DE1670480C2 - Pyrido[1,2-a]pyrimidinderivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende pharmazeutische Präparate - Google Patents
Pyrido[1,2-a]pyrimidinderivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende pharmazeutische PräparateInfo
- Publication number
- DE1670480C2 DE1670480C2 DE1670480A DE1670480A DE1670480C2 DE 1670480 C2 DE1670480 C2 DE 1670480C2 DE 1670480 A DE1670480 A DE 1670480A DE 1670480 A DE1670480 A DE 1670480A DE 1670480 C2 DE1670480 C2 DE 1670480C2
- Authority
- DE
- Germany
- Prior art keywords
- pyrido
- pyrimidine
- oxo
- acid
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VFMCUTPRJLZEEW-UHFFFAOYSA-N 4h-pyrido[1,2-a]pyrimidine Chemical class C1=CC=CN2CC=CN=C21 VFMCUTPRJLZEEW-UHFFFAOYSA-N 0.000 title claims description 7
- 238000000034 method Methods 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 title description 12
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000000825 pharmaceutical preparation Substances 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims description 13
- -1 carbethoxy, carbomethoxy Chemical group 0.000 claims description 11
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 6
- 230000005494 condensation Effects 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- QUXLCYFNVNNRBE-UHFFFAOYSA-N 6-methylpyridin-2-amine Chemical compound CC1=CC=CC(N)=N1 QUXLCYFNVNNRBE-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 16
- 239000003795 chemical substances by application Substances 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 230000002378 acidificating effect Effects 0.000 description 12
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 7
- 229920000137 polyphosphoric acid Polymers 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000006482 condensation reaction Methods 0.000 description 5
- 150000003230 pyrimidines Chemical class 0.000 description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical group O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 3
- UPQKNTNJVQSGIH-UHFFFAOYSA-N 2,6-dimethylpyrido[1,2-a]pyrimidin-4-one Chemical compound CC1=CC=CC2=NC(C)=CC(=O)N21 UPQKNTNJVQSGIH-UHFFFAOYSA-N 0.000 description 3
- 150000003930 2-aminopyridines Chemical class 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 208000010513 Stupor Diseases 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- 150000005058 1,8-naphthyridines Chemical class 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- ZLYHSYOPYSDSHB-UHFFFAOYSA-N ethyl 6-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxylate Chemical compound C1=CC=C(C)N2C(=O)C(C(=O)OCC)=CN=C21 ZLYHSYOPYSDSHB-UHFFFAOYSA-N 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 description 1
- YIFCWYUSYGFFMH-UHFFFAOYSA-N 2-(ethoxymethylidene)propanedioic acid Chemical compound CCOC=C(C(O)=O)C(O)=O YIFCWYUSYGFFMH-UHFFFAOYSA-N 0.000 description 1
- NZZYVDKRZFWNRJ-UHFFFAOYSA-M 2-chloro-2-methylbutanoate Chemical compound CCC(C)(Cl)C([O-])=O NZZYVDKRZFWNRJ-UHFFFAOYSA-M 0.000 description 1
- SZFDDZJGVCWLSZ-UHFFFAOYSA-N 2-methyl-4H-pyrido[1,2-a]pyrimidine Chemical compound CC=1N=C2N(CC1)C=CC=C2 SZFDDZJGVCWLSZ-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- BGVXSKKYJAOHOM-UHFFFAOYSA-N 6-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)N2C(C)=CC=CC2=N1 BGVXSKKYJAOHOM-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001347 alkyl bromides Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- OBESRABRARNZJB-UHFFFAOYSA-N aminomethanesulfonic acid Chemical compound NCS(O)(=O)=O OBESRABRARNZJB-UHFFFAOYSA-N 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-O hydron;pyrimidine Chemical compound C1=CN=C[NH+]=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-O 0.000 description 1
- 150000004694 iodide salts Chemical group 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- BATMYWDOUUWCJE-UHFFFAOYSA-N pyrimidin-1-ium;bromide Chemical compound Br.C1=CN=CN=C1 BATMYWDOUUWCJE-UHFFFAOYSA-N 0.000 description 1
- IDXKTTNFXPPXJY-UHFFFAOYSA-N pyrimidin-1-ium;chloride Chemical compound Cl.C1=CN=CN=C1 IDXKTTNFXPPXJY-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI000670 | 1966-11-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1670480A1 DE1670480A1 (de) | 1972-05-10 |
| DE1670480C2 true DE1670480C2 (de) | 1983-06-01 |
Family
ID=10994330
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1670480A Expired DE1670480C2 (de) | 1966-11-02 | 1967-10-24 | Pyrido[1,2-a]pyrimidinderivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende pharmazeutische Präparate |
| DE1795769A Expired DE1795769C3 (de) | 1966-11-02 | 1967-10-24 | 6,7,8,9-Tetrahydro-2H-pyrido [Ua] pyrimidinderivate, deren Salze mit Säuren und quaternäre Methosalze, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1795769A Expired DE1795769C3 (de) | 1966-11-02 | 1967-10-24 | 6,7,8,9-Tetrahydro-2H-pyrido [Ua] pyrimidinderivate, deren Salze mit Säuren und quaternäre Methosalze, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US3585198A (show.php) |
| JP (1) | JPS4939278B1 (show.php) |
| AT (5) | AT299212B (show.php) |
| BE (1) | BE705934A (show.php) |
| CH (1) | CH538494A (show.php) |
| CS (1) | CS165991B2 (show.php) |
| DE (2) | DE1670480C2 (show.php) |
| DK (1) | DK134160B (show.php) |
| FR (1) | FR7813M (show.php) |
| GB (1) | GB1209946A (show.php) |
| HK (1) | HK27876A (show.php) |
| IL (1) | IL28863A (show.php) |
| NL (1) | NL6714810A (show.php) |
| SE (3) | SE336134B (show.php) |
| YU (2) | YU35136B (show.php) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3907798A (en) * | 1966-06-15 | 1975-09-23 | Sterling Drug Inc | Preparation of 4H-pyrido{8 1,2-a{9 pyrimidin-4-ones from cyclic alkylidene 2-pyridylaminomethylenemalonates |
| BE788601A (fr) * | 1971-09-10 | 1973-03-08 | Takeda Chemical Industries Ltd | Procede de preparation de derives de pyrimidine |
| CA1005056A (en) * | 1971-09-17 | 1977-02-08 | E.R. Squibb And Sons | Manufacture of substituted pyridopyrimidinones |
| HU169230B (show.php) * | 1972-03-29 | 1976-10-28 | ||
| US3960847A (en) * | 1972-04-17 | 1976-06-01 | E. R. Squibb & Sons, Inc. | 9-Substituted-4-oxopyrido(1,2-α)pyrimidine-3-carboxylic acids and derivatives thereof |
| US4013656A (en) * | 1972-06-07 | 1977-03-22 | Dynamit Nobel Aktiengesellschaft | Process for the preparation of pyridylamino-methylenemalonic acid derivatives |
| HU166378B (show.php) | 1972-12-19 | 1975-03-28 | ||
| SE422272B (sv) * | 1972-08-03 | 1982-03-01 | Chinoin Gyogyszer Es Vegyeszet | Sett att framstella ett for oral administration lempligt farmaceutiskt preparat med synergistisk, analgetisk aktivitet, innehallande bl a azidokodein |
| US4027024A (en) | 1972-12-19 | 1977-05-31 | Chinoin Gyogyszer-Es Vegyeszeti Termekek Gyara Rt | Pharmaceutical composition having synergistic analgesic activity |
| HU168014B (show.php) * | 1973-03-30 | 1976-02-28 | ||
| US4209622A (en) * | 1973-03-30 | 1980-06-24 | Chinoin Gygyszer es Vegyeszeti Termekek Gyara Rt. | 3-(Ethoxycarbonyl-methyl)-6-methyl-4-oxo-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidine |
| HU169223B (show.php) * | 1973-12-29 | 1976-10-28 | ||
| US4022897A (en) * | 1974-03-04 | 1977-05-10 | E. R. Squibb & Sons, Inc. | CNS active compounds |
| US3929787A (en) * | 1974-04-22 | 1975-12-30 | Squibb & Sons Inc | 6,7,8,9-Tetrahydro-pyrido(1,2-a)pyrimidin-4-ones |
| US3935197A (en) * | 1975-05-16 | 1976-01-27 | E. R. Squibb & Sons, Inc. | 2-Styryl-4H-pyrido(1,2-a)pyrimidin-4-ones |
| HU173823B (hu) * | 1975-07-25 | 1979-08-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija stabil'nogo lechebnogo preparata dlja oral'noj dozirovki, kotoryj soderzhit proizvodnyj gomopirimidazola |
| JPS5822040B2 (ja) * | 1975-10-13 | 1983-05-06 | わかもと製薬 (株) | ホモピリイミダゾ−ル誘導体の製造法 |
| US4495189A (en) * | 1975-11-27 | 1985-01-22 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara R.T. | Condensed pyrimidines |
| HU173438B (hu) * | 1975-11-27 | 1979-05-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija novykh proizvodnykh 4-okso-1,6,7,8-/tetragidro-4h-pirido/1,2/pirimidina s zaderzhivajuhhejj vozgoranie aktivnot'ju i protivosvertivajuhhem effektom |
| HU174693B (hu) * | 1976-02-12 | 1980-03-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija kondensirovannykh proizvodnykh pirimidina |
| HU174901B (hu) * | 1976-06-25 | 1980-04-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija novykh proizvodnykh pirido/1,2-a/pirimidina |
| CA1067079A (en) * | 1976-07-22 | 1979-11-27 | Yamanouchi Pharmaceutical Co. | Nitrogen-containing heterobicyclic compounds |
| US4122274A (en) * | 1977-05-25 | 1978-10-24 | Bristol-Myers Company | 3-Tetrazolo-5,6,7,8-substituted-pyrido[1,2-a]pyrimidin-4-ones |
| HU178910B (en) * | 1977-08-19 | 1982-07-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing 2,3-disubstituted-4-oxo-4h-pyrido/1,2-a/-pyrimidines |
| HU180439B (en) * | 1977-12-29 | 1983-03-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 9-amino-pyrido-square bracket-1,2-a-square bracket closed-pyrimidine derivatives |
| HU178496B (en) * | 1977-12-29 | 1982-05-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing 6,7,8,9-tetrahydro-4h-pyrido/1,2-a/pyrimidine derivatives with antiallergic activity |
| US4192944A (en) * | 1978-04-03 | 1980-03-11 | Bristol-Myers Company | Optionally substituted 4-oxo-4H-pyrido[1,2-a]pyrimidine-3-N-(1H-tetrazol-4-yl)carboxamides and their use as antiallergy agents |
| FR2449689A1 (fr) * | 1979-02-20 | 1980-09-19 | Logeais Labor Jacques | Nouveaux derives condenses de pyrrolidine ou de piperidine, leur procede de preparation et leurs applications en therapeutique |
| HU176942B (hu) * | 1979-05-11 | 1981-06-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija 2,3- i 3,4-dvuzamehhjonnykh tetragidro-pirrolo!1,2-a!-pirimidinov |
| HU178452B (en) * | 1979-05-11 | 1982-05-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing 9-substituted amino-4-oxo-6,7-dihydro-4h-pyrido/1,2-a/pyrimidine derivatives |
| HU177184B (en) * | 1979-05-11 | 1981-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 2,3- and 3,4-disubstituted-hexahydro-pyrimido-square bracket-1,2-a-square bracket closed-asepines |
| US4482557A (en) * | 1979-05-11 | 1984-11-13 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt. | 3-Substituted-2-oxo-tetrahydro-pyrrol[1,2-a]pyrimidines having digitalis-like activity |
