DE1795618A1 - Verfahren zur Herstellung von Pyrolen - Google Patents
Verfahren zur Herstellung von PyrolenInfo
- Publication number
- DE1795618A1 DE1795618A1 DE19671795618 DE1795618A DE1795618A1 DE 1795618 A1 DE1795618 A1 DE 1795618A1 DE 19671795618 DE19671795618 DE 19671795618 DE 1795618 A DE1795618 A DE 1795618A DE 1795618 A1 DE1795618 A1 DE 1795618A1
- Authority
- DE
- Germany
- Prior art keywords
- cycloalkyl
- alkyl
- aralkyl
- imine
- manganese dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 8
- 150000003220 pyrenes Chemical class 0.000 title 1
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 28
- 150000002466 imines Chemical class 0.000 claims description 24
- -1 nickel peroxide Chemical class 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 16
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 14
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 10
- 229910052759 nickel Inorganic materials 0.000 claims description 10
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 7
- 125000001072 heteroaryl group Chemical group 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 150000003233 pyrroles Chemical class 0.000 claims description 4
- 239000000203 mixture Substances 0.000 description 15
- 230000009102 absorption Effects 0.000 description 14
- 238000010521 absorption reaction Methods 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- 229940073644 nickel Drugs 0.000 description 9
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 238000002329 infrared spectrum Methods 0.000 description 8
- 239000010779 crude oil Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- SOJXDJJIMYWISJ-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-imine Chemical compound CC(C)CN=CC(C)C SOJXDJJIMYWISJ-UHFFFAOYSA-N 0.000 description 6
- 150000001793 charged compounds Chemical class 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 238000001819 mass spectrum Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 5
- 150000004705 aldimines Chemical group 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 230000003595 spectral effect Effects 0.000 description 4
- BPPNDUBGLQQQBY-UHFFFAOYSA-N 2-propyl-1h-pyrrole Chemical compound CCCC1=CC=CN1 BPPNDUBGLQQQBY-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- AMWRITDGCCNYAT-UHFFFAOYSA-L manganese oxide Inorganic materials [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 3
- PPNAOCWZXJOHFK-UHFFFAOYSA-N manganese(2+);oxygen(2-) Chemical class [O-2].[Mn+2] PPNAOCWZXJOHFK-UHFFFAOYSA-N 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- QCVHZXIQEDRLSM-UHFFFAOYSA-N N-(2-methylpropyl)pentan-2-imine Chemical compound CC(CCC)=NCC(C)C QCVHZXIQEDRLSM-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 230000010354 integration Effects 0.000 description 2
- GQMZNYJOTOYEII-UHFFFAOYSA-N n-(2-methylpropyl)butan-1-imine Chemical compound CCCC=NCC(C)C GQMZNYJOTOYEII-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 238000003822 preparative gas chromatography Methods 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- IFKPLJWIEQBPGG-QGZVFWFLSA-N (5s)-6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one Chemical compound C=1C=CC=CC=1C([C@H](C)CN(C)C)(C(=O)CC)C1=CC=CC=C1 IFKPLJWIEQBPGG-QGZVFWFLSA-N 0.000 description 1
- BAMFBVSZEBABCA-UHFFFAOYSA-N 2-ethyl-n-(2-methylpropyl)hex-2-en-1-imine Chemical compound CCCC=C(CC)C=NCC(C)C BAMFBVSZEBABCA-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IWWGWVVTGLPZCY-UHFFFAOYSA-N n-butyl-3-methylbutan-1-imine Chemical compound CCCCN=CCC(C)C IWWGWVVTGLPZCY-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000011295 pitch Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009183 running Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/323—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59500166A | 1966-11-17 | 1966-11-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1795618A1 true DE1795618A1 (de) | 1972-04-06 |
