IL31444A - Pesticidal preparations containing trifluoromethyl-phenyl-(thio)ureas and certain new such compounds - Google Patents
Pesticidal preparations containing trifluoromethyl-phenyl-(thio)ureas and certain new such compoundsInfo
- Publication number
- IL31444A IL31444A IL31444A IL3144469A IL31444A IL 31444 A IL31444 A IL 31444A IL 31444 A IL31444 A IL 31444A IL 3144469 A IL3144469 A IL 3144469A IL 31444 A IL31444 A IL 31444A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- composition according
- active ingredient
- compounds
- group
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 20
- 230000000361 pesticidal effect Effects 0.000 title claims description 4
- 238000002360 preparation method Methods 0.000 title description 7
- 235000013877 carbamide Nutrition 0.000 title description 4
- 150000003672 ureas Chemical class 0.000 title description 3
- 241000196324 Embryophyta Species 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 8
- -1 2-me hylpropynyl Chemical group 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 230000002363 herbicidal effect Effects 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 241000894006 Bacteria Species 0.000 claims description 3
- 241000233866 Fungi Species 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229920000742 Cotton Polymers 0.000 claims description 2
- 244000068988 Glycine max Species 0.000 claims description 2
- 235000010469 Glycine max Nutrition 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 240000008042 Zea mays Species 0.000 claims description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 2
- 239000000853 adhesive Substances 0.000 claims description 2
- 230000001070 adhesive effect Effects 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 235000009973 maize Nutrition 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002911 monocyclic heterocycle group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 2
- 230000003032 phytopathogenic effect Effects 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 241000219146 Gossypium Species 0.000 claims 1
- 240000007594 Oryza sativa Species 0.000 claims 1
- 235000007164 Oryza sativa Nutrition 0.000 claims 1
- 239000000654 additive Substances 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 235000013339 cereals Nutrition 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 239000002270 dispersing agent Substances 0.000 claims 1
- 235000009566 rice Nutrition 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 239000000080 wetting agent Substances 0.000 claims 1
- 239000013543 active substance Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- 241000223602 Alternaria alternata Species 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- ASMZBOYDOWEBKG-UHFFFAOYSA-L Cl(=O)(=O)[O-].[Na+].[Na+].Cl(=O)(=O)[O-] Chemical compound Cl(=O)(=O)[O-].[Na+].[Na+].Cl(=O)(=O)[O-] ASMZBOYDOWEBKG-UHFFFAOYSA-L 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000003559 chemosterilizing effect Effects 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 229910052571 earthenware Inorganic materials 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/18—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/16—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with acylated ring nitrogen atoms
- C07D203/20—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with acylated ring nitrogen atoms by carbonic acid, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/06—1,3-Oxazines; Hydrogenated 1,3-oxazines not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH102268A CH493195A (de) | 1968-01-23 | 1968-01-23 | Schädlingsbekämpfungsmittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL31444A0 IL31444A0 (en) | 1969-03-27 |
| IL31444A true IL31444A (en) | 1973-03-30 |
Family
ID=4200614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL31444A IL31444A (en) | 1968-01-23 | 1969-01-19 | Pesticidal preparations containing trifluoromethyl-phenyl-(thio)ureas and certain new such compounds |
Country Status (15)
| Country | Link |
|---|---|
| BE (1) | BE727286A (enExample) |
| BG (1) | BG17267A3 (enExample) |
| CH (1) | CH493195A (enExample) |
| CS (1) | CS158236B2 (enExample) |
| DE (1) | DE1901501C3 (enExample) |
| DK (1) | DK124443B (enExample) |
| FR (1) | FR2000570A1 (enExample) |
| GB (1) | GB1260386A (enExample) |
| IE (1) | IE32624B1 (enExample) |
| IL (1) | IL31444A (enExample) |
| NL (1) | NL159091B (enExample) |
| RO (1) | RO54785A (enExample) |
| SE (1) | SE375095B (enExample) |
| SU (1) | SU404191A3 (enExample) |
| YU (1) | YU34874B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3222974A1 (de) * | 1982-06-19 | 1983-12-22 | Basf Ag, 6700 Ludwigshafen | Neue 5-phenoxybenzisothiazol-4'-harnstoffderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| DE59005183D1 (de) * | 1989-11-10 | 1994-05-05 | Agrolinz Agrarchemikalien | Verfahren zur Herstellung reiner, unsymmetrisch disubstituierter Harnstoffe. |
| DE10029564A1 (de) | 2000-06-22 | 2002-01-03 | Continental Ag | Elastomerlager |
| PL215132B1 (pl) | 2002-06-27 | 2013-10-31 | Novo Nordisk As | Pochodna arylokarbonylowa jako srodek terapeutyczny, jej zastosowanie i kompozycja farmaceutyczna ja zawierajaca |
| PT1723128E (pt) | 2004-01-06 | 2013-02-27 | Novo Nordisk As | Heteroaril-ureias e o seu uso como activadores da glicoquinase |
| EP1904438B1 (en) | 2005-07-08 | 2012-02-29 | Novo Nordisk A/S | Dicycloalkylcarbamoyl ureas as glucokinase activators |
| KR101446973B1 (ko) | 2005-07-14 | 2014-10-07 | 트랜스테크 파르마 엘엘씨 | 우레아 글루코키나제 활성제 |
| WO2008084043A1 (en) | 2007-01-09 | 2008-07-17 | Novo Nordisk A/S | Urea glucokinase activators |
| EP2099777B1 (en) | 2007-01-11 | 2015-08-12 | Novo Nordisk A/S | Urea glucokinase activators |
| CN112040945A (zh) | 2018-06-12 | 2020-12-04 | Vtv治疗有限责任公司 | 葡萄糖激酶激活剂与胰岛素或胰岛素类似物组合的治疗用途 |
| US12391658B2 (en) | 2020-02-18 | 2025-08-19 | Vtv Therapeutics Llc | Sulfoxide and sulfone glucokinase activators and methods of use thereof |
| AU2021289309A1 (en) | 2020-06-08 | 2023-01-19 | Vtv Therapeutics Llc | Salts or co-crystals of {2-[3-cyclohexyl-3-(trans-4-propoxy-cyclohexyl)-ureido]-thiazol-5-ylsulfanyl}-acetic acid and uses thereof |
-
1968
- 1968-01-23 CH CH102268A patent/CH493195A/de not_active IP Right Cessation
-
1969
- 1969-01-14 DE DE1901501A patent/DE1901501C3/de not_active Expired
- 1969-01-16 FR FR6900613A patent/FR2000570A1/fr not_active Withdrawn
- 1969-01-19 IL IL31444A patent/IL31444A/en unknown
- 1969-01-21 IE IE80/69A patent/IE32624B1/xx unknown
- 1969-01-21 SE SE6900757A patent/SE375095B/xx unknown
- 1969-01-22 NL NL6901066.A patent/NL159091B/xx not_active IP Right Cessation
- 1969-01-22 BE BE727286D patent/BE727286A/xx unknown
- 1969-01-22 YU YU154/69A patent/YU34874B/xx unknown
- 1969-01-22 DK DK34469AA patent/DK124443B/da unknown
- 1969-01-23 SU SU1300475A patent/SU404191A3/ru active
- 1969-01-23 RO RO58846A patent/RO54785A/ro unknown
- 1969-01-23 BG BG011505A patent/BG17267A3/xx unknown
- 1969-01-23 CS CS45669*#A patent/CS158236B2/cs unknown
- 1969-01-23 GB GB3873/69A patent/GB1260386A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1901501B2 (de) | 1977-09-22 |
| DE1901501A1 (de) | 1969-08-28 |
| YU34874B (en) | 1980-04-30 |
| SU404191A3 (enExample) | 1973-10-26 |
| SE375095B (enExample) | 1975-04-07 |
| CH493195A (de) | 1970-07-15 |
| RO54785A (enExample) | 1973-05-17 |
| GB1260386A (en) | 1972-01-19 |
| IE32624L (en) | 1969-07-23 |
| YU15469A (en) | 1979-10-31 |
| IE32624B1 (en) | 1973-10-03 |
| IL31444A0 (en) | 1969-03-27 |
| DE1901501C3 (de) | 1978-05-03 |
| CS158236B2 (enExample) | 1974-10-15 |
| DK124443B (da) | 1972-10-23 |
| NL6901066A (enExample) | 1969-07-25 |
| BE727286A (enExample) | 1969-07-22 |
| BG17267A3 (bg) | 1973-07-25 |
| FR2000570A1 (enExample) | 1969-09-12 |
| NL159091B (nl) | 1979-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3063823A (en) | Method of killing weeds and influencing plant growth | |
| US3367949A (en) | Sulfanilamides | |
| IL31444A (en) | Pesticidal preparations containing trifluoromethyl-phenyl-(thio)ureas and certain new such compounds | |
| DE2741437C2 (enExample) | ||
| DE2513730A1 (de) | Halogenacetanilide als mikrobizide wirkstoffe | |
| BG61021B1 (bg) | Хербицидно средство и метод за борба с нежелана растителност | |
| DE2513789A1 (de) | Haloacylanilide als mikrobizide wirkstoffe | |
| CA1055035A (en) | Carbamoyloxyimino derivatives of oxazolidinones and thiazolidinones | |
| US3641050A (en) | 1 5-substituted indazoles | |
| HU181859B (en) | Fungicide compositions containing 3-bracket-n-acyl-n-aryl-amino-bracket closed-gamma-butirolaktone- or 3-bracket-n-acyl-n-aryl-amino-bracket closed-gamma-butirolactone derivatives as active agents, and process for producing the active agents | |
| HU176584B (en) | Herbicide preparation containing of active mateirals of two types | |
| FI57943B (fi) | N-fenyl-n'-1,2,3-tiadiazol-5-yltiourea anvaendbar saosom herbicid | |
| US3265563A (en) | Phenyl nu-alkyl thiolcarbamate microbiocide | |
| GB1041011A (en) | Fungicidal compositions and halogenated quinoxalines | |
| CS232736B2 (en) | Fungicide agent and method of active component production | |
| US3396005A (en) | Methods of affecting plant growth | |
| US3246976A (en) | Method for controlling crab grass and water grass | |
| DE2539396C3 (de) | Pestizide | |
| US2804381A (en) | Herbicides | |
| SU849976A3 (ru) | Фунгицидоинсектицидное средство | |
| US2913323A (en) | Herbicidal method and composition employing bis(2-methyl-5-ethylpyridine) copper (ii) chloride | |
| US3366538A (en) | Method of disinfecting seeds | |
| RU2430915C2 (ru) | Антидоты гербицида 2,4-дихлорфеноксиуксусной кислоты | |
| US3238035A (en) | Herbicidal use of n-cycloalkyl-n-bis(beta-chloroalkyl)amines | |
| JPS5842162B2 (ja) | ジヨソウザイソセイブツ |