DE1760393A1 - Rakelvorrichtung - Google Patents
RakelvorrichtungInfo
- Publication number
- DE1760393A1 DE1760393A1 DE19681760393 DE1760393A DE1760393A1 DE 1760393 A1 DE1760393 A1 DE 1760393A1 DE 19681760393 DE19681760393 DE 19681760393 DE 1760393 A DE1760393 A DE 1760393A DE 1760393 A1 DE1760393 A1 DE 1760393A1
- Authority
- DE
- Germany
- Prior art keywords
- squeegee
- working
- doctor blade
- carrier
- base
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000007639 printing Methods 0.000 claims description 27
- 230000005291 magnetic effect Effects 0.000 claims description 12
- 239000000463 material Substances 0.000 claims description 10
- 210000000056 organ Anatomy 0.000 claims description 8
- 239000000758 substrate Substances 0.000 description 5
- 238000010276 construction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003302 ferromagnetic material Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- ONSIBMFFLJKTPT-UHFFFAOYSA-L zinc;2,3,4,5,6-pentachlorobenzenethiolate Chemical compound [Zn+2].[S-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl.[S-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl ONSIBMFFLJKTPT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41F—PRINTING MACHINES OR PRESSES
- B41F15/00—Screen printers
- B41F15/14—Details
- B41F15/44—Squeegees or doctors
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41F—PRINTING MACHINES OR PRESSES
- B41F15/00—Screen printers
- B41F15/14—Details
- B41F15/40—Inking units
- B41F15/42—Inking units comprising squeegees or doctors
- B41F15/426—Inking units comprising squeegees or doctors the squeegees or doctors being magnetically attracted
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Screen Printers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT488867A AT279529B (de) | 1967-05-26 | 1967-05-26 | Einrichtung an Rundschablonen |
| AT759167A AT287748B (de) | 1967-08-18 | 1967-08-18 | Rakelvorrichtung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1760393A1 true DE1760393A1 (de) | 1971-12-30 |
Family
ID=25601629
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681760393 Pending DE1760393A1 (de) | 1967-05-26 | 1968-05-13 | Rakelvorrichtung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3566784A (enExample) |
| CH (1) | CH472971A (enExample) |
| DE (1) | DE1760393A1 (enExample) |
| FR (1) | FR1565286A (enExample) |
| NL (1) | NL6807373A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0311744A1 (de) * | 1987-10-10 | 1989-04-19 | Johannes Zimmer | Auftragungsgerät |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1964182B2 (de) * | 1969-12-22 | 1974-03-21 | Mitter & Co, 4815 Schloss Holte | Rakelvorrichtung zur Auftragung flüssiger oder pastöser Medien auf Warenbahnen od. dgl., insbesondere für Filmdruckmaschinen |
| DE2108085C3 (de) * | 1970-03-09 | 1974-08-22 | Peter Kufstein Zimmer (Oesterreich) | Rakelrolle |
| CH562686A5 (enExample) * | 1972-01-04 | 1975-06-13 | Zimmer Peter | |
| US4138943A (en) * | 1973-06-20 | 1979-02-13 | Mitter & Co. | Reinforced hose means for biasing a squeegee |
| AT363899B (de) * | 1973-06-20 | 1981-09-10 | Mitter & Co | Rakeleinrichtung fuer siebdruckmaschinen |
| US3961575A (en) * | 1974-04-12 | 1976-06-08 | Rowena Ann Rodabaugh | Printing apparatus for use on plastic containers |
| NL7811246A (nl) * | 1978-11-14 | 1980-05-19 | Stork Brabant Bv | Rakel voor zeefdrukmachine. |
| US5302202A (en) * | 1989-06-13 | 1994-04-12 | Johannes Zimmer | Process and device for applying a coating or substance e.g. adhesive for washing and/or drying an endless conveyor belt or the like |
| EP0504501B1 (de) * | 1991-03-21 | 1995-10-18 | Johannes Zimmer | Rakelgerät |
| NL1011992C2 (nl) * | 1999-05-07 | 2000-11-09 | Stork Brabant Bv | Rakelinrichting. |
| GB2445550A (en) * | 2007-01-15 | 2008-07-16 | Dek Int Gmbh | Wiper blade holder for use in a screen printing machine and wiper blade therefor |
| USD855270S1 (en) * | 2018-05-07 | 2019-07-30 | Edward Dierickx | Squeegee |