Family
ID=24381292
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671795618 Pending DE1795618A1 (de) | 1966-11-17 | 1967-11-14 | Verfahren zur Herstellung von Pyrolen |
| DE19671668626 Granted DE1668626A1 (de) | 1966-11-17 | 1967-11-14 | Verfahren zur Herstellung organischer Verbindungen aus monomeren Iminen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671668626 Granted DE1668626A1 (de) | 1966-11-17 | 1967-11-14 | Verfahren zur Herstellung organischer Verbindungen aus monomeren Iminen |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE706725A (enExample) |
| CH (1) | CH540884A (enExample) |
| DE (2) | DE1795618A1 (enExample) |
| GB (1) | GB1177160A (enExample) |
| NL (1) | NL6715507A (enExample) |
-
1967
- 1967-10-24 GB GB4838567A patent/GB1177160A/en not_active Expired
- 1967-11-14 DE DE19671795618 patent/DE1795618A1/de active Pending
- 1967-11-14 DE DE19671668626 patent/DE1668626A1/de active Granted
- 1967-11-15 NL NL6715507A patent/NL6715507A/xx unknown
- 1967-11-16 CH CH1602867A patent/CH540884A/de not_active IP Right Cessation
- 1967-11-17 BE BE706725D patent/BE706725A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH540884A (de) | 1973-08-31 |
| DE1668626A1 (de) | 1971-07-29 |
| DE1668626B2 (enExample) | 1974-01-10 |
| BE706725A (enExample) | 1968-05-17 |
| NL6715507A (enExample) | 1968-05-20 |
| DE1668626C3 (enExample) | 1974-08-01 |
| GB1177160A (en) | 1970-01-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695753A1 (de) | Verbesserungen in der Herstellung von 4-Oxopiperidinverbindungen und gewisser neuer 4-Oxopiperidinverbindungen | |
| DE2336852A1 (de) | Verfahren zur herstellung organischer nitrile | |
| DE1144279B (de) | Verfahren zur Herstellung von 3-Aryl-3-hydroxypyrrolidinen und deren Salzen | |
| DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE1795618A1 (de) | Verfahren zur Herstellung von Pyrolen | |
| DE2852975C2 (de) | 5-Cyano-1-alkylpyrrol-2-essigsäure-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1921842A1 (de) | Verfahren zur Herstellung von cycloaliphatischen Halogeniden | |
| DE1493752A1 (de) | Verfahren zur Herstellung von reinem wasserfreiem 2-Amino-propionitril | |
| DE2005515C3 (de) | Verfahren zur Herstellung von γ -Cyanbutyraldinünen | |
| DE2626675A1 (de) | Verfahren zur herstellung von 2-pyrrolidon | |
| DE2003600C3 (de) | Aldolisierungsprodukte aus Isobutyraldehyd und Glyoxal und Verfahren zur Herstellung von Aldolisierungsprodukten | |
| DE3020298C2 (de) | Verfahren zur Herstellung von 2,2,4,5,5-Pentamethyl-3-formyl-3-pyrrolin | |
| DE3106169A1 (de) | Verfahren zur herstellung eines 3.3.3.-trifluorpropylierten benzolderivats | |
| DE1927528C3 (de) | Verfahren zur herstellung von alpha- aethinylaminen | |
| DE3144765A1 (de) | Verfahren zur herstellung von chlorlactonen aus ungesaettigten carbonsaeuren | |
| DE69310136T2 (de) | Aliphatische Omega-hydroxy-3-ketonitrile und Verfahren zur Herstellung von aliphatischen Omega-hydroxycarbonsäuren | |
| DE2730269C2 (enExample) | ||
| AT308085B (de) | Verfahren zum Herstellen von neuen Derivaten des Äthylendiamins | |
| DD150057A5 (de) | Verfahren zur herstellung von 2-aminopyrazinen | |
| DE1445655C3 (de) | Verfahren zur Herstellung von in 3-Stellung gamma-Aminopropylgruppen enthaltenden 3,4,5,6-Tetrahydropyridinderivaten | |
| DE2744956A1 (de) | Verfahren zur herstellung von n hoch 1 -(2'-furanidyl)-5-fluor- uracil | |
| DE1102157B (de) | Verfahren zur Herstellung von ungesaettigten Acylaminomethyl-aminen | |
| DE1964964C (enExample) | ||
| DE3009604A1 (de) | Verfahren zur herstellung von butyrolactonen | |
| DE1795811C2 (de) | N-(p-ChIorphenyl)-N-alkyl-N'-benzoyl -äthylendiamine |