DE1795650A1 - Verfahren zur herstellung von biologisch aktiven verbindungen - Google Patents
Verfahren zur herstellung von biologisch aktiven verbindungenInfo
- Publication number
- DE1795650A1 DE1795650A1 DE19661795650 DE1795650A DE1795650A1 DE 1795650 A1 DE1795650 A1 DE 1795650A1 DE 19661795650 DE19661795650 DE 19661795650 DE 1795650 A DE1795650 A DE 1795650A DE 1795650 A1 DE1795650 A1 DE 1795650A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- radical
- stands
- hydrogen
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 29
- 150000001875 compounds Chemical class 0.000 title claims description 27
- -1 halogenophenyl Chemical group 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 4
- 230000002140 halogenating effect Effects 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000012071 phase Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 3
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 150000008065 acid anhydrides Chemical class 0.000 claims 1
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 125000006501 nitrophenyl group Chemical group 0.000 claims 1
- 239000001301 oxygen Chemical group 0.000 claims 1
- 229910052760 oxygen Chemical group 0.000 claims 1
- 239000011593 sulfur Chemical group 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- 238000003756 stirring Methods 0.000 description 19
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 125000004423 acyloxy group Chemical group 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 235000013601 eggs Nutrition 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 241000238876 Acari Species 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- ORECNKBJIMKZNX-UHFFFAOYSA-N 1,3-thiazol-3-ium;chloride Chemical compound Cl.C1=CSC=N1 ORECNKBJIMKZNX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- MPGQQQKGAXDBDN-UHFFFAOYSA-N 1,3-thiazolidin-3-ium;chloride Chemical compound Cl.C1CSCN1 MPGQQQKGAXDBDN-UHFFFAOYSA-N 0.000 description 1
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- VLRGXXKFHVJQOL-UHFFFAOYSA-N 3-chloropentane-2,4-dione Chemical compound CC(=O)C(Cl)C(C)=O VLRGXXKFHVJQOL-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000238678 Boophilus Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 229910020175 SiOH Inorganic materials 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 230000003113 alkalizing effect Effects 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- DZLNHFMRPBPULJ-UHFFFAOYSA-N thioproline Chemical compound OC(=O)C1CSCN1 DZLNHFMRPBPULJ-UHFFFAOYSA-N 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/08—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/08—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring nitrogen atom
- C07D203/10—Radicals substituted by singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/12—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/18—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AU61653/65A AU409983B2 (en) | 1965-07-19 | 1965-07-19 | Process for the manufacture of thia zolidines and thiazolidines produced thereby |
| AU6193165 | 1965-07-26 | ||
| AU6341565 | 1965-08-31 | ||
| AU6378665 | 1965-09-08 | ||
| US56509266A | 1966-07-14 | 1966-07-14 | |
| US00240773A US3828061A (en) | 1965-07-19 | 1972-04-03 | Multi-step process for preparing 2,3,5,6-tetrahydroimidazo(2,1-b)thiazoles |
| US240827A US3862166A (en) | 1965-07-19 | 1972-04-03 | Certain 3-haloethyl-2-iminothiazolidine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1795650A1 true DE1795650A1 (de) | 1973-05-24 |
Family
ID=27560622
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1795651A Expired DE1795651C3 (de) | 1965-07-19 | 1966-07-13 | Verfahren zur Herstellung von 6-substituierten 233,6-Tetrahydroimidazo [2,1-b] thiazolen |
| DE19661695249 Pending DE1695249A1 (de) | 1965-07-19 | 1966-07-13 | Verfahren zur Herstellung von biologisch wirksamen Verbindungen |
| DE19661795650 Pending DE1795650A1 (de) | 1965-07-19 | 1966-07-13 | Verfahren zur herstellung von biologisch aktiven verbindungen |
Family Applications Before (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1795651A Expired DE1795651C3 (de) | 1965-07-19 | 1966-07-13 | Verfahren zur Herstellung von 6-substituierten 233,6-Tetrahydroimidazo [2,1-b] thiazolen |
| DE19661695249 Pending DE1695249A1 (de) | 1965-07-19 | 1966-07-13 | Verfahren zur Herstellung von biologisch wirksamen Verbindungen |
Country Status (14)
| Country | Link |
|---|---|
| US (4) | US3759937A (enExample) |
| AU (1) | AU409983B2 (enExample) |
| BE (1) | BE684340A (enExample) |
| BR (1) | BR6681363D0 (enExample) |
| CH (2) | CH490376A (enExample) |
| CS (2) | CS155143B2 (enExample) |
| DE (3) | DE1795651C3 (enExample) |
| DK (1) | DK125996B (enExample) |
| FR (1) | FR1502712A (enExample) |
| GB (3) | GB1131799A (enExample) |
| IL (3) | IL34051A (enExample) |
| NL (1) | NL6610166A (enExample) |
| SE (2) | SE370078B (enExample) |
| YU (2) | YU32997B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2429227A1 (de) * | 1973-06-18 | 1975-01-09 | American Cyanamid Co | Verfahren zur herstellung von dl-6phenyl-2,3,5,6-tetrahydroimidazo eckige klammer auf 2,1-b eckige klammer zu thiazol und dessen saeureadditionssalzen |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| OA04567A (fr) * | 1972-11-30 | 1980-05-31 | Rhone Poulenc Sa | Nouveaux dérivés de l'imidazo (2,1-b) thiazole et leur préparation. |
| US4107170A (en) * | 1975-10-29 | 1978-08-15 | American Cyanamid Company | Method of preparing dl 6-phenyl-2,3,5,6-tetrahydroimidazo-[2,1-b]thiazole and acid addition salts thereof |
| GB1533347A (en) * | 1976-10-22 | 1978-11-22 | Pfizer Ltd | Anthelmintic compounds |
| CA2028756A1 (en) * | 1989-11-24 | 1991-05-25 | Alfons H. M. Raeymaekers | Immunostimulating 6-aryl-5,6-dihydro-imidazo[2,1-b]thiazole derivatives |
| US6291370B1 (en) * | 1999-09-01 | 2001-09-18 | Harodite Industries, Inc. | Chopped fiberglass laminate for automotive headliners and method of fabrication |
| EP1694356B1 (en) * | 2003-12-09 | 2011-02-16 | Novo Nordisk A/S | Regulation of food preference using glp-1 agonists |
| EP2316446A1 (en) * | 2004-06-11 | 2011-05-04 | Novo Nordisk A/S | Counteracting drug-induced obesity using GLP-1 agonists |
| CN111377949B (zh) * | 2020-03-18 | 2021-05-14 | 山东国邦药业有限公司 | 一种四咪唑游离碱制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3624099A (en) * | 1965-10-05 | 1971-11-30 | American Cyanamid Co | Process of preparing 2 -imino-{60 phenyl 3-thiazolidineethanol acid salts |
| US3547996A (en) * | 1965-10-05 | 1970-12-15 | American Cyanamid Co | Di 2 - (2 - ((beta - hydroxyphenethyl)amino)ethyl) - 2 - thiopseudourea and hydrochloride salt thereof |
| US3642809A (en) * | 1965-10-05 | 1972-02-15 | American Cyanamid Co | Method for producing 2 3 5 6-tetra hydroimidazo-(2 1-b)thiazoles |
| US3679696A (en) * | 1965-10-05 | 1972-07-25 | American Cyanamid Co | METHOD OF PREPARING d1 6-PHENYL-2,3,5,6-TETRAHYDROIMIDAZO {8 2,1-b{9 -THIAZOLE HYDROCHLORIDE |
| US3297708A (en) * | 1965-10-06 | 1967-01-10 | American Cyanamid Co | Method of preparing thiazolidines |
| NL129632C (enExample) * | 1965-12-10 |
-
1965
- 1965-07-19 AU AU61653/65A patent/AU409983B2/en not_active Expired
-
1966
- 1966-07-04 GB GB33971/67A patent/GB1131799A/en not_active Expired
- 1966-07-04 GB GB33972/67A patent/GB1131800A/en not_active Expired
- 1966-07-04 GB GB29834/66A patent/GB1131798A/en not_active Expired
- 1966-07-11 IL IL34051A patent/IL34051A/xx unknown
- 1966-07-11 IL IL26123A patent/IL26123A/xx unknown
- 1966-07-11 IL IL34052A patent/IL34052A/en unknown
- 1966-07-13 DE DE1795651A patent/DE1795651C3/de not_active Expired
- 1966-07-13 DE DE19661695249 patent/DE1695249A1/de active Pending
- 1966-07-13 DE DE19661795650 patent/DE1795650A1/de active Pending
- 1966-07-14 US US00565092A patent/US3759937A/en not_active Expired - Lifetime
- 1966-07-18 BR BR181363/66A patent/BR6681363D0/pt unknown
- 1966-07-18 SE SE13384/68A patent/SE370078B/xx unknown
- 1966-07-18 FR FR69792A patent/FR1502712A/fr not_active Expired
- 1966-07-18 SE SE9822/66A patent/SE323382B/xx unknown
- 1966-07-19 CH CH1040966A patent/CH490376A/de not_active IP Right Cessation
- 1966-07-19 CS CS348072*1A patent/CS155143B2/cs unknown
- 1966-07-19 NL NL6610166A patent/NL6610166A/xx unknown
- 1966-07-19 YU YU1401/66A patent/YU32997B/xx unknown
- 1966-07-19 CS CS487666A patent/CS155142B2/cs unknown
- 1966-07-19 CH CH1104069A patent/CH562233A5/xx not_active IP Right Cessation
- 1966-07-19 BE BE684340D patent/BE684340A/xx unknown
-
1969
- 1969-09-17 DK DK496169AA patent/DK125996B/da unknown
-
1971
- 1971-12-08 US US206155A patent/US3927097A/en not_active Expired - Lifetime
-
1972
- 1972-04-03 US US240827A patent/US3862166A/en not_active Expired - Lifetime
- 1972-04-03 US US00240773A patent/US3828061A/en not_active Expired - Lifetime
-
1973
- 1973-03-13 YU YU00654/73A patent/YU65473A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2429227A1 (de) * | 1973-06-18 | 1975-01-09 | American Cyanamid Co | Verfahren zur herstellung von dl-6phenyl-2,3,5,6-tetrahydroimidazo eckige klammer auf 2,1-b eckige klammer zu thiazol und dessen saeureadditionssalzen |
Also Published As
| Publication number | Publication date |
|---|---|
| BE684340A (enExample) | 1967-01-19 |
| GB1131798A (en) | 1968-10-30 |
| DK125996B (da) | 1973-05-28 |
| US3828061A (en) | 1974-08-06 |
| BR6681363D0 (pt) | 1973-12-27 |
| YU140166A (en) | 1975-08-31 |
| AU6165365A (en) | 1968-01-18 |
| CH562233A5 (enExample) | 1975-05-30 |
| US3759937A (en) | 1973-09-18 |
| CH490376A (de) | 1970-05-15 |
| US3927097A (en) | 1975-12-16 |
| CS155143B2 (enExample) | 1974-05-30 |
| US3862166A (en) | 1975-01-21 |
| IL34051A (en) | 1970-08-19 |
| DE1695249A1 (de) | 1970-09-17 |
| DE1795651C3 (de) | 1979-09-13 |
| GB1131799A (en) | 1968-10-30 |
| DE1795652B2 (de) | 1977-01-20 |
| NL6610166A (enExample) | 1967-01-20 |
| CS155142B2 (enExample) | 1974-05-30 |
| GB1131800A (en) | 1968-10-30 |
| AU409983B2 (en) | 1970-12-31 |
| SE370078B (enExample) | 1974-09-30 |
| IL26123A (en) | 1970-08-19 |
| DE1795651A1 (de) | 1973-04-12 |
| YU65473A (en) | 1982-05-31 |
| DE1795651B2 (de) | 1979-01-04 |
| SE323382B (enExample) | 1970-05-04 |
| DE1795652A1 (de) | 1972-10-26 |
| YU32997B (en) | 1976-03-31 |
| FR1502712A (fr) | 1967-11-24 |
| IL34052A (en) | 1970-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3051146C2 (de) | 3,4-disubstituierte 1,2,5-thiadiazol-1-oxide und -1,1-dioxide, verfahren zu ihrer herstellung undsie enthaltende pharmazeutische mittel | |
| DE2713272C2 (de) | Derivate der 7-Aminothiazolyl-acetamido-cephalosporansäure, ihre Herstellung und pharmazeutische Zusammensetzungen | |
| DE3878708T2 (de) | Thiazolderivate mit aktivitaet auf das cholinergische system, verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammenstellungen. | |
| DE2341753C2 (de) | α-(3-tert.Butylamino-α-hydroxy-propylthio)- Thiazolderivate, Verfahren zu deren Herstellung und dieselben enthaltende pharmazeutische Zubereitung | |
| DE2322880C2 (de) | 4-(Imidazolin-2-ylamino)-2,1,3-benzothiadiazole und Verfahren zu deren Herstellung | |
| CH653989A5 (de) | Cyclobutendion-verbindungen. | |
| DD233374A5 (de) | Verfahren zur herstellung von 2-(n-subst.-guanidino)-4-heteroarylthiazole | |
| DE1795650A1 (de) | Verfahren zur herstellung von biologisch aktiven verbindungen | |
| DE1770583A1 (de) | Thiazolderivate und ihre Herstellung | |
| DE69105859T2 (de) | Thioharnstoffderivate und sie enthaltendes antimikrobielles Mittel und sie enthaltendes Mittel gegen Magengeschwüre. | |
| DE2916140A1 (de) | 1,3-diphenyl-2-iminoimidazolidine und 1,3-diphenyl-2-iminohexahydropyrimidine, verfahren zu ihrer herstellung und solche enthaltende arzneimittel | |
| DE1620329B2 (de) | 8-halogen-10-piperazino-10,11-dihydrobenzo (b,f) thiepinderivate und verfahren zu deren herstellung | |
| DE2461802A1 (de) | Pyrazinderivate | |
| MC1143A1 (fr) | Derives de thiouree | |
| DE68917333T2 (de) | Heterocyclische Verbindungen und Antiulkusmittel. | |
| DE1670301C3 (de) | 7- (Pyndylmercaptoacetamido) cephalosporansäuren, deren Salze und Verfahren zu ihrer Herstellung | |
| DE2600513A1 (de) | Acylamino(alkyl)benzolderivate und verfahren zu ihrer herstellung | |
| DE3445192A1 (de) | 4,5,6,7-tetrahydrothiazolo(5,4-c) pyridinderivate, verfahren zu deren hestellung und pharmazeutische mittel | |
| DE1695560C3 (de) | Pyrid-2-thione und diese enthaltende pharmazeutische Zusammensetzungen | |
| EP0573392A1 (de) | Thiosemicarbazonderivate und ihre Anwendung als Arzneimittelwirkstoff | |
| DE2425767A1 (de) | 3-alkyl-9-aminoalkyl-1,2,3,4-tetrahydrocarbazole und ihre verwendung in arzneimitteln | |
| DE2166270C3 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| DD279021A5 (de) | Verfahren zur herstellung neuer basisch substituierter 5-halogen-thienoisothiazol-3(2h)-on-1,1-dioxide | |
| DE1937629C3 (de) | Nitrofuryl-aminoalkoxy-pyriinidine | |
| DD140038A5 (de) | Verfahren zur herstellung neuer guanidinverbindungen |