| HU179443B (en) * | 1979-05-11 | 1982-10-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing substituted geminal dihalogeno-derivatives of pyrido-square bracket-1,2-a-square closed-pyrimidines,pyrrolo-square bracket-1,2-a-square bracket closed-pyrimidines and pyrimido-square bracket-1,2,-a-square bracket closed-asepines |
| HU186607B (en) * | 1982-03-31 | 1985-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing pharmaceutical composition with synergetic antiinflammatory activity |
| US4507477A (en) * | 1982-09-09 | 1985-03-26 | Riker Laboratories, Inc. | Process for tetrazolyl-pyrimidinone derivatives |
| US4474953A (en) * | 1982-09-09 | 1984-10-02 | Riker Laboratories, Inc. | Process and intermediates for the preparation of 3(1H-tetrazol-5-yl)-4H-pyrido[1,2-a]pyrimidin-4-ones |
| US4476130A (en) * | 1982-09-09 | 1984-10-09 | Riker Laboratories, Inc. | 3-(1H-Tetrazol-5-yl)-4H-pyrimido[2,1-b]benzoxazol-4-one compounds exhibiting anti-allergic activity |
| US4457932A (en) * | 1983-07-22 | 1984-07-03 | Bristol-Myers Company | Anti-ulcer agents |
| AU588917B2 (en) * | 1985-09-25 | 1989-09-28 | Shionogi & Co., Ltd. | 9-(substituted thio)-4h-pryido(1,2-a) pyrimidin-4-one derivatives |
| HU201551B (en) * | 1988-02-03 | 1990-11-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 4-oxo-4h-pyrido(1,2-a)pyrimidine-3-carboxylic acid amide derivatives and pharmaceutical compositions comprising same |
| CA2205313C (en) | 1996-05-28 | 2005-01-18 | Tecton Products | Method of manufacture of a plastic component which is insensitive to the elements, and a plastic component so manufactured |
| KR101828094B1 (ko) * | 2009-09-09 | 2018-03-22 | 이 아이 듀폰 디 네모아 앤드 캄파니 | 제초제 피리미돈 유도체 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3149112A (en) * | 1964-09-15 | Z-diethylaminoethoxy |
-
1967
- 1967-10-24 DE DE1670480A patent/DE1670480C2/de not_active Expired
- 1967-10-24 AT AT1022870A patent/AT299212B/de not_active IP Right Cessation
- 1967-10-24 AT AT355470A patent/AT296996B/de not_active IP Right Cessation
- 1967-10-24 AT AT355370A patent/AT294107B/de not_active IP Right Cessation
- 1967-10-24 AT AT00408/71A patent/AT302311B/de not_active IP Right Cessation
- 1967-10-24 DE DE1795769A patent/DE1795769C3/de not_active Expired
- 1967-10-24 CH CH1484767A patent/CH538494A/de not_active IP Right Cessation
- 1967-10-24 AT AT958567A patent/AT286990B/de not_active IP Right Cessation
- 1967-10-27 YU YU2095/67A patent/YU35136B/xx unknown
- 1967-10-31 NL NL6714810A patent/NL6714810A/xx unknown
- 1967-10-31 BE BE705934D patent/BE705934A/xx not_active IP Right Cessation
- 1967-10-31 FR FR126462A patent/FR7813M/fr not_active Expired
- 1967-10-31 IL IL28863A patent/IL28863A/en unknown
- 1967-11-01 GB GB49685/67A patent/GB1209946A/en not_active Expired
- 1967-11-01 DK DK545067AA patent/DK134160B/da not_active IP Right Cessation
- 1967-11-01 US US679640A patent/US3585198A/en not_active Expired - Lifetime
- 1967-11-02 SE SE15057/67A patent/SE336134B/xx unknown
- 1967-11-02 SE SE00046/71A patent/SE363333B/xx unknown
- 1967-11-02 CS CS7770A patent/CS165991B2/cs unknown
-
1970
- 1970-05-04 JP JP45037582A patent/JPS4939278B1/ja active Pending
-
1971
- 1971-01-04 SE SE7100047A patent/SE409327B/xx unknown
- 1971-05-28 US US148199A patent/US3696197A/en not_active Expired - Lifetime
-
1973
- 1973-09-21 YU YU2503/73A patent/YU35142B/xx unknown
-
1976
- 1976-05-13 HK HK278/76*UA patent/HK27876A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT302311B (de) | 1972-09-15 |
| DE1795769B2 (de) | 1978-03-09 |
| CH538494A (de) | 1973-06-30 |
| FR7813M (show.php) | 1970-05-20 |
| HK27876A (en) | 1976-05-21 |
| DE1795769C3 (de) | 1978-11-02 |
| SE363333B (show.php) | 1974-01-14 |
| US3585198A (en) | 1971-06-15 |
| DE1795769A1 (de) | 1975-04-10 |
| IL28863A (en) | 1973-07-30 |
| YU35142B (en) | 1980-09-25 |
| YU35136B (en) | 1980-09-25 |
| CS165991B2 (show.php) | 1975-12-22 |
| JPS4939278B1 (show.php) | 1974-10-24 |
| YU209567A (en) | 1980-03-15 |
| US3696197A (en) | 1972-10-03 |
| AT286990B (de) | 1971-01-11 |
| AT296996B (de) | 1972-03-10 |
| DK134160C (show.php) | 1977-02-21 |
| AT294107B (de) | 1971-11-10 |
| AT299212B (de) | 1972-06-12 |
| DE1670480A1 (de) | 1972-05-10 |
| SE336134B (show.php) | 1971-06-28 |
| NL6714810A (show.php) | 1968-05-03 |
| GB1209946A (en) | 1970-10-21 |
| DK134160B (da) | 1976-09-20 |
| YU250373A (en) | 1980-03-15 |
| BE705934A (show.php) | 1968-03-01 |
| SE409327B (sv) | 1979-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1670480C2 (de) | Pyrido[1,2-a]pyrimidinderivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende pharmazeutische Präparate | |
| DE2705446C2 (show.php) | ||
| DE2458965B2 (de) | 3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel | |
| CH381706A (de) | Verfahren zur Herstellung von Sulfamylanthranilsäuren | |
| DE2835004C2 (show.php) | ||
| DE1770595A1 (de) | Substituierte Tetrahydrochinoline | |
| DE1720019A1 (de) | Pyrrylaminoketonderivate und Verfahren zu ihrer Herstellung | |
| DE2263100C2 (de) | 5,5-Dimethyl-8-(3-methyl-2-octyl)-10-[4-(piperidino)-butyryloxy]-2-(2-propinyl)-1,2,3,4-tetrahydro-5H-[1]-benzopyrano[3,4-d]pyridin, Verfahren zu dessen Herstellung und die Verbindung enthaltende Arzneimittel | |
| DE1518452C3 (de) | 4 substituierte 2 Benzhydryl 2 butanol Derivate und Verfahren zu ihrer Herstellung | |
| DE1695656B2 (de) | l-Alkyl-4-aryl-2(lH)-chinazoIinone | |
| DE3129718C2 (show.php) | ||
| DE2440734C2 (de) | Amphetaminderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE3642497A1 (de) | Substituierte aminopropionsaeureamide, verfahren zu ihrer herstellung, diese enthaltende mittel und ihre verwendung sowie die bei der herstellung anfallenden neuen zwischenprodukte | |
| DE2426267C2 (de) | (1,3)-Thiazolo[4,3-a]isochinoline, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Präparate | |
| DE2643384A1 (de) | Neue 5,6-dihydropyrimidin-4(3h)-onderivate, verfahren zu ihrer herstellung und ihre verwendung als wirkstoff in pharmazeutischen praeparaten | |
| CH649551A5 (de) | 3-substituierte-tetrahydro-pyrrolo(1,2-a)pyrimidine, verfahren zu ihrer herstellung sowie ihrer verwendung in pharmazeutischen praeparaten. | |
| DE1226105B (de) | Verfahren zur Herstellung von neuen 3,4-Dihydrochinazolon-(4)-derivaten | |
| DE2166270B2 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| DE1816700C (de) | 1,4-Dihydrochinolinderivate | |
| DE1901167C3 (de) | Substituierte Indole, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| AT251584B (de) | Verfahren zur Herstellung von neuen 4(3H)-Chinazolinon-Derivaten | |
| DE2518516C3 (de) | 2-(3,45-Trimethoxybenzyl)-3,4-dimethylpyridin | |
| DE1190951B (de) | Verfahren zur Herstellung von N-(2, 3-Dimethylphenyl)-anthranilsaeure und deren Salzen | |
| DE3447730A1 (de) | Pyrazolopyridinderivate | |
| DE1695012C3 (de) | N hoch 1 -(6-Cyclopropyl-4-pyrimidinyl)-sulfanilamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |