DE1618621C - - Google Patents
Info
- Publication number
- DE1618621C DE1618621C DE1618621C DE 1618621 C DE1618621 C DE 1618621C DE 1618621 C DE1618621 C DE 1618621C
- Authority
- DE
- Germany
- Prior art keywords
- acid
- salts
- acids
- product
- ketocarboxylic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002253 acid Substances 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 15
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 12
- 150000007513 acids Chemical class 0.000 claims description 11
- 230000020477 pH reduction Effects 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 238000000926 separation method Methods 0.000 claims description 7
- 239000006227 byproduct Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 239000004202 carbamide Substances 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 239000012736 aqueous medium Substances 0.000 claims description 3
- 230000006378 damage Effects 0.000 claims description 3
- 239000002244 precipitate Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000000605 extraction Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000000468 ketone group Chemical group 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- GPPUPQFYDYLTIY-UHFFFAOYSA-N 2-oxooctanoic acid Chemical compound CCCCCCC(=O)C(O)=O GPPUPQFYDYLTIY-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 229930194542 Keto Natural products 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 150000001261 hydroxy acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- HORQAOAYAYGIBM-UHFFFAOYSA-N 2,4-dinitrophenylhydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HORQAOAYAYGIBM-UHFFFAOYSA-N 0.000 description 1
- TVZRAEYQIKYCPH-UHFFFAOYSA-N 3-(trimethylsilyl)propane-1-sulfonic acid Chemical compound C[Si](C)(C)CCCS(O)(=O)=O TVZRAEYQIKYCPH-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2326784C3 (de) | Verfahren zur Herstellung von Chinoxalin, insbesondere aus nicht gereinigten Rohstoffen | |
| DE1280236B (de) | Verfahren zur Reinigung von Kupfer und Vanadin enthaltenden Katalysatoren | |
| CH631956A5 (de) | Verfahren zur herstellung von 2,5-dichlorphenol. | |
| DE2727345C2 (de) | Verfahren zur Herstellung von 8-Amino-1-naphthol-3,6-disulfonsäure | |
| DE1618621C (cg-RX-API-DMAC10.html) | ||
| DE1768950A1 (de) | Verfahren zur Herstellung von Nitrophenolen | |
| DE1256210B (de) | Verfahren zur Reinigung von Terephthalsaeure | |
| DE2514990A1 (de) | Verfahren zur herstellung von butindiol | |
| DE965230C (de) | Verfahren zur Wiedergewinnung von Katalysatoren und Nebenprodukten aus den Mutterlaugen der Adipinsaeuregewinnung | |
| DE1618621B1 (de) | Verfahren zur Herstellung von geradkettigen, aliphatischen Alfa-Ketocarbonsäuren bzw. von deren Salzen | |
| EP0012299B1 (de) | Lithiumribonat, Lithiumarabonat sowie Verfahren zur Herstellung und Reindarstellung dieser Salze | |
| DE2333598C2 (de) | Verfahren zur Herstellung von 1,10-Decandicarbonsäure | |
| EP0475226B1 (de) | Verfahren zur Herstellung von 2-Mercapto-benzothiazol | |
| DE1618514C3 (cg-RX-API-DMAC10.html) | ||
| DE1518364C2 (de) | Verfahren zur Herstellung von Diaceton-2-keto-l-gulonsaurehydrat | |
| DE962527C (de) | Verfahren zur Herstellung von Oxyhydroperoxyden | |
| DE3303220A1 (de) | Verfahren zur gleichzeitigen gewinnung von 4-hydroxydiphenyl und 4,4'-dihydroxydiphenyl | |
| DE618907C (de) | Verfahren zur Herstellung von Polyoxycarbonsaeuren | |
| DE919601C (de) | Verfahren zur Herstellung von Penicillinalkalisalzen | |
| DE1445934C3 (de) | Verfahren zur Reinigung von Bipyridylen | |
| DE2225986C3 (de) | Verfahren zur Herstellung von Zitronensäure | |
| DE1959621B2 (de) | Verfahren zur Gewinnung von Adipinsäure aus 6-Hydroperoxyhexansäure | |
| DE2401743A1 (de) | Verfahren zur herstellung von trimethylhydrochinon | |
| DE2431814C3 (de) | Verfahren zur Herstellung von Di- bis Polyhydroxyverbindungen durch Reaktion von Formaldehyd mit Aldehyden oder Ketonen | |
| DE1445944C3 (de) | Verfahren zur Herstellung von 4,4'-Bipyridyl bzw. methylsubstituierten 4,4-Bipyridylen |