DE1901501C3 - m- Trifluormethylphenylharnstoffe und diese enthaltende herbizide Mittel - Google Patents
m- Trifluormethylphenylharnstoffe und diese enthaltende herbizide MittelInfo
- Publication number
- DE1901501C3 DE1901501C3 DE1901501A DE1901501A DE1901501C3 DE 1901501 C3 DE1901501 C3 DE 1901501C3 DE 1901501 A DE1901501 A DE 1901501A DE 1901501 A DE1901501 A DE 1901501A DE 1901501 C3 DE1901501 C3 DE 1901501C3
- Authority
- DE
- Germany
- Prior art keywords
- och
- trifluoromethylphenylureas
- post
- compound
- compositions containing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002363 herbicidal effect Effects 0.000 title description 6
- 239000000203 mixture Substances 0.000 title description 4
- 241000209140 Triticum Species 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 9
- 235000021307 Triticum Nutrition 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 229910052760 oxygen Inorganic materials 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 241000743985 Alopecurus Species 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 235000017896 Digitaria Nutrition 0.000 description 4
- 241001303487 Digitaria <clam> Species 0.000 description 4
- 241000219146 Gossypium Species 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 125000004430 oxygen atom Chemical group O* 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- -1 4-ethoxy-3-trifluoromethylphenyl Chemical group 0.000 description 3
- 241000209117 Panicum Species 0.000 description 3
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 3
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 3
- 240000006694 Stellaria media Species 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- AJBZENLMTKDAEK-UHFFFAOYSA-N 3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-4,9-diol Chemical compound CC12CCC(O)C(C)(C)C1CCC(C1(C)CC3O)(C)C2CCC1C1C3(C)CCC1C(=C)C AJBZENLMTKDAEK-UHFFFAOYSA-N 0.000 description 2
- 241000219318 Amaranthus Species 0.000 description 2
- 241000339490 Brachyachne Species 0.000 description 2
- 235000011331 Brassica Nutrition 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000003880 Calendula Nutrition 0.000 description 2
- 240000001432 Calendula officinalis Species 0.000 description 2
- 235000007516 Chrysanthemum Nutrition 0.000 description 2
- 240000005250 Chrysanthemum indicum Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 241001101998 Galium Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 235000009438 Gossypium Nutrition 0.000 description 2
- 241000209219 Hordeum Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 235000021506 Ipomoea Nutrition 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- 241000208204 Linum Species 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 241000219194 Arabidopsis Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 241000208152 Geranium Species 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 241001442129 Myosotis Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 240000006597 Poa trivialis Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/18—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/16—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with acylated ring nitrogen atoms
- C07D203/20—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with acylated ring nitrogen atoms by carbonic acid, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/06—1,3-Oxazines; Hydrogenated 1,3-oxazines not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH102268A CH493195A (de) | 1968-01-23 | 1968-01-23 | Schädlingsbekämpfungsmittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1901501A1 DE1901501A1 (de) | 1969-08-28 |
| DE1901501B2 DE1901501B2 (de) | 1977-09-22 |
| DE1901501C3 true DE1901501C3 (de) | 1978-05-03 |
Family
ID=4200614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1901501A Expired DE1901501C3 (de) | 1968-01-23 | 1969-01-14 | m- Trifluormethylphenylharnstoffe und diese enthaltende herbizide Mittel |
Country Status (15)
| Country | Link |
|---|---|
| BE (1) | BE727286A (enExample) |
| BG (1) | BG17267A3 (enExample) |
| CH (1) | CH493195A (enExample) |
| CS (1) | CS158236B2 (enExample) |
| DE (1) | DE1901501C3 (enExample) |
| DK (1) | DK124443B (enExample) |
| FR (1) | FR2000570A1 (enExample) |
| GB (1) | GB1260386A (enExample) |
| IE (1) | IE32624B1 (enExample) |
| IL (1) | IL31444A (enExample) |
| NL (1) | NL159091B (enExample) |
| RO (1) | RO54785A (enExample) |
| SE (1) | SE375095B (enExample) |
| SU (1) | SU404191A3 (enExample) |
| YU (1) | YU34874B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3222974A1 (de) * | 1982-06-19 | 1983-12-22 | Basf Ag, 6700 Ludwigshafen | Neue 5-phenoxybenzisothiazol-4'-harnstoffderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| EP0427963B1 (de) * | 1989-11-10 | 1994-03-30 | Agrolinz Agrarchemikalien Gesellschaft M.B.H. | Verfahren zur Herstellung reiner, unsymmetrisch disubstituierter Harnstoffe |
| DE10029564A1 (de) | 2000-06-22 | 2002-01-03 | Continental Ag | Elastomerlager |
| AU2003243921B2 (en) | 2002-06-27 | 2009-05-07 | Novo Nordisk A/S | Aryl carbonyl derivatives as therapeutic agents |
| WO2005066145A1 (en) | 2004-01-06 | 2005-07-21 | Novo Nordisk A/S | Heteroaryl-ureas and their use as glucokinase activators |
| ES2382815T3 (es) | 2005-07-08 | 2012-06-13 | Novo Nordisk A/S | Dicicloalquilcarbamoil ureas como activadores de glucoquinasa |
| US7884210B2 (en) | 2005-07-14 | 2011-02-08 | Novo Nordisk A/S | Ureido-thiazole glucokinase activators |
| US8138185B2 (en) | 2007-01-09 | 2012-03-20 | Novo Nordisk A/S | Urea glucokinase activators |
| US8318778B2 (en) | 2007-01-11 | 2012-11-27 | Novo Nordisk A/S | Urea glucokinase activators |
| KR20210020866A (ko) | 2018-06-12 | 2021-02-24 | 브이티브이 테라퓨틱스 엘엘씨 | 인슐린 또는 인슐린 유사체와 조합된 글루코키나제 활성제의 치료적 용도 |
| WO2021167840A1 (en) | 2020-02-18 | 2021-08-26 | Vtv Therapeutics Llc | Sulfoxide and sulfone glucokinase activators and methods of use thereof |
| EP4161640A4 (en) | 2020-06-08 | 2024-01-17 | vTv Therapeutics LLC | Salts or co-crystals of {2-[3-cyclohexyl-3-(trans-4-propoxy-cyclohexyl)-ureido]-thiazol-5-ylsulfanyl}-acetic acid and uses thereof |
-
1968
- 1968-01-23 CH CH102268A patent/CH493195A/de not_active IP Right Cessation
-
1969
- 1969-01-14 DE DE1901501A patent/DE1901501C3/de not_active Expired
- 1969-01-16 FR FR6900613A patent/FR2000570A1/fr not_active Withdrawn
- 1969-01-19 IL IL31444A patent/IL31444A/en unknown
- 1969-01-21 SE SE6900757A patent/SE375095B/xx unknown
- 1969-01-21 IE IE80/69A patent/IE32624B1/xx unknown
- 1969-01-22 BE BE727286D patent/BE727286A/xx unknown
- 1969-01-22 YU YU154/69A patent/YU34874B/xx unknown
- 1969-01-22 NL NL6901066.A patent/NL159091B/xx not_active IP Right Cessation
- 1969-01-22 DK DK34469AA patent/DK124443B/da unknown
- 1969-01-23 GB GB3873/69A patent/GB1260386A/en not_active Expired
- 1969-01-23 SU SU1300475A patent/SU404191A3/ru active
- 1969-01-23 CS CS45669*#A patent/CS158236B2/cs unknown
- 1969-01-23 RO RO58846A patent/RO54785A/ro unknown
- 1969-01-23 BG BG011505A patent/BG17267A3/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE32624L (en) | 1969-07-23 |
| YU15469A (en) | 1979-10-31 |
| CH493195A (de) | 1970-07-15 |
| YU34874B (en) | 1980-04-30 |
| NL6901066A (enExample) | 1969-07-25 |
| IE32624B1 (en) | 1973-10-03 |
| NL159091B (nl) | 1979-01-15 |
| SU404191A3 (enExample) | 1973-10-26 |
| DK124443B (da) | 1972-10-23 |
| RO54785A (enExample) | 1973-05-17 |
| BG17267A3 (bg) | 1973-07-25 |
| FR2000570A1 (enExample) | 1969-09-12 |
| CS158236B2 (enExample) | 1974-10-15 |
| DE1901501A1 (de) | 1969-08-28 |
| DE1901501B2 (de) | 1977-09-22 |
| IL31444A0 (en) | 1969-03-27 |
| BE727286A (enExample) | 1969-07-22 |
| IL31444A (en) | 1973-03-30 |
| SE375095B (enExample) | 1975-04-07 |
| GB1260386A (en) | 1972-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1905599C2 (de) | Verwendung von Harnstoffen als selektive Herbizide | |
| DE1901501C3 (de) | m- Trifluormethylphenylharnstoffe und diese enthaltende herbizide Mittel | |
| DE1643313A1 (de) | Neue herbicid wirksame Verbindungen und Zusammensetzungen | |
| DE1918112C3 (de) | N-(3-Chlor-4-äthoxyphenyi)-N'-methyI-N'-methoxyharnstoff, Verfahren zu seiner Herstellung sowie diesen enthaltende herbizide Mittel | |
| DE1923939A1 (de) | Fungicide | |
| DE1089210B (de) | Unkrautbekaempfungsmittel | |
| DE2044735C3 (de) | Phenylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE1110465B (de) | Mittel zur Beeinflussung, insbesondere Hemmung, des Pflanzenwachstums | |
| DE2324732A1 (de) | Phenyl-thiadiazolyl-thioharnstoff | |
| DE1131461B (de) | Bekaempfung von durch Pilze hervorgerufenen Pflanzenkrankheiten | |
| DE2302029C2 (de) | N,N-disubstituierte &alpha;-Aminothiopropionsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2221787A1 (de) | Hexahydrotriazinonderivate und ihre verwendung als selektive mittel zur unkrautbekaempfung | |
| AT356966B (de) | Herbizides mittel | |
| CH617571A5 (enExample) | ||
| AT307439B (de) | Verfahren zur Herstellung von neuen Harnstoff- bzw. Thioharnstoff-Derivaten | |
| EP0016731B1 (de) | Meta-Cyanoalkoxy-Phenylharnstoffe mit herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| DE1670312C3 (de) | Substituierte 2-Carbamoyloxyphenyl-4-methyl-1,2,4-oxadiazolidin-33-dione | |
| DE1643039C3 (de) | Bromacetylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende biocide Mittel | |
| DE1542882A1 (de) | Mittel zur Bekaempfung von Unkraeutern | |
| AT348832B (de) | Schaedlingsbekaempfungsmittel | |
| DE1542889B2 (de) | Mittel zur Bekämpfung von Unkräutern auf Phenylharnstoffbasis Hoechst AG, 6000 Frankfurt | |
| DE1770027A1 (de) | Thiocarbamoylalkylamino-s-triazine | |
| DE1643798C (de) | 3,4-DibromphenylharnstofTe bzw. -thioharnstoffe und diese als Wirkstoff enthaltende total- oder selektiv-herbizide Mittel | |
| AT227021B (de) | Herbizide Mittel | |
| DE2451418B2 (de) | N-alpha, alpha-dimethylbenzyl-n'- phenyl-n'-alkoxy-bzw. n'-alkenyloxy- harnstoffe und diese enthaltende herbicide mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |