DE1932257B2 - Zeithaltendes element - Google Patents
Zeithaltendes elementInfo
- Publication number
- DE1932257B2 DE1932257B2 DE19691932257 DE1932257A DE1932257B2 DE 1932257 B2 DE1932257 B2 DE 1932257B2 DE 19691932257 DE19691932257 DE 19691932257 DE 1932257 A DE1932257 A DE 1932257A DE 1932257 B2 DE1932257 B2 DE 1932257B2
- Authority
- DE
- Germany
- Prior art keywords
- time
- element according
- keeping element
- balance
- magnetic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005291 magnetic effect Effects 0.000 claims description 36
- 230000035699 permeability Effects 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 7
- 229910000906 Bronze Inorganic materials 0.000 claims description 5
- 239000010974 bronze Substances 0.000 claims description 5
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 claims description 5
- 229910001369 Brass Inorganic materials 0.000 claims description 3
- 239000010951 brass Substances 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- MOFOBJHOKRNACT-UHFFFAOYSA-N nickel silver Chemical compound [Ni].[Ag] MOFOBJHOKRNACT-UHFFFAOYSA-N 0.000 claims description 3
- 239000010956 nickel silver Substances 0.000 claims description 3
- 230000005298 paramagnetic effect Effects 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 229910000952 Be alloy Inorganic materials 0.000 claims 2
- 229910018651 Mn—Ni Inorganic materials 0.000 claims 1
- 229910000792 Monel Inorganic materials 0.000 claims 1
- 230000005290 antiferromagnetic effect Effects 0.000 claims 1
- 230000000694 effects Effects 0.000 description 11
- 239000000696 magnetic material Substances 0.000 description 7
- 229910000831 Steel Inorganic materials 0.000 description 5
- 239000010959 steel Substances 0.000 description 5
- 238000010276 construction Methods 0.000 description 4
- 238000005299 abrasion Methods 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- BGPVFRJUHWVFKM-UHFFFAOYSA-N N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] Chemical compound N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] BGPVFRJUHWVFKM-UHFFFAOYSA-N 0.000 description 1
- 229910001075 Nivarox Inorganic materials 0.000 description 1
- 208000001431 Psychomotor Agitation Diseases 0.000 description 1
- 206010038743 Restlessness Diseases 0.000 description 1
- 239000002885 antiferromagnetic material Substances 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000005021 gait Effects 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 230000002650 habitual effect Effects 0.000 description 1
- 230000005399 magnetomechanical effect Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000002907 paramagnetic material Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G04—HOROLOGY
- G04B—MECHANICALLY-DRIVEN CLOCKS OR WATCHES; MECHANICAL PARTS OF CLOCKS OR WATCHES IN GENERAL; TIME PIECES USING THE POSITION OF THE SUN, MOON OR STARS
- G04B43/00—Protecting clockworks by shields or other means against external influences, e.g. magnetic fields
- G04B43/007—Antimagnetic alloys
Landscapes
- Engineering & Computer Science (AREA)
- Metallurgy (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Electromechanical Clocks (AREA)
- Purses, Travelling Bags, Baskets, Or Suitcases (AREA)
- Hard Magnetic Materials (AREA)
- Soft Magnetic Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1246668A CH535989A (de) | 1968-08-19 | 1968-08-19 | Zeithaltendes Element |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1932257A1 DE1932257A1 (de) | 1970-03-19 |
| DE1932257B2 true DE1932257B2 (de) | 1971-04-29 |
Family
ID=4383293
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691932257 Pending DE1932257B2 (de) | 1968-08-19 | 1969-06-25 | Zeithaltendes element |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3683616A (enExample) |
| CH (2) | CH535989A (enExample) |
| DE (1) | DE1932257B2 (enExample) |
| FR (1) | FR2015873A1 (enExample) |
| GB (1) | GB1222460A (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1237058A1 (fr) * | 2001-02-28 | 2002-09-04 | Eta SA Fabriques d'Ebauches | Utilisation d'un revêtement amagnétique pour recouvrir des pièces dans un mouvement d'horlogerie |
| FR2842313B1 (fr) * | 2002-07-12 | 2004-10-22 | Gideon Levingston | Oscilliateur mecanique (systeme balancier et ressort spiral) en materiaux permettant d'atteindre un niveau superieur de precision, applique a un mouvement d'horlogerie ou autre instrument de precision |
| GB0324439D0 (en) * | 2003-10-20 | 2003-11-19 | Levingston Gideon R | Minimal thermal variation and temperature compensating non-magnetic balance wheels and methods of production of these and their associated balance springs |
| US8333501B2 (en) * | 2005-05-14 | 2012-12-18 | Carbontime Limited | Balance spring, regulated balance wheel assembly and methods of manufacture thereof |
| WO2008029158A2 (en) * | 2006-09-08 | 2008-03-13 | Gideon Levingston | Thermally compensating balance wheel |
| EP2400352A1 (fr) * | 2010-06-22 | 2011-12-28 | The Swatch Group Research and Development Ltd. | Système d'échappement pour pièce d'horlogerie |
| WO2013064390A1 (fr) * | 2011-10-24 | 2013-05-10 | Rolex S.A. | Oscillateur de mouvement horloger |
| EP2605081A1 (fr) * | 2011-12-16 | 2013-06-19 | ETA SA Manufacture Horlogère Suisse | Balancier d'horlogerie surmoulé |
| EP2607969B1 (fr) * | 2011-12-19 | 2014-09-17 | Nivarox-FAR S.A. | Mouvement horloger à faible sensibilité magnétique |
| EP2680090A1 (fr) * | 2012-06-28 | 2014-01-01 | Nivarox-FAR S.A. | Ressort-moteur pour une pièce d'horlogerie |
| EP2757423B1 (fr) * | 2013-01-17 | 2018-07-11 | Omega SA | Pièce pour mouvement d'horlogerie |
| EP2784601B1 (fr) * | 2013-03-26 | 2017-09-13 | Montres Breguet SA | Arbre de mobile pivotant d'horlogerie |
| EP2813906A1 (fr) * | 2013-06-12 | 2014-12-17 | Nivarox-FAR S.A. | Pièce pour mouvement d'horlogerie |
| EP3208664B1 (de) | 2016-02-19 | 2023-08-16 | Omega SA | Uhrwerk oder uhr ohne magnetische signatur |
| EP3273304B1 (fr) | 2016-07-19 | 2021-11-10 | Nivarox-FAR S.A. | Pièce pour mouvement d'horlogerie |
| EP3273307B1 (fr) * | 2016-07-19 | 2025-04-30 | Nivarox-FAR S.A. | Pièce pour mouvement d'horlogerie |
| EP3273305B1 (fr) | 2016-07-19 | 2023-07-19 | Nivarox-FAR S.A. | Pièce pour mouvement d'horlogerie |
| EP3273306B1 (fr) * | 2016-07-19 | 2025-08-27 | Nivarox-FAR S.A. | Pièce pour mouvement d'horlogerie |
| EP3273303B1 (fr) * | 2016-07-19 | 2025-10-01 | Nivarox-FAR S.A. | Pièce pour mouvement d'horlogerie |
| EP3885842B1 (fr) * | 2020-03-26 | 2024-03-20 | Nivarox-FAR S.A. | Composant horloger amagnétique avec résistance à l'usure améliorée |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US385951A (en) * | 1888-07-10 | Alloy | ||
| US385946A (en) * | 1888-07-10 | eldeedge | ||
| US385954A (en) * | 1888-07-10 | eldredge | ||
| US385952A (en) * | 1888-07-10 | Alloy | ||
| US385950A (en) * | 1888-07-10 | Alloy | ||
| US385949A (en) * | 1888-07-10 | Alloy | ||
| US385948A (en) * | 1888-07-10 | Alloy | ||
| US385955A (en) * | 1888-07-10 | Alloy | ||
| US385953A (en) * | 1888-07-10 | Alloy | ||
| US385945A (en) * | 1888-07-10 | Alloy | ||
| US385947A (en) * | 1888-07-10 | Alloy | ||
| CH159981A (de) * | 1931-11-18 | 1933-02-15 | Thommen S Uhrenfabriken A G | Verfahren zur Herstellung der Hemmung von Uhrwerken. |
-
1968
- 1968-08-19 CH CH1246668A patent/CH535989A/de unknown
- 1968-08-19 CH CH1246668D patent/CH1246668A4/xx unknown
-
1969
- 1969-06-25 DE DE19691932257 patent/DE1932257B2/de active Pending
- 1969-07-04 FR FR6922750A patent/FR2015873A1/fr not_active Withdrawn
- 1969-07-15 GB GB35531/69A patent/GB1222460A/en not_active Expired
- 1969-07-29 US US860132*A patent/US3683616A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1222460A (en) | 1971-02-17 |
| DE1932257A1 (de) | 1970-03-19 |
| CH1246668A4 (enExample) | 1972-11-30 |
| FR2015873A1 (enExample) | 1970-04-30 |
| US3683616A (en) | 1972-08-15 |
| CH535989A (de) | 1972-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1932257B2 (de) | Zeithaltendes element | |
| EP3417347B1 (de) | Ritzelwelle, uhrwerk, uhr oder messgerät ohne magnetische signatur | |
| RU2647756C2 (ru) | Компонент часового механизма | |
| CH551032A (en) | Paramagnetic metal/semiconductor alloys - for oscillating and spring elements with particular elastic properties | |
| DE2640340A1 (de) | Magnetisches daempfungssystem fuer induktions-wattstundenzaehler | |
| DE1960701A1 (de) | Reguliervorrichtung fuer Uhren | |
| DE1146454B (de) | Uhr mit nur plattenfoermigen Teil-Abschirmungen aus hochpermeablem Werkstoff gegen Magnetfelder | |
| CH348367A (de) | Antimagnetische Uhr | |
| US2299519A (en) | Clock | |
| DE747311C (de) | Lageranordnung fuer den drehbeweglichen Teil von Messgeraeten | |
| CH339142A (de) | Magnetische Hemmung | |
| DE896480C (de) | Magnetische Hemmung fuer Uhrwerke | |
| DE212023000351U1 (de) | Unruh für ein Uhrwerk | |
| DE1915711C (de) | Spiralfeder fur die Unruh einer Armbanduhr | |
| DE2003045C3 (de) | Elektronische Kleinuhr | |
| DE1253172B (de) | Magnetische Hemmung fuer stationaere Uhrwerke | |
| DE1942311A1 (de) | Elektrischer Zeitmesser,insbesondere Kleinuhr | |
| DE1087981B (de) | Magnetische Einrichtung zum Begrenzen des Ankerausschlages in Uhren | |
| DE713421C (de) | Spitzenzaehler mit Hysteresishemmoment | |
| DE1099948B (de) | Batteriegespeiste elektrische Uhr | |
| DE1926621A1 (de) | Uhr,insbesondere Armbanduhr | |
| AT227184B (de) | Stadion-Uhr | |
| CH520354A (de) | Rücker für Uhren | |
| DE1915711B2 (de) | Spiralfeder fuer die unruh einer armbanduhr | |
| DE1987070U (enExample) |