| JP7757662B2 (ja) * | 2021-08-27 | 2025-10-22 | セイコーエプソン株式会社 | 振動発生装置、振動発生装置の制御方法およびピックアップシステム |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1312034A (en) * | 1919-08-05 | Of rochester | ||
| US764275A (en) * | 1901-03-05 | 1904-07-05 | Dick Co Ab | Rotary stencil-printing machine. |
| US1264506A (en) * | 1915-08-02 | 1918-04-30 | John N Hahn | Corrugated-paper-making machine. |
| US1993055A (en) * | 1932-01-22 | 1935-03-05 | Gerstenberg Aage | Coating apparatus |
| US2330889A (en) * | 1941-06-28 | 1943-10-05 | Paper Patents Co | Roll doctor |
| US2695004A (en) * | 1951-03-02 | 1954-11-23 | Champion Paper & Fibre Co | Doctor blade for coating machines |
| CH328826A (de) * | 1955-01-28 | 1958-03-31 | Buehler Ag Geb | Hydraulische Abstreifvorrichtung für Walzenstühle |
| GB878094A (en) * | 1957-01-09 | 1961-09-27 | Zimmer Johannes | A device for use in printing on sheet material |
| US2920557A (en) * | 1957-03-21 | 1960-01-12 | Westfalendruck G M B H & Co Ko | Pressure control mechanism for doctor blades |
| DE1075545B (de) * | 1958-09-26 | 1960-02-18 | Kufstein Rupert Kraft (Österreich): | Filmdruckmaschine mit endlosen Schablonen |
| US3029779A (en) * | 1958-10-15 | 1962-04-17 | Beloit Iron Works | Reverse bar coater |
| DE1135856B (de) * | 1958-12-04 | 1962-09-06 | Zimmer S Erben K G | Filmdruckmaschine |
| US3089175A (en) * | 1960-09-01 | 1963-05-14 | Hamilton Clamp & Stampings Ltd | Windshield wipers |
| US3229624A (en) * | 1961-10-26 | 1966-01-18 | Libbey Owens Ford Glass Co | Marking apparatus |
| US3216349A (en) * | 1963-02-21 | 1965-11-09 | Johannes Zimmer Maschf | Apparatus for treating sheet material |
-
1968
- 1968-05-13 DE DE19681760393 patent/DE1760393A1/de active Pending
- 1968-05-23 US US731549A patent/US3566784A/en not_active Expired - Lifetime
- 1968-05-24 FR FR1565286D patent/FR1565286A/fr not_active Expired
- 1968-05-24 NL NL6807373A patent/NL6807373A/xx unknown
- 1968-05-24 CH CH770868A patent/CH472971A/de not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0311744A1 (de) * | 1987-10-10 | 1989-04-19 | Johannes Zimmer | Auftragungsgerät |
| WO1989003258A1 (fr) * | 1987-10-10 | 1989-04-20 | Johannes Zimmer | Appareil applicateur |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1565286A (enExample) | 1969-04-25 |
| CH472971A (de) | 1969-05-31 |
| NL6807373A (enExample) | 1968-11-27 |
| US3566784A (en) | 1971-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1760393A1 (de) | Rakelvorrichtung | |
| DE2414657A1 (de) | Einrichtung zum auftragen fluessiger oder pastoeser massen auf eine warenbahn | |
| EP0408704B2 (de) | Anordnung zum auftragen von substanzen auf bahnförmiges material | |
| DE3419590C2 (enExample) | ||
| DE2404532B2 (de) | Rakeleinrichtung mit einem allseitig geschlossenen Rakelgehäuse | |
| DE2630187A1 (de) | Rakelrolle, insbesondere fuer den schablonendruck | |
| EP0028608B1 (de) | Vorrichtung mit magnetisch bewirkter anpresskraft | |
| DE69606330T2 (de) | Rotationssiebdruckmaschine | |
| DE2754663A1 (de) | Vorrichtung zum auftragen von medien in ein substrat | |
| AT401894B (de) | Rakelvorrichtung | |
| EP0504501A1 (de) | Rakelgerät | |
| DE962520C (de) | Schablonendruckvorrichtung | |
| EP0297529B1 (de) | Einrichtung zum Auftragen einer Substanz auf eine Warenbahn | |
| DE2101085A1 (de) | Rakelrolle | |
| DE855408C (de) | Biegsame Flachdruckplatte | |
| AT289156B (de) | Schaber | |
| AT361438B (de) | Rakelvorrichtung | |
| DE1752374A1 (de) | Rakeivorrichtung mit gleitendem Arbeitsorgan | |
| AT360955B (de) | Rakeleinrichtung fuer zylinderschablonen | |
| DE1815490C3 (de) | Einrichtung zum Behandeln von flächenförmigem Material | |
| DE1786588A1 (de) | Einrichtung zum bedrucken od. dgl. von flaechenfoermigem material | |
| DE2300290C3 (de) | Rakeleinrichtung für Siebdruck | |
| AT314460B (de) | Rakeleinrichtung an Filmdruckmaschinen | |
| EP0095084A1 (de) | Rakelvorrichtung für eine Einrichtung zum Bedrucken oder Färben von Warenbahnen | |
| AT305948B (de) | Rakelvorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |