-11-14 | Polaroid Corporation | Electrical cells and batteries |
| US4124742A (en) * | 1977-06-30 | 1978-11-07 | Polaroid Corporation | Electrical cells and batteries and methods and apparatus for making the same |
| US4161815A (en) * | 1977-06-30 | 1979-07-24 | Polaroid Corporation | Methods for making electrical cells and batteries |
| US4182561A (en) * | 1978-08-03 | 1980-01-08 | Polaroid Corporation | Fast charging electronic flash device |
| US4184756A (en) * | 1978-10-13 | 1980-01-22 | Polaroid Corporation | Strobe without primary storage capacitor |
| US4364103A (en) * | 1980-08-11 | 1982-12-14 | Harshbarger Thad L | Battery case for an electrically operated device |
| US4535038A (en) * | 1984-05-21 | 1985-08-13 | Gte Communications Products Corporation | Structure for electrochemical batteries |
| US4608323A (en) * | 1985-03-07 | 1986-08-26 | Duracell Inc. | Cell jacket |
| US5089027A (en) * | 1990-11-26 | 1992-02-18 | Gould Inc. | Method for producing a solid electrolyte cell |
| IL102794A (en) * | 1991-09-24 | 1995-06-29 | Duracell Inc | Battery with electrochemical tester |
| JPH05225989A (ja) * | 1992-02-14 | 1993-09-03 | Yuasa Corp | 薄形電池の製造方法 |
| US5478667A (en) * | 1992-10-29 | 1995-12-26 | Shackle; Dale R. | Heat dissipating current collector for a battery |
| US5350645A (en) * | 1993-06-21 | 1994-09-27 | Micron Semiconductor, Inc. | Polymer-lithium batteries and improved methods for manufacturing batteries |
| US5897522A (en) * | 1995-12-20 | 1999-04-27 | Power Paper Ltd. | Flexible thin layer open electrochemical cell and applications of same |
| US7776468B2 (en) * | 2004-03-18 | 2010-08-17 | The Gillette Company | Wafer alkaline cell |
| US7531271B2 (en) * | 2004-03-18 | 2009-05-12 | The Gillette Company | Wafer alkaline cell |
| US7820329B2 (en) * | 2004-03-18 | 2010-10-26 | The Procter & Gamble Company | Wafer alkaline cell |
| US7413828B2 (en) * | 2004-03-18 | 2008-08-19 | The Gillette Company | Wafer alkaline cell |
| US8268472B2 (en) | 2009-09-30 | 2012-09-18 | Bright Automotive, Inc. | Battery cooling apparatus for electric vehicle |
| CN102544640A (zh) * | 2010-12-13 | 2012-07-04 | 依诺特生物能量控股公司 | 高聚体溶液、负电极材料层、电极及电池 |
| EP2885830B1 (en) | 2012-08-16 | 2017-10-11 | Enovix Corporation | Electrode structures for three-dimensional batteries |
| JP2016517618A (ja) | 2013-03-15 | 2016-06-16 | エノビクス・コーポレイションＥｎｏｖｉｘ Ｃｏｒｐｏｒａｔｉｏｎ | 三次元電池用セパレータ |
| US10283807B2 (en) | 2015-05-14 | 2019-05-07 | Enovix Corporation | Longitudinal constraints for energy storage devices |
| KR102707727B1 (ko) | 2016-05-13 | 2024-09-19 | 에노빅스 코오퍼레이션 | 3차원 배터리들에 대한 치수 구속부들 |
| KR102525366B1 (ko) | 2016-11-16 | 2023-04-26 | 에노빅스 코오퍼레이션 | 압축 가능 캐소드들이 있는 3차원 배터리들 |
| US10256507B1 (en) | 2017-11-15 | 2019-04-09 | Enovix Corporation | Constrained electrode assembly |
| WO2019099642A2 (en) | 2017-11-15 | 2019-05-23 | Enovix Corporation | Electrode assembly, secondary battery, and method of manufacture |
| US11211639B2 (en) | 2018-08-06 | 2021-12-28 | Enovix Corporation | Electrode assembly manufacture and device |
| WO2022212439A1 (en) * | 2021-03-31 | 2022-10-06 | Enovix Operations Inc. | Electrode assembly structure, secondary battery, and methods of manufacture |
-
1969
- 1969-02-20 US US800986A patent/US3563805A/en not_active Expired - Lifetime
-
1970
- 1970-01-07 CA CA071571A patent/CA930420A/en not_active Expired
- 1970-02-19 DE DE19702007506 patent/DE2007506A1/de active Pending
- 1970-02-20 GB GB1288489D patent/GB1288489A/en not_active Expired
- 1970-02-20 BE BE746335D patent/BE746335A/xx unknown
- 1970-02-20 FR FR7006247A patent/FR2032951A5/fr not_active Expired
- 1970-02-20 JP JP45014721A patent/JPS498579B1/ja active Pending
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3427287A1 (de) * | 1983-07-26 | 1985-02-14 | Casio Computer Co Ltd | Kompaktes elektronisches geraet |
| US4670664A (en) * | 1983-07-26 | 1987-06-02 | Casio Computer Co., Ltd. | Compact electronic equipment |
| DE3427287C2 (en, 2012) * | 1983-07-26 | 1988-02-18 | Casio Computer Co., Ltd., Tokio/Tokyo, Jp | |
| US4749875A (en) * | 1983-07-26 | 1988-06-07 | Casio Computer Co., Ltd. | Compact electronic equipment |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2032951A5 (en, 2012) | 1970-11-27 |
| US3563805A (en) | 1971-02-16 |
| BE746335A (fr) | 1970-08-20 |
| JPS498579B1 (en, 2012) | 1974-02-27 |
| CA930420A (en) | 1973-07-17 |
| GB1288489A (en, 2012) | 1972-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2007506A1 (de) | Galvanische Primarzellen und aus ihnen bestehende Batterien | |
| DE2517882C3 (de) | Galvanisches Festkörperelement | |
| DE2828817C2 (en, 2012) | ||
| DE69636651T2 (de) | Batteriezustandsprüfgerät | |
| DE2849294C3 (de) | Dünne Metall-Halogen-Zelle und Verfahren zu ihrer Herstellung | |
| EP1872426A1 (de) | Galvanisches element | |
| DE2166543B2 (de) | Plastische positive elektrode fuer galvanische elemente mit feststoffelektrolyten | |
| DE3036807C2 (de) | Elektrochemisches Element mit hoher Energiedichte | |
| DE2828818A1 (de) | Bauteilgruppen fuer galvanische elemente und daraus hergestellte galvanische elemente | |
| DE3613237A1 (de) | Mit luft depolarisiertes metallelement | |
| DE2220914A1 (de) | Flachzellen-batterie mit auf einer seite liegenden anschluessen | |
| DE1671857B1 (de) | Elektrochemische vorrichtung mit einem ionischen leitenden festelektrolyten | |
| DE2531274A1 (de) | Duenne, flache zellenkonstruktion mit einer gas-permeablen ueberzogenen, perforierten anode | |
| DE2909364A1 (de) | Elektrochemische zelle und verfahren zur herstellung einer solchen zelle | |
| DE2828815A1 (de) | Bauteilgruppen fuer schichtbatterien | |
| DE2132165A1 (de) | Galvanische Batterie | |
| DE2445042C2 (de) | Fotografische Filmkassette | |
| DE2502497C3 (de) | Galvanisches Element | |
| DE3014037A1 (de) | Positive elektrode fuer elektrische energiespeichereinrichtungen | |
| DE1935943A1 (de) | Galvanische Elemente und dafuer nuetzliche Halbzellen | |
| DE2349615B2 (de) | Galvanische festelektrolytzelle | |
| DE2921494A1 (de) | Lithium-halogenzelle mit aktivkohle | |
| DE1671858B2 (de) | Abgeschlossenes galvanisches element mit einem ionisch leitfaehigen feststoffelektrolyten | |
| DE2704710C2 (de) | Primärzelle und daraus aufgebaute Primärbatterie in Flachbauweise | |
| DE2007562C3 (de) | Galvanische Flachzellenbatterie |