DE19508038A1 - Kathode für eine Elektronenröhre - Google Patents
Kathode für eine ElektronenröhreInfo
- Publication number
- DE19508038A1 DE19508038A1 DE19508038A DE19508038A DE19508038A1 DE 19508038 A1 DE19508038 A1 DE 19508038A1 DE 19508038 A DE19508038 A DE 19508038A DE 19508038 A DE19508038 A DE 19508038A DE 19508038 A1 DE19508038 A1 DE 19508038A1
- Authority
- DE
- Germany
- Prior art keywords
- cathode
- compound
- electron
- carbonate
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000011777 magnesium Substances 0.000 claims abstract description 38
- 150000001875 compounds Chemical class 0.000 claims abstract description 30
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 23
- 229910052751 metal Inorganic materials 0.000 claims abstract description 17
- 239000002184 metal Substances 0.000 claims abstract description 17
- 239000000126 substance Substances 0.000 claims abstract description 15
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 12
- -1 alkaline earth metal carbonate Chemical class 0.000 claims abstract description 11
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 11
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052788 barium Inorganic materials 0.000 claims abstract description 8
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052746 lanthanum Inorganic materials 0.000 claims abstract description 5
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 5
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims abstract description 4
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims abstract description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 239000002075 main ingredient Substances 0.000 claims description 3
- RIAXXCZORHQTQD-UHFFFAOYSA-N lanthanum magnesium Chemical compound [Mg].[La] RIAXXCZORHQTQD-UHFFFAOYSA-N 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 abstract description 4
- 239000000470 constituent Substances 0.000 abstract 1
- 239000010410 layer Substances 0.000 description 22
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 13
- 238000000034 method Methods 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 10
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 6
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 6
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 6
- 229910002651 NO3 Inorganic materials 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- FYDKNKUEBJQCCN-UHFFFAOYSA-N lanthanum(3+);trinitrate Chemical compound [La+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O FYDKNKUEBJQCCN-UHFFFAOYSA-N 0.000 description 4
- 229910052761 rare earth metal Inorganic materials 0.000 description 4
- 150000002910 rare earth metals Chemical class 0.000 description 4
- 238000005245 sintering Methods 0.000 description 4
- 239000000020 Nitrocellulose Substances 0.000 description 3
- 229920001220 nitrocellulos Polymers 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 229910002422 La(NO3)3·6H2O Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 238000001994 activation Methods 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- RSEIMSPAXMNYFJ-UHFFFAOYSA-N europium(III) oxide Inorganic materials O=[Eu]O[Eu]=O RSEIMSPAXMNYFJ-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- HYXGAEYDKFCVMU-UHFFFAOYSA-N scandium(III) oxide Inorganic materials O=[Sc]O[Sc]=O HYXGAEYDKFCVMU-UHFFFAOYSA-N 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000012549 training Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/13—Solid thermionic cathodes
- H01J1/14—Solid thermionic cathodes characterised by the material
- H01J1/142—Solid thermionic cathodes characterised by the material with alkaline-earth metal oxides, or such oxides used in conjunction with reducing agents, as an emissive material
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/13—Solid thermionic cathodes
- H01J1/20—Cathodes heated indirectly by an electric current; Cathodes heated by electron or ion bombardment
- H01J1/28—Dispenser-type cathodes, e.g. L-cathode
Landscapes
- Solid Thermionic Cathode (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1019940026115A KR100200661B1 (ko) | 1994-10-12 | 1994-10-12 | 전자관용 음극 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE19508038A1 true DE19508038A1 (de) | 1996-04-18 |
Family
ID=19394973
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19508038A Withdrawn DE19508038A1 (de) | 1994-10-12 | 1995-03-07 | Kathode für eine Elektronenröhre |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US5698937A (https=) |
| JP (1) | JP3301881B2 (https=) |
| KR (1) | KR100200661B1 (https=) |
| CN (1) | CN1081386C (https=) |
| DE (1) | DE19508038A1 (https=) |
| GB (1) | GB2294155B (https=) |
| MY (1) | MY130117A (https=) |
| NL (1) | NL194139C (https=) |
| TW (1) | TW319881B (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH09147735A (ja) * | 1995-09-21 | 1997-06-06 | Matsushita Electron Corp | 陰極線管用エミッタ材料及びその製造方法 |
| KR100366073B1 (ko) * | 1995-10-30 | 2003-03-06 | 삼성에스디아이 주식회사 | 전자관용음극 |
| KR100269360B1 (ko) * | 1997-12-24 | 2000-10-16 | 구자홍 | 음극선관용 음극구조체 |
| KR100249714B1 (ko) * | 1997-12-30 | 2000-03-15 | 손욱 | 전자총용 음극 |
| KR100297687B1 (ko) * | 1998-09-24 | 2001-08-07 | 김순택 | 전자총용음극 |
| US6882093B2 (en) * | 2001-08-01 | 2005-04-19 | Matsushita Electric Industrial Co., Ltd. | Long-life electron tube device, electron tube cathode, and manufacturing method for the electron tube device |
| FR2871933A1 (fr) * | 2004-06-21 | 2005-12-23 | Thomson Licensing Sa | Structure de cathode basse consommation pour tubes a rayons cathodiques |
| KR101708785B1 (ko) * | 2009-08-11 | 2017-02-21 | 도레이 카부시키가이샤 | 전자 방출원용 페이스트 및 전자 방출원 |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB817063A (https=) * | ||||
| US1794298A (en) * | 1926-09-21 | 1931-02-24 | Gen Electric | Thermionic cathode |
| FR901530A (fr) * | 1943-03-15 | 1945-07-30 | Telefunken Gmbh | Perfectionnements aux cathodes à oxydes pour récipients à décharge électrique |
| NL273523A (https=) * | 1961-01-17 | |||
| US4073989A (en) * | 1964-01-17 | 1978-02-14 | Horizons Incorporated | Continuous channel electron beam multiplier |
| US3436584A (en) * | 1966-03-15 | 1969-04-01 | Gen Electric | Electron emission source with sharply defined emitting area |
| CH582951A5 (https=) * | 1973-07-09 | 1976-12-15 | Bbc Brown Boveri & Cie | |
| US4017808A (en) * | 1975-02-10 | 1977-04-12 | Owens-Illinois, Inc. | Gas laser with sputter-resistant cathode |
| JPS5652835A (en) * | 1979-10-01 | 1981-05-12 | Hitachi Ltd | Impregnated cathode |
| JPS5949131A (ja) * | 1982-09-13 | 1984-03-21 | Mitsubishi Electric Corp | 電子管陰極 |
| CA1270890A (en) * | 1985-07-19 | 1990-06-26 | Keiji Watanabe | Cathode for electron tube |
| NL8701739A (nl) * | 1987-07-23 | 1989-02-16 | Philips Nv | Oxydekathode. |
| JPS6460938A (en) * | 1987-09-01 | 1989-03-08 | Hitachi Ltd | Cathode for electron tube |
| JPH0690907B2 (ja) * | 1988-02-02 | 1994-11-14 | 三菱電機株式会社 | 電子管用陰極 |
| KR910009660B1 (ko) * | 1988-02-23 | 1991-11-25 | 미쓰비시전기 주식회사 | 전자관용 산화물피복음극 |
| JPH01279537A (ja) * | 1988-04-30 | 1989-11-09 | Futaba Corp | 傍熱形線状陰極 |
| NL8900806A (nl) * | 1989-04-03 | 1990-11-01 | Philips Nv | Kathode voor een elektrische ontladingsbuis. |
| KR920001337B1 (ko) * | 1989-09-07 | 1992-02-10 | 삼성전관 주식회사 | 전자관음극 및 그 제조방법 |
| JP2758244B2 (ja) * | 1990-03-07 | 1998-05-28 | 三菱電機株式会社 | 電子管用陰極 |
| NL9002291A (nl) * | 1990-10-22 | 1992-05-18 | Philips Nv | Oxydekathode. |
| US5348934A (en) * | 1991-09-09 | 1994-09-20 | Raytheon Company | Secondary emission cathode having supeconductive oxide material |
| GB2279495A (en) * | 1993-06-22 | 1995-01-04 | Thorn Microwave Devices Limite | Thermionic cathode |
| EP0639848B1 (en) * | 1993-08-20 | 1997-09-10 | Samsung Display Devices Co., Ltd. | Oxide cathode for electron tube |
| KR100294484B1 (ko) * | 1993-08-24 | 2001-09-17 | 김순택 | 전자관용음극 |
-
1994
- 1994-10-12 KR KR1019940026115A patent/KR100200661B1/ko not_active Expired - Fee Related
-
1995
- 1995-02-14 JP JP2486595A patent/JP3301881B2/ja not_active Expired - Fee Related
- 1995-02-15 GB GB9502967A patent/GB2294155B/en not_active Expired - Fee Related
- 1995-02-16 MY MYPI95000386A patent/MY130117A/en unknown
- 1995-02-16 NL NL9500286A patent/NL194139C/nl not_active IP Right Cessation
- 1995-02-23 US US08/393,534 patent/US5698937A/en not_active Expired - Fee Related
- 1995-03-03 TW TW084102045A patent/TW319881B/zh active
- 1995-03-07 DE DE19508038A patent/DE19508038A1/de not_active Withdrawn
- 1995-03-07 CN CN95100987A patent/CN1081386C/zh not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| NL194139B (nl) | 2001-03-01 |
| KR960015634A (ko) | 1996-05-22 |
| NL9500286A (nl) | 1996-05-01 |
| US5698937A (en) | 1997-12-16 |
| TW319881B (https=) | 1997-11-11 |
| KR100200661B1 (ko) | 1999-06-15 |
| CN1120728A (zh) | 1996-04-17 |
| NL194139C (nl) | 2001-07-03 |
| GB2294155B (en) | 1999-03-03 |
| GB2294155A (en) | 1996-04-17 |
| GB9502967D0 (en) | 1995-04-05 |
| MY130117A (en) | 2007-06-29 |
| CN1081386C (zh) | 2002-03-20 |
| JPH08124476A (ja) | 1996-05-17 |
| JP3301881B2 (ja) | 2002-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69101797T2 (de) | Elektronenröhrenkathode. | |
| DD209703A5 (de) | Verfahren zum herstellen einer nachlieferungskathode und nach diesen verfahren hergestellte nachlieferungskathode | |
| DE2647396A1 (de) | Gasentladungspaneel | |
| DE2951741A1 (de) | Elektrode fuer eine entladungslampe | |
| DE3819852C2 (https=) | ||
| DE19508038A1 (de) | Kathode für eine Elektronenröhre | |
| DE68906557T2 (de) | Kathode fuer eine kathodenstrahlroehre. | |
| DE69503198T2 (de) | Vorratskathode und verfahren zur herstellung einer vorratskathode | |
| DE69626077T2 (de) | Emittierendes Material für Kathodenstrahlröhren und Verfahren zu dessen Herstellung | |
| DE69119191T2 (de) | ZnO:Zn Phosphor für fluoreszente Vakuumvorrichtung | |
| DE2604709A1 (de) | Durch langsame elektronen erregbare leuchtanzeigevorrichtung | |
| DE68916542T2 (de) | Elektrode für entladungslichtquelle. | |
| DE2947313C2 (de) | Elektronenröhrenkathode | |
| DE19618929A1 (de) | Kathode für Elektronenröhren | |
| DE3780246T3 (de) | Drahtförmige Glühkathode. | |
| DE102005025404B4 (de) | Mehrfarbig leuchtende, fluoreszierende Sichtanzeigevorrichtung | |
| DE19935773A1 (de) | Kathode für Elektronenkanone | |
| DE2660891C2 (de) | Verwendung eines Gemisches aus ZnO und ZnS:Ag als Leuchtmasse | |
| DE69313845T2 (de) | Oxydkathode für Elektronenröhre | |
| DE60102648T2 (de) | Oxidkathode und zugehöriges herstellungsverfahren | |
| DE2738207C2 (de) | Basismetallplattenwerkstoff für eine direkt erhitzte Oxidkathode | |
| DE2849606B2 (de) | Basismetallplattenmaterial für direkt erhitzte Oxidkathoden | |
| DE69409306T2 (de) | Thermisch emittierende Kathode, Herstellungsverfahren einer solchen thermisch emittierende Kathode und Elektronenstrahl-Gerät | |
| DE3119747A1 (de) | Emittierende masse und verfahren zu ihrer herstellung | |
| DE19935774A1 (de) | Kathode für Elektronenkanone |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8139 | Disposal/non-payment of the annual fee |