CH617571A5 - - Google Patents
Download PDFInfo
- Publication number
- CH617571A5 CH617571A5 CH33776A CH33776A CH617571A5 CH 617571 A5 CH617571 A5 CH 617571A5 CH 33776 A CH33776 A CH 33776A CH 33776 A CH33776 A CH 33776A CH 617571 A5 CH617571 A5 CH 617571A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- carbon atoms
- mol
- alkyl
- compounds
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 21
- 241000196324 Embryophyta Species 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000004009 herbicide Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- DPMZXMBOYHBELT-UHFFFAOYSA-N 1,3,5-trimethyl-1,3,5-triazinane Chemical compound CN1CN(C)CN(C)C1 DPMZXMBOYHBELT-UHFFFAOYSA-N 0.000 description 4
- SXJYSIBLFGQAND-UHFFFAOYSA-N 1-isocyanato-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(N=C=O)=C1 SXJYSIBLFGQAND-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 241001330453 Paspalum Species 0.000 description 4
- 244000046052 Phaseolus vulgaris Species 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 238000012216 screening Methods 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- -1 thiomethyl aryl ureas Chemical class 0.000 description 4
- 244000178993 Brassica juncea Species 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 235000005474 African couch grass Nutrition 0.000 description 2
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 2
- 244000237956 Amaranthus retroflexus Species 0.000 description 2
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 235000014698 Brassica juncea var multisecta Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 241001520106 Eustachys Species 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KDOIUFIZFQJSCT-UHFFFAOYSA-N 1-ethylsulfanyl-n-methylmethanamine;hydrochloride Chemical compound Cl.CCSCNC KDOIUFIZFQJSCT-UHFFFAOYSA-N 0.000 description 1
- ZALPYLCGQDBLNQ-UHFFFAOYSA-N 1-tert-butylsulfanyl-n-methylmethanamine;hydrochloride Chemical compound Cl.CNCSC(C)(C)C ZALPYLCGQDBLNQ-UHFFFAOYSA-N 0.000 description 1
- HKNIBUUBFMMKFB-UHFFFAOYSA-N 2,4,4-trimethylpentan-2-ylsulfanylmethanamine Chemical compound CC(C)(C)CC(C)(C)SCN HKNIBUUBFMMKFB-UHFFFAOYSA-N 0.000 description 1
- 235000011332 Brassica juncea Nutrition 0.000 description 1
- 235000014700 Brassica juncea var napiformis Nutrition 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 244000299507 Gossypium hirsutum Species 0.000 description 1
- 244000088461 Panicum crus-galli Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 235000021501 Rumex crispus Nutrition 0.000 description 1
- 244000207667 Rumex vesicarius Species 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- FQEIBEOBXKJAMZ-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]urea Chemical compound NC(=O)NC1=CC=CC(C(F)(F)F)=C1 FQEIBEOBXKJAMZ-UHFFFAOYSA-N 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 230000003203 everyday effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000003324 growth hormone secretagogue Substances 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- GLAHOGLQISUYKF-UHFFFAOYSA-N n-methyl-1-(2,4,4-trimethylpentan-2-ylsulfanyl)methanamine;hydrochloride Chemical compound Cl.CNCSC(C)(C)CC(C)(C)C GLAHOGLQISUYKF-UHFFFAOYSA-N 0.000 description 1
- BBXBGAJKQZHBSE-UHFFFAOYSA-N n-methyl-1-propan-2-ylsulfanylmethanamine;hydrochloride Chemical compound Cl.CNCSC(C)C BBXBGAJKQZHBSE-UHFFFAOYSA-N 0.000 description 1
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical compound NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- WMXCDAVJEZZYLT-UHFFFAOYSA-N tert-butylthiol Chemical compound CC(C)(C)S WMXCDAVJEZZYLT-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US54037475A | 1975-01-13 | 1975-01-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH617571A5 true CH617571A5 (enExample) | 1980-06-13 |
Family
ID=24155183
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH33776A CH617571A5 (enExample) | 1975-01-13 | 1976-01-13 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4111682A (enExample) |
| JP (1) | JPS5195040A (enExample) |
| BE (1) | BE837534A (enExample) |
| BR (1) | BR7600167A (enExample) |
| CA (1) | CA1073466A (enExample) |
| CH (1) | CH617571A5 (enExample) |
| DD (1) | DD123856A5 (enExample) |
| DE (1) | DE2601051A1 (enExample) |
| DK (1) | DK11976A (enExample) |
| EG (1) | EG12114A (enExample) |
| FR (1) | FR2297212A1 (enExample) |
| GB (1) | GB1479126A (enExample) |
| HU (1) | HU173776B (enExample) |
| IL (1) | IL48829A (enExample) |
| IN (1) | IN142854B (enExample) |
| MY (1) | MY7800487A (enExample) |
| NL (1) | NL7600306A (enExample) |
| PH (1) | PH13853A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4090864A (en) * | 1977-05-31 | 1978-05-23 | Stauffer Chemical Company | Herbicidal acetamidothiomethyl ureas |
| AU1395983A (en) * | 1982-05-03 | 1983-11-10 | Uniroyal Inc. | Substituted urea herbicides |
| MXPA02002578A (es) * | 1999-09-08 | 2002-10-23 | Guilford Pharm Inc | Compuestos de union a ciclofilina no peptidicos, y su uso. |
| EP1360173A2 (en) | 2001-01-25 | 2003-11-12 | Guilford Pharmaceuticals Inc. | Trisubstituted carbocyclic cyclophilin binding compounds and their use |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA699773A (en) * | 1964-12-15 | T. Goebel Max | Herbicidally active aryl alkyl methoxymethyl ureas | |
| US2708677A (en) * | 1950-08-23 | 1955-05-17 | Cilag Ltd | Thioethers and a process for their production |
| US3072719A (en) * | 1959-04-23 | 1963-01-08 | Monsanto Chemicals | 3, 4-dichlorophenyl substituted alkyl ureas |
| DE1192454B (de) * | 1963-12-03 | 1965-05-06 | Basf Ag | Selektive herbizide Mittel |
| DE1542687A1 (de) | 1965-06-04 | 1970-07-23 | Basf Ag | Herbizide Mittel |
| DE1542688A1 (de) * | 1965-06-12 | 1970-07-02 | Basf Ag | Herbizide Mittel |
| DE2101698A1 (de) * | 1971-01-15 | 1972-09-07 | Badische Anilin- & Soda-Fabrik Ag, 6700 Ludwigshafen | Substituierte m-Trifluormethylphenylharnstoffderivate |
| BE791449A (fr) * | 1971-11-17 | 1973-05-16 | Roussel Uclaf | Nouvelles urees substituees et procede de |
| BG23537A3 (bg) * | 1973-05-22 | 1977-09-15 | Philargo S.A. | Средство за регулиране растежа на растенията |
| US3978123A (en) * | 1973-07-12 | 1976-08-31 | Chevron Research Company | Herbicidal n-alkylsulfoxymethyl-and-n-alkylsulfonyl-methyl-n-aryl |
| SU713521A3 (ru) * | 1975-02-18 | 1980-01-30 | Руссель-Юклаф (Фирма) | Гербицидный состав |
-
1976
- 1976-01-12 PH PH17960A patent/PH13853A/en unknown
- 1976-01-12 FR FR7600554A patent/FR2297212A1/fr active Granted
- 1976-01-13 CA CA243,462A patent/CA1073466A/en not_active Expired
- 1976-01-13 JP JP51003145A patent/JPS5195040A/ja active Pending
- 1976-01-13 DK DK11976*#A patent/DK11976A/da unknown
- 1976-01-13 GB GB1179/76A patent/GB1479126A/en not_active Expired
- 1976-01-13 CH CH33776A patent/CH617571A5/de not_active IP Right Cessation
- 1976-01-13 EG EG13/76A patent/EG12114A/xx active
- 1976-01-13 HU HU76SA2877A patent/HU173776B/hu unknown
- 1976-01-13 BE BE7000761A patent/BE837534A/xx unknown
- 1976-01-13 DD DD190792A patent/DD123856A5/xx unknown
- 1976-01-13 DE DE19762601051 patent/DE2601051A1/de not_active Withdrawn
- 1976-01-13 IL IL48829A patent/IL48829A/xx unknown
- 1976-01-13 BR BR167/76A patent/BR7600167A/pt unknown
- 1976-01-13 NL NL7600306A patent/NL7600306A/xx not_active Application Discontinuation
- 1976-03-24 IN IN515/CAL/1976A patent/IN142854B/en unknown
-
1977
- 1977-05-31 US US05/801,889 patent/US4111682A/en not_active Expired - Lifetime
-
1978
- 1978-12-30 MY MY487/78A patent/MY7800487A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE837534A (nl) | 1976-07-13 |
| MY7800487A (en) | 1978-12-31 |
| IL48829A0 (en) | 1976-03-31 |
| DK11976A (da) | 1976-07-14 |
| FR2297212B1 (enExample) | 1979-07-27 |
| HU173776B (hu) | 1979-08-28 |
| DD123856A5 (enExample) | 1977-01-19 |
| GB1479126A (en) | 1977-07-06 |
| JPS5195040A (enExample) | 1976-08-20 |
| AU1024476A (en) | 1977-07-21 |
| PH13853A (en) | 1980-10-22 |
| EG12114A (en) | 1978-09-30 |
| IL48829A (en) | 1979-01-31 |
| NL7600306A (nl) | 1976-07-15 |
| FR2297212A1 (fr) | 1976-08-06 |
| DE2601051A1 (de) | 1976-07-15 |
| IN142854B (enExample) | 1977-09-03 |
| CA1073466A (en) | 1980-03-11 |
| BR7600167A (pt) | 1976-11-09 |
| US4111682A (en) | 1978-09-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1518815C3 (de) | m-(UreidophenyI)-carbaminsäureester, deren Herstellung und diese enthaltende herbizide Mittel | |
| CH633260A5 (de) | N'-(4-phenylaethyloxyphenyl)-n-methyl-n-methoxyharnstoffe, bei denen der phenylrest des phenylaethylrestes substituiert ist. | |
| DE2628384C2 (de) | 2-(4-Phenoxyphenoxy)- bzw. 2-(4-Benzylphenoxy)-propionsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenbehandlungsmittel | |
| DE1901501B2 (de) | M- trifluormethylphenylharnstoffe und diese enthaltende herbizide mittel | |
| EP0037971B1 (de) | Trisubstituierte Cyanguanidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| EP0154508A2 (en) | Thiophenylureas, their production and use | |
| CH628017A5 (de) | Verfahren zur herstellung der neuen verbindung n-(4-benzyloxyphenyl)-n'-methyl-n'-methoxyharnstoff. | |
| EP0036390A2 (de) | Diphenyläther-Harnstoffe mit herbizider Wirkung | |
| DE2928410A1 (de) | Acylharnstoffe, insektizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung | |
| DE2643403C2 (de) | Thiocarbonsäurederivate, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| CH617571A5 (enExample) | ||
| EP0030922B1 (de) | Äthinyl-Phenylharnstoffe, Verfahren zu deren Herstellung und deren Verwendung als Herbizide | |
| EP0010692B1 (de) | Neue m-Anilidurethane, sie enthaltende Herbizide und Verfahren zu deren Herstellung, sowie Verfahren zur Bekämpfung von unerwünschtem Pflanzenwuchs | |
| DE3047629A1 (de) | "tetrahydrofuranderivate" | |
| DE2044735C3 (de) | Phenylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| CH633546A5 (en) | Tetrahydro-1,3,5-thiadiazin-4-one compounds | |
| DE3782362T2 (de) | Cyanacetamid-derivate mit fungizider wirkung. | |
| DE2919825C2 (enExample) | ||
| DE2919292A1 (de) | Substituierte harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als pflanzenbakterizide | |
| DE1291733B (de) | Verfahren zur Herstellung von N-Aryl-harnstoffen | |
| EP0097614B1 (de) | Schädlingsbekämpfungsmittel | |
| DE2643445C2 (de) | N-Acylierte N-Phenyl-alaninthiomethylester, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| US3352750A (en) | Alkyl-substituted-benzoquinone-4-oximinyl nu-alkyl carbamates and use as fungicides | |
| EP0032366B1 (de) | Verwendung von 4-Thioparabansäure-Derivaten als herbizide Wirkstoffe | |
| DE2156919A1 (de) | m-substituierte Phenylharnstoffe und -thioharnstoffe sowie diese als Wirkstoffe enthaltende Herbizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |