DE1936241A1 - Thiadiazolyl-harnstoffe - Google Patents
Thiadiazolyl-harnstoffeInfo
- Publication number
 - DE1936241A1 DE1936241A1 DE19691936241 DE1936241A DE1936241A1 DE 1936241 A1 DE1936241 A1 DE 1936241A1 DE 19691936241 DE19691936241 DE 19691936241 DE 1936241 A DE1936241 A DE 1936241A DE 1936241 A1 DE1936241 A1 DE 1936241A1
 - Authority
 - DE
 - Germany
 - Prior art keywords
 - formula
 - thiadiazolyl
 - urea
 - ureas
 - methylthio
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Pending
 
Links
- -1 Thiadiazolyl ureas Chemical class 0.000 title description 41
 - 235000013877 carbamide Nutrition 0.000 title description 21
 - 239000004480 active ingredient Substances 0.000 claims description 51
 - 241000196324 Embryophyta Species 0.000 claims description 40
 - 239000004202 carbamide Substances 0.000 claims description 26
 - 230000002363 herbicidal effect Effects 0.000 claims description 22
 - XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methyl urea Chemical compound CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 claims description 19
 - 238000000034 method Methods 0.000 claims description 16
 - 239000002253 acid Substances 0.000 claims description 13
 - 239000004009 herbicide Substances 0.000 claims description 12
 - 125000004432 carbon atom Chemical group C* 0.000 claims description 10
 - 229910052739 hydrogen Inorganic materials 0.000 claims description 10
 - 239000001257 hydrogen Substances 0.000 claims description 10
 - 239000004215 Carbon black (E152) Substances 0.000 claims description 8
 - 239000003795 chemical substances by application Substances 0.000 claims description 8
 - 229930195733 hydrocarbon Natural products 0.000 claims description 8
 - 229920006395 saturated elastomer Polymers 0.000 claims description 7
 - 125000001931 aliphatic group Chemical group 0.000 claims description 6
 - 239000000969 carrier Substances 0.000 claims description 6
 - 150000002431 hydrogen Chemical group 0.000 claims description 6
 - 238000002360 preparation method Methods 0.000 claims description 6
 - YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 5
 - 241001148683 Zostera marina Species 0.000 claims description 5
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
 - 239000011230 binding agent Substances 0.000 claims description 4
 - 150000004657 carbamic acid derivatives Chemical class 0.000 claims description 4
 - 239000012948 isocyanate Substances 0.000 claims description 4
 - 150000002513 isocyanates Chemical class 0.000 claims description 4
 - QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 claims description 3
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
 - 150000001412 amines Chemical class 0.000 claims description 3
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
 - 229910052794 bromium Inorganic materials 0.000 claims description 3
 - 229910052740 iodine Inorganic materials 0.000 claims description 3
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
 - DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
 - NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 claims description 2
 - 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
 - 230000003115 biocidal effect Effects 0.000 claims description 2
 - 229910052801 chlorine Inorganic materials 0.000 claims description 2
 - 239000000460 chlorine Substances 0.000 claims description 2
 - 150000004820 halides Chemical class 0.000 claims description 2
 - KOSYAAIZOGNATQ-UHFFFAOYSA-N o-phenyl chloromethanethioate Chemical compound ClC(=S)OC1=CC=CC=C1 KOSYAAIZOGNATQ-UHFFFAOYSA-N 0.000 claims description 2
 - 229910001414 potassium ion Inorganic materials 0.000 claims description 2
 - 239000011734 sodium Substances 0.000 claims description 2
 - 229910001415 sodium ion Inorganic materials 0.000 claims description 2
 - 150000004651 carbonic acid esters Chemical class 0.000 claims 2
 - AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical group OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 claims 1
 - PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 1
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
 - 150000003839 salts Chemical class 0.000 description 18
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
 - 239000000203 mixture Substances 0.000 description 15
 - 150000002148 esters Chemical class 0.000 description 13
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
 - XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 12
 - 239000000126 substance Substances 0.000 description 10
 - 239000004563 wettable powder Substances 0.000 description 10
 - 235000007319 Avena orientalis Nutrition 0.000 description 9
 - 244000075850 Avena orientalis Species 0.000 description 9
 - 150000001875 compounds Chemical class 0.000 description 9
 - 230000000885 phytotoxic effect Effects 0.000 description 9
 - 241000219198 Brassica Species 0.000 description 8
 - HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
 - 239000012141 concentrate Substances 0.000 description 8
 - 239000000839 emulsion Substances 0.000 description 8
 - 239000008187 granular material Substances 0.000 description 8
 - 229920000151 polyglycol Polymers 0.000 description 8
 - 239000010695 polyglycol Substances 0.000 description 8
 - 239000007921 spray Substances 0.000 description 8
 - 235000003351 Brassica cretica Nutrition 0.000 description 7
 - 235000003343 Brassica rupestris Nutrition 0.000 description 7
 - QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 7
 - 238000006243 chemical reaction Methods 0.000 description 7
 - 235000010460 mustard Nutrition 0.000 description 7
 - 150000003672 ureas Chemical class 0.000 description 7
 - 239000005995 Aluminium silicate Substances 0.000 description 6
 - QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
 - JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
 - 235000012211 aluminium silicate Nutrition 0.000 description 6
 - NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 6
 - 238000002844 melting Methods 0.000 description 6
 - 230000008018 melting Effects 0.000 description 6
 - 239000002689 soil Substances 0.000 description 6
 - RYECOJGRJDOGPP-UHFFFAOYSA-N Ethylurea Chemical compound CCNC(N)=O RYECOJGRJDOGPP-UHFFFAOYSA-N 0.000 description 5
 - 241000220261 Sinapis Species 0.000 description 5
 - 241000219873 Vicia Species 0.000 description 5
 - 239000013543 active substance Substances 0.000 description 5
 - 239000006185 dispersion Substances 0.000 description 5
 - 239000000463 material Substances 0.000 description 5
 - 239000000843 powder Substances 0.000 description 5
 - 239000007787 solid Substances 0.000 description 5
 - 239000002904 solvent Substances 0.000 description 5
 - 210000002700 urine Anatomy 0.000 description 5
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
 - 239000000654 additive Substances 0.000 description 4
 - 235000013339 cereals Nutrition 0.000 description 4
 - 239000002270 dispersing agent Substances 0.000 description 4
 - 230000000694 effects Effects 0.000 description 4
 - 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
 - 231100000208 phytotoxic Toxicity 0.000 description 4
 - ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
 - 241001260012 Bursa Species 0.000 description 3
 - 240000006122 Chenopodium album Species 0.000 description 3
 - 235000009344 Chenopodium album Nutrition 0.000 description 3
 - 241000251730 Chondrichthyes Species 0.000 description 3
 - 240000006240 Linum usitatissimum Species 0.000 description 3
 - 235000004431 Linum usitatissimum Nutrition 0.000 description 3
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
 - YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
 - ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
 - 240000008042 Zea mays Species 0.000 description 3
 - 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
 - 150000007513 acids Chemical class 0.000 description 3
 - 125000003545 alkoxy group Chemical group 0.000 description 3
 - 230000006378 damage Effects 0.000 description 3
 - 235000019441 ethanol Nutrition 0.000 description 3
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
 - 238000002474 experimental method Methods 0.000 description 3
 - XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 3
 - 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
 - 239000003960 organic solvent Substances 0.000 description 3
 - AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 3
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
 - 238000009331 sowing Methods 0.000 description 3
 - 239000007858 starting material Substances 0.000 description 3
 - 239000000725 suspension Substances 0.000 description 3
 - YBBLOADPFWKNGS-UHFFFAOYSA-N 1,1-dimethylurea Chemical compound CN(C)C(N)=O YBBLOADPFWKNGS-UHFFFAOYSA-N 0.000 description 2
 - 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
 - GDGIVSREGUOIJZ-UHFFFAOYSA-N 5-amino-3h-1,3,4-thiadiazole-2-thione Chemical compound NC1=NN=C(S)S1 GDGIVSREGUOIJZ-UHFFFAOYSA-N 0.000 description 2
 - PCLAZAJARAIGGD-UHFFFAOYSA-N 5-methylsulfanyl-1,3,4-thiadiazol-2-amine Chemical compound CSC1=NN=C(N)S1 PCLAZAJARAIGGD-UHFFFAOYSA-N 0.000 description 2
 - ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
 - 241000220244 Capsella <angiosperm> Species 0.000 description 2
 - ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
 - BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
 - 241001101998 Galium Species 0.000 description 2
 - 241000209082 Lolium Species 0.000 description 2
 - BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 2
 - 240000004370 Pastinaca sativa Species 0.000 description 2
 - QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
 - ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
 - 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
 - 239000000853 adhesive Substances 0.000 description 2
 - 230000001070 adhesive effect Effects 0.000 description 2
 - 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
 - 150000001408 amides Chemical class 0.000 description 2
 - 239000002585 base Substances 0.000 description 2
 - 238000009835 boiling Methods 0.000 description 2
 - 239000003085 diluting agent Substances 0.000 description 2
 - NVVZQXQBYZPMLJ-UHFFFAOYSA-N formaldehyde;naphthalene-1-sulfonic acid Chemical compound O=C.C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 NVVZQXQBYZPMLJ-UHFFFAOYSA-N 0.000 description 2
 - 239000011630 iodine Substances 0.000 description 2
 - HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
 - 239000007788 liquid Substances 0.000 description 2
 - 235000009973 maize Nutrition 0.000 description 2
 - 238000004519 manufacturing process Methods 0.000 description 2
 - 238000002156 mixing Methods 0.000 description 2
 - 125000002950 monocyclic group Chemical group 0.000 description 2
 - 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
 - IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
 - 229920001223 polyethylene glycol Polymers 0.000 description 2
 - VPJDULFXCAQHRC-UHFFFAOYSA-N prop-2-enylurea Chemical compound NC(=O)NCC=C VPJDULFXCAQHRC-UHFFFAOYSA-N 0.000 description 2
 - 150000003254 radicals Chemical class 0.000 description 2
 - 239000000376 reactant Substances 0.000 description 2
 - 150000003335 secondary amines Chemical class 0.000 description 2
 - 159000000000 sodium salts Chemical class 0.000 description 2
 - 238000001228 spectrum Methods 0.000 description 2
 - 230000000087 stabilizing effect Effects 0.000 description 2
 - 238000010998 test method Methods 0.000 description 2
 - SMYMJHWAQXWPDB-UHFFFAOYSA-N (2,4,5-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-N 0.000 description 1
 - MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
 - ZWAVGZYKJNOTPX-UHFFFAOYSA-N 1,3-diethylurea Chemical compound CCNC(=O)NCC ZWAVGZYKJNOTPX-UHFFFAOYSA-N 0.000 description 1
 - ZWOULFZCQXICLZ-UHFFFAOYSA-N 1,3-dimethyl-1-phenylurea Chemical compound CNC(=O)N(C)C1=CC=CC=C1 ZWOULFZCQXICLZ-UHFFFAOYSA-N 0.000 description 1
 - KFAKZJUYBOYVKA-UHFFFAOYSA-N 1,4-dichloro-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1Cl KFAKZJUYBOYVKA-UHFFFAOYSA-N 0.000 description 1
 - FXFCLNJIQWLFEL-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)-1,3-dimethylurea Chemical compound CNC(=O)N(C)C1=CC=C(Cl)C(Cl)=C1 FXFCLNJIQWLFEL-UHFFFAOYSA-N 0.000 description 1
 - LGXNQMGCMMSGAI-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)-3-methoxy-1-methylurea Chemical compound CONC(=O)N(C)C1=CC=C(Cl)C(Cl)=C1 LGXNQMGCMMSGAI-UHFFFAOYSA-N 0.000 description 1
 - LPUCHTNHUHOTRY-UHFFFAOYSA-N 1-(3-bicyclo[2.2.1]heptanyl)ethanamine Chemical compound C1CC2C(C(N)C)CC1C2 LPUCHTNHUHOTRY-UHFFFAOYSA-N 0.000 description 1
 - ZRRCPKLWTBJUHI-UHFFFAOYSA-N 1-[(2,3,6-trichlorophenyl)methoxy]propan-1-ol Chemical compound CCC(O)OCC1=C(Cl)C=CC(Cl)=C1Cl ZRRCPKLWTBJUHI-UHFFFAOYSA-N 0.000 description 1
 - SXMYFCMKPGFIHC-UHFFFAOYSA-N 1-chloroethylurea Chemical compound CC(Cl)NC(N)=O SXMYFCMKPGFIHC-UHFFFAOYSA-N 0.000 description 1
 - 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
 - NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
 - UYGUFXUBSNDUFA-UHFFFAOYSA-N 2,3,5,6-tetrachlorobenzoic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl UYGUFXUBSNDUFA-UHFFFAOYSA-N 0.000 description 1
 - XZIDTOHMJBOSOX-UHFFFAOYSA-N 2,3,6-TBA Chemical compound OC(=O)C1=C(Cl)C=CC(Cl)=C1Cl XZIDTOHMJBOSOX-UHFFFAOYSA-N 0.000 description 1
 - 239000003559 2,4,5-trichlorophenoxyacetic acid Substances 0.000 description 1
 - YIVXMZJTEQBPQO-UHFFFAOYSA-N 2,4-DB Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1Cl YIVXMZJTEQBPQO-UHFFFAOYSA-N 0.000 description 1
 - 239000002794 2,4-DB Substances 0.000 description 1
 - 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
 - HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
 - AUAXYMOBWXOEQD-UHFFFAOYSA-N 2,5-dichloro-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC([N+]([O-])=O)=C1Cl AUAXYMOBWXOEQD-UHFFFAOYSA-N 0.000 description 1
 - YOYAIZYFCNQIRF-UHFFFAOYSA-N 2,6-dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N YOYAIZYFCNQIRF-UHFFFAOYSA-N 0.000 description 1
 - KGKGSIUWJCAFPX-UHFFFAOYSA-N 2,6-dichlorothiobenzamide Chemical compound NC(=S)C1=C(Cl)C=CC=C1Cl KGKGSIUWJCAFPX-UHFFFAOYSA-N 0.000 description 1
 - GQOHYQAHKDLXCV-UHFFFAOYSA-N 2-(2,3,6-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=C(Cl)C=CC(Cl)=C1Cl GQOHYQAHKDLXCV-UHFFFAOYSA-N 0.000 description 1
 - LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
 - DUMPKRLSSRTFMY-UHFFFAOYSA-N 2-butan-2-yl-3,4-dinitrophenol Chemical compound CCC(C)C1=C(O)C=CC([N+]([O-])=O)=C1[N+]([O-])=O DUMPKRLSSRTFMY-UHFFFAOYSA-N 0.000 description 1
 - LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
 - WBEKRMVYCWRRDJ-UHFFFAOYSA-N 2-n-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound CC(C)NC1=NC=NC(N)=N1 WBEKRMVYCWRRDJ-UHFFFAOYSA-N 0.000 description 1
 - 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
 - 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
 - 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
 - XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
 - RHPUJHQBPORFGV-UHFFFAOYSA-N 4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=CC=C1O RHPUJHQBPORFGV-UHFFFAOYSA-N 0.000 description 1
 - XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
 - TYMRJKKKYZIDFH-UHFFFAOYSA-N 6-chloro-2-n,4-n-bis(3-methoxypropyl)-1,3,5-triazine-2,4-diamine Chemical compound COCCCNC1=NC(Cl)=NC(NCCCOC)=N1 TYMRJKKKYZIDFH-UHFFFAOYSA-N 0.000 description 1
 - 241001621841 Alopecurus myosuroides Species 0.000 description 1
 - 240000001592 Amaranthus caudatus Species 0.000 description 1
 - 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
 - 235000006463 Brassica alba Nutrition 0.000 description 1
 - 244000140786 Brassica hirta Species 0.000 description 1
 - OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
 - 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
 - 241000871189 Chenopodiaceae Species 0.000 description 1
 - 241000219312 Chenopodium Species 0.000 description 1
 - 229920000742 Cotton Polymers 0.000 description 1
 - 239000005510 Diuron Substances 0.000 description 1
 - KMHZPJNVPCAUMN-UHFFFAOYSA-N Erbon Chemical compound CC(Cl)(Cl)C(=O)OCCOC1=CC(Cl)=C(Cl)C=C1Cl KMHZPJNVPCAUMN-UHFFFAOYSA-N 0.000 description 1
 - IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
 - ZLSWBLPERHFHIS-UHFFFAOYSA-N Fenoprop Chemical compound OC(=O)C(C)OC1=CC(Cl)=C(Cl)C=C1Cl ZLSWBLPERHFHIS-UHFFFAOYSA-N 0.000 description 1
 - PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
 - 241000209510 Liliopsida Species 0.000 description 1
 - 244000042664 Matricaria chamomilla Species 0.000 description 1
 - 244000182930 Matricaria sp Species 0.000 description 1
 - 235000008885 Matricaria sp Nutrition 0.000 description 1
 - LKJPSUCKSLORMF-UHFFFAOYSA-N Monolinuron Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C=C1 LKJPSUCKSLORMF-UHFFFAOYSA-N 0.000 description 1
 - CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
 - 241001478756 Panicum sp. Species 0.000 description 1
 - 241000205407 Polygonum Species 0.000 description 1
 - KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
 - 244000062793 Sorghum vulgare Species 0.000 description 1
 - 101150052863 THY1 gene Proteins 0.000 description 1
 - WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
 - 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
 - 239000000443 aerosol Substances 0.000 description 1
 - 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
 - 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
 - 239000003513 alkali Substances 0.000 description 1
 - 150000001342 alkaline earth metals Chemical class 0.000 description 1
 - 125000003342 alkenyl group Chemical group 0.000 description 1
 - 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
 - 125000000217 alkyl group Chemical group 0.000 description 1
 - DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
 - SXQXMCWCWVCFPC-UHFFFAOYSA-N aluminum;potassium;dioxido(oxo)silane Chemical compound [Al+3].[K+].[O-][Si]([O-])=O.[O-][Si]([O-])=O SXQXMCWCWVCFPC-UHFFFAOYSA-N 0.000 description 1
 - 125000003277 amino group Chemical group 0.000 description 1
 - 230000000844 anti-bacterial effect Effects 0.000 description 1
 - 239000002518 antifoaming agent Substances 0.000 description 1
 - 239000003429 antifungal agent Substances 0.000 description 1
 - 239000007900 aqueous suspension Substances 0.000 description 1
 - 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
 - 125000004429 atom Chemical group 0.000 description 1
 - 239000003899 bactericide agent Substances 0.000 description 1
 - 239000000022 bacteriostatic agent Substances 0.000 description 1
 - 150000001559 benzoic acids Chemical class 0.000 description 1
 - 229910052796 boron Inorganic materials 0.000 description 1
 - CNWSQCLBDWYLAN-UHFFFAOYSA-N butylurea Chemical compound CCCCNC(N)=O CNWSQCLBDWYLAN-UHFFFAOYSA-N 0.000 description 1
 - 229910052799 carbon Inorganic materials 0.000 description 1
 - 239000001768 carboxy methyl cellulose Substances 0.000 description 1
 - 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
 - 150000001735 carboxylic acids Chemical class 0.000 description 1
 - 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
 - 239000012876 carrier material Substances 0.000 description 1
 - 235000019993 champagne Nutrition 0.000 description 1
 - 239000011248 coating agent Substances 0.000 description 1
 - 238000000576 coating method Methods 0.000 description 1
 - 238000001816 cooling Methods 0.000 description 1
 - 235000005822 corn Nutrition 0.000 description 1
 - 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
 - 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
 - ARUKYTASOALXFG-UHFFFAOYSA-N cycloheptylcycloheptane Chemical group C1CCCCCC1C1CCCCCC1 ARUKYTASOALXFG-UHFFFAOYSA-N 0.000 description 1
 - 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
 - WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical group C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 description 1
 - WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 1
 - 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
 - NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical group C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 1
 - 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
 - 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
 - 238000000354 decomposition reaction Methods 0.000 description 1
 - 150000008050 dialkyl sulfates Chemical class 0.000 description 1
 - 150000004891 diazines Chemical class 0.000 description 1
 - IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
 - HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
 - 238000007865 diluting Methods 0.000 description 1
 - 150000002170 ethers Chemical class 0.000 description 1
 - 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
 - 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
 - 241001233957 eudicotyledons Species 0.000 description 1
 - 238000001704 evaporation Methods 0.000 description 1
 - 239000004744 fabric Substances 0.000 description 1
 - XXOYNJXVWVNOOJ-UHFFFAOYSA-N fenuron Chemical compound CN(C)C(=O)NC1=CC=CC=C1 XXOYNJXVWVNOOJ-UHFFFAOYSA-N 0.000 description 1
 - 239000003337 fertilizer Substances 0.000 description 1
 - 239000000706 filtrate Substances 0.000 description 1
 - 229910052731 fluorine Inorganic materials 0.000 description 1
 - 239000011737 fluorine Substances 0.000 description 1
 - WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
 - 239000000446 fuel Substances 0.000 description 1
 - 239000000417 fungicide Substances 0.000 description 1
 - 230000035784 germination Effects 0.000 description 1
 - 235000012432 gingerbread Nutrition 0.000 description 1
 - 238000000227 grinding Methods 0.000 description 1
 - 150000008282 halocarbons Chemical class 0.000 description 1
 - 150000003977 halocarboxylic acids Chemical class 0.000 description 1
 - 229910052736 halogen Inorganic materials 0.000 description 1
 - 150000002367 halogens Chemical group 0.000 description 1
 - 150000002391 heterocyclic compounds Chemical class 0.000 description 1
 - 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
 - BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
 - 150000004679 hydroxides Chemical class 0.000 description 1
 - 239000005457 ice water Substances 0.000 description 1
 - 238000005470 impregnation Methods 0.000 description 1
 - 239000004615 ingredient Substances 0.000 description 1
 - 239000002917 insecticide Substances 0.000 description 1
 - HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
 - INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
 - 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
 - 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
 - 150000002576 ketones Chemical class 0.000 description 1
 - 235000021374 legumes Nutrition 0.000 description 1
 - 230000007774 longterm Effects 0.000 description 1
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
 - HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
 - 230000003641 microbiacidal effect Effects 0.000 description 1
 - 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - 230000001069 nematicidal effect Effects 0.000 description 1
 - 239000005645 nematicide Substances 0.000 description 1
 - 230000007935 neutral effect Effects 0.000 description 1
 - 150000002825 nitriles Chemical class 0.000 description 1
 - 230000009965 odorless effect Effects 0.000 description 1
 - 239000003921 oil Substances 0.000 description 1
 - 239000003791 organic solvent mixture Substances 0.000 description 1
 - 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
 - 239000002245 particle Substances 0.000 description 1
 - 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
 - 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
 - WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
 - PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
 - 125000003367 polycyclic group Chemical group 0.000 description 1
 - 229920001296 polysiloxane Polymers 0.000 description 1
 - 229910052700 potassium Inorganic materials 0.000 description 1
 - 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
 - 239000000047 product Substances 0.000 description 1
 - 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
 - 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
 - 239000013558 reference substance Substances 0.000 description 1
 - 238000010992 reflux Methods 0.000 description 1
 - 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
 - 230000009528 severe injury Effects 0.000 description 1
 - KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
 - 238000003756 stirring Methods 0.000 description 1
 - 238000006467 substitution reaction Methods 0.000 description 1
 - 208000024891 symptom Diseases 0.000 description 1
 - 239000000454 talc Substances 0.000 description 1
 - 229910052623 talc Inorganic materials 0.000 description 1
 - 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
 - 150000003512 tertiary amines Chemical class 0.000 description 1
 - VHXDHGALQPVNKI-UHFFFAOYSA-N thiadiazol-4-ylurea Chemical compound NC(=O)NC1=CSN=N1 VHXDHGALQPVNKI-UHFFFAOYSA-N 0.000 description 1
 - 150000003583 thiosemicarbazides Chemical class 0.000 description 1
 - 239000011573 trace mineral Substances 0.000 description 1
 - 235000013619 trace mineral Nutrition 0.000 description 1
 - 125000005270 trialkylamine group Chemical group 0.000 description 1
 - 150000003918 triazines Chemical class 0.000 description 1
 - 150000003852 triazoles Chemical class 0.000 description 1
 - 229940035893 uracil Drugs 0.000 description 1
 - JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
 - 235000013311 vegetables Nutrition 0.000 description 1
 - 239000000080 wetting agent Substances 0.000 description 1
 - 238000010626 work up procedure Methods 0.000 description 1
 - 239000008096 xylene Substances 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
 - C07D285/01—Five-membered rings
 - C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
 - C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
 - C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
 - C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
 - C07D285/135—Nitrogen atoms
 
 - 
        
- A—HUMAN NECESSITIES
 - A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
 - A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
 - A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
 - A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
 - A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
 - A01N47/36—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< directly attached to at least one heterocyclic ring; Thio analogues thereof
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
 - C07D285/01—Five-membered rings
 - C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
 - C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
 - C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Life Sciences & Earth Sciences (AREA)
 - Agronomy & Crop Science (AREA)
 - Pest Control & Pesticides (AREA)
 - Plant Pathology (AREA)
 - Health & Medical Sciences (AREA)
 - Engineering & Computer Science (AREA)
 - Dentistry (AREA)
 - General Health & Medical Sciences (AREA)
 - Wood Science & Technology (AREA)
 - Zoology (AREA)
 - Environmental Sciences (AREA)
 - Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
 - Agricultural Chemicals And Associated Chemicals (AREA)
 - Plural Heterocyclic Compounds (AREA)
 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| CH1069168A CH498859A (de) | 1968-07-17 | 1968-07-17 | Verfahren zur Herstellung von Thiadiazolyl-harnstoffen | 
Publications (1)
| Publication Number | Publication Date | 
|---|---|
| DE1936241A1 true DE1936241A1 (de) | 1970-02-12 | 
Family
ID=4365813
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| DE19691936241 Pending DE1936241A1 (de) | 1968-07-17 | 1969-07-16 | Thiadiazolyl-harnstoffe | 
Country Status (15)
| Country | Link | 
|---|---|
| JP (1) | JPS5440610B1 (enEXAMPLES) | 
| AT (1) | AT291668B (enEXAMPLES) | 
| BE (1) | BE736171A (enEXAMPLES) | 
| BG (1) | BG16312A3 (enEXAMPLES) | 
| CH (2) | CH498859A (enEXAMPLES) | 
| CS (1) | CS157651B2 (enEXAMPLES) | 
| DE (1) | DE1936241A1 (enEXAMPLES) | 
| DK (1) | DK139357B (enEXAMPLES) | 
| ES (4) | ES369572A1 (enEXAMPLES) | 
| FR (1) | FR2013116A1 (enEXAMPLES) | 
| GB (1) | GB1282308A (enEXAMPLES) | 
| IL (1) | IL32632A (enEXAMPLES) | 
| NL (1) | NL6910940A (enEXAMPLES) | 
| PL (1) | PL80180B1 (enEXAMPLES) | 
| RO (1) | RO61084A (enEXAMPLES) | 
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| DE2044442A1 (en) * | 1970-09-03 | 1972-03-09 | Schering Ag | 5-alkylsulphinyl or sulphonyl - 1,3,4-thiadiazolyl-ureas - as herbicides | 
| DE2059328A1 (de) * | 1970-11-24 | 1972-06-08 | Schering Ag | Thiadiazolylharnstoffe mit herbizider Wirkung | 
| DE19542721A1 (de) * | 1995-11-16 | 1997-05-22 | Sgl Technik Gmbh | Verfahren zur Herstellen von Formkörpern aus Kunststoff-Füllstoff-Mischungen mit einem hohen Gehalt an Füllstoffen | 
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| CH498859A (de) * | 1968-07-17 | 1970-11-15 | Agripat Sa | Verfahren zur Herstellung von Thiadiazolyl-harnstoffen | 
| DE2719810A1 (de) | 1977-04-28 | 1978-11-02 | Schering Ag | 1,2,3-thiadiazolin-2-id-derivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit wachstumsregulatorischer wirkung fuer pflanzen | 
| DE3151017A1 (de) * | 1981-12-23 | 1983-06-30 | W. Antpöhler GmbH & Co KG, 4795 Delbrück | Maschine zum schneiden von teigstraengen in scheiben und verfahren zur gebaeckherstellung unter verwendung der maschine | 
| WO2004002481A1 (en) * | 2002-06-27 | 2004-01-08 | Novo Nordisk A/S | Aryl carbonyl derivatives as therapeutic agents | 
| PT1723128E (pt) | 2004-01-06 | 2013-02-27 | Novo Nordisk As | Heteroaril-ureias e o seu uso como activadores da glicoquinase | 
| WO2007006760A1 (en) | 2005-07-08 | 2007-01-18 | Novo Nordisk A/S | Dicycloalkyl urea glucokinase activators | 
| WO2007006761A1 (en) | 2005-07-08 | 2007-01-18 | Novo Nordisk A/S | Dicycloalkylcarbamoyl ureas as glucokinase activators | 
| WO2007006814A1 (en) * | 2005-07-14 | 2007-01-18 | Novo Nordisk A/S | Urea glucokinase activators | 
| EP2118083A1 (en) | 2007-01-09 | 2009-11-18 | Novo Nordisk A/S | Urea glucokinase activators | 
| EP2099777B1 (en) | 2007-01-11 | 2015-08-12 | Novo Nordisk A/S | Urea glucokinase activators | 
| WO2019241089A1 (en) | 2018-06-12 | 2019-12-19 | Vtv Therapeutics Llc | Therapeutic uses of glucokinase activators in combination with insulin or insulin analogs | 
| WO2021167840A1 (en) | 2020-02-18 | 2021-08-26 | Vtv Therapeutics Llc | Sulfoxide and sulfone glucokinase activators and methods of use thereof | 
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| DE1670925B2 (de) * | 1967-09-19 | 1977-03-10 | Bayer Ag, 5090 Leverkusen | 1,3,4-thiadiazolylharnstoffe | 
| GB1195672A (en) * | 1968-02-01 | 1970-06-17 | Mobil Oil Corp | Novel Urea Derivatives and Herbicides containing the same | 
| CH498859A (de) * | 1968-07-17 | 1970-11-15 | Agripat Sa | Verfahren zur Herstellung von Thiadiazolyl-harnstoffen | 
| CH521711A (de) * | 1968-12-23 | 1972-04-30 | Bayer Ag | Herbizides Mittel | 
| GB1290223A (enEXAMPLES) * | 1969-04-21 | 1972-09-20 | 
- 
        1968
        
- 1968-07-17 CH CH1069168A patent/CH498859A/de not_active IP Right Cessation
 - 1968-07-17 CH CH1288770A patent/CH502762A/de not_active IP Right Cessation
 
 - 
        1969
        
- 1969-07-14 DK DK380269AA patent/DK139357B/da unknown
 - 1969-07-16 IL IL32632A patent/IL32632A/en unknown
 - 1969-07-16 ES ES369572A patent/ES369572A1/es not_active Expired
 - 1969-07-16 FR FR6924179A patent/FR2013116A1/fr not_active Withdrawn
 - 1969-07-16 AT AT683269A patent/AT291668B/de not_active IP Right Cessation
 - 1969-07-16 DE DE19691936241 patent/DE1936241A1/de active Pending
 - 1969-07-16 ES ES369570A patent/ES369570A1/es not_active Expired
 - 1969-07-16 BG BG012671A patent/BG16312A3/bg unknown
 - 1969-07-16 GB GB35803/69A patent/GB1282308A/en not_active Expired
 - 1969-07-16 ES ES369569A patent/ES369569A1/es not_active Expired
 - 1969-07-16 NL NL6910940A patent/NL6910940A/xx not_active Application Discontinuation
 - 1969-07-16 BE BE736171A patent/BE736171A/xx unknown
 - 1969-07-16 JP JP5603969A patent/JPS5440610B1/ja active Pending
 - 1969-07-16 PL PL1969134858A patent/PL80180B1/pl unknown
 - 1969-07-16 RO RO60545A patent/RO61084A/ro unknown
 - 1969-07-16 ES ES369571A patent/ES369571A1/es not_active Expired
 - 1969-07-16 CS CS502869A patent/CS157651B2/cs unknown
 
 
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| DE2044442A1 (en) * | 1970-09-03 | 1972-03-09 | Schering Ag | 5-alkylsulphinyl or sulphonyl - 1,3,4-thiadiazolyl-ureas - as herbicides | 
| DE2059328A1 (de) * | 1970-11-24 | 1972-06-08 | Schering Ag | Thiadiazolylharnstoffe mit herbizider Wirkung | 
| DE19542721A1 (de) * | 1995-11-16 | 1997-05-22 | Sgl Technik Gmbh | Verfahren zur Herstellen von Formkörpern aus Kunststoff-Füllstoff-Mischungen mit einem hohen Gehalt an Füllstoffen | 
| US5804116A (en) * | 1995-11-16 | 1998-09-08 | Sgl Technik Gmbh | Method for the manufacture of shaped bodies formed from plastics-filler mixtures having a high filler content | 
Also Published As
| Publication number | Publication date | 
|---|---|
| BG16312A3 (bg) | 1972-08-20 | 
| CH498859A (de) | 1970-11-15 | 
| NL6910940A (enEXAMPLES) | 1970-01-20 | 
| DK139357B (da) | 1979-02-05 | 
| ES369570A1 (es) | 1971-06-01 | 
| GB1282308A (en) | 1972-07-19 | 
| ES369571A1 (es) | 1971-06-01 | 
| DK139357C (enEXAMPLES) | 1979-07-16 | 
| JPS5440610B1 (enEXAMPLES) | 1979-12-04 | 
| BE736171A (enEXAMPLES) | 1970-01-16 | 
| FR2013116A1 (enEXAMPLES) | 1970-03-27 | 
| ES369569A1 (es) | 1971-06-01 | 
| IL32632A (en) | 1973-03-30 | 
| ES369572A1 (es) | 1971-06-01 | 
| PL80180B1 (enEXAMPLES) | 1975-08-30 | 
| AT291668B (de) | 1971-07-26 | 
| IL32632A0 (en) | 1969-09-25 | 
| RO61084A (enEXAMPLES) | 1976-10-15 | 
| CS157651B2 (enEXAMPLES) | 1974-09-16 | 
| CH502762A (de) | 1971-02-15 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| DE1670912C3 (de) | Herbizide Mittel auf Basis von 1,2,4-Triazin-5-onen | |
| DE1936241A1 (de) | Thiadiazolyl-harnstoffe | |
| DE2207549B2 (de) | 1-Aminouracile und deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE1816696C2 (de) | N-[5-Trifluormethyl-1,3,4-thiadiazolyl- (2)]-harnstoff-derivate | |
| DE2141468A1 (de) | 1-(2-benzothiazolyl)-1,3-dialkyl-harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE2945530A1 (de) | Harnstoffe mit cyclischen substituenten, ihre herstellung und verwendung als herbizide | |
| DE1670924B2 (de) | 1,2,4-thiadiazolyl-harnstoffderivate | |
| DE1922837A1 (de) | Neue Pyrido[1,2-a]-s-triazin-dione | |
| DE1668170C (enEXAMPLES) | ||
| DE1914012C3 (de) | 2-Amino-4-azido-6-cyclopropylamino-s-triazin-Derivate | |
| DE1567044A1 (de) | Pestizides,insbesondere herbizides Mittel | |
| DE2053333A1 (de) | Herbizide Mittel | |
| DE2512171A1 (de) | 2,3-dihalogen-alkanoyl-harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE1668170B2 (de) | N-octahydro-1,2,4-methenopentalenyl(5)-harnstoffe, verfahren zu deren herstellung und deren verwendung als herbizide | |
| DE2238042A1 (de) | Heterocyclische verbindungen und deren verwendung | |
| DE2434922A1 (de) | Isothiazolylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE1932827C3 (de) | Cycloaliphatische Imidazolidin-2-on-1-carbonsäure-amide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2044735A1 (de) | Schädlingsbekämpfungsmittel | |
| CH513585A (de) | Herbizides Mittel | |
| DE2119749A1 (de) | Neue herbizid wirksame 5 Sulfamoyl 1,3,4 thiadiazolyl (2) harnstoffe | |
| DE2230076A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Stoffe | |
| DE1542779A1 (de) | Herbizide Mittel | |
| DE1964147A1 (de) | Neue Bicyclo[n.1.0]alkyl-Harnstoffe | |
| DD139990A5 (de) | Herbizides mittel | |
| DE2556938C2 (de) | N,N-disubstituierte Alaninderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als herbicide Mittel | 
Legal Events
| Date | Code | Title | Description | 
|---|---|---|---|
| OHW | Rejection |